Compare commits
6 Commits
stable_2
...
unlabeled-
| Author | SHA1 | Date | |
|---|---|---|---|
|
|
d50fcf35ca | ||
|
|
df59cd7a52 | ||
|
|
92c82d48a5 | ||
|
|
897860ddf8 | ||
|
|
fdc319884e | ||
|
|
b5c00dbbf4 |
17
Copyright
17
Copyright
@@ -1,17 +0,0 @@
|
|||||||
/*
|
|
||||||
* (c) copyright 1983 by the Vrije Universiteit, Amsterdam, The Netherlands.
|
|
||||||
*
|
|
||||||
* This product is part of the Amsterdam Compiler Kit.
|
|
||||||
*
|
|
||||||
* Permission to use, sell, duplicate or disclose this software must be
|
|
||||||
* obtained in writing. Requests for such permissions may be sent to
|
|
||||||
*
|
|
||||||
* Dr. Andrew S. Tanenbaum
|
|
||||||
* Wiskundig Seminarium
|
|
||||||
* Vrije Universiteit
|
|
||||||
* Postbox 7161
|
|
||||||
* 1007 MC Amsterdam
|
|
||||||
* The Netherlands
|
|
||||||
*
|
|
||||||
*/
|
|
||||||
|
|
||||||
35
Makefile
35
Makefile
@@ -1,35 +0,0 @@
|
|||||||
cmp: # compile everything and compare
|
|
||||||
(cd etc ; make cmp )
|
|
||||||
(cd util ; make cmp )
|
|
||||||
(cd lang ; make cmp )
|
|
||||||
(cd mach ; make cmp )
|
|
||||||
|
|
||||||
install: # compile everything to machine code
|
|
||||||
(cd etc ; make install )
|
|
||||||
(cd util ; make install )
|
|
||||||
(cd lang/cem ; make install )
|
|
||||||
(cd mach ; make install )
|
|
||||||
(cd lang/pc ; make install )
|
|
||||||
|
|
||||||
clean: # remove all non-sources, except boot-files
|
|
||||||
(cd doc ; make clean )
|
|
||||||
(cd man ; make clean )
|
|
||||||
(cd h ; make clean )
|
|
||||||
(cd etc ; make clean )
|
|
||||||
(cd util ; make clean )
|
|
||||||
(cd lang ; make clean )
|
|
||||||
(cd mach ; make clean )
|
|
||||||
|
|
||||||
opr: # print all sources
|
|
||||||
make pr | opr
|
|
||||||
|
|
||||||
pr: # print all sources
|
|
||||||
@( pr Makefile ; \
|
|
||||||
(cd doc ; make pr ) ; \
|
|
||||||
(cd man ; make pr ) ; \
|
|
||||||
(cd h ; make pr ) ; \
|
|
||||||
(cd etc ; make pr ) ; \
|
|
||||||
(cd lang ; make pr ) ; \
|
|
||||||
(cd util ; make pr ) ; \
|
|
||||||
(cd mach ; make pr ) \
|
|
||||||
)
|
|
||||||
40
doc/Makefile
40
doc/Makefile
@@ -1,40 +0,0 @@
|
|||||||
SUF=pr
|
|
||||||
PRINT=cat
|
|
||||||
RESFILES=cref.$(SUF) pcref.$(SUF) val.$(SUF) v7bugs.$(SUF) install.$(SUF)\
|
|
||||||
ack.$(SUF) cg.$(SUF) regadd.$(SUF) peep.$(SUF) toolkit.$(SUF)
|
|
||||||
NROFF=nroff
|
|
||||||
MS=-ms
|
|
||||||
|
|
||||||
cref.$(SUF): cref.doc
|
|
||||||
tbl $? | $(NROFF) >$@
|
|
||||||
v7bugs.$(SUF): v7bugs.doc
|
|
||||||
$(NROFF) $(MS) $? >$@
|
|
||||||
ack.$(SUF): ack.doc
|
|
||||||
$(NROFF) $(MS) $? >$@
|
|
||||||
cg.$(SUF): cg.doc
|
|
||||||
$(NROFF) $(MS) $? >$@
|
|
||||||
regadd.$(SUF): regadd.doc
|
|
||||||
$(NROFF) $(MS) $? >$@
|
|
||||||
install.$(SUF): install.doc
|
|
||||||
$(NROFF) $(MS) $? >$@
|
|
||||||
pcref.$(SUF): pcref.doc
|
|
||||||
$(NROFF) $? >$@
|
|
||||||
peep.$(SUF): peep.doc
|
|
||||||
$(NROFF) $(MS) $? >$@
|
|
||||||
val.$(SUF): val.doc
|
|
||||||
$(NROFF) $? >$@
|
|
||||||
toolkit.$(SUF): toolkit.doc
|
|
||||||
$(NROFF) $(MS) $? >$@
|
|
||||||
|
|
||||||
install cmp:
|
|
||||||
|
|
||||||
pr:
|
|
||||||
@make "SUF="$SUF "NROFF="$NROFF "PRINT="$PRINT $(RESFILES) \
|
|
||||||
>make.pr.out 2>&1
|
|
||||||
@$(PRINT) $(RESFILES)
|
|
||||||
|
|
||||||
opr:
|
|
||||||
make pr | opr
|
|
||||||
|
|
||||||
clean:
|
|
||||||
-rm -f *.old $(RESFILES) *.t
|
|
||||||
419
doc/ack.doc
419
doc/ack.doc
@@ -1,419 +0,0 @@
|
|||||||
.nr LL 7.5i
|
|
||||||
.tr ~
|
|
||||||
.nr PD 1v
|
|
||||||
.TL
|
|
||||||
Ack Description File
|
|
||||||
.br
|
|
||||||
Reference Manual
|
|
||||||
.AU
|
|
||||||
Ed Keizer
|
|
||||||
.AI
|
|
||||||
Wiskundig Seminarium
|
|
||||||
Vrije Universiteit
|
|
||||||
Amsterdam
|
|
||||||
.NH
|
|
||||||
Introduction
|
|
||||||
.PP
|
|
||||||
The program \fIack\fP(I) internally maintains a table of
|
|
||||||
possible transformations and a table of string variables.
|
|
||||||
The transformation table contains one entry for each possible
|
|
||||||
transformation of a file.
|
|
||||||
Which transformations are used depends on the suffix of the
|
|
||||||
source file.
|
|
||||||
Each transformation table entry tells which input suffixes are
|
|
||||||
allowed and what suffix/name the output file has.
|
|
||||||
When the output file does not already satisfy the request of the
|
|
||||||
user, with the flag \fB-c.suffix\fP, the table is scanned
|
|
||||||
starting with the next transformation in the table for another
|
|
||||||
transformation that has as input suffix the output suffix of
|
|
||||||
the previous transformation.
|
|
||||||
A few special transformations are recognized, among them is the
|
|
||||||
combiner.
|
|
||||||
A program combining several files into one.
|
|
||||||
When no stop suffix was specified (flag \fB-c.suffix\fP) \fIack\fP
|
|
||||||
stops after executing the combiner with as arguments the -
|
|
||||||
possibly transformed - input files and libraries.
|
|
||||||
\fIAck\fP will only perform the transformations in the order in
|
|
||||||
which they are presented in the table.
|
|
||||||
.LP
|
|
||||||
The string variables are used while creating the argument list
|
|
||||||
and program call name for
|
|
||||||
a particular transformation.
|
|
||||||
.NH
|
|
||||||
Which descriptions are used
|
|
||||||
.PP
|
|
||||||
\fIAck\fP always uses two description files: one to define the
|
|
||||||
front-end transformations and one for the machine dependent
|
|
||||||
back-end transformations.
|
|
||||||
Each description has a name.
|
|
||||||
First the way of determining
|
|
||||||
the name of the descriptions needed is described.
|
|
||||||
.PP
|
|
||||||
When the shell environment variable ACKFE is set \fIack\fP uses
|
|
||||||
that to determine the front-end table name, otherwise it uses
|
|
||||||
\fBfe\fP.
|
|
||||||
.PP
|
|
||||||
The way the backend table name is determined is more
|
|
||||||
convoluted.
|
|
||||||
.br
|
|
||||||
First, when the last filename in the program call name is not
|
|
||||||
one of \fIack\fP, \fIcc\fP, \fIacc\fP, \fIpc\fP or \fIapc\fP,
|
|
||||||
this filename is used as the backend description name.
|
|
||||||
Second, when the \fB-m\fP is present the \fB-m\fP is chopped of this
|
|
||||||
flag and the rest is used as the backend description name.
|
|
||||||
Third, when both failed the shell environment variable ACKM is
|
|
||||||
used.
|
|
||||||
Last, when also ACKM was not present the default backend is
|
|
||||||
used, determined by the definition of ACKM in h/local.h.
|
|
||||||
The presence and value of the definition of ACKM is
|
|
||||||
determined at compile time of \fIack\fP.
|
|
||||||
.PP
|
|
||||||
Now, we have the names, but that is only the first step.
|
|
||||||
\fIAck\fP stores a few descriptions at compile time.
|
|
||||||
This descriptions are simply files read in at compile time.
|
|
||||||
At the moment of writing this document, the descriptions
|
|
||||||
included are: pdp, fe, i86, m68k2, vax2 and int.
|
|
||||||
The name of a description is first searched for internally,
|
|
||||||
then in the directory lib/ack and finally in the current
|
|
||||||
directory of the user.
|
|
||||||
.NH
|
|
||||||
Using the description file
|
|
||||||
.PP
|
|
||||||
Before starting on a narrative of the description file,
|
|
||||||
the introduction of a few terms is necessary.
|
|
||||||
All these terms are used to describe the scanning of zero
|
|
||||||
terminated strings, thereby producing another string or
|
|
||||||
sequence of strings.
|
|
||||||
.IP Backslashing 5
|
|
||||||
.br
|
|
||||||
All characters preceded by \e are modified to prevent
|
|
||||||
recognition at further scanning.
|
|
||||||
This modification is undone before a string is passed to the
|
|
||||||
outside world as argument or message.
|
|
||||||
When reading the description files the
|
|
||||||
sequences \e\e, \e# and \e<newline> have a special meaning.
|
|
||||||
\e\e translates to a single \e, \e# translates to a single #
|
|
||||||
that is not
|
|
||||||
recognized as the start of comment, but can be used in
|
|
||||||
recognition and finally, \e<newline> translates to nothing at
|
|
||||||
all, thereby allowing continuation lines.
|
|
||||||
.nr PD 0
|
|
||||||
.IP "Variable replacement"
|
|
||||||
.br
|
|
||||||
The scan recognizes the sequences {{, {NAME} and {NAME?text}
|
|
||||||
Where NAME can be any combination if characters excluding ? and
|
|
||||||
} and text may be anything excluding }.
|
|
||||||
(~\e} is allowed of course~)
|
|
||||||
The first sequence produces an unescaped single {.
|
|
||||||
The second produces the contents of the NAME, definitions are
|
|
||||||
done by \fIack\fP and in description files.
|
|
||||||
When the NAME is not defined an error message is produced on
|
|
||||||
the diagnostic output.
|
|
||||||
The last sequence produces the contents of NAME if it is
|
|
||||||
defined and text otherwise.
|
|
||||||
.PP
|
|
||||||
.IP "Expression replacement"
|
|
||||||
.br
|
|
||||||
Syntax: (\fIsuffix sequence\fP:\fIsuffix sequence\fP=\fItext\fP)
|
|
||||||
.br
|
|
||||||
Example: (.c.p.e:.e=tail_em)
|
|
||||||
.br
|
|
||||||
If the two suffix sequences have a common member -~\&.e in this
|
|
||||||
case~- the text is produced.
|
|
||||||
When no common member is present the empty string is produced.
|
|
||||||
Thus the example given is a constant expression.
|
|
||||||
Normally, one of the suffix sequences is produced by variable
|
|
||||||
replacement.
|
|
||||||
\fIAck\fP sets three variables while performing the diverse
|
|
||||||
transformations: HEAD, TAIL and RTS.
|
|
||||||
All three variables depend on the properties \fIrts\fP and
|
|
||||||
\fIneed\fP from the transformations used.
|
|
||||||
Whenever a transformation is used for the first time,
|
|
||||||
the text following the \fIneed\fP is appended to both the HEAD and
|
|
||||||
TAIL variable.
|
|
||||||
The value of the variable RTS is determined by the first
|
|
||||||
transformation used with a \fIrts\fP property.
|
|
||||||
.LP
|
|
||||||
Two runtime flags have effect on the value of one or more of
|
|
||||||
these variables.
|
|
||||||
The flag \fB-.suffix\fP has the same effect on these three variables
|
|
||||||
as if a file with that \fBsuffix\fP was included in the argument list
|
|
||||||
and had to be translated.
|
|
||||||
The flag \fB-r.suffix\fP only has that effect on the TAIL
|
|
||||||
variable.
|
|
||||||
The program call names \fIacc\fP and \fIcc\fP have the effect
|
|
||||||
of an automatic \fB-.c\fB flag.
|
|
||||||
\fIApc\fP and \fIpc\fP have the effect of an automatic \fB-.p\fP flag.
|
|
||||||
.IP "Line splitting"
|
|
||||||
.br
|
|
||||||
The string is transformed into a sequence of strings by replacing
|
|
||||||
the blank space by string separators (nulls).
|
|
||||||
.IP "IO replacement"
|
|
||||||
.br
|
|
||||||
The > in the string is replaced by the output file name.
|
|
||||||
The < in the string is replaced by the input file name.
|
|
||||||
When multiple input files are present the string is duplicated
|
|
||||||
for each input file name.
|
|
||||||
.nr PD 1v
|
|
||||||
.LP
|
|
||||||
Each description is a sequence of variable definitions followed
|
|
||||||
by a sequence of transformation definitions.
|
|
||||||
Variable definitions use a line each, transformations
|
|
||||||
definitions consist of a sequence of lines.
|
|
||||||
Empty lines are discarded, as are lines with nothing but
|
|
||||||
comment.
|
|
||||||
Comment is started by a # character, and continues to the end
|
|
||||||
of the line.
|
|
||||||
Three special two-characters sequences exist: \e#, \e\e and
|
|
||||||
\e<newline>.
|
|
||||||
Their effect is described under 'backslashing' above.
|
|
||||||
Each - nonempty - line starts with a keyword, possibly
|
|
||||||
preceded by blank space.
|
|
||||||
The keyword can be followed by a further specification.
|
|
||||||
The two are separated by blank space.
|
|
||||||
.PP
|
|
||||||
Variable definitions use the keyword \fIvar\fP and look like this:
|
|
||||||
.DS X
|
|
||||||
var NAME=text
|
|
||||||
.DE
|
|
||||||
The name can be any identifier, the text may contain any
|
|
||||||
character.
|
|
||||||
Blank space before the equal sign is not part of the NAME.
|
|
||||||
Blank space after the equal is considered as part of the text.
|
|
||||||
The text is scanned for variable replacement before it is
|
|
||||||
associated with the variable name.
|
|
||||||
.br
|
|
||||||
.sp 2
|
|
||||||
The start of a transformation definition is indicated by the
|
|
||||||
keyword \fIname\fP.
|
|
||||||
The last line of such a definition contains the keyword
|
|
||||||
\fIend\fP.
|
|
||||||
The lines in between associate properties to a transformation
|
|
||||||
and may be presented in any order.
|
|
||||||
The identifier after the \fIname\fP keyword determines the name
|
|
||||||
of the transformation.
|
|
||||||
This name is used for debugging and by the \fB-R\fP flag.
|
|
||||||
The keywords are used to specify which input suffices are
|
|
||||||
recognized by that transformation,
|
|
||||||
the program to run, the arguments to be handed to that program
|
|
||||||
and the name or suffix of the resulting output file.
|
|
||||||
Two keywords are used to indicate which run-time startoffs and
|
|
||||||
libraries are needed.
|
|
||||||
The possible keywords are:
|
|
||||||
.IP \fIfrom\fP
|
|
||||||
.br
|
|
||||||
followed by a sequence of suffices.
|
|
||||||
Each file with one of these suffices is allowed as input file.
|
|
||||||
Preprocessor transformations, those with the \fBP\fP property
|
|
||||||
after the \fIprop\fP keyword, do not need the \fIfrom\fP
|
|
||||||
keyword. All other transformations do.
|
|
||||||
.nr PD 0
|
|
||||||
.IP \fIto\fP
|
|
||||||
.br
|
|
||||||
followed by the suffix of the output file name or in the case of a
|
|
||||||
linker -~indicated by C option after the \fIprop\fP keyword~-
|
|
||||||
the output file name.
|
|
||||||
.IP \fIprogram\fP
|
|
||||||
.br
|
|
||||||
followed by name of the load file of the program, a pathname most likely
|
|
||||||
starts with either a / or {EM}.
|
|
||||||
This keyword must be
|
|
||||||
present, the remainder of the line
|
|
||||||
is subject to backslashing and variable replacement.
|
|
||||||
.IP \fImapflag\fP
|
|
||||||
.br
|
|
||||||
The mapflags are used to grab flags given to \fIack\fP and
|
|
||||||
pass them on to a specific transformation.
|
|
||||||
This feature uses a few simple pattern matching and replacement
|
|
||||||
facilities.
|
|
||||||
Multiple occurences of this keyword are allowed.
|
|
||||||
This text following the keyword is
|
|
||||||
subjected to backslashing.
|
|
||||||
The keyword is followed by a match expression and a variable
|
|
||||||
assignment separated by blank space.
|
|
||||||
As soon as both description files are read, \fIack\fP looks
|
|
||||||
at all transformations in these files to find a match for the
|
|
||||||
flags given to \fIack\fP.
|
|
||||||
The flags \fB-m\fP, \fB-o\fP,
|
|
||||||
\fI-O\fP, \fB-r\fP, \fB-v\fP, \fB-g\fP, -\fB-c\fP, \fB-t\fP,
|
|
||||||
\fB-k\fP, \fB-R\fP and -\f-.\fP are specific to \fIack\fP and
|
|
||||||
not handed down to any transformation.
|
|
||||||
The matching is performed in the order in which the entries
|
|
||||||
appear in the definition.
|
|
||||||
The scanning stops after first match is found.
|
|
||||||
When a match is found, the variable assignment is executed.
|
|
||||||
A * in the match expression matches any sequence of characters,
|
|
||||||
a * in the right hand part of the assignment is
|
|
||||||
replaced by the characters matched by
|
|
||||||
the * in the expression.
|
|
||||||
The right hand part is also subject to variable replacement.
|
|
||||||
The variable will probably be used in the program arguments.
|
|
||||||
The \fB-l\fP flags are special,
|
|
||||||
the order in which they are presented to \fIack\fP must be
|
|
||||||
preserved.
|
|
||||||
The identifier LNAME is used in conjunction with the scanning of
|
|
||||||
\fB-l\fP flags.
|
|
||||||
The value assigned to LNAME is used to replace the flag.
|
|
||||||
The example further on shows the use all this.
|
|
||||||
.IP \fIargs\fP
|
|
||||||
.br
|
|
||||||
The keyword is followed by the program call arguments.
|
|
||||||
It is subject to backslashing, variable replacement, expression
|
|
||||||
replacement, line splitting and IO replacement.
|
|
||||||
The variables assigned to by \fImapflags\P will probably be
|
|
||||||
used here.
|
|
||||||
The flags not recognized by \fIack\fP or any of the transformations
|
|
||||||
are passed to the linker and inserted before all other arguments.
|
|
||||||
.IP \fIprop\fB
|
|
||||||
.br
|
|
||||||
This -~optional~- keyword is followed by a sequence of options,
|
|
||||||
each option is indicated by one character
|
|
||||||
signifying a special property of the transformation.
|
|
||||||
The possible options are:
|
|
||||||
.DS X
|
|
||||||
< the input file will be read from standard input
|
|
||||||
> the output file will be written on standard output
|
|
||||||
p the input files must be preprocessed
|
|
||||||
m the input files must be preprocessed when starting with #
|
|
||||||
O this transformation is an optimizer and may be skipped
|
|
||||||
P this transformation is the preprocessor
|
|
||||||
C this transformation is the linker
|
|
||||||
.DE
|
|
||||||
.IP \fIrts\fP
|
|
||||||
.br
|
|
||||||
This -~optional~- keyword indicates that the rest of the line must be
|
|
||||||
used to set the variable RTS, if it was not already set.
|
|
||||||
Thus the variable RTS is set by the first transformation
|
|
||||||
executed which such a property or as a result from \fIack\fP's program
|
|
||||||
call name (acc, cc, apc or pc) or by the \fB-.suffix\fP flag.
|
|
||||||
.IP \fIneed\fP
|
|
||||||
.br
|
|
||||||
This -~optional~- keyword indicates that the rest of the line must be
|
|
||||||
concatenated to the NEEDS variable.
|
|
||||||
This is done once for every transformation used or indicated
|
|
||||||
by one of the program call names mentioned above or indicated
|
|
||||||
by the \fB-.suffix\fP flag.
|
|
||||||
.br
|
|
||||||
.nr PD 1v
|
|
||||||
.NH
|
|
||||||
Conventions used in description files
|
|
||||||
.PP
|
|
||||||
\fIAck\fP reads two description files.
|
|
||||||
A few of the variables defined in the machine specific file
|
|
||||||
are used by the descriptions of the front-ends.
|
|
||||||
Other variables, set by \fack\fB, are of use to all
|
|
||||||
transformations.
|
|
||||||
.PP
|
|
||||||
\fIAck\fP sets the variable EM to the home directory of the
|
|
||||||
Amsterdam Compiler Kit.
|
|
||||||
The variable SOURCE is set to the name of the argument that is currently
|
|
||||||
being massaged, this is usefull for debugging.
|
|
||||||
.br
|
|
||||||
The variable M indicates the
|
|
||||||
directory in mach/{M}/lib/tail_..... and NAME is the string to
|
|
||||||
be defined by the preprocessor with -D{NAME}.
|
|
||||||
The definitions of {w}, {s}, {l}, {d}, {f} and {p} indicate
|
|
||||||
EM_WSIZE, EM_SSIZE, EM_LSIZE, EM_DSIZE, EM_FSIZE and EM_PSIZE
|
|
||||||
respectively.
|
|
||||||
.br
|
|
||||||
The variable INCLUDES is used as the last argument to \fIcpp\fP,
|
|
||||||
it is currently used to add the directory {EM}/include to
|
|
||||||
the list of directories containing #include files.
|
|
||||||
{EM}/include contains a few files used by the library routines
|
|
||||||
for part III from the
|
|
||||||
.UX
|
|
||||||
manual.
|
|
||||||
These routines are included in the kit.
|
|
||||||
.PP
|
|
||||||
The variables HEAD, TAIL and RTS are set by \fIack\fP and used
|
|
||||||
to compose the arguments for the linker.
|
|
||||||
.NH
|
|
||||||
Example
|
|
||||||
.sp 1
|
|
||||||
description for front-end
|
|
||||||
.DS X
|
|
||||||
name cpp # the C-preprocessor
|
|
||||||
# no from, it's governed by the P property
|
|
||||||
to .i # result files have suffix i
|
|
||||||
program {EM}/lib/cpp # pathname of loadfile
|
|
||||||
mapflag -I* CPP_F={CPP_F?} -I* # grab -I.. -U.. and
|
|
||||||
mapflag -U* CPP_F={CPP_F?} -U* # -D.. to use as arguments
|
|
||||||
mapflag -D* CPP_F={CPP_F?} -D* # in the variable CPP_F
|
|
||||||
args {CPP_F?} {INCLUDES?} -D{NAME} -DEM_WSIZE={w} -DEM_PSIZE={p} \
|
|
||||||
-DEM_SSIZE={s} -DEM_LSIZE={l} -DEM_FSIZE={f} -DEM_DSIZE={d} <
|
|
||||||
# The arguments are: first the -[IUD]...
|
|
||||||
# then the include dir's for this machine
|
|
||||||
# then the NAME and size valeus finally
|
|
||||||
# followed by the input file name
|
|
||||||
prop >P # Output on stdout, is preprocessor
|
|
||||||
end
|
|
||||||
name cem # the C-compiler proper
|
|
||||||
from .c # used for files with suffix .c
|
|
||||||
to .k # produces compact code files
|
|
||||||
program {EM}/lib/em_cem # pathname of loadfile
|
|
||||||
mapflag -p CEM_F={CEM_F?} -Xp # pass -p as -Xp to cem
|
|
||||||
mapflag -L CEM_F={CEM_F?} -l # pass -L as -l to cem
|
|
||||||
args -Vw{w}i{w}p{p}f{f}s{s}l{l}d{d} {CEM_F?}
|
|
||||||
# the arguments are the object sizes in
|
|
||||||
# the -V... flag and possibly -l and -Xp
|
|
||||||
prop <>p # input on stdin, output on stdout, use cpp
|
|
||||||
rts .c # use the C run-time system
|
|
||||||
need .c # use the C libraries
|
|
||||||
end
|
|
||||||
name decode # make human readable files from compact code
|
|
||||||
from .k.m # accept files with suffix .k or .m
|
|
||||||
to .e # produce .e files
|
|
||||||
program {EM}/lib/em_decode # pathname of loadfile
|
|
||||||
args < # the input file name is the only argument
|
|
||||||
prop > # the output comes on stdout
|
|
||||||
end
|
|
||||||
.DE
|
|
||||||
|
|
||||||
.DS X
|
|
||||||
Example of a backend, in this case the EM assembler/loader.
|
|
||||||
|
|
||||||
var w=2 # wordsize 2
|
|
||||||
var p=2 # pointersize 2
|
|
||||||
var s=2 # short size 2
|
|
||||||
var l=4 # long size 4
|
|
||||||
var f=4 # float size 4
|
|
||||||
var d=8 # double size 8
|
|
||||||
var M=int # Unused in this example
|
|
||||||
var NAME=int22 # for cpp (NAME=int results in #define int 1)
|
|
||||||
var LIB=mach/int/lib/tail_ # part of file name for libraries
|
|
||||||
var RT=mach/int/lib/head_ # part of file name for run-time startoff
|
|
||||||
var SIZE_FLAG=-sm # default internal table size flag
|
|
||||||
var INCLUDES=-I{EM}/include # use {EM}/include for #include files
|
|
||||||
name asld # Assembler/loader
|
|
||||||
from .k.m.a # accepts compact code and archives
|
|
||||||
to e.out # output file name
|
|
||||||
program {EM}/lib/em_ass # load file pathname
|
|
||||||
mapflag -l* LNAME={EM}/{LIB}* # e.g. -ly becomes
|
|
||||||
# {EM}/mach/int/lib/tail_y
|
|
||||||
mapflag -+* ASS_F={ASS_F?} -+* # recognize -+ and --
|
|
||||||
mapflag --* ASS_F={ASS_F?} --*
|
|
||||||
mapflag -s* SIZE_FLAG=-s* # overwrite old value of SIZE_FLAG
|
|
||||||
args {SIZE_FLAG} \
|
|
||||||
({RTS}:.c={EM}/{RT}cc) ({RTS}:.p={EM}/{RT}pc) -o > < \
|
|
||||||
(.p:{TAIL}={EM}/{LIB}pc) \
|
|
||||||
(.c:{TAIL}={EM}/{LIB}cc.1s {EM}/{LIB}cc.2g) \
|
|
||||||
(.c.p:{TAIL}={EM}/{LIB}mon)
|
|
||||||
# -s[sml] must be first argument
|
|
||||||
# the next line contains the choice for head_cc or head_pc
|
|
||||||
# and the specification of in- and output.
|
|
||||||
# the last three args lines choose libraries
|
|
||||||
prop C # This is the final stage
|
|
||||||
end
|
|
||||||
.DE
|
|
||||||
|
|
||||||
The command "ack -mint -v -v -I../h -L -ly prog.c"
|
|
||||||
would result in the following
|
|
||||||
calls (with exec(II)):
|
|
||||||
.DS X
|
|
||||||
1) /lib/cpp -I../h -I/usr/em/include -Dint22 -DEM_WSIZE=2 -DEM_PSIZE=2
|
|
||||||
-DEM_SSIZE=2 -DEM_LSIZE=4 -DEM_FSIZE=4 -DEM_DSIZE=8 prog.c
|
|
||||||
2) /usr/em/lib/em_cem -Vw2i2p2f4s2l4d8 -l
|
|
||||||
3) /usr/em/lib/em_ass -sm /usr/em/mach/int/lib/head_cc -o e.out prog.k
|
|
||||||
/usr/em/mach/int/lib/tail_y /usr/em/mach/int/lib/tail_cc.1s
|
|
||||||
/usr/em/mach/int/lib/tail_cc.2g /usr/em/mach/int/lib/tail_mon
|
|
||||||
.DE
|
|
||||||
1837
doc/cg.doc
1837
doc/cg.doc
File diff suppressed because it is too large
Load Diff
317
doc/cref.doc
317
doc/cref.doc
@@ -1,317 +0,0 @@
|
|||||||
.ll 72
|
|
||||||
.nr ID 4
|
|
||||||
.de hd
|
|
||||||
'sp 2
|
|
||||||
'tl ''-%-''
|
|
||||||
'sp 3
|
|
||||||
..
|
|
||||||
.de fo
|
|
||||||
'bp
|
|
||||||
..
|
|
||||||
.tr ~
|
|
||||||
. TITLE
|
|
||||||
.de TL
|
|
||||||
.sp 15
|
|
||||||
.ce
|
|
||||||
\\fB\\$1\\fR
|
|
||||||
..
|
|
||||||
. AUTHOR
|
|
||||||
.de AU
|
|
||||||
.sp 15
|
|
||||||
.ce
|
|
||||||
by
|
|
||||||
.sp 2
|
|
||||||
.ce
|
|
||||||
\\$1
|
|
||||||
..
|
|
||||||
. DATE
|
|
||||||
.de DA
|
|
||||||
.sp 3
|
|
||||||
.ce
|
|
||||||
( Dated \\$1 )
|
|
||||||
..
|
|
||||||
. INSTITUTE
|
|
||||||
.de VU
|
|
||||||
.sp 3
|
|
||||||
.ce 4
|
|
||||||
Wiskundig Seminarium
|
|
||||||
Vrije Universteit
|
|
||||||
De Boelelaan 1081
|
|
||||||
Amsterdam
|
|
||||||
..
|
|
||||||
. PARAGRAPH
|
|
||||||
.de PP
|
|
||||||
.sp
|
|
||||||
.ti +\n(ID
|
|
||||||
..
|
|
||||||
.nr CH 0 1
|
|
||||||
. CHAPTER
|
|
||||||
.de CH
|
|
||||||
.nr SH 0 1
|
|
||||||
.bp
|
|
||||||
.in 0
|
|
||||||
\\fB\\n+(CH.~\\$1\\fR
|
|
||||||
.PP
|
|
||||||
..
|
|
||||||
. SUBCHAPTER
|
|
||||||
.de SH
|
|
||||||
.sp 3
|
|
||||||
.in 0
|
|
||||||
\\fB\\n(CH.\\n+(SH.~\\$1\\fR
|
|
||||||
.PP
|
|
||||||
..
|
|
||||||
. INDENT START
|
|
||||||
.de IS
|
|
||||||
.sp
|
|
||||||
.in +\n(ID
|
|
||||||
..
|
|
||||||
. INDENT END
|
|
||||||
.de IE
|
|
||||||
.in -\n(ID
|
|
||||||
.sp
|
|
||||||
..
|
|
||||||
.de PT
|
|
||||||
.ti -\n(ID
|
|
||||||
.ta \n(ID
|
|
||||||
.fc " @
|
|
||||||
"\\$1@"\c
|
|
||||||
.fc
|
|
||||||
..
|
|
||||||
. DOUBLE INDENT START
|
|
||||||
.de DS
|
|
||||||
.sp
|
|
||||||
.in +\n(ID
|
|
||||||
.ll -\n(ID
|
|
||||||
..
|
|
||||||
. DOUBLE INDENT END
|
|
||||||
.de DE
|
|
||||||
.ll +\n(ID
|
|
||||||
.in -\n(ID
|
|
||||||
.sp
|
|
||||||
..
|
|
||||||
. EQUATION START
|
|
||||||
.de EQ
|
|
||||||
.sp
|
|
||||||
.nf
|
|
||||||
..
|
|
||||||
. EQUATION END
|
|
||||||
.de EN
|
|
||||||
.fi
|
|
||||||
.sp
|
|
||||||
..
|
|
||||||
. ITEM
|
|
||||||
.de IT
|
|
||||||
.sp
|
|
||||||
.in 0
|
|
||||||
\\fB~\\$1\\fR
|
|
||||||
.ti +5
|
|
||||||
..
|
|
||||||
.de CS
|
|
||||||
.br
|
|
||||||
~-~\\
|
|
||||||
..
|
|
||||||
.br
|
|
||||||
.fi
|
|
||||||
.TL "Ack-C reference manual"
|
|
||||||
.AU "Ed Keizer"
|
|
||||||
.DA "September 12, 1983"
|
|
||||||
.VU
|
|
||||||
.wh 0 hd
|
|
||||||
.wh 60 fo
|
|
||||||
.CH "Introduction"
|
|
||||||
The C frontend included in the Amsterdam Compiler Kit
|
|
||||||
translates UNIX-V7 C into compact EM code [1].
|
|
||||||
The language accepted is described in [2] and [3].
|
|
||||||
This document describes which implementation dependent choices were
|
|
||||||
made in the Ack-C frontend and
|
|
||||||
some restrictions and additions.
|
|
||||||
.CH "The language"
|
|
||||||
.PP
|
|
||||||
Under the same heading as used in [2] we describe the
|
|
||||||
properties of the Ack-C frontend.
|
|
||||||
.IT "2.2 Identifiers"
|
|
||||||
External identifiers are unique up to 7 characters and allow
|
|
||||||
both upper and lower case.
|
|
||||||
.IT "2.4.3 Character constants"
|
|
||||||
The ASCII-mapping is used when a character is converted to an
|
|
||||||
integer.
|
|
||||||
.IT "2.4.4 Floating constants"
|
|
||||||
To prevent loss of precision the compiler does not perform
|
|
||||||
floating point constant folding.
|
|
||||||
.IT "2.6 Hardware characteristics"
|
|
||||||
The size of objects of the several arithmetic types and the two
|
|
||||||
pointer types depend on the EM-implementation used.
|
|
||||||
The ranges of the arithmetic types depend on the size used,
|
|
||||||
the C-frontend assumes two's complement representation for the
|
|
||||||
integral types. All sizes are multiples of bytes.
|
|
||||||
The calling program \fIack\fP[4] passes information about the
|
|
||||||
size of the types to the compiler proper.
|
|
||||||
.br
|
|
||||||
However, a few general remarks must be made:
|
|
||||||
.sp 1
|
|
||||||
.IS
|
|
||||||
.PT (a)
|
|
||||||
Two different pointer types exist: pointers to data and
|
|
||||||
pointers to functions.
|
|
||||||
The latter type is twice as large as the former.
|
|
||||||
Pointers to functions use the same format as Pascal procedure
|
|
||||||
parameters, thereby allowing C to use Pascal procedure
|
|
||||||
parameters and vice-versa.
|
|
||||||
The extra information passed indicates the scope level of the
|
|
||||||
procedure.
|
|
||||||
.PT (b)
|
|
||||||
The size of pointers to data is a multiple of
|
|
||||||
(or equal to) the size of an \fIint\fP.
|
|
||||||
.PT (c)
|
|
||||||
The following relations exist for the sizes of the types
|
|
||||||
mentioned:
|
|
||||||
.br
|
|
||||||
.ti +5
|
|
||||||
\fIchar<=short<=int<=long\fP
|
|
||||||
.PT (d)
|
|
||||||
Objects of type \fIchar\fP use one 8-bit byte of storage,
|
|
||||||
although several bytes are allocated sometimes.
|
|
||||||
.PT (e)
|
|
||||||
All sizes are in multiples of bytes.
|
|
||||||
.PT (f)
|
|
||||||
Most EM implementations use 4 bytes for floats and 8 bytes
|
|
||||||
for doubles, but exceptions to this rule occur.
|
|
||||||
.IE
|
|
||||||
.IT "6.1 Characters and integers"
|
|
||||||
Objects of type \fIchar\fP are unsigned and do not cause
|
|
||||||
sign-extension when converted to \fIint\fP.
|
|
||||||
The range of characters values is from 0 to 255.
|
|
||||||
.IT "6.3 Floating and integral"
|
|
||||||
Floating point numbers are truncated towards zero when
|
|
||||||
converted to the integral types.
|
|
||||||
.IT "6.4 Pointers and integers"
|
|
||||||
When a \fIlong\fP is added to or subtracted from a pointer and
|
|
||||||
longs are larger then data pointers the \fIlong\fP is converted to an
|
|
||||||
\fIint\fP before the operation is performed.
|
|
||||||
.IT "8.5 Structure and union declarations"
|
|
||||||
The only type allowed for fields is \fIint\fP.
|
|
||||||
Fields with exactly the size of \fIint\fP are signed,
|
|
||||||
all other fields are unsigned.
|
|
||||||
.br
|
|
||||||
The size of any single structure must be less then 4096 bytes.
|
|
||||||
.IT "8.6 Initialization"
|
|
||||||
Initialization of structures containing bit fields is not
|
|
||||||
allowed.
|
|
||||||
There is one restriction when using an 'address expression' to initialize
|
|
||||||
an integral variable.
|
|
||||||
The integral variable must have the size of a data pointer.
|
|
||||||
Conversions altering the size of the address expression are not allowed.
|
|
||||||
.IT "10.1 External function definitions"
|
|
||||||
The total amount for storage used for parameters
|
|
||||||
in any function must be less then 4096 bytes.
|
|
||||||
The same holds for the total amount of storage occupied by the
|
|
||||||
automatic variables declared inside any function.
|
|
||||||
.sp
|
|
||||||
Using formal parameters whose size is smaller the the size of an int
|
|
||||||
is less efficient on several machines.
|
|
||||||
At procedure entry these parameters are converted from integer to the
|
|
||||||
declared type, because the compiler doesn't know where the least
|
|
||||||
significant bytes are stored in the int.
|
|
||||||
.IT "11.2 Scope of externals"
|
|
||||||
Most C compilers are rather lax in enforcing the restriction
|
|
||||||
that only one external definition without the keyword
|
|
||||||
\fIextern\fP is allowed in a program.
|
|
||||||
The Ack-C frontend is very strict in this.
|
|
||||||
The only exception is that declarations of arrays with a
|
|
||||||
missing first array bounds expression are regarded to have an
|
|
||||||
explicit keyword \fIextern\fP.
|
|
||||||
.IT "14.4 Explicit pointer conversions"
|
|
||||||
Pointers may be larger the ints, thus assigning a pointer to an
|
|
||||||
int and back will not always result in the same pointer.
|
|
||||||
The process mentioned above works with integrals
|
|
||||||
of the same size or larger as pointers in all EM implementations
|
|
||||||
having such integrals.
|
|
||||||
Note that pointers to functions have
|
|
||||||
twice the size of pointers to data.
|
|
||||||
When converting data pointers to an integral type or vice-versa,
|
|
||||||
the pointers is seen as an unsigned with the same size a data-pointer.
|
|
||||||
When converting function pointers to anything else the static link part
|
|
||||||
of the pointer is discarded,
|
|
||||||
the resulting value is treated as if it were a data pointer.
|
|
||||||
When converting a data pointer or object of integral type to a function pointer
|
|
||||||
a static link with the value 0 is added to complete the function pointer.
|
|
||||||
.br
|
|
||||||
EM guarantees that any object can be placed at a word boundary,
|
|
||||||
this allows the C-programs to use \fIint\fP pointers
|
|
||||||
as pointers to objects of any type not smaller than an \fIint\fP.
|
|
||||||
.CH "Frontend options"
|
|
||||||
The C-frontend has a few options, these are controlled
|
|
||||||
by flags:
|
|
||||||
.IS
|
|
||||||
.PT -V
|
|
||||||
This flag is followed by a sequence of letters each followed by
|
|
||||||
positive integers. Each letter indicates a
|
|
||||||
certain type, the integer following it specifies the size of
|
|
||||||
objects of that type. One letter indicates the wordsize used.
|
|
||||||
.IS
|
|
||||||
.sp 1
|
|
||||||
.TS
|
|
||||||
center tab(:);
|
|
||||||
l l16 l l.
|
|
||||||
letter:type:letter:type
|
|
||||||
|
|
||||||
w:wordsize:i:int
|
|
||||||
s:short:l:long
|
|
||||||
f:float:d:double
|
|
||||||
p:pointer::
|
|
||||||
.TE
|
|
||||||
.sp 1
|
|
||||||
All existing implementations use an integer size equal to the
|
|
||||||
wordsize.
|
|
||||||
.IE
|
|
||||||
The calling program \fIack\fP[4] provides the frontend with
|
|
||||||
this flag, with values depending on the machine used.
|
|
||||||
.sp 1
|
|
||||||
.PT -l
|
|
||||||
The frontend normally generates code to keep track of the line
|
|
||||||
number and source file name at runtime for debugging purposes.
|
|
||||||
Currently a pointer to a
|
|
||||||
string containing the filename is stored at a fixed place in
|
|
||||||
memory at each function
|
|
||||||
entry and the line number at the start of every expression.
|
|
||||||
At the return from a function these memory locations are not reset to
|
|
||||||
the values they had before the call.
|
|
||||||
Most library routines do not use this feature and thus do not
|
|
||||||
ruin the current line number and filename when called.
|
|
||||||
However, you are really unlucky when your program crashes due
|
|
||||||
to a bug in such a library function, because the line number
|
|
||||||
and filename do not indicate that something went wrong inside
|
|
||||||
the library function.
|
|
||||||
.br
|
|
||||||
Providing the flag -l to the frontend tells it not to generate
|
|
||||||
the code updating line number and file name.
|
|
||||||
This is, for example, used when translating the stdio library.
|
|
||||||
.br
|
|
||||||
When the \fIack\fP[4] is called with the -L flag it provides
|
|
||||||
the frontend with this flag.
|
|
||||||
.sp 1
|
|
||||||
.PT -Xp
|
|
||||||
When this flag is present the frontend generates a call to
|
|
||||||
the function \fBprocentry\fP at each function entry and a
|
|
||||||
call to \fBprocexit\fP at each function exit.
|
|
||||||
Both functions are provided with one parameter,
|
|
||||||
a pointer to a string containing the function name.
|
|
||||||
.br
|
|
||||||
When \fIack\fP is called with the -p flag it provides the
|
|
||||||
frontend with this flag.
|
|
||||||
.IE
|
|
||||||
.CH References
|
|
||||||
.IS
|
|
||||||
.PT [1]
|
|
||||||
A.S. Tanenbaum, Hans van Staveren, Ed Keizer and Johan
|
|
||||||
Stevenson \fIDescription of a machine architecture for use with
|
|
||||||
block structured languages\fP Informatica report IR-81.
|
|
||||||
.sp 1
|
|
||||||
.PT [2]
|
|
||||||
B.W. Kernighan and D.M. Ritchie, \fIThe C Programming
|
|
||||||
language\fP, Prentice-Hall, 1978
|
|
||||||
.PT [3]
|
|
||||||
D.M. Ritchie, \fIC Reference Manual\fP
|
|
||||||
.sp
|
|
||||||
.PT [4]
|
|
||||||
UNIX manual ack(I).
|
|
||||||
@@ -1,28 +0,0 @@
|
|||||||
head: doc.pr
|
|
||||||
|
|
||||||
NROFF=nroff
|
|
||||||
FILES = macr.nr title.nr intro.nr mem.nr ispace.nr dspace.nr mapping.nr types.nr descr.nr iotrap.nr mach.nr assem.nr app.nr
|
|
||||||
IOP=../../util/ass/ip_spec.t
|
|
||||||
|
|
||||||
doc.pr: $(FILES) itables em.i
|
|
||||||
tbl $(FILES) | $(NROFF) >doc.pr
|
|
||||||
|
|
||||||
opr: doc.pr
|
|
||||||
make pr | opr
|
|
||||||
|
|
||||||
pr:
|
|
||||||
@make "NROFF="$NROFF doc.pr >makepr.out 2>&1
|
|
||||||
@cat doc.pr
|
|
||||||
|
|
||||||
app.t: itables em.i
|
|
||||||
|
|
||||||
em.i: int/em.p
|
|
||||||
@echo Sorry, this copy was edited by hand from int/em.p
|
|
||||||
|
|
||||||
itables: $(IOP)
|
|
||||||
awk -f ip.awk $(IOP) | tbl >itables
|
|
||||||
|
|
||||||
.SUFFIXES : .pr .nr
|
|
||||||
.nr.pr: ; tbl macr.nr $*.nr | $(NROFF) >$@
|
|
||||||
|
|
||||||
cont.t intro.t mem.t ispace.t dspace.t mapping.t succ.t descr.t iotrap.t mach.t assem.t kern.t app.t: macr.nr
|
|
||||||
@@ -1 +0,0 @@
|
|||||||
Sorry, the kun macro package is not ours to distribute.
|
|
||||||
1121
doc/em/addend.n
1121
doc/em/addend.n
File diff suppressed because it is too large
Load Diff
488
doc/em/app.nr
488
doc/em/app.nr
@@ -1,488 +0,0 @@
|
|||||||
.BP
|
|
||||||
.AP "EM INTERPRETER"
|
|
||||||
.nf
|
|
||||||
.ta 8 16 24 32 40 48 56 64 72 80
|
|
||||||
.so em.i
|
|
||||||
.fi
|
|
||||||
.BP
|
|
||||||
.AP "EM CODE TABLES"
|
|
||||||
The following table is used by the assembler for EM machine
|
|
||||||
language.
|
|
||||||
It specifies the opcodes used for each instruction and
|
|
||||||
how arguments are mapped to machine language arguments.
|
|
||||||
The table is presented in three columns,
|
|
||||||
each line in each column contains three or four fields.
|
|
||||||
Each line describes a range of interpreter opcodes by
|
|
||||||
specifying for which instruction the range is used, the type of the
|
|
||||||
opcodes (mini, shortie, etc..) and range for the instruction
|
|
||||||
argument.
|
|
||||||
.A
|
|
||||||
The first field on each line gives the EM instruction mnemonic,
|
|
||||||
the second field gives some flags.
|
|
||||||
If the opcodes are minis or shorties the third field specifies
|
|
||||||
how many minis/shorties are used.
|
|
||||||
The last field gives the number of the (first) interpreter
|
|
||||||
opcode.
|
|
||||||
.N 1
|
|
||||||
Flags :
|
|
||||||
.IS 3
|
|
||||||
.N 1
|
|
||||||
Opcode type, only one of the following may be specified.
|
|
||||||
.PS - 5 " "
|
|
||||||
.PT -
|
|
||||||
opcode without argument
|
|
||||||
.PT m
|
|
||||||
mini
|
|
||||||
.PT s
|
|
||||||
shortie
|
|
||||||
.PT 2
|
|
||||||
opcode with 2-byte signed argument
|
|
||||||
.PT 4
|
|
||||||
opcode with 4-byte signed argument
|
|
||||||
.PT 8
|
|
||||||
opcode with 8-byte signed argument
|
|
||||||
.PE
|
|
||||||
Secondary (escaped) opcodes.
|
|
||||||
.PS - 5 " "
|
|
||||||
.PT e
|
|
||||||
The opcode thus marked is in the secondary opcode group instead
|
|
||||||
of the primary
|
|
||||||
.PE
|
|
||||||
restrictions on arguments
|
|
||||||
.PS - 5 " "
|
|
||||||
.PT N
|
|
||||||
Negative arguments only
|
|
||||||
.PT P
|
|
||||||
Positive and zero arguments only
|
|
||||||
.PE
|
|
||||||
mapping of arguments
|
|
||||||
.PS - 5 " "
|
|
||||||
.PT w
|
|
||||||
argument must be divisible by the wordsize and is divided by the
|
|
||||||
wordsize before use as opcode argument.
|
|
||||||
.PT o
|
|
||||||
argument ( possibly after division ) must be >= 1 and is
|
|
||||||
decremented before use as opcode argument
|
|
||||||
.PE
|
|
||||||
.IE
|
|
||||||
If the opcode type is 2,4 or 8 the resulting argument is used as
|
|
||||||
opcode argument (least significant byte first).
|
|
||||||
.N
|
|
||||||
If the opcode type is mini, the argument is added
|
|
||||||
to the first opcode - if in range - .
|
|
||||||
If the argument is negative, the absolute value minus one is
|
|
||||||
used in the algorithm above.
|
|
||||||
.N
|
|
||||||
For shorties with positive arguments the first opcode is used
|
|
||||||
for arguments in the range 0..255, the second for the range
|
|
||||||
256..511, etc..
|
|
||||||
For shorties with negative arguments the first opcode is used
|
|
||||||
for arguments in the range -1..-256, the second for the range
|
|
||||||
-257..-512, etc..
|
|
||||||
The byte following the opcode contains the least significant
|
|
||||||
byte of the argument.
|
|
||||||
First some examples of these specifications.
|
|
||||||
.PS - 5
|
|
||||||
.PT "aar mwPo 1 34"
|
|
||||||
Indicates that opcode 34 is used as a mini for Positive
|
|
||||||
instruction arguments only.
|
|
||||||
The w and o indicate division and decrementing of the
|
|
||||||
instruction argument.
|
|
||||||
Because the resulting argument must be zero ( only opcode 34 may be used
|
|
||||||
), this mini can only be used for instruction argument 2.
|
|
||||||
Conclusion: opcode 34 is for "AAR 2".
|
|
||||||
.PT "adp sP 1 41"
|
|
||||||
Opcode 41 is used as shortie for ADP with arguments in the range
|
|
||||||
0..255.
|
|
||||||
.PT "bra sN 2 60"
|
|
||||||
Opcode 60 is used as shortie for BRA with arguments -1..-256,
|
|
||||||
61 is used for arguments -257..-512.
|
|
||||||
.PT "zer e- 145"
|
|
||||||
Escaped opcode 145 is used for ZER.
|
|
||||||
.PE
|
|
||||||
The interpreter opcode table:
|
|
||||||
.N 1
|
|
||||||
.IS 3
|
|
||||||
.DS B
|
|
||||||
.so itables
|
|
||||||
.DE 0
|
|
||||||
.IE
|
|
||||||
.P
|
|
||||||
The table above results in the following dispatch tables.
|
|
||||||
Dispatch tables are used by interpreters to jump to the
|
|
||||||
routines implementing the EM instructions, indexed by the next opcode.
|
|
||||||
Each line of the dispatch tables gives the routine names
|
|
||||||
of eight consecutive opcodes, preceded by the first opcode number
|
|
||||||
on that line.
|
|
||||||
Routine names consist of an EM mnemonic followed by a suffix.
|
|
||||||
The suffices show the encoding used for each opcode.
|
|
||||||
.N
|
|
||||||
The following suffices exist:
|
|
||||||
.N 1
|
|
||||||
.VS 1 0
|
|
||||||
.IS 4
|
|
||||||
.PS - 11
|
|
||||||
.PT .z
|
|
||||||
no arguments
|
|
||||||
.PT .l
|
|
||||||
16-bit argument
|
|
||||||
.PT .lw
|
|
||||||
16-bit argument divided by the wordsize
|
|
||||||
.PT .p
|
|
||||||
positive 16-bit argument
|
|
||||||
.PT .pw
|
|
||||||
positive 16-bit argument divided by the wordsize
|
|
||||||
.PT .n
|
|
||||||
negative 16-bit argument
|
|
||||||
.PT .nw
|
|
||||||
negative 16-bit argument divided by the wordsize
|
|
||||||
.PT .s<num>
|
|
||||||
shortie with <num> as high order argument byte
|
|
||||||
.PT .sw<num>
|
|
||||||
shortie with argument divided by the wordsize
|
|
||||||
.PT .<num>
|
|
||||||
mini with <num> as argument
|
|
||||||
.PT .<num>W
|
|
||||||
mini with <num>*wordsize as argument
|
|
||||||
.PE 3
|
|
||||||
<num> is a possibly negative integer.
|
|
||||||
.VS 1 1
|
|
||||||
.IE
|
|
||||||
The dispatch table for the 256 primary opcodes:
|
|
||||||
.DS B
|
|
||||||
0 loc.0 loc.1 loc.2 loc.3 loc.4 loc.5 loc.6 loc.7
|
|
||||||
8 loc.8 loc.9 loc.10 loc.11 loc.12 loc.13 loc.14 loc.15
|
|
||||||
16 loc.16 loc.17 loc.18 loc.19 loc.20 loc.21 loc.22 loc.23
|
|
||||||
24 loc.24 loc.25 loc.26 loc.27 loc.28 loc.29 loc.30 loc.31
|
|
||||||
32 loc.32 loc.33 aar.1W adf.s0 adi.1W adi.2W adp.l adp.1
|
|
||||||
40 adp.2 adp.s0 adp.s-1 ads.1W and.1W asp.1W asp.2W asp.3W
|
|
||||||
48 asp.4W asp.5W asp.w0 beq.l beq.s0 bge.s0 bgt.s0 ble.s0
|
|
||||||
56 blm.s0 blt.s0 bne.s0 bra.l bra.s-1 bra.s-2 bra.s0 bra.s1
|
|
||||||
64 cal.1 cal.2 cal.3 cal.4 cal.5 cal.6 cal.7 cal.8
|
|
||||||
72 cal.9 cal.10 cal.11 cal.12 cal.13 cal.14 cal.15 cal.16
|
|
||||||
80 cal.17 cal.18 cal.19 cal.20 cal.21 cal.22 cal.23 cal.24
|
|
||||||
88 cal.25 cal.26 cal.27 cal.28 cal.s0 cff.z cif.z cii.z
|
|
||||||
96 cmf.s0 cmi.1W cmi.2W cmp.z cms.s0 csa.1W csb.1W dec.z
|
|
||||||
104 dee.w0 del.w-1 dup.1W dvf.s0 dvi.1W fil.l inc.z ine.lw
|
|
||||||
112 ine.w0 inl.-1W inl.-2W inl.-3W inl.w-1 inn.s0 ior.1W ior.s0
|
|
||||||
120 lae.l lae.w0 lae.w1 lae.w2 lae.w3 lae.w4 lae.w5 lae.w6
|
|
||||||
128 lal.p lal.n lal.0 lal.-1 lal.w0 lal.w-1 lal.w-2 lar.W
|
|
||||||
136 ldc.0 lde.lw lde.w0 ldl.0 ldl.w-1 lfr.1W lfr.2W lfr.s0
|
|
||||||
144 lil.w-1 lil.w0 lil.0 lil.1W lin.l lin.s0 lni.z loc.l
|
|
||||||
152 loc.-1 loc.s0 loc.s-1 loe.lw loe.w0 loe.w1 loe.w2 loe.w3
|
|
||||||
160 loe.w4 lof.l lof.1W lof.2W lof.3W lof.4W lof.s0 loi.l
|
|
||||||
168 loi.1 loi.1W loi.2W loi.3W loi.4W loi.s0 lol.pw lol.nw
|
|
||||||
176 lol.0 lol.1W lol.2W lol.3W lol.-1W lol.-2W lol.-3W lol.-4W
|
|
||||||
184 lol.-5W lol.-6W lol.-7W lol.-8W lol.w0 lol.w-1 lxa.1 lxl.1
|
|
||||||
192 lxl.2 mlf.s0 mli.1W mli.2W rck.1W ret.0 ret.1W ret.s0
|
|
||||||
200 rmi.1W sar.1W sbf.s0 sbi.1W sbi.2W sdl.w-1 set.s0 sil.w-1
|
|
||||||
208 sil.w0 sli.1W ste.lw ste.w0 ste.w1 ste.w2 stf.l stf.W
|
|
||||||
216 stf.2W stf.s0 sti.1 sti.1W sti.2W sti.3W sti.4W sti.s0
|
|
||||||
224 stl.pw stl.nw stl.0 stl.1W stl.-1W stl.-2W stl.-3W stl.-4W
|
|
||||||
232 stl.-5W stl.w-1 teq.z tgt.z tlt.z tne.z zeq.l zeq.s0
|
|
||||||
240 zeq.s1 zer.s0 zge.s0 zgt.s0 zle.s0 zlt.s0 zne.s0 zne.s-1
|
|
||||||
248 zre.lw zre.w0 zrl.-1W zrl.-2W zrl.w-1 zrl.nw escape1 escape2
|
|
||||||
.DE 2
|
|
||||||
The list of secondary opcodes (escape1):
|
|
||||||
.N 1
|
|
||||||
.DS B
|
|
||||||
0 aar.l aar.z adf.l adf.z adi.l adi.z ads.l ads.z
|
|
||||||
8 adu.l adu.z and.l and.z asp.lw ass.l ass.z bge.l
|
|
||||||
16 bgt.l ble.l blm.l bls.l bls.z blt.l bne.l cai.z
|
|
||||||
24 cal.l cfi.z cfu.z ciu.z cmf.l cmf.z cmi.l cmi.z
|
|
||||||
32 cms.l cms.z cmu.l cmu.z com.l com.z csa.l csa.z
|
|
||||||
40 csb.l csb.z cuf.z cui.z cuu.z dee.lw del.pw del.nw
|
|
||||||
48 dup.l dus.l dus.z dvf.l dvf.z dvi.l dvi.z dvu.l
|
|
||||||
56 dvu.z fef.l fef.z fif.l fif.z inl.pw inl.nw inn.l
|
|
||||||
64 inn.z ior.l ior.z lar.l lar.z ldc.l ldf.l ldl.pw
|
|
||||||
72 ldl.nw lfr.l lil.pw lil.nw lim.z los.l los.z lor.s0
|
|
||||||
80 lpi.l lxa.l lxl.l mlf.l mlf.z mli.l mli.z mlu.l
|
|
||||||
88 mlu.z mon.z ngf.l ngf.z ngi.l ngi.z nop.z rck.l
|
|
||||||
96 rck.z ret.l rmi.l rmi.z rmu.l rmu.z rol.l rol.z
|
|
||||||
104 ror.l ror.z rtt.z sar.l sar.z sbf.l sbf.z sbi.l
|
|
||||||
112 sbi.z sbs.l sbs.z sbu.l sbu.z sde.l sdf.l sdl.pw
|
|
||||||
120 sdl.nw set.l set.z sig.z sil.pw sil.nw sim.z sli.l
|
|
||||||
128 sli.z slu.l slu.z sri.l sri.z sru.l sru.z sti.l
|
|
||||||
136 sts.l sts.z str.s0 tge.z tle.z trp.z xor.l xor.z
|
|
||||||
144 zer.l zer.z zge.l zgt.l zle.l zlt.l zne.l zrf.l
|
|
||||||
152 zrf.z zrl.pw dch.z exg.s0 exg.l exg.z lpb.z gto.l
|
|
||||||
.DE 2
|
|
||||||
Finally, the list of opcodes with four byte arguments (escape2).
|
|
||||||
.DS
|
|
||||||
|
|
||||||
0 loc
|
|
||||||
.DE 0
|
|
||||||
.BP
|
|
||||||
.AP "AN EXAMPLE PROGRAM"
|
|
||||||
.DS B
|
|
||||||
1 program example(output);
|
|
||||||
2 {This program just demonstrates typical EM code.}
|
|
||||||
3 type rec = record r1: integer; r2:real; r3: boolean end;
|
|
||||||
4 var mi: integer; mx:real; r:rec;
|
|
||||||
5
|
|
||||||
6 function sum(a,b:integer):integer;
|
|
||||||
7 begin
|
|
||||||
8 sum := a + b
|
|
||||||
9 end;
|
|
||||||
10
|
|
||||||
11 procedure test(var r: rec);
|
|
||||||
12 label 1;
|
|
||||||
13 var i,j: integer;
|
|
||||||
14 x,y: real;
|
|
||||||
15 b: boolean;
|
|
||||||
16 c: char;
|
|
||||||
17 a: array[1..100] of integer;
|
|
||||||
18
|
|
||||||
19 begin
|
|
||||||
20 j := 1;
|
|
||||||
21 i := 3 * j + 6;
|
|
||||||
22 x := 4.8;
|
|
||||||
23 y := x/0.5;
|
|
||||||
24 b := true;
|
|
||||||
25 c := 'z';
|
|
||||||
26 for i:= 1 to 100 do a[i] := i * i;
|
|
||||||
27 r.r1 := j+27;
|
|
||||||
28 r.r3 := b;
|
|
||||||
29 r.r2 := x+y;
|
|
||||||
30 i := sum(r.r1, a[j]);
|
|
||||||
31 while i > 0 do begin j := j + r.r1; i := i - 1 end;
|
|
||||||
32 with r do begin r3 := b; r2 := x+y; r1 := 0 end;
|
|
||||||
33 goto 1;
|
|
||||||
34 1: writeln(j, i:6, x:9:3, b)
|
|
||||||
35 end; {test}
|
|
||||||
36 begin {main program}
|
|
||||||
37 mx := 15.96;
|
|
||||||
38 mi := 99;
|
|
||||||
39 test(r)
|
|
||||||
40 end.
|
|
||||||
.DE 0
|
|
||||||
.BP
|
|
||||||
The EM code as produced by the Pascal-VU compiler is given below. Comments
|
|
||||||
have been added manually. Note that this code has already been optimized.
|
|
||||||
.DS B
|
|
||||||
mes 2,2,2 ; wordsize 2, pointersize 2
|
|
||||||
.1
|
|
||||||
rom 't.p\e000' ; the name of the source file
|
|
||||||
hol 552,-32768,0 ; externals and buf occupy 552 bytes
|
|
||||||
exp $sum ; sum can be called from other modules
|
|
||||||
pro $sum,2 ; procedure sum; 2 bytes local storage
|
|
||||||
lin 8 ; code from source line 8
|
|
||||||
ldl 0 ; load two locals ( a and b )
|
|
||||||
adi 2 ; add them
|
|
||||||
ret 2 ; return the result
|
|
||||||
end 2 ; end of procedure ( still two bytes local storage )
|
|
||||||
.2
|
|
||||||
rom 1,99,2 ; descriptor of array a[]
|
|
||||||
exp $test ; the compiler exports all level 0 procedures
|
|
||||||
pro $test,226 ; procedure test, 226 bytes local storage
|
|
||||||
.3
|
|
||||||
rom 4.8F8 ; assemble Floating point 4.8 (8 bytes) in
|
|
||||||
.4 ; global storage
|
|
||||||
rom 0.5F8 ; same for 0.5
|
|
||||||
mes 3,-226,2,2 ; compiler temporary not referenced by address
|
|
||||||
mes 3,-24,2,0 ; the same is true for i, j, b and c in test
|
|
||||||
mes 3,-22,2,0
|
|
||||||
mes 3,-4,2,0
|
|
||||||
mes 3,-2,2,0
|
|
||||||
mes 3,-20,8,0 ; and for x and y
|
|
||||||
mes 3,-12,8,0
|
|
||||||
lin 20 ; maintain source line number
|
|
||||||
loc 1
|
|
||||||
stl -4 ; j := 1
|
|
||||||
lni ; lin 21 prior to optimization
|
|
||||||
lol -4
|
|
||||||
loc 3
|
|
||||||
mli 2
|
|
||||||
loc 6
|
|
||||||
adi 2
|
|
||||||
stl -2 ; i := 3 * j + 6
|
|
||||||
lni ; lin 22 prior to optimization
|
|
||||||
lae .3
|
|
||||||
loi 8
|
|
||||||
lal -12
|
|
||||||
sti 8 ; x := 4.8
|
|
||||||
lni ; lin 23 prior to optimization
|
|
||||||
lal -12
|
|
||||||
loi 8
|
|
||||||
lae .4
|
|
||||||
loi 8
|
|
||||||
dvf 8
|
|
||||||
lal -20
|
|
||||||
sti 8 ; y := x / 0.5
|
|
||||||
lni ; lin 24 prior to optimization
|
|
||||||
loc 1
|
|
||||||
stl -22 ; b := true
|
|
||||||
lni ; lin 25 prior to optimization
|
|
||||||
loc 122
|
|
||||||
stl -24 ; c := 'z'
|
|
||||||
lni ; lin 26 prior to optimization
|
|
||||||
loc 1
|
|
||||||
stl -2 ; for i:= 1
|
|
||||||
2
|
|
||||||
lol -2
|
|
||||||
dup 2
|
|
||||||
mli 2 ; i*i
|
|
||||||
lal -224
|
|
||||||
lol -2
|
|
||||||
lae .2
|
|
||||||
sar 2 ; a[i] :=
|
|
||||||
lol -2
|
|
||||||
loc 100
|
|
||||||
beq *3 ; to 100 do
|
|
||||||
inl -2 ; increment i and loop
|
|
||||||
bra *2
|
|
||||||
3
|
|
||||||
lin 27
|
|
||||||
lol -4
|
|
||||||
loc 27
|
|
||||||
adi 2 ; j + 27
|
|
||||||
sil 0 ; r.r1 :=
|
|
||||||
lni ; lin 28 prior to optimization
|
|
||||||
lol -22 ; b
|
|
||||||
lol 0
|
|
||||||
stf 10 ; r.r3 :=
|
|
||||||
lni ; lin 29 prior to optimization
|
|
||||||
lal -20
|
|
||||||
loi 16
|
|
||||||
adf 8 ; x + y
|
|
||||||
lol 0
|
|
||||||
adp 2
|
|
||||||
sti 8 ; r.r2 :=
|
|
||||||
lni ; lin 23 prior to optimization
|
|
||||||
lal -224
|
|
||||||
lol -4
|
|
||||||
lae .2
|
|
||||||
lar 2 ; a[j]
|
|
||||||
lil 0 ; r.r1
|
|
||||||
cal $sum ; call now
|
|
||||||
asp 4 ; remove parameters from stack
|
|
||||||
lfr 2 ; get function result
|
|
||||||
stl -2 ; i :=
|
|
||||||
4
|
|
||||||
lin 31
|
|
||||||
lol -2
|
|
||||||
zle *5 ; while i > 0 do
|
|
||||||
lol -4
|
|
||||||
lil 0
|
|
||||||
adi 2
|
|
||||||
stl -4 ; j := j + r.r1
|
|
||||||
del -2 ; i := i - 1
|
|
||||||
bra *4 ; loop
|
|
||||||
5
|
|
||||||
lin 32
|
|
||||||
lol 0
|
|
||||||
stl -226 ; make copy of address of r
|
|
||||||
lol -22
|
|
||||||
lol -226
|
|
||||||
stf 10 ; r3 := b
|
|
||||||
lal -20
|
|
||||||
loi 16
|
|
||||||
adf 8
|
|
||||||
lol -226
|
|
||||||
adp 2
|
|
||||||
sti 8 ; r2 := x + y
|
|
||||||
loc 0
|
|
||||||
sil -226 ; r1 := 0
|
|
||||||
lin 34 ; note the abscence of the unnecesary jump
|
|
||||||
lae 22 ; address of output structure
|
|
||||||
lol -4
|
|
||||||
cal $_wri ; write integer with default width
|
|
||||||
asp 4 ; pop parameters
|
|
||||||
lae 22
|
|
||||||
lol -2
|
|
||||||
loc 6
|
|
||||||
cal $_wsi ; write integer width 6
|
|
||||||
asp 6
|
|
||||||
lae 22
|
|
||||||
lal -12
|
|
||||||
loi 8
|
|
||||||
loc 9
|
|
||||||
loc 3
|
|
||||||
cal $_wrf ; write fixed format real, width 9, precision 3
|
|
||||||
asp 14
|
|
||||||
lae 22
|
|
||||||
lol -22
|
|
||||||
cal $_wrb ; write boolean, default width
|
|
||||||
asp 4
|
|
||||||
lae 22
|
|
||||||
cal $_wln ; writeln
|
|
||||||
asp 2
|
|
||||||
ret 0 ; return, no result
|
|
||||||
end 226
|
|
||||||
exp $_main
|
|
||||||
pro $_main,0 ; main program
|
|
||||||
.6
|
|
||||||
con 2,-1,22 ; description of external files
|
|
||||||
.5
|
|
||||||
rom 15.96F8
|
|
||||||
fil .1 ; maintain source file name
|
|
||||||
lae .6 ; description of external files
|
|
||||||
lae 0 ; base of hol area to relocate buffer addresses
|
|
||||||
cal $_ini ; initialize files, etc...
|
|
||||||
asp 4
|
|
||||||
lin 37
|
|
||||||
lae .5
|
|
||||||
loi 8
|
|
||||||
lae 2
|
|
||||||
sti 8 ; mx := 15.96
|
|
||||||
lni ; lin 38 prior to optimization
|
|
||||||
loc 99
|
|
||||||
ste 0 ; mi := 99
|
|
||||||
lni ; lin 39 prior to optimization
|
|
||||||
lae 10 ; address of r
|
|
||||||
cal $test
|
|
||||||
asp 2
|
|
||||||
loc 0 ; normal exit
|
|
||||||
cal $_hlt ; cleanup and finish
|
|
||||||
asp 2
|
|
||||||
end 0
|
|
||||||
mes 5 ; reals were used
|
|
||||||
.DE 0
|
|
||||||
The compact code corresponding to the above program is listed below.
|
|
||||||
Read it horizontally, line by line, not column by column.
|
|
||||||
Each number represents a byte of compact code, printed in decimal.
|
|
||||||
The first two bytes form the magic word.
|
|
||||||
.N 1
|
|
||||||
.IS 3
|
|
||||||
.DS B
|
|
||||||
173 0 159 122 122 122 255 242 1 161 250 124 116 46 112 0
|
|
||||||
255 156 245 40 2 245 0 128 120 155 249 123 115 117 109 160
|
|
||||||
249 123 115 117 109 122 67 128 63 120 3 122 88 122 152 122
|
|
||||||
242 2 161 121 219 122 255 155 249 124 116 101 115 116 160 249
|
|
||||||
124 116 101 115 116 245 226 0 242 3 161 253 128 123 52 46
|
|
||||||
56 255 242 4 161 253 128 123 48 46 53 255 159 123 245 30
|
|
||||||
255 122 122 255 159 123 96 122 120 255 159 123 98 122 120 255
|
|
||||||
159 123 116 122 120 255 159 123 118 122 120 255 159 123 100 128
|
|
||||||
120 255 159 123 108 128 120 255 67 140 69 121 113 116 68 73
|
|
||||||
116 69 123 81 122 69 126 3 122 113 118 68 57 242 3 72
|
|
||||||
128 58 108 112 128 68 58 108 72 128 57 242 4 72 128 44
|
|
||||||
128 58 100 112 128 68 69 121 113 98 68 69 245 122 0 113
|
|
||||||
96 68 69 121 113 118 182 73 118 42 122 81 122 58 245 32
|
|
||||||
255 73 118 57 242 2 94 122 73 118 69 220 10 123 54 118
|
|
||||||
18 122 183 67 147 73 116 69 147 3 122 104 120 68 73 98
|
|
||||||
73 120 111 130 68 58 100 72 136 2 128 73 120 4 122 112
|
|
||||||
128 68 58 245 32 255 73 116 57 242 2 59 122 65 120 20
|
|
||||||
249 123 115 117 109 8 124 64 122 113 118 184 67 151 73 118
|
|
||||||
128 125 73 116 65 120 3 122 113 116 41 118 18 124 185 67
|
|
||||||
152 73 120 113 245 30 255 73 98 73 245 30 255 111 130 58
|
|
||||||
100 72 136 2 128 73 245 30 255 4 122 112 128 69 120 104
|
|
||||||
245 30 255 67 154 57 142 73 116 20 249 124 95 119 114 105
|
|
||||||
8 124 57 142 73 118 69 126 20 249 124 95 119 115 105 8
|
|
||||||
126 57 142 58 108 72 128 69 129 69 123 20 249 124 95 119
|
|
||||||
114 102 8 134 57 142 73 98 20 249 124 95 119 114 98 8
|
|
||||||
124 57 142 20 249 124 95 119 108 110 8 122 88 120 152 245
|
|
||||||
226 0 155 249 125 95 109 97 105 110 160 249 125 95 109 97
|
|
||||||
105 110 120 242 6 151 122 119 142 255 242 5 161 253 128 125
|
|
||||||
49 53 46 57 54 255 50 242 1 57 242 6 57 120 20 249
|
|
||||||
124 95 105 110 105 8 124 67 157 57 242 5 72 128 57 122
|
|
||||||
112 128 68 69 219 110 120 68 57 130 20 249 124 116 101 115
|
|
||||||
116 8 122 69 120 20 249 124 95 104 108 116 8 122 152 120
|
|
||||||
159 124 160 255 159 125 255
|
|
||||||
.DE 0
|
|
||||||
.IE
|
|
||||||
.MS T A 0
|
|
||||||
.ME
|
|
||||||
.BP
|
|
||||||
.MS B A 0
|
|
||||||
.ME
|
|
||||||
.CT
|
|
||||||
756
doc/em/assem.nr
756
doc/em/assem.nr
@@ -1,756 +0,0 @@
|
|||||||
.BP
|
|
||||||
.SN 11
|
|
||||||
.S1 "EM ASSEMBLY LANGUAGE"
|
|
||||||
We use two representations for assembly language programs,
|
|
||||||
one is in ASCII and the other is the compact assembly language.
|
|
||||||
The latter needs less space than the first for the same program
|
|
||||||
and therefore allows faster processing.
|
|
||||||
Our only program accepting ASCII assembly
|
|
||||||
language converts it to the compact form.
|
|
||||||
All other programs expect compact assembly input.
|
|
||||||
The first part of the chapter describes the ASCII assembly
|
|
||||||
language and its semantics.
|
|
||||||
The second part describes the syntax of the compact assembly
|
|
||||||
language.
|
|
||||||
The last part lists the EM instructions with the type of
|
|
||||||
arguments allowed and an indication of the function.
|
|
||||||
Appendix A gives a detailed description of the effect of all
|
|
||||||
instructions in the form of a Pascal program.
|
|
||||||
.S2 "ASCII assembly language"
|
|
||||||
An assembly language program consists of a series of lines, each
|
|
||||||
line may be blank, contain one (pseudo)instruction or contain one
|
|
||||||
label.
|
|
||||||
Input to the assembler is in lower case.
|
|
||||||
Upper case is used in this
|
|
||||||
document merely to distinguish keywords from the surrounding prose.
|
|
||||||
Comment is allowed at the end of each line and starts with a semicolon ";".
|
|
||||||
This kind of comment does not exist in the compact form.
|
|
||||||
.A
|
|
||||||
Labels must be placed all by themselves on a line and start in
|
|
||||||
column 1.
|
|
||||||
There are two kinds of labels, instruction and data labels.
|
|
||||||
Instruction labels are unsigned positive integers.
|
|
||||||
The scope of an instruction label is its procedure.
|
|
||||||
.A
|
|
||||||
The pseudoinstructions CON, ROM and BSS may be preceded by a
|
|
||||||
line containing a
|
|
||||||
1-8 character data label, the first character of which is a
|
|
||||||
letter, period or underscore.
|
|
||||||
The period may only be followed by
|
|
||||||
digits, the others may be followed by letters, digits and underscores.
|
|
||||||
The use of the character "." followed by a constant,
|
|
||||||
which must be in the range 1 to 32767 (e.g. ".40") is recommended
|
|
||||||
for compiler
|
|
||||||
generated programs.
|
|
||||||
These labels are considered as a special case and handled
|
|
||||||
more efficiently in compact assembly language (see below).
|
|
||||||
Note that a data label on its own or two consecutive labels are not
|
|
||||||
allowed.
|
|
||||||
.P
|
|
||||||
Each statement may contain an instruction mnemonic or pseudoinstruction.
|
|
||||||
These must begin in column 2 or later (not column 1) and must be followed
|
|
||||||
by a space, tab, semicolon or LF.
|
|
||||||
Everything on the line following a semicolon is
|
|
||||||
taken as a comment.
|
|
||||||
.P
|
|
||||||
Each input file contains one module.
|
|
||||||
A module may contain many procedures,
|
|
||||||
which may be nested.
|
|
||||||
A procedure consists of
|
|
||||||
a PRO statement, a (possibly empty)
|
|
||||||
collection of instructions and pseudoinstructions and finally an END
|
|
||||||
statement.
|
|
||||||
Pseudoinstructions are also allowed between procedures.
|
|
||||||
They do not belong to a specific procedure.
|
|
||||||
.P
|
|
||||||
All constants in EM are interpreted in the decimal base.
|
|
||||||
The ASCII assembly language accepts constant expressions
|
|
||||||
wherever constants are allowed.
|
|
||||||
The operators recognized are: +, -, *, % and / with the usual
|
|
||||||
precedence order.
|
|
||||||
Use of the parentheses ( and ) to alter the precedence order is allowed.
|
|
||||||
.S3 "Instruction arguments"
|
|
||||||
Unlike many other assembly languages, the EM assembly
|
|
||||||
language requires all arguments of normal and pseudoinstructions
|
|
||||||
to be either a constant or an identifier, but not a combination
|
|
||||||
of these two.
|
|
||||||
There is one exception to this rule: when a data label is used
|
|
||||||
for initialization or as an instruction argument,
|
|
||||||
expressions of the form 'label+constant' and 'label-constant'
|
|
||||||
are allowed.
|
|
||||||
This makes it possible to address, for example, the
|
|
||||||
third word of a ten word BSS block
|
|
||||||
directly.
|
|
||||||
Thus LOE LABEL+4 is permitted and so is CON LABEL+3.
|
|
||||||
The resulting address is must be in the same fragment as the label.
|
|
||||||
It is not allowed to add or subtract from instruction labels or procedure
|
|
||||||
identifiers,
|
|
||||||
which certainly is not a severe restriction and greatly aids
|
|
||||||
optimization.
|
|
||||||
.P
|
|
||||||
Instruction arguments can be constants,
|
|
||||||
data labels, data labels offsetted by a constant, instruction
|
|
||||||
labels and procedure identifiers.
|
|
||||||
The range of integers allowed depends on the instruction.
|
|
||||||
Most instructions allow only integers
|
|
||||||
(signed or unsigned)
|
|
||||||
that fit in a word.
|
|
||||||
Arguments used as offsets to pointers should fit in a
|
|
||||||
pointer-sized integer.
|
|
||||||
Finally, arguments to LDC should fit in a double-word integer.
|
|
||||||
.P
|
|
||||||
Several instructions have two possible forms:
|
|
||||||
with an explicit argument and with an implicit argument on top of the stack.
|
|
||||||
The size of the implicit argument is the wordsize.
|
|
||||||
The implicit argument is always popped before all other operands.
|
|
||||||
For example: 'CMI 4' specifies that two four-byte signed
|
|
||||||
integers on top of the stack are to be compared.
|
|
||||||
\&'CMI' without an argument expects a wordsized integer
|
|
||||||
on top of the stack that specifies the size of the integers to
|
|
||||||
be compared.
|
|
||||||
Thus the following two sequences are equivalent:
|
|
||||||
.N 2
|
|
||||||
.TS
|
|
||||||
center, tab(:) ;
|
|
||||||
l r 30 l r.
|
|
||||||
LDL:-10:LDL:-10
|
|
||||||
LDL:-14:LDL:-14
|
|
||||||
::LOC:4
|
|
||||||
CMI:4:CMI:
|
|
||||||
ZEQ:*1:ZEQ:*1
|
|
||||||
.TE 2
|
|
||||||
Section 11.1.6 shows the arguments allowed for each instruction.
|
|
||||||
.S3 "Pseudoinstruction arguments"
|
|
||||||
Pseudoinstruction arguments can be divided in two classes:
|
|
||||||
Initializers and others.
|
|
||||||
The following initializers are allowed: signed integer constants,
|
|
||||||
unsigned integer constants, floating-point constants, strings,
|
|
||||||
data labels, data labels offsetted by a constant, instruction
|
|
||||||
labels and procedure identifiers.
|
|
||||||
.P
|
|
||||||
Constant initializers in BSS, HOL, CON and ROM pseudoinstructions
|
|
||||||
can be followed by a letter I, U or F.
|
|
||||||
This indicator
|
|
||||||
specifies the type of the initializer: Integer, Unsigned or Float.
|
|
||||||
If no indicator is present I is assumed.
|
|
||||||
The size of the object is the wordsize unless
|
|
||||||
the indicator is followed by an integer specifying the
|
|
||||||
object's size.
|
|
||||||
This integer is governed by the same restrictions as for
|
|
||||||
transfer of objects to/from memory.
|
|
||||||
As in instruction arguments, initializers include expressions of the form:
|
|
||||||
\&"LABEL+offset" and "LABEL-offset".
|
|
||||||
The offset must be an unsigned decimal constant.
|
|
||||||
The 'IUF' indicators cannot be used in the offsets.
|
|
||||||
.P
|
|
||||||
Data labels are referred to by their name.
|
|
||||||
.P
|
|
||||||
Strings are surrounded by double quotes (").
|
|
||||||
Semecolon's in string do not indicate the start of comment.
|
|
||||||
In the ASCII representation the escape character \e (backslash)
|
|
||||||
alters the meaning of subsequent character(s).
|
|
||||||
This feature allows inclusion of zeroes, graphic characters and
|
|
||||||
the double quote in the string.
|
|
||||||
The following escape sequences exist:
|
|
||||||
.DS
|
|
||||||
.TS
|
|
||||||
center, tab(:);
|
|
||||||
l l l.
|
|
||||||
newline:NL\|(LF):\en
|
|
||||||
horizontal tab:HT:\et
|
|
||||||
backspace:BS:\eb
|
|
||||||
carriage return:CR:\er
|
|
||||||
form feed:FF:\ef
|
|
||||||
backslash:\e:\e\e
|
|
||||||
double quote:":\e"
|
|
||||||
bit pattern:\fBddd\fP:\e\fBddd\fP
|
|
||||||
.TE
|
|
||||||
.DE
|
|
||||||
The escape \fBddd\fP consists of the backslash followed by 1,
|
|
||||||
2, or 3 octal digits specifing the value of
|
|
||||||
the desired character.
|
|
||||||
If the character following a backslash is not one of those
|
|
||||||
specified,
|
|
||||||
the backslash is ignored.
|
|
||||||
Example: CON "hello\e012\e0".
|
|
||||||
Each string element initializes a single byte.
|
|
||||||
The ASCII character set is used to map characters onto values.
|
|
||||||
Strings are padded with zeroes up to a multiple of the wordsize.
|
|
||||||
.P
|
|
||||||
Instruction labels are referred to as *1, *2, etc. in both branch
|
|
||||||
instructions and as initializers.
|
|
||||||
.P
|
|
||||||
The notation $procname means the identifier for the procedure
|
|
||||||
with the specified name.
|
|
||||||
This identifier has the size of a pointer.
|
|
||||||
.S3 Notation
|
|
||||||
First, the notation used for the arguments, classes of
|
|
||||||
instructions and pseudoinstructions.
|
|
||||||
.IS 2
|
|
||||||
.TS
|
|
||||||
tab(:);
|
|
||||||
l l l.
|
|
||||||
<cst>:\&=:integer constant (current range -2**31..2**31-1)
|
|
||||||
<dlb>:\&=:data label
|
|
||||||
<arg>:\&=:<cst> or <dlb> or <dlb>+<cst> or <dlb>-<cst>
|
|
||||||
<con>:\&=:integer constant, unsigned constant, floating-point constant
|
|
||||||
<str>:\&=:string constant (surrounded by double quotes),
|
|
||||||
<ilb>:\&=:instruction label
|
|
||||||
::'*' followed by an integer in the range 0..32767.
|
|
||||||
<pro>:\&=:procedure number ('$' followed by a procedure name)
|
|
||||||
<val>:\&=:<arg>, <con>, <pro> or <ilb>.
|
|
||||||
<par>:\&=:<val> or <str>
|
|
||||||
<...>*:\&=:zero or more of <...>
|
|
||||||
<...>+:\&=:one or more of <...>
|
|
||||||
[...]:\&=:optional ...
|
|
||||||
.TE
|
|
||||||
.IE
|
|
||||||
.S3 "Pseudoinstructions"
|
|
||||||
.S4 Storage declaration
|
|
||||||
Initialized global data is allocated by the pseudoinstruction CON,
|
|
||||||
which needs at least one argument.
|
|
||||||
For each argument, an integral number of words,
|
|
||||||
determined by the argument type, is allocated and initialized.
|
|
||||||
.P
|
|
||||||
The pseudoinstruction ROM is the same as CON,
|
|
||||||
except that it guarantees that the initialized words
|
|
||||||
will not change during the execution of the program.
|
|
||||||
This information allows optimizers to do
|
|
||||||
certain calculations such as array indexing and
|
|
||||||
subrange checking at compile time instead
|
|
||||||
of at run time.
|
|
||||||
.P
|
|
||||||
The pseudoinstruction BSS allocates
|
|
||||||
uninitialized global data or large blocks of data initialized
|
|
||||||
by the same value.
|
|
||||||
The first argument to this pseudo is the number
|
|
||||||
of bytes required, which must be a multiple of the wordsize.
|
|
||||||
The other arguments specify the value used for initialization and
|
|
||||||
whether the initialization is only for convenience or a strict necessity.
|
|
||||||
The pseudoinstruction HOL is similar to BSS in that it requests an
|
|
||||||
(un)initialized global data block.
|
|
||||||
Addressing of a HOL block, however, is quasi absolute.
|
|
||||||
The first byte is addressed by 0,
|
|
||||||
the second byte by 1 etc. in assembly language.
|
|
||||||
The assembler/loader adds the base address of
|
|
||||||
the HOL block to these numbers to obtain the
|
|
||||||
absolute address in the machine language.
|
|
||||||
.P
|
|
||||||
The scope of a HOL block starts at the HOL pseudo and
|
|
||||||
ends at the next HOL pseudo or at the end of a module
|
|
||||||
whatever comes first.
|
|
||||||
Each instruction falls in the scope of at most one
|
|
||||||
HOL block, the current HOL block.
|
|
||||||
It is not allowed to have more than one HOL block per procedure.
|
|
||||||
.P
|
|
||||||
The alignment restrictions are enforced by the
|
|
||||||
pseudoinstructions.
|
|
||||||
All objects are aligned on a multiple of their size or the wordsize
|
|
||||||
whichever is smaller.
|
|
||||||
Switching to another type of fragment or placing a label forces
|
|
||||||
word-alignment.
|
|
||||||
There are three types of fragments in global data space: CON, ROM and
|
|
||||||
BSS/HOL.
|
|
||||||
.N 2
|
|
||||||
.IS 2
|
|
||||||
.PS - 4
|
|
||||||
.PT "BSS <cst1>,<val>,<cst2>"
|
|
||||||
Reserve <cst1> bytes.
|
|
||||||
<val> is the value used to initialize the area.
|
|
||||||
<cst1> must be a multiple of the size of <val>.
|
|
||||||
<cst2> is 0 if the initialization is not strictly necessary,
|
|
||||||
1 if it is.
|
|
||||||
.PT "HOL <cst1>,<val>,<cst2>"
|
|
||||||
Idem, but all following absolute global data references will
|
|
||||||
refer to this block.
|
|
||||||
Only one HOL is allowed per procedure,
|
|
||||||
it has to be placed before the first instruction.
|
|
||||||
.PT "CON <val>+"
|
|
||||||
Assemble global data words initialized with the <val> constants.
|
|
||||||
.PT "ROM <val>+"
|
|
||||||
Idem, but the initialized data will never be changed by the program.
|
|
||||||
.PE
|
|
||||||
.IE
|
|
||||||
.S4 Partitioning
|
|
||||||
Two pseudoinstructions partition the input into procedures:
|
|
||||||
.IS 2
|
|
||||||
.PS - 4
|
|
||||||
.PT "PRO <pro>[,<cst>]"
|
|
||||||
Start of procedure.
|
|
||||||
<pro> is the procedure name.
|
|
||||||
<cst> is the number of bytes for locals.
|
|
||||||
The number of bytes for locals must be specified in the PRO or
|
|
||||||
END pseudoinstruction.
|
|
||||||
When specified in both, they must be identical.
|
|
||||||
.PT "END [<cst>]"
|
|
||||||
End of Procedure.
|
|
||||||
<cst> is the number of bytes for locals.
|
|
||||||
The number of bytes for locals must be specified in either the PRO or
|
|
||||||
END pseudoinstruction or both.
|
|
||||||
.PE
|
|
||||||
.IE
|
|
||||||
.S4 Visibility
|
|
||||||
Names of data and procedures in an EM module can either be
|
|
||||||
internal or external.
|
|
||||||
External names are known outside the module and are used to link
|
|
||||||
several pieces of a program.
|
|
||||||
Internal names are not known outside the modules they are used in.
|
|
||||||
Other modules will not 'see' an internal name.
|
|
||||||
.A
|
|
||||||
To reduce the number of passes needed,
|
|
||||||
it must be known at the first occurrence whether
|
|
||||||
a name is internal or external.
|
|
||||||
If the first occurrence of a name is in a definition,
|
|
||||||
the name is considered to be internal.
|
|
||||||
If the first occurrence of a name is a reference,
|
|
||||||
the name is considered to be external.
|
|
||||||
If the first occurrence is in one of the following pseudoinstructions,
|
|
||||||
the effect of the pseudo has precedence.
|
|
||||||
.IS 2
|
|
||||||
.PS - 4
|
|
||||||
.PT "EXA <dlb>"
|
|
||||||
External name.
|
|
||||||
<dlb> is known, possibly defined, outside this module.
|
|
||||||
Note that <dlb> may be defined in the same module.
|
|
||||||
.PT "EXP <pro>"
|
|
||||||
External procedure identifier.
|
|
||||||
Note that <pro> may be defined in the same module.
|
|
||||||
.PT "INA <dlb>"
|
|
||||||
Internal name.
|
|
||||||
<dlb> is internal to this module and must be defined in this module.
|
|
||||||
.PT "INP <pro>"
|
|
||||||
Internal procedure.
|
|
||||||
<pro> is internal to this module and must be defined in this module.
|
|
||||||
.PE
|
|
||||||
.IE
|
|
||||||
.S4 Miscellaneous
|
|
||||||
Two other pseudoinstructions provide miscellaneous features:
|
|
||||||
.IS 2
|
|
||||||
.PS - 4
|
|
||||||
.PT "EXC <cst1>,<cst2>"
|
|
||||||
Two blocks of instructions preceding this one are
|
|
||||||
interchanged before being processed.
|
|
||||||
<cst1> gives the number of lines of the first block.
|
|
||||||
<cst2> gives the number of lines of the second one.
|
|
||||||
Blank and pure comment lines do not count.
|
|
||||||
.PT "MES <cst>[,<par>]*"
|
|
||||||
A special type of comment.
|
|
||||||
Used by compilers to communicate with the
|
|
||||||
optimizer, assembler, etc. as follows:
|
|
||||||
.VS 1 0
|
|
||||||
.PS - 4
|
|
||||||
.PT "MES 0"
|
|
||||||
An error has occurred, stop further processing.
|
|
||||||
.PT "MES 1"
|
|
||||||
Suppress optimization.
|
|
||||||
.PT "MES 2,<cst1>,<cst2>"
|
|
||||||
Use wordsize <cst1> and pointer size <cst2>.
|
|
||||||
.PT "MES 3,<cst1>,<cst2>,<cst3>,<cst4>"
|
|
||||||
Indicates that a local variable is never referenced indirectly.
|
|
||||||
Used to indicate that a register may be used for a specific
|
|
||||||
variable.
|
|
||||||
<cst1> is offset in bytes from AB if positive
|
|
||||||
and offset from LB if negative.
|
|
||||||
<cst2> gives the size of the variable.
|
|
||||||
<cst3> indicates the class of the variable.
|
|
||||||
The following values are currently recognized:
|
|
||||||
.PS
|
|
||||||
.PT 0
|
|
||||||
The variable can be used for anything.
|
|
||||||
.PT 1
|
|
||||||
The variable is used as a loopindex.
|
|
||||||
.PT 2
|
|
||||||
The variable is used as a pointer.
|
|
||||||
.PT 3
|
|
||||||
The variable is used as a floating point number.
|
|
||||||
.PE 0
|
|
||||||
<cst4> gives the priority of the variable,
|
|
||||||
higher numbers indicate better candidates.
|
|
||||||
.PT "MES 4,<cst>,<str>"
|
|
||||||
Number of source lines in file <str> (for profiler).
|
|
||||||
.PT "MES 5"
|
|
||||||
Floating point used.
|
|
||||||
.PT "MES 6,<val>*"
|
|
||||||
Comment. Used to provide comments in compact assembly language.
|
|
||||||
.PT "MES 7,....."
|
|
||||||
Reserved.
|
|
||||||
.PT "MES 8,<pro>[,<dlb>]..."
|
|
||||||
Library module. Indicates that the module may only be loaded
|
|
||||||
if it is useful, that is, if it can satisfy any unresolved
|
|
||||||
references during the loading process.
|
|
||||||
May not be preceded by any other pseudo, except MES's.
|
|
||||||
.PT "MES 9,<cst>"
|
|
||||||
Guarantees that no more than <cst> bytes of parameters are
|
|
||||||
accessed, either directly or indirectly.
|
|
||||||
.PE 1
|
|
||||||
.VS 1 1
|
|
||||||
Each backend is free to skip irrelevant MES pseudos.
|
|
||||||
.PE
|
|
||||||
.IE
|
|
||||||
.S2 "The Compact Assembly Language"
|
|
||||||
The assembler accepts input in a highly encoded form.
|
|
||||||
This
|
|
||||||
form is intended to reduce the amount of file transport between the
|
|
||||||
front ends, optimizers
|
|
||||||
and back ends, and also reduces the amount of storage required for storing
|
|
||||||
libraries.
|
|
||||||
Libraries are stored as archived compact assembly language, not machine
|
|
||||||
language.
|
|
||||||
.P
|
|
||||||
When beginning to read the input, the assembler is in neutral state, and
|
|
||||||
expects either a label or an instruction (including the pseudoinstructions).
|
|
||||||
The meaning of the next byte(s) when in neutral state is as follows, where
|
|
||||||
b1, b2
|
|
||||||
etc. represent the succeeding bytes.
|
|
||||||
.N 1
|
|
||||||
.DS
|
|
||||||
.TS
|
|
||||||
tab(:) ;
|
|
||||||
rw17 4 l.
|
|
||||||
0:Reserved for future use
|
|
||||||
1-129:Machine instructions, see Appendix A, alphabetical list
|
|
||||||
130-149:Reserved for future use
|
|
||||||
150-161:BSS,CON,END,EXA,EXC,EXP,HOL,INA,INP,MES,PRO,ROM
|
|
||||||
162-179:Reserved for future pseudoinstructions
|
|
||||||
180-239:Instruction labels 0 - 59 (180 is local label 0 etc.)
|
|
||||||
240-244:See the Common Table below
|
|
||||||
245-255:Not used
|
|
||||||
.TE 1
|
|
||||||
.DE 0
|
|
||||||
After a label, the assembler is back in neutral state; it can immediately
|
|
||||||
accept another label or an instruction in the next byte.
|
|
||||||
No linefeeds are used to separate lines.
|
|
||||||
.P
|
|
||||||
If an opcode expects no arguments,
|
|
||||||
the assembler is back in neutral state after
|
|
||||||
reading the one byte containing the instruction number.
|
|
||||||
If it has one or
|
|
||||||
more arguments (only pseudos have more than 1), the arguments follow directly,
|
|
||||||
encoded as follows:
|
|
||||||
.N 1
|
|
||||||
.IS 2
|
|
||||||
.TS
|
|
||||||
tab(:);
|
|
||||||
r l.
|
|
||||||
0-239:Offsets from -120 to 119
|
|
||||||
|
|
||||||
240-255:See the Common Table below
|
|
||||||
.TE 1
|
|
||||||
Absence of an optional argument is indicated by a special
|
|
||||||
byte.
|
|
||||||
.IE 2
|
|
||||||
.CS
|
|
||||||
Common Table for Neutral State and Arguments
|
|
||||||
.CE
|
|
||||||
.TS
|
|
||||||
tab(:);
|
|
||||||
c c s c
|
|
||||||
l8 l l8 l.
|
|
||||||
class:bytes:description
|
|
||||||
|
|
||||||
<ilb>:240:b1:Instruction label b1 (Not used for branches)
|
|
||||||
<ilb>:241:b1 b2:16 bit instruction label (256*b2 + b1)
|
|
||||||
<dlb>:242:b1:Global label .0-.255, with b1 being the label
|
|
||||||
<dlb>:243:b1 b2:Global label .0-.32767
|
|
||||||
:::with 256*b2+b1 being the label
|
|
||||||
<dlb>:244:<string>:Global symbol not of the form .nnn
|
|
||||||
<cst>:245:b1 b2:16 bit constant
|
|
||||||
<cst>:246:b1 b2 b3 b4:32 bit constant
|
|
||||||
<cst>:247:b1 .. b8:64 bit constant
|
|
||||||
<arg>:248:<dlb><cst>:Global label + (possibly negative) constant
|
|
||||||
<pro>:249:<string>:Procedure name (not including $)
|
|
||||||
<str>:250:<string>:String used in CON or ROM (no quotes-no escapes)
|
|
||||||
<con>:251:<cst><string>:Integer constant, size <cst> bytes
|
|
||||||
<con>:252:<cst><string>:Unsigned constant, size <cst> bytes
|
|
||||||
<con>:253:<cst><string>:Floating constant, size <cst> bytes
|
|
||||||
:254::unused
|
|
||||||
<end>:255::Delimiter for argument lists or
|
|
||||||
:::indicates absence of optional argument
|
|
||||||
.TE 1
|
|
||||||
.P
|
|
||||||
The bytes specifying the value of a 16, 32 or 64 bit constant
|
|
||||||
are presented in two's complement notation, with the least
|
|
||||||
significant byte first. For example: the value of a 32 bit
|
|
||||||
constant is ((s4*256+b3)*256+b2)*256+b1, where s4 is b4-256 if
|
|
||||||
b4 is greater than 128 else s4 takes the value of b4.
|
|
||||||
A <string> consists of a <cst> inmediatly followed by
|
|
||||||
a sequence of bytes with length <cst>.
|
|
||||||
.P
|
|
||||||
.ne 8
|
|
||||||
The pseudoinstructions fall into several categories, depending on their
|
|
||||||
arguments:
|
|
||||||
.N 1
|
|
||||||
.DS
|
|
||||||
Group 1 -- EXC, BSS, HOL have a known number of arguments
|
|
||||||
Group 2 -- EXA, EXP, INA, INP have a string as argument
|
|
||||||
Group 3 -- CON, MES, ROM have a variable number of various things
|
|
||||||
Group 4 -- END, PRO have a trailing optional argument.
|
|
||||||
.DE 1
|
|
||||||
Groups 1 and 2
|
|
||||||
use the encoding described above.
|
|
||||||
Group 3 also uses the encoding listed above, with an <end> byte after the
|
|
||||||
last argument to indicate the end of the list.
|
|
||||||
Group 4 uses
|
|
||||||
an <end> byte if the trailing argument is not present.
|
|
||||||
.N 2
|
|
||||||
.IS 2
|
|
||||||
.TS
|
|
||||||
tab(|);
|
|
||||||
l s l
|
|
||||||
l s s
|
|
||||||
l 2 lw(46) l.
|
|
||||||
Example ASCII|Example compact
|
|
||||||
(LOC = 69, BRA = 18 here):
|
|
||||||
|
|
||||||
2||182
|
|
||||||
1||181
|
|
||||||
LOC|10|69 130
|
|
||||||
LOC|-10|69 110
|
|
||||||
LOC|300|69 245 44 1
|
|
||||||
BRA|*19|18 139
|
|
||||||
300||241 44 1
|
|
||||||
.3||242 3
|
|
||||||
CON|4,9,*2,$foo|151 124 129 240 2 249 123 102 111 111 255
|
|
||||||
CON|.35|151 242 35 255
|
|
||||||
.TE 0
|
|
||||||
.IE 0
|
|
||||||
.BP
|
|
||||||
.S2 "Assembly language instruction list"
|
|
||||||
.P
|
|
||||||
For each instruction in the list the range of argument values
|
|
||||||
in the assembly language is given.
|
|
||||||
The column headed \fIassem\fP contains the mnemonics defined
|
|
||||||
in 11.1.3.
|
|
||||||
The following column specifies restrictions of the argument
|
|
||||||
value.
|
|
||||||
Addresses have to obey the restrictions mentioned in chapter 2.
|
|
||||||
The classes of arguments
|
|
||||||
are indicated by letters:
|
|
||||||
.ds b \fBb\fP
|
|
||||||
.ds c \fBc\fP
|
|
||||||
.ds d \fBd\fP
|
|
||||||
.ds g \fBg\fP
|
|
||||||
.ds f \fBf\fP
|
|
||||||
.ds l \fBl\fP
|
|
||||||
.ds n \fBn\fP
|
|
||||||
.ds w \fBw\fP
|
|
||||||
.ds p \fBp\fP
|
|
||||||
.ds r \fBr\fP
|
|
||||||
.ds s \fBs\fP
|
|
||||||
.ds z \fBz\fP
|
|
||||||
.ds o \fBo\fP
|
|
||||||
.ds - \fB-\fP
|
|
||||||
.N 1
|
|
||||||
.TS
|
|
||||||
tab(:);
|
|
||||||
c s l l
|
|
||||||
l l 15 l l.
|
|
||||||
\fIassem\fP:constraints:rationale
|
|
||||||
|
|
||||||
\&\*c:cst:fits word:constant
|
|
||||||
\&\*d:cst:fits double word:constant
|
|
||||||
\&\*l:cst::local offset
|
|
||||||
\&\*g:arg:>= 0:global offset
|
|
||||||
\&\*f:cst::fragment offset
|
|
||||||
\&\*n:cst:>= 0:counter
|
|
||||||
\&\*s:cst:>0 , word multiple:object size
|
|
||||||
\&\*z:cst:>= 0 , zero or word multiple:object size
|
|
||||||
\&\*o:cst:>= 0 , word multiple or fraction:object size
|
|
||||||
\&\*w:cst:> 0 , word multiple:object size *
|
|
||||||
\&\*p:pro::pro identifier
|
|
||||||
\&\*b:ilb:>= 0:label number
|
|
||||||
\&\*r:cst:0,1,2:register number
|
|
||||||
\&\*-:::no argument
|
|
||||||
.TE 1
|
|
||||||
.P
|
|
||||||
The * at the rationale for \*w indicates that the argument
|
|
||||||
can either be given as argument or on top of the stack.
|
|
||||||
If the argument is omitted, the argument is fetched from the
|
|
||||||
stack;
|
|
||||||
it is assumed to be a wordsized unsigned integer.
|
|
||||||
Instructions that check for undefined integer or floating-point
|
|
||||||
values and underflow or overflow
|
|
||||||
are indicated below by (*).
|
|
||||||
.N 1
|
|
||||||
.DS B
|
|
||||||
GROUP 1 - LOAD
|
|
||||||
|
|
||||||
LOC \*c : Load constant (i.e. push one word onto the stack)
|
|
||||||
LDC \*d : Load double constant ( push two words )
|
|
||||||
LOL \*l : Load word at \*l-th local (\*l<0) or parameter (\*l>=0)
|
|
||||||
LOE \*g : Load external word \*g
|
|
||||||
LIL \*l : Load word pointed to by \*l-th local or parameter
|
|
||||||
LOF \*f : Load offsetted (top of stack + \*f yield address)
|
|
||||||
LAL \*l : Load address of local or parameter
|
|
||||||
LAE \*g : Load address of external
|
|
||||||
LXL \*n : Load lexical (address of LB \*n static levels back)
|
|
||||||
LXA \*n : Load lexical (address of AB \*n static levels back)
|
|
||||||
LOI \*o : Load indirect \*o bytes (address is popped from the stack)
|
|
||||||
LOS \*w : Load indirect, \*w-byte integer on top of stack gives object size
|
|
||||||
LDL \*l : Load double local or parameter (two consecutive words are stacked)
|
|
||||||
LDE \*g : Load double external (two consecutive externals are stacked)
|
|
||||||
LDF \*f : Load double offsetted (top of stack + \*f yield address)
|
|
||||||
LPI \*p : Load procedure identifier
|
|
||||||
|
|
||||||
GROUP 2 - STORE
|
|
||||||
|
|
||||||
STL \*l : Store local or parameter
|
|
||||||
STE \*g : Store external
|
|
||||||
SIL \*l : Store into word pointed to by \*l-th local or parameter
|
|
||||||
STF \*f : Store offsetted
|
|
||||||
STI \*o : Store indirect \*o bytes (pop address, then data)
|
|
||||||
STS \*w : Store indirect, \*w-byte integer on top of stack gives object size
|
|
||||||
SDL \*l : Store double local or parameter
|
|
||||||
SDE \*g : Store double external
|
|
||||||
SDF \*f : Store double offsetted
|
|
||||||
|
|
||||||
GROUP 3 - INTEGER ARITHMETIC
|
|
||||||
|
|
||||||
ADI \*w : Addition (*)
|
|
||||||
SBI \*w : Subtraction (*)
|
|
||||||
MLI \*w : Multiplication (*)
|
|
||||||
DVI \*w : Division (*)
|
|
||||||
RMI \*w : Remainder (*)
|
|
||||||
NGI \*w : Negate (two's complement) (*)
|
|
||||||
SLI \*w : Shift left (*)
|
|
||||||
SRI \*w : Shift right (*)
|
|
||||||
|
|
||||||
GROUP 4 - UNSIGNED ARITHMETIC
|
|
||||||
|
|
||||||
ADU \*w : Addition
|
|
||||||
SBU \*w : Subtraction
|
|
||||||
MLU \*w : Multiplication
|
|
||||||
DVU \*w : Division
|
|
||||||
RMU \*w : Remainder
|
|
||||||
SLU \*w : Shift left
|
|
||||||
SRU \*w : Shift right
|
|
||||||
|
|
||||||
GROUP 5 - FLOATING POINT ARITHMETIC
|
|
||||||
|
|
||||||
ADF \*w : Floating add (*)
|
|
||||||
SBF \*w : Floating subtract (*)
|
|
||||||
MLF \*w : Floating multiply (*)
|
|
||||||
DVF \*w : Floating divide (*)
|
|
||||||
NGF \*w : Floating negate (*)
|
|
||||||
FIF \*w : Floating multiply and split integer and fraction part (*)
|
|
||||||
FEF \*w : Split floating number in exponent and fraction part (*)
|
|
||||||
|
|
||||||
GROUP 6 - POINTER ARITHMETIC
|
|
||||||
|
|
||||||
ADP \*f : Add \*f to pointer on top of stack
|
|
||||||
ADS \*w : Add \*w-byte value and pointer
|
|
||||||
SBS \*w : Subtract pointers in same fragment and push diff as size \*w integer
|
|
||||||
|
|
||||||
GROUP 7 - INCREMENT/DECREMENT/ZERO
|
|
||||||
|
|
||||||
INC \*- : Increment word on top of stack by 1 (*)
|
|
||||||
INL \*l : Increment local or parameter (*)
|
|
||||||
INE \*g : Increment external (*)
|
|
||||||
DEC \*- : Decrement word on top of stack by 1 (*)
|
|
||||||
DEL \*l : Decrement local or parameter (*)
|
|
||||||
DEE \*g : Decrement external (*)
|
|
||||||
ZRL \*l : Zero local or parameter
|
|
||||||
ZRE \*g : Zero external
|
|
||||||
ZRF \*w : Load a floating zero of size \*w
|
|
||||||
ZER \*w : Load \*w zero bytes
|
|
||||||
|
|
||||||
GROUP 8 - CONVERT (stack: source, source size, dest. size (top))
|
|
||||||
|
|
||||||
CII \*- : Convert integer to integer (*)
|
|
||||||
CUI \*- : Convert unsigned to integer (*)
|
|
||||||
CFI \*- : Convert floating to integer (*)
|
|
||||||
CIF \*- : Convert integer to floating (*)
|
|
||||||
CUF \*- : Convert unsigned to floating (*)
|
|
||||||
CFF \*- : Convert floating to floating (*)
|
|
||||||
CIU \*- : Convert integer to unsigned
|
|
||||||
CUU \*- : Convert unsigned to unsigned
|
|
||||||
CFU \*- : Convert floating to unsigned
|
|
||||||
|
|
||||||
GROUP 9 - LOGICAL
|
|
||||||
|
|
||||||
AND \*w : Boolean and on two groups of \*w bytes
|
|
||||||
IOR \*w : Boolean inclusive or on two groups of \*w bytes
|
|
||||||
XOR \*w : Boolean exclusive or on two groups of \*w bytes
|
|
||||||
COM \*w : Complement (one's complement of top \*w bytes)
|
|
||||||
ROL \*w : Rotate left a group of \*w bytes
|
|
||||||
ROR \*w : Rotate right a group of \*w bytes
|
|
||||||
|
|
||||||
GROUP 10 - SETS
|
|
||||||
|
|
||||||
INN \*w : Bit test on \*w byte set (bit number on top of stack)
|
|
||||||
SET \*w : Create singleton \*w byte set with bit n on (n is top of stack)
|
|
||||||
|
|
||||||
GROUP 11 - ARRAY
|
|
||||||
|
|
||||||
LAR \*w : Load array element, descriptor contains integers of size \*w
|
|
||||||
SAR \*w : Store array element
|
|
||||||
AAR \*w : Load address of array element
|
|
||||||
|
|
||||||
GROUP 12 - COMPARE
|
|
||||||
|
|
||||||
CMI \*w : Compare \*w byte integers, Push negative, zero, positive for <, = or >
|
|
||||||
CMF \*w : Compare \*w byte reals
|
|
||||||
CMU \*w : Compare \*w byte unsigneds
|
|
||||||
CMS \*w : Compare \*w byte values, can only be used for bit for bit equality test
|
|
||||||
CMP \*- : Compare pointers
|
|
||||||
|
|
||||||
TLT \*- : True if less, i.e. iff top of stack < 0
|
|
||||||
TLE \*- : True if less or equal, i.e. iff top of stack <= 0
|
|
||||||
TEQ \*- : True if equal, i.e. iff top of stack = 0
|
|
||||||
TNE \*- : True if not equal, i.e. iff top of stack non zero
|
|
||||||
TGE \*- : True if greater or equal, i.e. iff top of stack >= 0
|
|
||||||
TGT \*- : True if greater, i.e. iff top of stack > 0
|
|
||||||
|
|
||||||
GROUP 13 - BRANCH
|
|
||||||
|
|
||||||
BRA \*b : Branch unconditionally to label \*b
|
|
||||||
|
|
||||||
BLT \*b : Branch less (pop 2 words, branch if top > second)
|
|
||||||
BLE \*b : Branch less or equal
|
|
||||||
BEQ \*b : Branch equal
|
|
||||||
BNE \*b : Branch not equal
|
|
||||||
BGE \*b : Branch greater or equal
|
|
||||||
BGT \*b : Branch greater
|
|
||||||
|
|
||||||
ZLT \*b : Branch less than zero (pop 1 word, branch negative)
|
|
||||||
ZLE \*b : Branch less or equal to zero
|
|
||||||
ZEQ \*b : Branch equal zero
|
|
||||||
ZNE \*b : Branch not zero
|
|
||||||
ZGE \*b : Branch greater or equal zero
|
|
||||||
ZGT \*b : Branch greater than zero
|
|
||||||
|
|
||||||
GROUP 14 - PROCEDURE CALL
|
|
||||||
|
|
||||||
CAI \*- : Call procedure (procedure identifier on stack)
|
|
||||||
CAL \*p : Call procedure (with identifier \*p)
|
|
||||||
LFR \*s : Load function result
|
|
||||||
RET \*z : Return (function result consists of top \*z bytes)
|
|
||||||
|
|
||||||
GROUP 15 - MISCELLANEOUS
|
|
||||||
|
|
||||||
ASP \*f : Adjust the stack pointer by \*f
|
|
||||||
ASS \*w : Adjust the stack pointer by \*w-byte integer
|
|
||||||
BLM \*z : Block move \*z bytes; first pop destination addr, then source addr
|
|
||||||
BLS \*w : Block move, size is in \*w-byte integer on top of stack
|
|
||||||
CSA \*w : Case jump; address of jump table at top of stack
|
|
||||||
CSB \*w : Table lookup jump; address of jump table at top of stack
|
|
||||||
DCH \*- : Follow dynamic chain, convert LB to LB of caller
|
|
||||||
DUP \*s : Duplicate top \*s bytes
|
|
||||||
DUS \*w : Duplicate top \*w bytes
|
|
||||||
EXG \*w : Exchange top \*w bytes
|
|
||||||
FIL \*g : File name (external 4 := \*g)
|
|
||||||
GTO \*g : Non-local goto, descriptor at \*g
|
|
||||||
LIM \*- : Load 16 bit ignore mask
|
|
||||||
LIN \*n : Line number (external 0 := \*n)
|
|
||||||
LNI \*- : Line number increment
|
|
||||||
LOR \*r : Load register (0=LB, 1=SP, 2=HP)
|
|
||||||
LPB \*- : Convert local base to argument base
|
|
||||||
MON \*- : Monitor call
|
|
||||||
NOP \*- : No operation
|
|
||||||
RCK \*w : Range check; trap on error
|
|
||||||
RTT \*- : Return from trap
|
|
||||||
SIG \*- : Trap errors to proc identifier on top of stack, -2 resets default
|
|
||||||
SIM \*- : Store 16 bit ignore mask
|
|
||||||
STR \*r : Store register (0=LB, 1=SP, 2=HP)
|
|
||||||
TRP \*- : Cause trap to occur (Error number on stack)
|
|
||||||
.DE 0
|
|
||||||
164
doc/em/descr.nr
164
doc/em/descr.nr
@@ -1,164 +0,0 @@
|
|||||||
.SN 7
|
|
||||||
.BP
|
|
||||||
.S1 "DESCRIPTORS"
|
|
||||||
Several instructions use descriptors, notably the range check instruction,
|
|
||||||
the array instructions, the goto instruction and the case jump instructions.
|
|
||||||
Descriptors reside in data space.
|
|
||||||
They may be constructed at run time, but
|
|
||||||
more often they are fixed and allocated in ROM data.
|
|
||||||
.P
|
|
||||||
All instructions using descriptors, except GTO, have as argument
|
|
||||||
the size of the integers in the descriptor.
|
|
||||||
All implementations have to allow integers of the size of a
|
|
||||||
word in descriptors.
|
|
||||||
All integers popped from the stack and used for indexing or comparing
|
|
||||||
must have the same size as the integers in the descriptor.
|
|
||||||
.S2 "Range check descriptors"
|
|
||||||
Range check descriptors consist of two integers:
|
|
||||||
.IS 2
|
|
||||||
.PS 1 4 "" .
|
|
||||||
.PT
|
|
||||||
lower bound~~~~~~~signed
|
|
||||||
.PT
|
|
||||||
upper bound~~~~~~~signed
|
|
||||||
.PE
|
|
||||||
.IE
|
|
||||||
The range check instruction checks an integer on the stack against
|
|
||||||
these bounds and causes a trap if the value is outside the interval.
|
|
||||||
The value itself is neither changed nor removed from the stack.
|
|
||||||
.S2 "Array descriptors"
|
|
||||||
Each array descriptor describes a single dimension.
|
|
||||||
For multi-dimensional arrays, several array instructions are
|
|
||||||
needed to access a single element.
|
|
||||||
Array descriptors contain the following three integers:
|
|
||||||
.IS 2
|
|
||||||
.PS 1 4 "" .
|
|
||||||
.PT
|
|
||||||
lower bound~~~~~~~~~~~~~~~~~~~~~signed
|
|
||||||
.PT
|
|
||||||
upper bound - lower bound~~~~~~~unsigned
|
|
||||||
.PT
|
|
||||||
number of bytes per element~~~~~unsigned
|
|
||||||
.PE
|
|
||||||
.IE
|
|
||||||
The array instructions LAR, SAR and AAR have the pointer to the start
|
|
||||||
of the descriptor as operand on the stack.
|
|
||||||
.sp
|
|
||||||
The element A[I] is fetched as follows:
|
|
||||||
.IS 2
|
|
||||||
.PS 1 4 "" .
|
|
||||||
.PT
|
|
||||||
Stack the address of A (e.g., using LAE or LAL)
|
|
||||||
.PT
|
|
||||||
Stack the value of I (n-byte integer)
|
|
||||||
.PT
|
|
||||||
Stack the pointer to the descriptor (e.g., using LAE)
|
|
||||||
.PT
|
|
||||||
LAR n (n is the size of the integers in the descriptor and I)
|
|
||||||
.PE
|
|
||||||
.IE
|
|
||||||
All array instructions first pop the address of the descriptor
|
|
||||||
and the index.
|
|
||||||
If the index is not within the bounds specified, a trap occurs.
|
|
||||||
If ok, (I~-~lower bound) is multiplied
|
|
||||||
by the number of bytes per element (the third word). The result is added
|
|
||||||
to the address of A and replaces A on the stack.
|
|
||||||
.A
|
|
||||||
At this point LAR, SAR and AAR diverge.
|
|
||||||
AAR is finished. LAR pops the address and fetches the data
|
|
||||||
item,
|
|
||||||
the size being specified by the descriptor.
|
|
||||||
The usual restrictions for memory access must be obeyed.
|
|
||||||
SAR pops the address and stores the
|
|
||||||
data item now exposed.
|
|
||||||
.S2 "Non-local goto descriptors"
|
|
||||||
The GTO instruction provides a way of returning directly to any
|
|
||||||
active procedure invocation.
|
|
||||||
The argument of the instruction is the address of a descriptor
|
|
||||||
containing three pointers:
|
|
||||||
.IS 2
|
|
||||||
.PS 1 4 "" .
|
|
||||||
.PT
|
|
||||||
value of PC after the jump
|
|
||||||
.PT
|
|
||||||
value of SP after the jump
|
|
||||||
.PT
|
|
||||||
value of LB after the jump
|
|
||||||
.PE
|
|
||||||
.IE
|
|
||||||
GTO replaces the loads PC, SP and LB from the descriptor,
|
|
||||||
thereby jumping to a procedure
|
|
||||||
and removing zeor or more frames from the stack.
|
|
||||||
The LB, SP and PC in the descriptor must belong to a
|
|
||||||
dynamically enclosing procedure,
|
|
||||||
because some EM implementations will need to backtrack through
|
|
||||||
the dynamic chain and use the implementation dependent data
|
|
||||||
in frames to restore registers etc.
|
|
||||||
.S2 "Case descriptors"
|
|
||||||
The case jump instructions CSA and CSB both
|
|
||||||
provide multiway branches selected by a case index.
|
|
||||||
Both fetch two operands from the stack:
|
|
||||||
first a pointer to the low address of the case descriptor
|
|
||||||
and then the case index.
|
|
||||||
CSA uses the case index as index in the descriptor table, but CSB searches
|
|
||||||
the table for an occurrence of the case index.
|
|
||||||
Therefore, the descriptors for CSA and CSB,
|
|
||||||
as shown in figure 4, are different.
|
|
||||||
All pointers in the table must be addresses of instructions in the
|
|
||||||
procedure executing the case instruction.
|
|
||||||
.P
|
|
||||||
CSA selects the new PC by indexing.
|
|
||||||
If the index, a signed integer, is greater than or equal to
|
|
||||||
the lower bound and less than or equal to the upper bound,
|
|
||||||
then fetch the new PC from the list of instruction pointers by indexing with
|
|
||||||
index-lower.
|
|
||||||
The table does not contain the value of the upper bound,
|
|
||||||
but the value of upper-lower as an unsigned integer.
|
|
||||||
If the index is out of bounds or if the fetched pointer is 0,
|
|
||||||
then fetch the default instruction pointer.
|
|
||||||
If the resulting PC is 0, then trap.
|
|
||||||
.P
|
|
||||||
CSB selects the new PC by searching.
|
|
||||||
The table is searched for an entry with index value equal to the case index.
|
|
||||||
That entry or, if none is found, the default entry contains the
|
|
||||||
new PC.
|
|
||||||
When the resulting PC is 0, a trap is performed.
|
|
||||||
.P
|
|
||||||
The choice of which case instruction to use for
|
|
||||||
each source language case statement
|
|
||||||
is up to the front end.
|
|
||||||
If the range of the index value is dense, i.e
|
|
||||||
.DS
|
|
||||||
(highest value - lowest value) / number of cases
|
|
||||||
.DE 1
|
|
||||||
is less than some threshold, then CSA is the obvious choice.
|
|
||||||
If the range is sparse, CSB is better.
|
|
||||||
.N 2
|
|
||||||
.DS
|
|
||||||
|--------------------| |--------------------| high address
|
|
||||||
| pointer for upb | | pointer n-1 |
|
|
||||||
|--------------------| |- - - - - - - |
|
|
||||||
| . | | index n-1 |
|
|
||||||
| . | |--------------------|
|
|
||||||
| . | | . |
|
|
||||||
| . | | . |
|
|
||||||
| . | | . |
|
|
||||||
| . | |--------------------|
|
|
||||||
| . | | pointer 1 |
|
|
||||||
|--------------------| |- - - - - - - |
|
|
||||||
| pointer for lwb+1 | | index 1 |
|
|
||||||
|--------------------| |--------------------|
|
|
||||||
| pointer for lwb | | pointer 0 |
|
|
||||||
|--------------------| |- - - - - - - |
|
|
||||||
| upper - lower | | index 0 |
|
|
||||||
|--------------------| |--------------------|
|
|
||||||
| lower bound | | number of entries |
|
|
||||||
|--------------------| |--------------------|
|
|
||||||
| default pointer | | default pointer | low address
|
|
||||||
|--------------------| |--------------------|
|
|
||||||
|
|
||||||
CSA descriptor CSB descriptor
|
|
||||||
|
|
||||||
|
|
||||||
Figure 4. Descriptor layout for CSA and CSB
|
|
||||||
.DE
|
|
||||||
377
doc/em/dspace.nr
377
doc/em/dspace.nr
@@ -1,377 +0,0 @@
|
|||||||
.BP
|
|
||||||
.SN 4
|
|
||||||
.S1 "DATA ADDRESS SPACE"
|
|
||||||
The data address space is divided into three parts, called 'areas',
|
|
||||||
each with its own addressing method:
|
|
||||||
global data area,
|
|
||||||
local data area (including the stack),
|
|
||||||
and heap data area.
|
|
||||||
These data areas must be part of the same
|
|
||||||
address space because all data is accessed by
|
|
||||||
the same type of pointers.
|
|
||||||
.P
|
|
||||||
Space for global data is reserved using several pseudoinstructions in the
|
|
||||||
assembly language, as described in
|
|
||||||
the next paragraph and chapter 11.
|
|
||||||
The size of the global data area is fixed per program.
|
|
||||||
.A
|
|
||||||
Global data is addressed absolutely in the machine language.
|
|
||||||
Many instructions are available to address global data.
|
|
||||||
They all have an absolute address as argument.
|
|
||||||
Examples are LOE, LAE and STE.
|
|
||||||
.P
|
|
||||||
Part of the global data area is initialized by the
|
|
||||||
compiler, the
|
|
||||||
rest is not initialized at all or is initialized
|
|
||||||
with a value, typically -32768 or 0.
|
|
||||||
Part of the initialized global data may be made read-only
|
|
||||||
if the implementation supports protection.
|
|
||||||
.P
|
|
||||||
The local data area is used as a stack,
|
|
||||||
which grows from high to low addresses
|
|
||||||
and contains some data for each active procedure
|
|
||||||
invocation, called a 'frame'.
|
|
||||||
The size of the local data area varies dynamically during
|
|
||||||
execution.
|
|
||||||
Below the current procedure frame resides the operand stack.
|
|
||||||
The stack pointer SP always points to the bottom of
|
|
||||||
the local data area.
|
|
||||||
Local data is addressed by offsetting from the local base pointer LB.
|
|
||||||
LB always points to the frame of the current procedure.
|
|
||||||
Only the words of the current frame and the parameters
|
|
||||||
can be addressed directly.
|
|
||||||
Variables in other active procedures are addressed by following
|
|
||||||
the chain of statically enclosing procedures using the LXL or LXA instruction.
|
|
||||||
The variables in dynamically enclosing procedures can be
|
|
||||||
addressed with the use of the DCH instruction.
|
|
||||||
.A
|
|
||||||
Many instructions have offsets to LB as argument,
|
|
||||||
for instance LOL, LAL and STL.
|
|
||||||
The arguments of these instructions range from -1 to some
|
|
||||||
(negative) minimum
|
|
||||||
for the access of local storage and from 0 to some (positive)
|
|
||||||
maximum for parameter access.
|
|
||||||
.P
|
|
||||||
The procedure call instructions CAL and CAI each create a new frame
|
|
||||||
on the stack.
|
|
||||||
Each procedure has an assembly-time parameter specifying
|
|
||||||
the number of bytes needed for local storage.
|
|
||||||
This storage is allocated each time the procedure is called and
|
|
||||||
must be a multiple of the wordsize.
|
|
||||||
Each procedure, therefore, starts with a stack with the local variables
|
|
||||||
already allocated.
|
|
||||||
The return instructions RET and RTT remove a frame.
|
|
||||||
The actual parameters must be removed by the calling procedure.
|
|
||||||
.P
|
|
||||||
RET may copy some words from the stack of
|
|
||||||
the returning procedure to an unnamed 'function return area'.
|
|
||||||
This area is available for 'READ-ONCE' access using the LFR instruction.
|
|
||||||
The result of a LFR is only defined if the size used to fetch
|
|
||||||
is identical to the size used in the last return.
|
|
||||||
The instruction ASP, used to remove the parameters from the
|
|
||||||
stack, the branch instruction BRA and the non-local goto
|
|
||||||
instrucion GTO are the only ones that leave the contents of
|
|
||||||
the 'function return area' intact.
|
|
||||||
All other instructions are allowed to destroy the function
|
|
||||||
return area.
|
|
||||||
Thus parameters can be popped before fetching the function result.
|
|
||||||
The maximum size of all function return areas is
|
|
||||||
implementation dependent,
|
|
||||||
but should allow procedure instance identifiers and all
|
|
||||||
implemented objects of type integer, unsigned, float
|
|
||||||
and pointer to be returned.
|
|
||||||
In most implementations
|
|
||||||
the maximum size of the function return
|
|
||||||
area is twice the pointer size,
|
|
||||||
because we want to be able to handle 'procedure instance
|
|
||||||
identifiers' which consist of a procedure identifier and the LB
|
|
||||||
of a frame belonging to that procedure.
|
|
||||||
.P
|
|
||||||
The heap data area grows upwards, to higher numbered
|
|
||||||
addresses.
|
|
||||||
It is initially empty.
|
|
||||||
The initial value of the heap pointer HP
|
|
||||||
marks the low end.
|
|
||||||
The heap pointer may be manipulated
|
|
||||||
by the LOR and STR instructions.
|
|
||||||
The heap can only be addressed indirectly,
|
|
||||||
by pointers derived from previous values of HP.
|
|
||||||
.S2 "Global data area"
|
|
||||||
The initial size of the global data area is determined at assembly time.
|
|
||||||
Global data is allocated by several
|
|
||||||
pseudoinstructions in the EM assembly
|
|
||||||
language.
|
|
||||||
Each pseudoinstruction allocates one or more bytes.
|
|
||||||
The bytes allocated for a single pseudo form
|
|
||||||
a 'block'.
|
|
||||||
A block differs from a fragment, because,
|
|
||||||
under certain conditions, several blocks are allocated
|
|
||||||
in a single fragment.
|
|
||||||
This guarantees that the bytes of these blocks
|
|
||||||
are consecutive.
|
|
||||||
.P
|
|
||||||
Global data is addressed absolutely in binary
|
|
||||||
machine language.
|
|
||||||
Most compilers, however,
|
|
||||||
cannot assign absolute addresses to their global variables,
|
|
||||||
especially not if the language
|
|
||||||
allows programs to be composed of several separately compiled modules.
|
|
||||||
The assembly language therefore allows the compiler to name
|
|
||||||
the first address of a global data block with an alphanumeric label.
|
|
||||||
Moreover, the only way to address such a named global data block
|
|
||||||
in the assembly language is by using its name.
|
|
||||||
It is the task of the assembler/loader to
|
|
||||||
translate these labels into absolute addresses.
|
|
||||||
These labels may also be used
|
|
||||||
in CON and ROM pseudoinstructions to initialize pointers.
|
|
||||||
.P
|
|
||||||
The pseudoinstruction CON allocates initialized data.
|
|
||||||
ROM acts like CON but indicates that the initialized data will
|
|
||||||
not change during execution of the program.
|
|
||||||
The pseudoinstruction BSS allocates a block of uninitialized
|
|
||||||
or identically initialized
|
|
||||||
data.
|
|
||||||
The pseudoinstruction HOL is similar to BSS,
|
|
||||||
but it alters the meaning of subsequent absolute addressing in
|
|
||||||
the assembly language.
|
|
||||||
.P
|
|
||||||
Another type of global data is a small block,
|
|
||||||
called the ABS block, with an implementation defined size.
|
|
||||||
Storage in this type of block can only be addressed
|
|
||||||
absolutely in assembly language.
|
|
||||||
The first word has address 0 and is used to maintain the
|
|
||||||
source line number.
|
|
||||||
Special instructions LIN and LNI are provided to
|
|
||||||
update this counter.
|
|
||||||
A pointer at location 4 points to a string containing the
|
|
||||||
current source file name.
|
|
||||||
The instruction FIL can be used to update the pointer.
|
|
||||||
.P
|
|
||||||
All numeric arguments of the instructions that address
|
|
||||||
the global data area refer to locations in the
|
|
||||||
ABS block unless
|
|
||||||
they are preceded by at least one HOL pseudo in the same
|
|
||||||
module,
|
|
||||||
in which case they refer to the storage area allocated by the
|
|
||||||
last HOL pseudoinstruction.
|
|
||||||
Thus LOE 0 loads the zeroth word of the most recent HOL, unless no HOL has
|
|
||||||
appeared in the current file so
|
|
||||||
far, in which case it loads the zeroth word of the
|
|
||||||
ABS fragment.
|
|
||||||
.P
|
|
||||||
The global data area is highly fragmented.
|
|
||||||
The ABS block and each HOL and BSS block are separate fragments.
|
|
||||||
The way fragments are formed from CON and ROM blocks is more complex.
|
|
||||||
The assemblers group several blocks into a single fragment.
|
|
||||||
A fragment only contains blocks of the same type: CON or ROM.
|
|
||||||
It is guaranteed that the bytes allocated for two consecutive CON pseudos are
|
|
||||||
allocated consecutively in a single fragment, unless
|
|
||||||
these CON pseudos are separated in the assembly language program
|
|
||||||
by a data label definition or one or more of the following pseudos:
|
|
||||||
.DS
|
|
||||||
|
|
||||||
ROM, BSS, HOL and END
|
|
||||||
|
|
||||||
.DE
|
|
||||||
An analogous rule holds for ROM pseudos.
|
|
||||||
.S2 "Local data area"
|
|
||||||
The local data area consists of a sequence of frames, one for
|
|
||||||
each active procedure.
|
|
||||||
Below the frame of the current procedure resides the
|
|
||||||
expression stack.
|
|
||||||
Frames are generated by procedure calls and are
|
|
||||||
removed by procedure returns.
|
|
||||||
A procedure frame consists of six 'zones':
|
|
||||||
.DS
|
|
||||||
|
|
||||||
1. The return status block
|
|
||||||
2. The local variables and compiler temporaries
|
|
||||||
3. The register save block
|
|
||||||
4. The dynamic local generators
|
|
||||||
5. The operand stack.
|
|
||||||
6. The parameters of a procedure one level deeper
|
|
||||||
|
|
||||||
.DE
|
|
||||||
A sample frame is shown in Figure 1.
|
|
||||||
.P
|
|
||||||
Before a procedure call is performed the actual
|
|
||||||
parameters are pushed onto the stack of the calling procedure.
|
|
||||||
The exact details are compiler dependent.
|
|
||||||
EM allows procedures to be called with a variable number of
|
|
||||||
parameters.
|
|
||||||
The implementation of the C-language almost forces its runtime
|
|
||||||
system to push the parameters in reverse order, that is,
|
|
||||||
the first positional parameter last.
|
|
||||||
Most compilers use the C calling convention to be compatible.
|
|
||||||
The parameters of a procedure belong to the frame of the
|
|
||||||
calling procedure.
|
|
||||||
Note that the evaluation of the actual parameters may imply
|
|
||||||
the calling of procedures.
|
|
||||||
The parameters can be accessed with certain instructions using
|
|
||||||
offsets of 0 and greater.
|
|
||||||
The first byte of the last parameter pushed has offset 0.
|
|
||||||
Note that the parameter at offset 0 has a special use in the
|
|
||||||
instructions following the static chain (LXL and LXA).
|
|
||||||
These instructions assume that this parameter contains the LB of
|
|
||||||
the statically enclosing procedure.
|
|
||||||
Procedures that do not have a dynamically enclosing procedure
|
|
||||||
do not need a static link at offset 0.
|
|
||||||
.P
|
|
||||||
Two instructions are available to perform procedure calls, CAL
|
|
||||||
and CAI.
|
|
||||||
Several tasks are performed by these call instructions.
|
|
||||||
.A
|
|
||||||
First, a part of the status of the calling procedure is
|
|
||||||
saved on the stack in the return status block.
|
|
||||||
This block should contain the return address of the calling
|
|
||||||
procedure, its LB and other implementation dependent data.
|
|
||||||
The size of this block is fixed for any given implementation
|
|
||||||
because the lexical instructions LPB, LXL and LXA must be able to
|
|
||||||
obtain the base addresses of the procedure parameters \fBand\fP local
|
|
||||||
variables.
|
|
||||||
An alternative solution can be used on machines with a highly
|
|
||||||
segmented address space.
|
|
||||||
The stack frames need not be contiguous then and the first
|
|
||||||
status save area can contain the parameter base AB,
|
|
||||||
which has the value of SP just after the last parameter has
|
|
||||||
been pushed.
|
|
||||||
.A
|
|
||||||
Second, the LB is changed to point to the
|
|
||||||
first word above the local variables.
|
|
||||||
The new LB is a copy of the SP after the return status
|
|
||||||
block has been pushed.
|
|
||||||
.A
|
|
||||||
Third, the amount of local storage needed by the procedure is
|
|
||||||
reserved.
|
|
||||||
The parameters and local storage are accessed by the same instructions.
|
|
||||||
Negative offsets are used for access to local variables.
|
|
||||||
The highest byte, that is the byte nearest
|
|
||||||
to LB, has to be accessed with offset -1.
|
|
||||||
The pseudoinstruction specifying the entry point of a
|
|
||||||
procedure, has an argument that specifies the amount of local
|
|
||||||
storage needed.
|
|
||||||
The local variables allocated by the CAI or CAL instructions
|
|
||||||
are the only ones that can be accessed with a fixed negative offset.
|
|
||||||
The initial value of the allocated words is
|
|
||||||
not defined, but implementations that check for undefined
|
|
||||||
values will probably initialize them with a
|
|
||||||
special 'undefined' pattern, typically -32768.
|
|
||||||
.A
|
|
||||||
Fourth, any EM implementation is allowed to reserve a variable size
|
|
||||||
block beneath the local variables.
|
|
||||||
This block could, for example, be used to save a variable number
|
|
||||||
of registers.
|
|
||||||
.A
|
|
||||||
Finally, the address of the entry point of the called procedure
|
|
||||||
is loaded into the Program Counter.
|
|
||||||
.P
|
|
||||||
The ASP instruction can be used to allocate further (dynamic)
|
|
||||||
local storage.
|
|
||||||
The base address of such storage must be obtained with a LOR~SP
|
|
||||||
instruction.
|
|
||||||
This same instruction ASP may also be used
|
|
||||||
to remove some words from the stack.
|
|
||||||
.P
|
|
||||||
There is a version of ASP, called ASS, which fetches the number
|
|
||||||
of bytes to allocate from the stack.
|
|
||||||
It can be used to allocate space for local
|
|
||||||
objects whose size is unknown at compile time,
|
|
||||||
so called 'dynamic local generators'.
|
|
||||||
.P
|
|
||||||
Control is returned to the calling procedure with a RET instruction.
|
|
||||||
Any return value is then copied to the 'function return area'.
|
|
||||||
The frame created by the call is deallocated and the status of
|
|
||||||
the calling procedure is restored.
|
|
||||||
The value of SP just after the return value has been popped must
|
|
||||||
be the same as the
|
|
||||||
value of SP just before executing the first instruction of this
|
|
||||||
invocation.
|
|
||||||
This means that when a RET is executed the operand stack can
|
|
||||||
only contain the return value and all dynamically generated locals must be
|
|
||||||
deallocated.
|
|
||||||
Violating this restriction might result in hard to detect
|
|
||||||
errors.
|
|
||||||
The calling procedure has to remove the parameters from the stack.
|
|
||||||
This can be done with the aforementioned ASP instruction.
|
|
||||||
.P
|
|
||||||
Each procedure frame is a separate fragment.
|
|
||||||
Because any fragment may be placed anywhere in memory,
|
|
||||||
procedure frames need not be contiguous.
|
|
||||||
.DS
|
|
||||||
|===============================|
|
|
||||||
| actual parameter n-1 |
|
|
||||||
|-------------------------------|
|
|
||||||
| . |
|
|
||||||
| . |
|
|
||||||
| . |
|
|
||||||
|-------------------------------|
|
|
||||||
| actual parameter 0 | ( <- AB )
|
|
||||||
|===============================|
|
|
||||||
|
|
||||||
|
|
||||||
|===============================|
|
|
||||||
|///////////////////////////////|
|
|
||||||
|///// return status block /////|
|
|
||||||
|///////////////////////////////| <- LB
|
|
||||||
|===============================|
|
|
||||||
| |
|
|
||||||
| local variables |
|
|
||||||
| |
|
|
||||||
|-------------------------------|
|
|
||||||
| |
|
|
||||||
| compiler temporaries |
|
|
||||||
| |
|
|
||||||
|===============================|
|
|
||||||
|///////////////////////////////|
|
|
||||||
|///// register save block /////|
|
|
||||||
|///////////////////////////////|
|
|
||||||
|===============================|
|
|
||||||
| |
|
|
||||||
| dynamic local generators |
|
|
||||||
| |
|
|
||||||
|===============================|
|
|
||||||
| operand |
|
|
||||||
|-------------------------------|
|
|
||||||
| operand |
|
|
||||||
|===============================|
|
|
||||||
| parameter m-1 |
|
|
||||||
|-------------------------------|
|
|
||||||
| . |
|
|
||||||
| . |
|
|
||||||
| . |
|
|
||||||
|-------------------------------|
|
|
||||||
| parameter 0 | <- SP
|
|
||||||
|===============================|
|
|
||||||
|
|
||||||
Figure 1. A sample procedure frame and parameters.
|
|
||||||
.DE
|
|
||||||
.S2 "Heap data area"
|
|
||||||
The heap area starts empty, with HP
|
|
||||||
pointing to the low end of it.
|
|
||||||
HP always contains a word address.
|
|
||||||
A copy of HP can always be obtained with the LOR instruction.
|
|
||||||
A new value may be stored in the heap pointer using the STR instruction.
|
|
||||||
If the new value is greater than the old one,
|
|
||||||
then the heap grows.
|
|
||||||
If it is smaller, then the heap shrinks.
|
|
||||||
HP may never point below its original value.
|
|
||||||
All words between the current HP and the original HP
|
|
||||||
are allocated to the heap.
|
|
||||||
The heap may not grow into a part of memory that is already allocated
|
|
||||||
for the stack.
|
|
||||||
When this is attempted, the STR instruction will cause a trap to occur.
|
|
||||||
.P
|
|
||||||
The only way to address the heap is indirectly.
|
|
||||||
Whenever an object is allocated by increasing HP,
|
|
||||||
then the old HP value must be saved and can be used later to address
|
|
||||||
the allocated object.
|
|
||||||
If, in the meantime, HP is decreased so that the object
|
|
||||||
is no longer part of the heap, then an attempt to access
|
|
||||||
the object is not allowed.
|
|
||||||
Furthermore, if the heap pointer is increased again to above
|
|
||||||
the object address, then access to the old object gives undefined results.
|
|
||||||
.P
|
|
||||||
The heap is a single fragment.
|
|
||||||
All bytes have consecutive addresses.
|
|
||||||
No limits are imposed on the size of the heap as long as it fits
|
|
||||||
in the available data address space.
|
|
||||||
1666
doc/em/em.i
1666
doc/em/em.i
File diff suppressed because it is too large
Load Diff
@@ -1,9 +0,0 @@
|
|||||||
main() {
|
|
||||||
register int l,j ;
|
|
||||||
|
|
||||||
for ( j=0 ; (l=getchar()) != -1 ; j++ ) {
|
|
||||||
if ( j%16 == 15 ) printf("%3d\n",l&0377 ) ;
|
|
||||||
else printf("%3d ",l&0377 ) ;
|
|
||||||
}
|
|
||||||
printf("\n") ;
|
|
||||||
}
|
|
||||||
178
doc/em/exam.e
178
doc/em/exam.e
@@ -1,178 +0,0 @@
|
|||||||
mes 2,2,2 ; wordsize 2, pointersize 2
|
|
||||||
.1
|
|
||||||
rom 't.p\000' ; the name of the source file
|
|
||||||
hol 552,-32768,0 ; externals and buf occupy 552 bytes
|
|
||||||
exp $sum ; sum can be called from other modules
|
|
||||||
pro $sum,2 ; procedure sum; 2 bytes local storage
|
|
||||||
lin 8 ; code from source line 8
|
|
||||||
ldl 0 ; load two locals ( a and b )
|
|
||||||
adi 2 ; add them
|
|
||||||
ret 2 ; return the result
|
|
||||||
end 2 ; end of procedure ( still two bytes local storage )
|
|
||||||
.2
|
|
||||||
rom 1,99,2 ; descriptor of array a[]
|
|
||||||
exp $test ; the compiler exports all level 0 procedures
|
|
||||||
pro $test,226 ; procedure test, 226 bytes local storage
|
|
||||||
.3
|
|
||||||
rom 4.8F8 ; assemble Floating point 4.8 (8 bytes) in
|
|
||||||
.4 ; global storage
|
|
||||||
rom 0.5F8 ; same for 0.5
|
|
||||||
mes 3,-226,2,2 ; compiler temporary not referenced indirect
|
|
||||||
mes 3,-24,2,0 ; the same is true for i, j, b and c in test
|
|
||||||
mes 3,-22,2,0
|
|
||||||
mes 3,-4,2,0
|
|
||||||
mes 3,-2,2,0
|
|
||||||
mes 3,-20,8,0 ; and for x and y
|
|
||||||
mes 3,-12,8,0
|
|
||||||
lin 20 ; maintain source line number
|
|
||||||
loc 1
|
|
||||||
stl -4 ; j := 1
|
|
||||||
lni ; was lin 21 prior to optimization
|
|
||||||
lol -4
|
|
||||||
loc 3
|
|
||||||
mli 2
|
|
||||||
loc 6
|
|
||||||
adi 2
|
|
||||||
stl -2 ; i := 3 * j + 6
|
|
||||||
lni ; was lin 22 prior to optimization
|
|
||||||
lae .3
|
|
||||||
loi 8
|
|
||||||
lal -12
|
|
||||||
sti 8 ; x := 4.8
|
|
||||||
lni ; was lin 23 prior to optimization
|
|
||||||
lal -12
|
|
||||||
loi 8
|
|
||||||
lae .4
|
|
||||||
loi 8
|
|
||||||
dvf 8
|
|
||||||
lal -20
|
|
||||||
sti 8 ; y := x / 0.5
|
|
||||||
lni ; was lin 24 prior to optimization
|
|
||||||
loc 1
|
|
||||||
stl -22 ; b := true
|
|
||||||
lni ; was lin 25 prior to optimization
|
|
||||||
loc 122
|
|
||||||
stl -24 ; c := 'z'
|
|
||||||
lni ; was lin 26 prior to optimization
|
|
||||||
loc 1
|
|
||||||
stl -2 ; for i:= 1
|
|
||||||
2
|
|
||||||
lol -2
|
|
||||||
dup 2
|
|
||||||
mli 2 ; i*i
|
|
||||||
lal -224
|
|
||||||
lol -2
|
|
||||||
lae .2
|
|
||||||
sar 2 ; a[i] :=
|
|
||||||
lol -2
|
|
||||||
loc 100
|
|
||||||
beq *3 ; to 100 do
|
|
||||||
inl -2 ; increment i and loop
|
|
||||||
bra *2
|
|
||||||
3
|
|
||||||
lin 27
|
|
||||||
lol -4
|
|
||||||
loc 27
|
|
||||||
adi 2 ; j + 27
|
|
||||||
sil 0 ; r.r1 :=
|
|
||||||
lni ; was lin 28 prior to optimization
|
|
||||||
lol -22 ; b
|
|
||||||
lol 0
|
|
||||||
stf 10 ; r.r3 :=
|
|
||||||
lni ; was lin 29 prior to optimization
|
|
||||||
lal -20
|
|
||||||
loi 16
|
|
||||||
adf 8 ; x + y
|
|
||||||
lol 0
|
|
||||||
adp 2
|
|
||||||
sti 8 ; r.r2 :=
|
|
||||||
lni ; was lin 23 prior to optimization
|
|
||||||
lal -224
|
|
||||||
lol -4
|
|
||||||
lae .2
|
|
||||||
lar 2 ; a[j]
|
|
||||||
lil 0 ; r.r1
|
|
||||||
cal $sum ; call now
|
|
||||||
asp 4 ; remove parameters from stack
|
|
||||||
lfr 2 ; get function result
|
|
||||||
stl -2 ; i :=
|
|
||||||
4
|
|
||||||
lin 31
|
|
||||||
lol -2
|
|
||||||
zle *5 ; while i > 0 do
|
|
||||||
lol -4
|
|
||||||
lil 0
|
|
||||||
adi 2
|
|
||||||
stl -4 ; j := j + r.r1
|
|
||||||
del -2 ; i := i - 1
|
|
||||||
bra *4 ; loop
|
|
||||||
5
|
|
||||||
lin 32
|
|
||||||
lol 0
|
|
||||||
stl -226 ; make copy of address of r
|
|
||||||
lol -22
|
|
||||||
lol -226
|
|
||||||
stf 10 ; r3 := b
|
|
||||||
lal -20
|
|
||||||
loi 16
|
|
||||||
adf 8
|
|
||||||
lol -226
|
|
||||||
adp 2
|
|
||||||
sti 8 ; r2 := x + y
|
|
||||||
loc 0
|
|
||||||
sil -226 ; r1 := 0
|
|
||||||
lin 34 ; note the abscence of the unnecesary jump
|
|
||||||
lae 22 ; address of output structure
|
|
||||||
lol -4
|
|
||||||
cal $_wri ; write integer with default width
|
|
||||||
asp 4 ; pop parameters
|
|
||||||
lae 22
|
|
||||||
lol -2
|
|
||||||
loc 6
|
|
||||||
cal $_wsi ; write integer width 6
|
|
||||||
asp 6
|
|
||||||
lae 22
|
|
||||||
lal -12
|
|
||||||
loi 8
|
|
||||||
loc 9
|
|
||||||
loc 3
|
|
||||||
cal $_wrf ; write fixed format real, width 9, precision 3
|
|
||||||
asp 14
|
|
||||||
lae 22
|
|
||||||
lol -22
|
|
||||||
cal $_wrb ; write boolean, default width
|
|
||||||
asp 4
|
|
||||||
lae 22
|
|
||||||
cal $_wln ; writeln
|
|
||||||
asp 2
|
|
||||||
ret 0 ; return, no result
|
|
||||||
end 226
|
|
||||||
exp $_main
|
|
||||||
pro $_main,0 ; main program
|
|
||||||
.6
|
|
||||||
con 2,-1,22 ; description of external files
|
|
||||||
.5
|
|
||||||
rom 15.96F8
|
|
||||||
fil .1 ; maintain source file name
|
|
||||||
lae .6 ; description of external files
|
|
||||||
lae 0 ; base of hol area to relocate buffer addresses
|
|
||||||
cal $_ini ; initialize files, etc...
|
|
||||||
asp 4
|
|
||||||
lin 37
|
|
||||||
lae .5
|
|
||||||
loi 8
|
|
||||||
lae 2
|
|
||||||
sti 8 ; x := 15.9
|
|
||||||
lni ; was lin 38 prior to optimization
|
|
||||||
loc 99
|
|
||||||
ste 0 ; mi := 99
|
|
||||||
lni ; was lin 39 prior to optimization
|
|
||||||
lae 10 ; address of r
|
|
||||||
cal $test
|
|
||||||
asp 2
|
|
||||||
loc 0 ; normal exit
|
|
||||||
cal $_hlt ; cleanup and finish
|
|
||||||
asp 2
|
|
||||||
end 0
|
|
||||||
mes 4,40 ; length of source file is 40 lines
|
|
||||||
mes 5 ; reals were used
|
|
||||||
@@ -1,40 +0,0 @@
|
|||||||
program example(output);
|
|
||||||
{This program just demonstrates typical EM code.}
|
|
||||||
type rec = record r1: integer; r2:real; r3: boolean end;
|
|
||||||
var mi: integer; mx:real; r:rec;
|
|
||||||
|
|
||||||
function sum(a,b:integer):integer;
|
|
||||||
begin
|
|
||||||
sum := a + b
|
|
||||||
end;
|
|
||||||
|
|
||||||
procedure test(var r: rec);
|
|
||||||
label 1;
|
|
||||||
var i,j: integer;
|
|
||||||
x,y: real;
|
|
||||||
b: boolean;
|
|
||||||
c: char;
|
|
||||||
a: array[1..100] of integer;
|
|
||||||
|
|
||||||
begin
|
|
||||||
j := 1;
|
|
||||||
i := 3 * j + 6;
|
|
||||||
x := 4.8;
|
|
||||||
y := x/0.5;
|
|
||||||
b := true;
|
|
||||||
c := 'z';
|
|
||||||
for i:= 1 to 100 do a[i] := i * i;
|
|
||||||
r.r1 := j+27;
|
|
||||||
r.r3 := b;
|
|
||||||
r.r2 := x+y;
|
|
||||||
i := sum(r.r1, a[j]);
|
|
||||||
while i > 0 do begin j := j + r.r1; i := i - 1 end;
|
|
||||||
with r do begin r3 := b; r2 := x+y; r1 := 0 end;
|
|
||||||
goto 1;
|
|
||||||
1: writeln(j, i:6, x:9:3, b)
|
|
||||||
end; {test}
|
|
||||||
begin {main program}
|
|
||||||
mx := 15.96;
|
|
||||||
mi := 99;
|
|
||||||
test(r)
|
|
||||||
end.
|
|
||||||
@@ -1,32 +0,0 @@
|
|||||||
CFLAGS=-O
|
|
||||||
HOME=../../..
|
|
||||||
|
|
||||||
install \
|
|
||||||
all: em emdmp tables
|
|
||||||
|
|
||||||
tables: mktables $(HOME)/util/ass/ip_spec.t
|
|
||||||
mktables $(HOME)/util/ass/ip_spec.t tables
|
|
||||||
|
|
||||||
mktables: mktables.c $(HOME)/h/em_spec.h $(HOME)/h/em_flag.h \
|
|
||||||
$(HOME)/util/data/em_data.a $(HOME)/util/ass/ip_spec.h
|
|
||||||
cc -O -o mktables mktables.c $(HOME)/util/data/em_data.a
|
|
||||||
|
|
||||||
em.out: em.p
|
|
||||||
apc -mint -O em.p >emerrs ; mv e.out em.out
|
|
||||||
|
|
||||||
em: em.p
|
|
||||||
apc -O -i em.p >emerrs ; mv a.out em
|
|
||||||
|
|
||||||
nem.p: em.p
|
|
||||||
sed -e '/maxadr = t16/s//maxadr =t15/' -e '/maxdata = 8191; /s//maxdata = 14335;/' -e '/ adr=.*long/s// adr= 0..maxadr/' <em.p >nem.p
|
|
||||||
|
|
||||||
nem: nem.p
|
|
||||||
apc -O -i nem.p >emerrs ; mv a.out nem
|
|
||||||
|
|
||||||
emdmp: emdmp.c
|
|
||||||
cc -o emdmp -O emdmp.c
|
|
||||||
|
|
||||||
cmp:
|
|
||||||
|
|
||||||
pr:
|
|
||||||
@pr em.p mktables.c emdmp.c
|
|
||||||
@@ -1,5 +0,0 @@
|
|||||||
This interpreter is meant for inclusion in the EM manual.
|
|
||||||
Although slow, it showed decent behaviour on several tests.
|
|
||||||
The only monitor calls implemented are exit, read(untested),
|
|
||||||
write and ioctl - just reurns the correct code for telling it's
|
|
||||||
a terminal -
|
|
||||||
1767
doc/em/int/em.p
1767
doc/em/int/em.p
File diff suppressed because it is too large
Load Diff
@@ -1,210 +0,0 @@
|
|||||||
/*
|
|
||||||
* (c) copyright 1983 by the Vrije Universiteit, Amsterdam, The Netherlands.
|
|
||||||
*
|
|
||||||
* This product is part of the Amsterdam Compiler Kit.
|
|
||||||
*
|
|
||||||
* Permission to use, sell, duplicate or disclose this software must be
|
|
||||||
* obtained in writing. Requests for such permissions may be sent to
|
|
||||||
*
|
|
||||||
* Dr. Andrew S. Tanenbaum
|
|
||||||
* Wiskundig Seminarium
|
|
||||||
* Vrije Universiteit
|
|
||||||
* Postbox 7161
|
|
||||||
* 1007 MC Amsterdam
|
|
||||||
* The Netherlands
|
|
||||||
*
|
|
||||||
*/
|
|
||||||
|
|
||||||
/* Author: E.G. Keizer */
|
|
||||||
|
|
||||||
/* Print a readable version of the data in the post mortem dump */
|
|
||||||
/* dmpc [-s] [-dn,m] [file] */
|
|
||||||
|
|
||||||
#include "/usr/em/h/local.h"
|
|
||||||
#include <stdio.h>
|
|
||||||
#include <ctype.h>
|
|
||||||
|
|
||||||
int dflag = 0 ;
|
|
||||||
long l_low,l_high;
|
|
||||||
|
|
||||||
int sflag;
|
|
||||||
|
|
||||||
int wsize,asize;
|
|
||||||
long tsize,dsize;
|
|
||||||
long ignmask,uerrorproc,cause;
|
|
||||||
long pc,sp,lb,hp,pd,pb;
|
|
||||||
|
|
||||||
char *cstr[] = {
|
|
||||||
"Array bound error",
|
|
||||||
"Range bound error",
|
|
||||||
"Set error",
|
|
||||||
"Integer overflow",
|
|
||||||
"Float overflow",
|
|
||||||
"Float underflow",
|
|
||||||
"Divide by 0",
|
|
||||||
"Divide by 0.0",
|
|
||||||
"Integer undefined",
|
|
||||||
"Float undefined",
|
|
||||||
"Conversion error",
|
|
||||||
"User error 11",
|
|
||||||
"User error 12",
|
|
||||||
"User error 13",
|
|
||||||
"User error 14",
|
|
||||||
"User error 15",
|
|
||||||
"Stack overflow",
|
|
||||||
"Heap overflow",
|
|
||||||
"Illegal instruction",
|
|
||||||
"Illegal size parameter",
|
|
||||||
"Case error",
|
|
||||||
"Memory fault",
|
|
||||||
"Illegal pointer",
|
|
||||||
"Illegal pc",
|
|
||||||
"Bad argument of LAE",
|
|
||||||
"Bad monitor call",
|
|
||||||
"Bad line number",
|
|
||||||
"GTO descriptor error"
|
|
||||||
};
|
|
||||||
|
|
||||||
FILE *fcore;
|
|
||||||
char *core = "core" ;
|
|
||||||
int nbyte=0;
|
|
||||||
|
|
||||||
char *pname;
|
|
||||||
|
|
||||||
int readbyte();
|
|
||||||
int read2();
|
|
||||||
long readaddr();
|
|
||||||
long readword();
|
|
||||||
unsigned getbyte();
|
|
||||||
long getword();
|
|
||||||
long getaddr();
|
|
||||||
|
|
||||||
main(argc,argv) char **argv;
|
|
||||||
{
|
|
||||||
register i ;
|
|
||||||
long line,fileaddr;
|
|
||||||
char tok ;
|
|
||||||
|
|
||||||
scanargs(argc,argv); fcore=fopen(core,"r") ;
|
|
||||||
if ( fcore==NULL ) fatal("Can't open %s",core) ;
|
|
||||||
|
|
||||||
if ( read2()!=010255 ) fatal("not a post mortem dump");
|
|
||||||
if ( read2()!=VERSION ) fatal("wrong version dump file");
|
|
||||||
wsize=read2(); asize=read2();
|
|
||||||
if ( wsize>4 ) fatal("cannot handle word size %d",wsize) ;
|
|
||||||
if ( asize>4 ) fatal("cannot handle pointer size %d",asize) ;
|
|
||||||
tsize=readaddr(); dsize=readaddr();
|
|
||||||
ignmask=readaddr(); uerrorproc=readaddr(); cause=readaddr();
|
|
||||||
pc=readaddr(); sp=readaddr(); lb=readaddr(); hp=readaddr();
|
|
||||||
pd=readaddr(); pb=readaddr();
|
|
||||||
if ( sflag==0 ) {
|
|
||||||
line=getword(0L);
|
|
||||||
fileaddr=getaddr(4L);
|
|
||||||
if ( fileaddr ) {
|
|
||||||
for ( i=0 ; i<40 ; i++ ) {
|
|
||||||
tok=getbyte(fileaddr++) ;
|
|
||||||
if ( !isprint(tok) ) break ;
|
|
||||||
putc(tok,stdout);
|
|
||||||
}
|
|
||||||
printf(" ");
|
|
||||||
}
|
|
||||||
if ( line ) {
|
|
||||||
printf("line %D",line) ;
|
|
||||||
}
|
|
||||||
if ( fileaddr || line ) printf(", ");
|
|
||||||
fseek(fcore,512L,0);
|
|
||||||
|
|
||||||
if ( cause>27 ) {
|
|
||||||
printn("cause",cause) ;
|
|
||||||
} else {
|
|
||||||
prints("cause",cstr[(int)cause]);
|
|
||||||
}
|
|
||||||
printn("pc",pc);printn("sp",sp);printn("lb",lb);
|
|
||||||
printn("hp",hp);
|
|
||||||
if ( pd ) printn("pd",pd) ;
|
|
||||||
if ( pb ) printn("pb",pb) ;
|
|
||||||
printn("errproc",uerrorproc) ;
|
|
||||||
printn("ignmask",ignmask) ;
|
|
||||||
if ( tsize ) printn("Text size",tsize) ;
|
|
||||||
if ( dsize ) printn("Data size",dsize) ;
|
|
||||||
}
|
|
||||||
if ( dflag==0 ) return 0;
|
|
||||||
fatal("d-flag not implemeted (yet)");
|
|
||||||
return 1 ;
|
|
||||||
}
|
|
||||||
|
|
||||||
scanargs(argc,argv) char **argv ; {
|
|
||||||
pname=argv[0];
|
|
||||||
while ( argv++, argc-- > 1 ) {
|
|
||||||
switch( argv[0][0] ) {
|
|
||||||
case '-': switch( argv[0][1] ) {
|
|
||||||
case 's': sflag++ ; break ;
|
|
||||||
case 'l': dflag++ ; break ;
|
|
||||||
default : fatal(": [-s] [-ln.m] [file]") ;
|
|
||||||
} ;
|
|
||||||
break ;
|
|
||||||
default :core=argv[0] ;
|
|
||||||
}
|
|
||||||
}
|
|
||||||
}
|
|
||||||
|
|
||||||
prints(s1,s2) char *s1,*s2; {
|
|
||||||
printf("%-15s %s\n",s1,s2);
|
|
||||||
}
|
|
||||||
|
|
||||||
printn(s1,d) char *s1; long d; {
|
|
||||||
printf("%-15s %15ld\n",s1,d);
|
|
||||||
}
|
|
||||||
|
|
||||||
/* VARARGS1 */
|
|
||||||
fatal(s1,p1,p2,p3,p4,p5) char *s1 ; {
|
|
||||||
fprintf(stderr,"%s: ",pname);
|
|
||||||
fprintf(stderr,s1,p1,p2,p3,p4,p5) ;
|
|
||||||
fprintf(stderr,"\n") ;
|
|
||||||
exit(1) ;
|
|
||||||
}
|
|
||||||
|
|
||||||
int getb() {
|
|
||||||
int i ;
|
|
||||||
i=getc(fcore) ;
|
|
||||||
if ( i==EOF ) fatal("Premature EOF");
|
|
||||||
return i&0377 ;
|
|
||||||
}
|
|
||||||
|
|
||||||
int read2() {
|
|
||||||
int i ;
|
|
||||||
i=getb() ; return getb()*256 + i ;
|
|
||||||
}
|
|
||||||
|
|
||||||
long readaddr() {
|
|
||||||
long res ;
|
|
||||||
register int i ;
|
|
||||||
|
|
||||||
res=0 ;
|
|
||||||
for (i=0 ; i<asize ; i++ ) res |= getb()<<(8*i) ;
|
|
||||||
return res ;
|
|
||||||
}
|
|
||||||
|
|
||||||
long readword() {
|
|
||||||
long res ;
|
|
||||||
register int i ;
|
|
||||||
|
|
||||||
res=0 ;
|
|
||||||
for (i=0 ; i<wsize ; i++ ) res |= getb()<<(8*i) ;
|
|
||||||
return res ;
|
|
||||||
}
|
|
||||||
|
|
||||||
unsigned getbyte(a) long a ; {
|
|
||||||
fseek(fcore,a+512,0) ;
|
|
||||||
return getb() ;
|
|
||||||
}
|
|
||||||
|
|
||||||
long getword(a) long a ; {
|
|
||||||
fseek(fcore,a+512,0) ;
|
|
||||||
return readword() ;
|
|
||||||
}
|
|
||||||
|
|
||||||
long getaddr(a) long a ; {
|
|
||||||
fseek(fcore,a+512,0) ;
|
|
||||||
return readaddr() ;
|
|
||||||
}
|
|
||||||
@@ -1,244 +0,0 @@
|
|||||||
/*
|
|
||||||
* (c) copyright 1983 by the Vrije Universiteit, Amsterdam, The Netherlands.
|
|
||||||
*
|
|
||||||
* This product is part of the Amsterdam Compiler Kit.
|
|
||||||
*
|
|
||||||
* Permission to use, sell, duplicate or disclose this software must be
|
|
||||||
* obtained in writing. Requests for such permissions may be sent to
|
|
||||||
*
|
|
||||||
* Dr. Andrew S. Tanenbaum
|
|
||||||
* Wiskundig Seminarium
|
|
||||||
* Vrije Universiteit
|
|
||||||
* Postbox 7161
|
|
||||||
* 1007 MC Amsterdam
|
|
||||||
* The Netherlands
|
|
||||||
*
|
|
||||||
*/
|
|
||||||
|
|
||||||
/* Author: E.G. Keizer */
|
|
||||||
|
|
||||||
#include <stdio.h>
|
|
||||||
#include "/usr/em/util/ass/ip_spec.h"
|
|
||||||
#include "/usr/em/h/em_spec.h"
|
|
||||||
#include "/usr/em/h/em_flag.h"
|
|
||||||
|
|
||||||
/* This program reads the human readable interpreter specification
|
|
||||||
and produces a efficient machine representation that can be
|
|
||||||
translated by a C-compiler.
|
|
||||||
*/
|
|
||||||
|
|
||||||
#define ESCAP 256
|
|
||||||
|
|
||||||
int nerror = 0 ;
|
|
||||||
int atend = 0 ;
|
|
||||||
int line = 1 ;
|
|
||||||
int maxinsl= 0 ;
|
|
||||||
|
|
||||||
extern char em_mnem[][4] ;
|
|
||||||
char esca[] = "escape" ;
|
|
||||||
#define ename(no) ((no)==ESCAP?esca:em_mnem[(no)])
|
|
||||||
|
|
||||||
extern char em_flag[] ;
|
|
||||||
|
|
||||||
main(argc,argv) char **argv ; {
|
|
||||||
if ( argc>1 ) {
|
|
||||||
if ( freopen(argv[1],"r",stdin)==NULL) {
|
|
||||||
fatal("Cannot open %s",argv[1]) ;
|
|
||||||
}
|
|
||||||
}
|
|
||||||
if ( argc>2 ) {
|
|
||||||
if ( freopen(argv[2],"w",stdout)==NULL) {
|
|
||||||
fatal("Cannot create %s",argv[2]) ;
|
|
||||||
}
|
|
||||||
}
|
|
||||||
if ( argc>3 ) {
|
|
||||||
fatal("%s [ file [ file ] ]",argv[0]) ;
|
|
||||||
}
|
|
||||||
atend=0 ;
|
|
||||||
readin();
|
|
||||||
atend=1 ;
|
|
||||||
return nerror ;
|
|
||||||
}
|
|
||||||
|
|
||||||
readin() {
|
|
||||||
char *ident();
|
|
||||||
char *firstid ;
|
|
||||||
int opcode,flags;
|
|
||||||
int c;
|
|
||||||
|
|
||||||
while ( !feof(stdin) ) {
|
|
||||||
firstid=ident() ;
|
|
||||||
if ( *firstid=='\n' || feof(stdin) ) continue ;
|
|
||||||
opcode = getmnem(firstid) ;
|
|
||||||
printf("%d ",opcode+1) ;
|
|
||||||
flags = decflag(ident(),opcode) ;
|
|
||||||
switch(em_flag[opcode]&EM_PAR) {
|
|
||||||
case PAR_D: case PAR_F: case PAR_B: case PAR_L: case PAR_C:
|
|
||||||
putchar('S') ;
|
|
||||||
}
|
|
||||||
putchar(' ');
|
|
||||||
while ( (c=readchar())!='\n' && c!=EOF ) putchar(c) ;
|
|
||||||
putchar('\n') ;
|
|
||||||
}
|
|
||||||
}
|
|
||||||
|
|
||||||
char *ident() {
|
|
||||||
/* skip spaces and tabs, anything up to space,tab or eof is
|
|
||||||
a identifier.
|
|
||||||
Anything from # to end-of-line is an end-of-line.
|
|
||||||
End-of-line is an identifier all by itself.
|
|
||||||
*/
|
|
||||||
|
|
||||||
static char array[200] ;
|
|
||||||
register int c ;
|
|
||||||
register char *cc ;
|
|
||||||
|
|
||||||
do {
|
|
||||||
c=readchar() ;
|
|
||||||
} while ( c==' ' || c=='\t' ) ;
|
|
||||||
for ( cc=array ; cc<&array[(sizeof array) - 1] ; cc++ ) {
|
|
||||||
if ( c=='#' ) {
|
|
||||||
do {
|
|
||||||
c=readchar();
|
|
||||||
} while ( c!='\n' && c!=EOF ) ;
|
|
||||||
}
|
|
||||||
*cc = c ;
|
|
||||||
if ( c=='\n' && cc==array ) break ;
|
|
||||||
c=readchar() ;
|
|
||||||
if ( c=='\n' ) {
|
|
||||||
pushback(c) ;
|
|
||||||
break ;
|
|
||||||
}
|
|
||||||
if ( c==' ' || c=='\t' || c==EOF ) break ;
|
|
||||||
}
|
|
||||||
*++cc=0 ;
|
|
||||||
return array ;
|
|
||||||
}
|
|
||||||
|
|
||||||
int getmnem(str) char *str ; {
|
|
||||||
char (*ptr)[4] ;
|
|
||||||
|
|
||||||
for ( ptr = em_mnem ; *ptr<= &em_mnem[sp_lmnem][0] ; ptr++ ) {
|
|
||||||
if ( strcmp(*ptr,str)==0 ) return (ptr-em_mnem) ;
|
|
||||||
}
|
|
||||||
error("Illegal mnemonic") ;
|
|
||||||
return 0 ;
|
|
||||||
}
|
|
||||||
|
|
||||||
error(str,a1,a2,a3,a4,a5,a6) /* VARARGS1 */ char *str ; {
|
|
||||||
if ( !atend ) fprintf(stderr,"line %d: ",line) ;
|
|
||||||
fprintf(stderr,str,a1,a2,a3,a4,a5,a6) ;
|
|
||||||
fprintf(stderr,"\n");
|
|
||||||
nerror++ ;
|
|
||||||
}
|
|
||||||
|
|
||||||
mess(str,a1,a2,a3,a4,a5,a6) /* VARARGS1 */ char *str ; {
|
|
||||||
if ( !atend ) fprintf(stderr,"line %d: ",line) ;
|
|
||||||
fprintf(stderr,str,a1,a2,a3,a4,a5,a6) ;
|
|
||||||
fprintf(stderr,"\n");
|
|
||||||
}
|
|
||||||
|
|
||||||
fatal(str,a1,a2,a3,a4,a5,a6) /* VARARGS1 */ char *str ; {
|
|
||||||
error(str,a1,a2,a3,a4,a5,a6) ;
|
|
||||||
exit(1) ;
|
|
||||||
}
|
|
||||||
|
|
||||||
#define ILLGL -1
|
|
||||||
|
|
||||||
check(val) int val ; {
|
|
||||||
if ( val!=ILLGL ) error("Illegal flag combination") ;
|
|
||||||
}
|
|
||||||
|
|
||||||
int decflag(str,opc) char *str ; {
|
|
||||||
int type ;
|
|
||||||
int escape ;
|
|
||||||
int range ;
|
|
||||||
int wordm ;
|
|
||||||
int notzero ;
|
|
||||||
char c;
|
|
||||||
|
|
||||||
type=escape=range=wordm=notzero= ILLGL ;
|
|
||||||
while ( c= *str++ ) {
|
|
||||||
switch ( c ) {
|
|
||||||
case 'm' :
|
|
||||||
check(type) ; type=OPMINI ; break ;
|
|
||||||
case 's' :
|
|
||||||
check(type) ; type=OPSHORT ; break ;
|
|
||||||
case '-' :
|
|
||||||
check(type) ; type=OPNO ;
|
|
||||||
if ( (em_flag[opc]&EM_PAR)==PAR_W ) c='i' ;
|
|
||||||
break ;
|
|
||||||
case '1' :
|
|
||||||
check(type) ; type=OP8 ; break ;
|
|
||||||
case '2' :
|
|
||||||
check(type) ; type=OP16 ; break ;
|
|
||||||
case '4' :
|
|
||||||
check(type) ; type=OP32 ; break ;
|
|
||||||
case '8' :
|
|
||||||
check(type) ; type=OP64 ; break ;
|
|
||||||
case 'e' :
|
|
||||||
check(escape) ; escape=0 ; break ;
|
|
||||||
case 'N' :
|
|
||||||
check(range) ; range= 2 ; break ;
|
|
||||||
case 'P' :
|
|
||||||
check(range) ; range= 1 ; break ;
|
|
||||||
case 'w' :
|
|
||||||
check(wordm) ; wordm=0 ; break ;
|
|
||||||
case 'o' :
|
|
||||||
check(notzero) ; notzero=0 ; break ;
|
|
||||||
default :
|
|
||||||
error("Unknown flag") ;
|
|
||||||
}
|
|
||||||
putchar(c);
|
|
||||||
}
|
|
||||||
if ( type==ILLGL ) error("Type must be specified") ;
|
|
||||||
switch ( type ) {
|
|
||||||
case OP64 :
|
|
||||||
case OP32 :
|
|
||||||
if ( escape!=ILLGL ) error("Conflicting escapes") ;
|
|
||||||
escape=ILLGL ;
|
|
||||||
case OP16 :
|
|
||||||
case OP8 :
|
|
||||||
case OPSHORT :
|
|
||||||
case OPNO :
|
|
||||||
if ( notzero!=ILLGL ) mess("Improbable OPNZ") ;
|
|
||||||
if ( type==OPNO && range!=ILLGL ) {
|
|
||||||
mess("No operand in range") ;
|
|
||||||
}
|
|
||||||
}
|
|
||||||
if ( escape!=ILLGL ) type|=OPESC ;
|
|
||||||
if ( wordm!=ILLGL ) type|=OPWORD ;
|
|
||||||
switch ( range) {
|
|
||||||
case ILLGL : type|=OP_BOTH ; break ;
|
|
||||||
case 1 : type|=OP_POS ; break ;
|
|
||||||
case 2 : type|=OP_NEG ; break ;
|
|
||||||
}
|
|
||||||
if ( notzero!=ILLGL ) type|=OPNZ ;
|
|
||||||
return type ;
|
|
||||||
}
|
|
||||||
|
|
||||||
static int pushchar ;
|
|
||||||
static int pushf ;
|
|
||||||
|
|
||||||
int readchar() {
|
|
||||||
int c ;
|
|
||||||
|
|
||||||
if ( pushf ) {
|
|
||||||
pushf=0 ;
|
|
||||||
c = pushchar ;
|
|
||||||
} else {
|
|
||||||
if ( feof(stdin) ) return EOF ;
|
|
||||||
c=getc(stdin) ;
|
|
||||||
}
|
|
||||||
if ( c=='\n' ) line++ ;
|
|
||||||
return c ;
|
|
||||||
}
|
|
||||||
|
|
||||||
pushback(c) {
|
|
||||||
if ( pushf ) {
|
|
||||||
fatal("Double pushback") ;
|
|
||||||
}
|
|
||||||
pushf++ ;
|
|
||||||
pushchar=c ;
|
|
||||||
if ( c=='\n' ) line-- ;
|
|
||||||
}
|
|
||||||
180
doc/em/intro.nr
180
doc/em/intro.nr
@@ -1,180 +0,0 @@
|
|||||||
.BP
|
|
||||||
.S1 "INTRODUCTION"
|
|
||||||
EM is a family of intermediate languages designed for producing
|
|
||||||
portable compilers.
|
|
||||||
The general strategy is for a program called
|
|
||||||
.B front end
|
|
||||||
to translate the source program to EM.
|
|
||||||
Another program,
|
|
||||||
.B back
|
|
||||||
.BW end
|
|
||||||
translates EM to target assembly language.
|
|
||||||
Alternatively, the EM code can be assembled to a binary form
|
|
||||||
and interpreted.
|
|
||||||
These considerations led to the following goals:
|
|
||||||
.IS 2 10
|
|
||||||
.PS 1 4
|
|
||||||
.PT
|
|
||||||
The design should allow translation to,
|
|
||||||
or interpretation on, a wide range of existing machines.
|
|
||||||
Design decisions should be delayed as far as possible
|
|
||||||
and the implications of these decisions should
|
|
||||||
be localized as much as possible.
|
|
||||||
.N
|
|
||||||
The current microcomputer technology offers 8, 16 and 32 bit machines
|
|
||||||
with various sizes of address space.
|
|
||||||
EM should be flexible enough to be useful on most of these
|
|
||||||
machines.
|
|
||||||
The differences between the members of the EM family should only
|
|
||||||
concern the wordsize and address space size.
|
|
||||||
.PT
|
|
||||||
The architecture should ease the task of code generation for
|
|
||||||
high level languages such as Pascal, C, Ada, Algol 68, BCPL.
|
|
||||||
.PT
|
|
||||||
The instruction set used by the interpreter should be compact,
|
|
||||||
to reduce the amount of memory needed
|
|
||||||
for program storage, and to reduce the time needed to transmit
|
|
||||||
programs over communication lines.
|
|
||||||
.PT
|
|
||||||
It should be designed with microprogrammed implementations in
|
|
||||||
mind; in particular, the use of many short fields within
|
|
||||||
instruction opcodes should be avoided, because their extraction by the
|
|
||||||
microprogram or conversion to other instruction formats is inefficient.
|
|
||||||
.PE
|
|
||||||
.IE
|
|
||||||
.A
|
|
||||||
The basic architecture is based on the concept of a stack. The stack
|
|
||||||
is used for procedure return addresses, actual parameters, local variables,
|
|
||||||
and arithmetic operations.
|
|
||||||
There are several built-in object types,
|
|
||||||
for example, signed and unsigned integers,
|
|
||||||
floating point numbers, pointers and sets of bits.
|
|
||||||
There are instructions to push and pop objects
|
|
||||||
to and from the stack.
|
|
||||||
The push and pop instructions are not typed.
|
|
||||||
They only care about the size of the objects.
|
|
||||||
For each built-in type there are
|
|
||||||
reverse Polish type instructions that pop one or more
|
|
||||||
objects from the top of
|
|
||||||
the stack, perform an operation, and push the result back onto the
|
|
||||||
stack.
|
|
||||||
For all types except pointers,
|
|
||||||
these instructions have the object size
|
|
||||||
as argument.
|
|
||||||
.P
|
|
||||||
There are no visible general registers used for arithmetic operands
|
|
||||||
etc. This is in contrast to most third generation computers, which usually
|
|
||||||
have 8 or 16 general registers. The decision not to have a group of
|
|
||||||
general registers was fully intentional, and follows W.L. Van der
|
|
||||||
Poel's dictum that a machine should have 0, 1, or an infinite
|
|
||||||
number of any feature. General registers have two primary uses: to hold
|
|
||||||
intermediate results of complicated expressions, e.g.
|
|
||||||
.IS 5 0 1
|
|
||||||
((a*b + c*d)/e + f*g/h) * i
|
|
||||||
.IE 1
|
|
||||||
and to hold local variables.
|
|
||||||
.P
|
|
||||||
Various studies
|
|
||||||
have shown that the average expression has fewer than two operands,
|
|
||||||
making the former use of registers of doubtful value. The present trend
|
|
||||||
toward structured programs consisting of many small
|
|
||||||
procedures greatly reduces the value of registers to hold local variables
|
|
||||||
because the large number of procedure calls implies a large overhead in
|
|
||||||
saving and restoring the registers at every call.
|
|
||||||
.BP
|
|
||||||
.P
|
|
||||||
Although there are no general purpose registers, there are a
|
|
||||||
few internal registers with specific functions as follows:
|
|
||||||
.IS 2
|
|
||||||
.N 1
|
|
||||||
.TS
|
|
||||||
tab(:);
|
|
||||||
l 1 l l.
|
|
||||||
PC:-:Program Counter:Pointer to next instruction
|
|
||||||
LB:-:Local Base:Points to base of the local variables \
|
|
||||||
in the current procedure.
|
|
||||||
SP:-:Stack Pointer:Points to the highest occupied word on the stack.
|
|
||||||
HP:-:Heap Pointer:Points to the top of the heap area.
|
|
||||||
.TE 1
|
|
||||||
.IE
|
|
||||||
.A
|
|
||||||
Furthermore, reverse Polish code is much easier to generate than
|
|
||||||
multi-register machine code, especially if highly efficient code is
|
|
||||||
desired.
|
|
||||||
When translating to assembly language the back end can make
|
|
||||||
good use of the target machine's registers.
|
|
||||||
An EM machine can
|
|
||||||
achieve high performance by keeping part of the stack
|
|
||||||
in high speed storage (a cache or microprogram scratchpad memory) rather
|
|
||||||
than in primary memory.
|
|
||||||
.P
|
|
||||||
Again according to van der Poel's dictum,
|
|
||||||
all EM instructions have zero or one argument.
|
|
||||||
We believe that instructions needing two arguments
|
|
||||||
can be split into two simpler ones.
|
|
||||||
The simpler ones can probably be used in other
|
|
||||||
circumstances as well.
|
|
||||||
Moreover, these two instructions together often
|
|
||||||
have a shorter encoding than the single
|
|
||||||
instruction before.
|
|
||||||
.P
|
|
||||||
This document describes EM at three different levels:
|
|
||||||
the abstract level, the assembly language level and
|
|
||||||
the machine language level.
|
|
||||||
.A
|
|
||||||
The most important level is that of the abstract EM architecture.
|
|
||||||
This level deals with the basic design issues.
|
|
||||||
Only the functional capabilities of instructions are relevant, not their
|
|
||||||
format or encoding.
|
|
||||||
Most chapters of this document refer to the abstract level
|
|
||||||
and it is explicitly stated whenever
|
|
||||||
another level is described.
|
|
||||||
.A
|
|
||||||
The assembly language is intended for the compiler writer.
|
|
||||||
It presents a more or less orthogonal instruction
|
|
||||||
set and provides symbolic names for data.
|
|
||||||
Moreover, it facilitates the linking of
|
|
||||||
separately compiled 'modules' into a single program
|
|
||||||
by providing several pseudoinstructions.
|
|
||||||
.A
|
|
||||||
The machine language is designed for interpretation with a compact
|
|
||||||
program text and easy decoding.
|
|
||||||
The binary representation of the machine language instruction set is
|
|
||||||
far from orthogonal.
|
|
||||||
Frequent instructions have a short opcode.
|
|
||||||
The encoding is fully byte oriented.
|
|
||||||
These bytes do not contain small bit fields, because
|
|
||||||
bit fields would slow down decoding considerably.
|
|
||||||
.P
|
|
||||||
A common use for EM is for producing portable (cross) compilers.
|
|
||||||
When used this way, the compilers produce
|
|
||||||
EM assembly language as their output.
|
|
||||||
To run the compiled program on the target machine,
|
|
||||||
the back end, translates the EM assembly language to
|
|
||||||
the target machine's assembly language.
|
|
||||||
When this approach is used, the format of the EM
|
|
||||||
machine language instructions is irrelevant.
|
|
||||||
On the other hand, when writing an interpreter for EM machine language
|
|
||||||
programs, the interpreter must deal with the machine language
|
|
||||||
and not with the symbolic assembly language.
|
|
||||||
.P
|
|
||||||
As mentioned above, the
|
|
||||||
current microcomputer technology offers 8, 16 and 32 bit
|
|
||||||
machines with address spaces ranging from 2\v'-0.5m'16\v'0.5m'
|
|
||||||
to 2\v'-0.5m'32\v'0.5m' bytes.
|
|
||||||
Having one size of pointers and integers restricts
|
|
||||||
the usefulness of the language.
|
|
||||||
We decided to have a different language for each combination of
|
|
||||||
word and pointer size.
|
|
||||||
All languages offer the same instruction set and differ only in
|
|
||||||
memory alignment restrictions and the implicit size assumed in
|
|
||||||
several instructions.
|
|
||||||
The languages
|
|
||||||
differ slightly for the
|
|
||||||
different size combinations.
|
|
||||||
For example: the
|
|
||||||
size of any object on the stack and alignment restrictions.
|
|
||||||
The wordsize is restricted to powers of 2 and
|
|
||||||
the pointer size must be a multiple of the wordsize.
|
|
||||||
Almost all programs handling EM will be parametrized with word
|
|
||||||
and pointer size.
|
|
||||||
376
doc/em/iotrap.nr
376
doc/em/iotrap.nr
@@ -1,376 +0,0 @@
|
|||||||
.SN 8
|
|
||||||
.VS 1 0
|
|
||||||
.BP
|
|
||||||
.S1 "ENVIRONMENT INTERACTIONS"
|
|
||||||
EM programs can interact with their environment in three ways.
|
|
||||||
Two, starting/stopping and monitor calls, are dealt with in this chapter.
|
|
||||||
The remaining way to interact, interrupts, will be treated
|
|
||||||
together with traps in chapter 9.
|
|
||||||
.S2 "Program starting and stopping"
|
|
||||||
EM user programs start with a call to a procedure called
|
|
||||||
m_a_i_n.
|
|
||||||
The assembler and backends look for the definition of a procedure
|
|
||||||
with this name in their input.
|
|
||||||
The call passes three parameters to the procedure.
|
|
||||||
The parameters are similar to the parameters supplied by the
|
|
||||||
UNIX
|
|
||||||
.FS
|
|
||||||
UNIX is a Trademark of Bell Laboratories.
|
|
||||||
.FE
|
|
||||||
operating system to C programs.
|
|
||||||
These parameters are often called
|
|
||||||
.BW argc ,
|
|
||||||
.B argv
|
|
||||||
and
|
|
||||||
.BW envp .
|
|
||||||
Argc is the parameter nearest to LB and is a wordsized integer.
|
|
||||||
The other two are pointers to the first element of an array of
|
|
||||||
string pointers.
|
|
||||||
.N
|
|
||||||
The
|
|
||||||
.B argv
|
|
||||||
array contains
|
|
||||||
.B argc
|
|
||||||
strings, the first of which contains the program call name.
|
|
||||||
The other strings in the
|
|
||||||
.B argv
|
|
||||||
array are the program parameters.
|
|
||||||
.P
|
|
||||||
The
|
|
||||||
.B envp
|
|
||||||
array contains strings in the form "name=string", where 'name'
|
|
||||||
is the name of an environment variable and string its value.
|
|
||||||
The
|
|
||||||
.B envp
|
|
||||||
is terminated by a zero pointer.
|
|
||||||
.P
|
|
||||||
An EM user program stops if the program returns from the first
|
|
||||||
invocation of m_a_i_n.
|
|
||||||
The contents of the function return area are used to procure a
|
|
||||||
wordsized program return code.
|
|
||||||
EM programs also stop when traps and interrupts occur that are
|
|
||||||
not caught and when the exit monitor call is executed.
|
|
||||||
.S2 "Input/Output and other monitor calls"
|
|
||||||
EM differs from most conventional machines in that it has high level i/o
|
|
||||||
instructions.
|
|
||||||
Typical instructions are OPEN FILE and READ FROM FILE instead
|
|
||||||
of low level instructions such as setting and clearing
|
|
||||||
bits in device registers.
|
|
||||||
By providing such high level i/o primitives, the task of implementing
|
|
||||||
EM on various non EM machines is made considerably easier.
|
|
||||||
.P
|
|
||||||
I/O is initiated by the MON instruction, which expects an iocode on top
|
|
||||||
of the stack.
|
|
||||||
Often there are also parameters which are pushed on the
|
|
||||||
stack in reverse order, that is: last
|
|
||||||
parameter first.
|
|
||||||
Some i/o functions also provide results, which are returned on the stack.
|
|
||||||
In the list of monitor calls we use several types of parameters and results,
|
|
||||||
these types consist of integers and unsigneds of varying sizes, but never
|
|
||||||
smaller than the wordsize, and the two pointer types.
|
|
||||||
.N 1
|
|
||||||
The names of the types used are:
|
|
||||||
.IS 4
|
|
||||||
.PS - 10
|
|
||||||
.PT int
|
|
||||||
an integer of wordsize
|
|
||||||
.PT int2
|
|
||||||
an integer whose size is the maximum of the wordsize and 2
|
|
||||||
bytes
|
|
||||||
.PT int4
|
|
||||||
an integer whose size is the maximum of the wordsize and 4
|
|
||||||
bytes
|
|
||||||
.PT intp
|
|
||||||
an integer with the size of a pointer
|
|
||||||
.PT uns2
|
|
||||||
an unsigned integer whose size is the maximum of the wordsize and 2
|
|
||||||
.PT unsp
|
|
||||||
an unsigned integer with the size of a pointer
|
|
||||||
.PT ptr
|
|
||||||
a pointer into data space
|
|
||||||
.PE 1
|
|
||||||
.IE 0
|
|
||||||
The table below lists the i/o codes with their results and
|
|
||||||
parameters.
|
|
||||||
This list is similar to the system calls of the UNIX Version 7
|
|
||||||
operating system.
|
|
||||||
.BP
|
|
||||||
.A
|
|
||||||
To execute a monitor call, proceed as follows:
|
|
||||||
.IS 2
|
|
||||||
.N 1
|
|
||||||
.PS a 4 "" )
|
|
||||||
.PT
|
|
||||||
Stack the parameters, in reverse order, last parameter first.
|
|
||||||
.PT
|
|
||||||
Push the monitor call number (iocode) onto the stack.
|
|
||||||
.PT
|
|
||||||
Execute the MON instruction.
|
|
||||||
.PE 1
|
|
||||||
.IE
|
|
||||||
An error code is present on the top of the stack after
|
|
||||||
execution of most monitor calls.
|
|
||||||
If this error code is zero, the call performed the action
|
|
||||||
requested and the results are available on top of the stack.
|
|
||||||
Non-zero error codes indicate a failure, in this case no
|
|
||||||
results are available and the error code has been pushed twice.
|
|
||||||
This construction enables programs to test for failure with a
|
|
||||||
single instruction (~TEQ or TNE~) and still find out the cause of
|
|
||||||
the failure.
|
|
||||||
The result name 'e' is reserved for the error code.
|
|
||||||
.N 1
|
|
||||||
List of monitor calls.
|
|
||||||
.DS B
|
|
||||||
number name parameters results function
|
|
||||||
|
|
||||||
1 Exit status:int Terminate this process
|
|
||||||
2 Fork e,flag,pid:int Spawn new process
|
|
||||||
3 Read fildes:int;buf:ptr;nbytes:unsp
|
|
||||||
e:int;rbytes:unsp Read from file
|
|
||||||
4 Write fildes:int;buf:ptr;nbytes:unsp
|
|
||||||
e:int;wbytes:unsp Write on a file
|
|
||||||
5 Open string:ptr;flag:int
|
|
||||||
e,fildes:int Open file for read and/or write
|
|
||||||
6 Close fildes:int e:int Close a file
|
|
||||||
7 Wait e:int;status,pid:int2
|
|
||||||
Wait for child
|
|
||||||
8 Creat string:ptr;mode:int
|
|
||||||
e,fildes:int Create a new file
|
|
||||||
9 Link string1,string2:ptr
|
|
||||||
e:int Link to a file
|
|
||||||
10 Unlink string:ptr e:int Remove directory entry
|
|
||||||
12 Chdir string:ptr e:int Change default directory
|
|
||||||
14 Mknod string:ptr;mode,addr:int2
|
|
||||||
e:int Make a special file
|
|
||||||
15 Chmod string:ptr;mode:int2
|
|
||||||
e:int Change mode of file
|
|
||||||
16 Chown string:ptr;owner,group:int2
|
|
||||||
e:int Change owner/group of a file
|
|
||||||
18 Stat string,statbuf:ptr
|
|
||||||
e:int Get file status
|
|
||||||
19 Lseek fildes:int;off:int4;whence:int
|
|
||||||
e:int;oldoff:int4 Move read/write pointer
|
|
||||||
20 Getpid pid:int2 Get process identification
|
|
||||||
21 Mount special,string:ptr;rwflag:int
|
|
||||||
e:int Mount file system
|
|
||||||
22 Umount special:ptr e:int Unmount file system
|
|
||||||
23 Setuid userid:int2 e:int Set user ID
|
|
||||||
24 Getuid e_uid,r_uid:int2 Get user ID
|
|
||||||
25 Stime time:int4 e:int Set time and date
|
|
||||||
26 Ptrace request:int;pid:int2;addr:ptr;data:int
|
|
||||||
e,value:int Process trace
|
|
||||||
27 Alarm seconds:uns2 previous:uns2 Schedule signal
|
|
||||||
28 Fstat fildes:int;statbuf:ptr
|
|
||||||
e:int Get file status
|
|
||||||
29 Pause Stop until signal
|
|
||||||
30 Utime string,timep:ptr
|
|
||||||
e:int Set file times
|
|
||||||
33 Access string,mode:int e:int Determine file accessibility
|
|
||||||
34 Nice incr:int Set program priority
|
|
||||||
35 Ftime bufp:ptr e:int Get date and time
|
|
||||||
36 Sync Update filesystem
|
|
||||||
37 Kill pid:int2;sig:int
|
|
||||||
e:int Send signal to a process
|
|
||||||
41 Dup fildes,newfildes:int
|
|
||||||
e,fildes:int Duplicate a file descriptor
|
|
||||||
42 Pipe e,w_des,r_des:int Create a pipe
|
|
||||||
43 Times buffer:ptr Get process times
|
|
||||||
44 Profil buff:ptr;bufsiz,offset,scale:intp Execution time profile
|
|
||||||
46 Setgid gid:int2 e:int Set group ID
|
|
||||||
47 Getgid e_gid,r_gid:int Get group ID
|
|
||||||
48 Sigtrp trapno,signo:int
|
|
||||||
e,prevtrap:int See below
|
|
||||||
51 Acct file:ptr e:int Turn accounting on or off
|
|
||||||
53 Lock flag:int e:int Lock a process
|
|
||||||
54 Ioctl fildes,request:int;argp:ptr
|
|
||||||
e:int Control device
|
|
||||||
56 Mpxcall cmd:int;vec:ptr e:int Multiplexed file handling
|
|
||||||
59 Exece name,argv,envp:ptr
|
|
||||||
e:int Execute a file
|
|
||||||
60 Umask complmode:int2 oldmask:int2 Set file creation mode mask
|
|
||||||
61 Chroot string:ptr e:int Change root directory
|
|
||||||
.DE 1
|
|
||||||
Codes 0, 11, 13, 17, 31, 32, 38, 39, 40, 45, 49, 50, 52,
|
|
||||||
55, 57, 58, 62, and 63 are
|
|
||||||
not used.
|
|
||||||
.P
|
|
||||||
All monitor calls, except fork and sigtrp
|
|
||||||
are the same as the UNIX version 7 system calls.
|
|
||||||
.P
|
|
||||||
The sigtrp entry maps UNIX signals onto EM interrupts.
|
|
||||||
Normally, trapno is in the range 0 to 252.
|
|
||||||
In that case it requests that signal signo
|
|
||||||
will cause trap trapno to occur.
|
|
||||||
When given trap number -2, default signal handling is reset, and when given
|
|
||||||
trap number -3, the signal is ignored.
|
|
||||||
.P
|
|
||||||
The flag returned by fork is 1 in the child process and 0 in
|
|
||||||
the parent.
|
|
||||||
The pid returned is the process-id of the other process.
|
|
||||||
.BP
|
|
||||||
.S1 "TRAPS AND INTERRUPTS"
|
|
||||||
EM provides a means for the user program to catch all traps
|
|
||||||
generated by the program itself, the hardware, or external conditions.
|
|
||||||
This mechanism uses five instructions: LIM, SIM, SIG, TRP and RTT.
|
|
||||||
This section of the manual may be omitted on the first reading since it
|
|
||||||
presupposes knowledge of the EM instruction set.
|
|
||||||
.P
|
|
||||||
The action taken when a trap occures is determined by the value
|
|
||||||
of an internal EM trap register.
|
|
||||||
This register contains a pointer to a procedure.
|
|
||||||
Initially the pointer used is zero and all traps halt the
|
|
||||||
program with, hopefully, a useful message to the outside world.
|
|
||||||
The SIG instruction can be used to alter the trap register,
|
|
||||||
it pops a procedure pointer from the
|
|
||||||
stack into the trap register.
|
|
||||||
When a trap occurs after storing a nonzero value in the trap
|
|
||||||
register, the procedure pointed to by the trap register
|
|
||||||
is called with the trap number
|
|
||||||
as the only parameter (see below).
|
|
||||||
SIG returns the previous value of the trap register on the
|
|
||||||
stack.
|
|
||||||
Two consecutive SIGs are a no-op.
|
|
||||||
When a trap occurs, the trap register is reset to its initial
|
|
||||||
condition, to prevent recursive traps from hanging the machine up,
|
|
||||||
e.g. stack overflow in the stack overflow handling procedure.
|
|
||||||
.P
|
|
||||||
The runtime systems for some languages need to ignore some EM
|
|
||||||
traps.
|
|
||||||
EM offers a feature called the ignore mask.
|
|
||||||
It contains one bit for each of the lowest 16 trap numbers.
|
|
||||||
The bits are numbered 0 to 15, with the least significant bit
|
|
||||||
having number 0.
|
|
||||||
If a certain bit is 1 the corresponding trap never
|
|
||||||
occurs and processing simply continues.
|
|
||||||
The actions performed by the offending instruction are
|
|
||||||
described by the Pascal program in appendix A.
|
|
||||||
.N
|
|
||||||
If the bit is 0, traps are not ignored.
|
|
||||||
The instructions LIM and SIM allow copying and replacement of
|
|
||||||
the ignore mask.~
|
|
||||||
.P
|
|
||||||
The TRP instruction generates a trap, the trap number being found on the
|
|
||||||
stack.
|
|
||||||
This is, among other things,
|
|
||||||
useful for library procedures and runtime systems.
|
|
||||||
It can also be used by a low level trap procedure to pass the trap to a
|
|
||||||
higher level one (see example below).
|
|
||||||
.P
|
|
||||||
The RTT instruction returns from the trap procedure and continues after the
|
|
||||||
trap.
|
|
||||||
In the list below all traps marked with an asterisk ('*') are
|
|
||||||
considered to be fatal and it is explicitly undefined what happens if
|
|
||||||
you try to restart after the trap.
|
|
||||||
.P
|
|
||||||
The way a trap procedure is called is completely compatible
|
|
||||||
with normal calling conventions. The only way a trap procedure
|
|
||||||
differs from normal procedures is the return. It has to use RTT instead
|
|
||||||
of RET. This is necessary because the complete runtime status is saved on the
|
|
||||||
stack before calling the procedure and all this status has to be reloaded.
|
|
||||||
Error numbers are in the range 0 to 252.
|
|
||||||
The trap numbers are divided into three categories:
|
|
||||||
.IS 4
|
|
||||||
.N 1
|
|
||||||
.PS - 10
|
|
||||||
.PT ~~0-~63
|
|
||||||
EM machine errors, e.g. illegal instruction.
|
|
||||||
.PS - 8
|
|
||||||
.PT ~0-15
|
|
||||||
maskable
|
|
||||||
.PT 16-63
|
|
||||||
not maskable
|
|
||||||
.PE
|
|
||||||
.PT ~64-127
|
|
||||||
Reserved for use by compilers, run time systems, etc.
|
|
||||||
.PT 128-252
|
|
||||||
Available for user programs.
|
|
||||||
.PE 1
|
|
||||||
.IE
|
|
||||||
EM machine errors are numbered as follows:
|
|
||||||
.DS I 5
|
|
||||||
.TS
|
|
||||||
tab(@);
|
|
||||||
n l l.
|
|
||||||
0@EARRAY@Array bound error
|
|
||||||
1@ERANGE@Range bound error
|
|
||||||
2@ESET@Set bound error
|
|
||||||
3@EIOVFL@Integer overflow
|
|
||||||
4@EFOVFL@Floating overflow
|
|
||||||
5@EFUNFL@Floating underflow
|
|
||||||
6@EIDIVZ@Divide by 0
|
|
||||||
7@EFDIVZ@Divide by 0.0
|
|
||||||
8@EIUND@Undefined integer
|
|
||||||
9@EFUND@Undefined float
|
|
||||||
10@ECONV@Conversion error
|
|
||||||
16*@ESTACK@Stack overflow
|
|
||||||
17*@EHEAP@Heap overflow
|
|
||||||
18*@EILLINS@Illegal instruction
|
|
||||||
19*@EODDZ@Illegal size argument
|
|
||||||
20*@ECASE@Case error
|
|
||||||
21*@EMEMFLT@Addressing non existent memory
|
|
||||||
22*@EBADPTR@Bad pointer used
|
|
||||||
23*@EBADPC@Program counter out of range
|
|
||||||
24@EBADLAE@Bad argument of LAE
|
|
||||||
25@EBADMON@Bad monitor call
|
|
||||||
26@EBADLIN@Argument of LIN too high
|
|
||||||
27@EBADGTO@GTO descriptor error
|
|
||||||
.TE
|
|
||||||
.DE 0
|
|
||||||
.P
|
|
||||||
As an example,
|
|
||||||
suppose a subprocedure has to be written to do a numeric
|
|
||||||
calculation.
|
|
||||||
When an overflow occurs the computation has to be stopped and
|
|
||||||
the higher level procedure must be resumed.
|
|
||||||
This can be programmed as follows using the mechanism described above:
|
|
||||||
.DS B
|
|
||||||
mes 2,2,2 ; set sizes
|
|
||||||
ersave
|
|
||||||
bss 2,0,0 ; Room to save previous value of trap procedure
|
|
||||||
msave
|
|
||||||
bss 2,0,0 ; Room to save previous value of trap mask
|
|
||||||
|
|
||||||
pro calcule,0 ; entry point
|
|
||||||
lxl 0 ; fill in non-local goto descriptor with LB
|
|
||||||
ste jmpbuf+4
|
|
||||||
lor 1 ; and SP
|
|
||||||
ste jmpbuf+2
|
|
||||||
lim ; get current ignore mask
|
|
||||||
ste msave ; save it
|
|
||||||
lim
|
|
||||||
loc 4 ; bit for EFOVFL
|
|
||||||
ior 2 ; set in mask
|
|
||||||
sim ; ignore EFOVFL from now on
|
|
||||||
lpi $catch ; load procedure identifier
|
|
||||||
sig ; catch wil get all traps now
|
|
||||||
ste ersave ; save previous trap procedure identifier
|
|
||||||
; perform calculation now, possibly generating overflow
|
|
||||||
1 ; label jumped to by catch procedure
|
|
||||||
loe ersave ; get old trap procedure
|
|
||||||
sig ; refer all following trap to old procedure
|
|
||||||
asp 2 ; remove result of sig
|
|
||||||
loe msave ; restore previous mask
|
|
||||||
sim ; done now
|
|
||||||
; load result of calculation
|
|
||||||
ret 2 ; return result
|
|
||||||
jmpbuf
|
|
||||||
con *1,0,0
|
|
||||||
end
|
|
||||||
.DE 0
|
|
||||||
.VS 1 1
|
|
||||||
.DS
|
|
||||||
Example of catch procedure
|
|
||||||
pro catch,0 ; Local procedure that must catch the overflow trap
|
|
||||||
lol 2 ; Load trap number
|
|
||||||
loc 4 ; check for overflow
|
|
||||||
bne *1 ; if other trap, call higher trap procedure
|
|
||||||
gto jmpbuf ; return to procedure calcule
|
|
||||||
1 ; other trap has occurred
|
|
||||||
loe ersave ; previous trap procedure
|
|
||||||
sig ; other procedure will get the traps now
|
|
||||||
asp 2 ; remove the result of sig
|
|
||||||
lol 2 ; stack trap number
|
|
||||||
trp ; call other trap procedure
|
|
||||||
rtt ; if other procedure returns, do the same
|
|
||||||
end
|
|
||||||
.DE
|
|
||||||
@@ -1,6 +0,0 @@
|
|||||||
BEGIN { printf ".TS\nlw(6) lw(8) rw(3) rw(6) 14 lw(6) lw(8) rw(3) rw(6) 14 lw(6) lw(8) rw(3) rw(6).\n" }
|
|
||||||
NF == 4 { printf "%s\t%s\t%d\t%d",$1,$2,$3,$4 }
|
|
||||||
NF == 3 { printf "%s\t%s\t\t%d",$1,$2,$3 }
|
|
||||||
{ if ( NR%3 == 0 ) printf("\n") ; else printf("\t"); }
|
|
||||||
END { if ( NR%3 != 0 ) printf("\n")
|
|
||||||
printf ".TE\n" }
|
|
||||||
@@ -1,61 +0,0 @@
|
|||||||
.SN 3
|
|
||||||
.BP
|
|
||||||
.S1 "INSTRUCTION ADDRESS SPACE"
|
|
||||||
The instruction space of the EM machine contains
|
|
||||||
the code for procedures.
|
|
||||||
Tables necessary for the execution of this code, for example, procedure
|
|
||||||
descriptor tables, may also be present.
|
|
||||||
The instruction space does not change during
|
|
||||||
the execution of a program, so that it may be
|
|
||||||
protected.
|
|
||||||
No further restrictions to the instruction address space are
|
|
||||||
necessary for the abstract and assembly language level.
|
|
||||||
.P
|
|
||||||
Each procedure has a single entry point: the first instruction.
|
|
||||||
A special type of pointer identifies a procedure.
|
|
||||||
Pointers into the instruction
|
|
||||||
address space have the same size as pointers into data space and
|
|
||||||
can, for example, contain the address of the first instruction
|
|
||||||
or an index in a procedure descriptor table.
|
|
||||||
.A
|
|
||||||
There is a single EM program counter, PC, pointing
|
|
||||||
to the next instruction to be executed.
|
|
||||||
The procedure pointed to by PC is
|
|
||||||
called the 'current' procedure.
|
|
||||||
A procedure may call another procedure using the CAL or CAI
|
|
||||||
instruction.
|
|
||||||
The calling procedure remains 'active' and is resumed whenever the called
|
|
||||||
procedure returns.
|
|
||||||
Note that a procedure has several 'active' invocations when
|
|
||||||
called recursively.
|
|
||||||
.P
|
|
||||||
Each procedure must return properly.
|
|
||||||
It is not allowed to fall through to the
|
|
||||||
code of the next procedure.
|
|
||||||
There are several ways to exit from a procedure:
|
|
||||||
.IS 3
|
|
||||||
.PS
|
|
||||||
.PT
|
|
||||||
the RET instruction, which returns to the
|
|
||||||
calling procedure.
|
|
||||||
.PT
|
|
||||||
the RTT instruction, which exits a trap handling routine and resumes
|
|
||||||
the trapping instruction (see next chapter).
|
|
||||||
.PT
|
|
||||||
the GTO instruction, which is used for non-local goto's.
|
|
||||||
It can remove several frames from the stack and transfer
|
|
||||||
control to an active procedure.
|
|
||||||
.PE
|
|
||||||
.IE
|
|
||||||
.P
|
|
||||||
All branch instructions can transfer control
|
|
||||||
to any label within the same procedure.
|
|
||||||
Branch instructions can never jump out of a procedure.
|
|
||||||
.P
|
|
||||||
Several language implementations use a so called procedure
|
|
||||||
instance identifier, a combination of a procedure identifier and
|
|
||||||
the LB of a stack frame, also called static link.
|
|
||||||
.P
|
|
||||||
The program text for each procedure, as well as any tables,
|
|
||||||
are fragments and can be allocated anywhere
|
|
||||||
in the instruction address space.
|
|
||||||
2525
doc/em/itables
2525
doc/em/itables
File diff suppressed because it is too large
Load Diff
390
doc/em/mach.nr
390
doc/em/mach.nr
@@ -1,390 +0,0 @@
|
|||||||
.BP
|
|
||||||
.SN 10
|
|
||||||
.S1 "EM MACHINE LANGUAGE"
|
|
||||||
The EM machine language is designed to make program text compact
|
|
||||||
and to make decoding easy.
|
|
||||||
Compact program text has many advantages: programs execute faster,
|
|
||||||
programs occupy less primary and secondary storage and loading
|
|
||||||
programs into satellite processors is faster.
|
|
||||||
The decoding of EM machine language is so simple,
|
|
||||||
that it is feasible to use interpreters as long as EM hardware
|
|
||||||
machines are not available.
|
|
||||||
This chapter is irrelevant when back ends are used to
|
|
||||||
produce executable target machine code.
|
|
||||||
.S2 "Instruction encoding"
|
|
||||||
A design goal of EM is to make the
|
|
||||||
program text as compact as possible.
|
|
||||||
Decoding must be easy, however.
|
|
||||||
The encoding is fully byte oriented, without any small bit fields.
|
|
||||||
There are 256 primary opcodes, two of which are an escape to
|
|
||||||
two groups of 256 secondary opcodes each.
|
|
||||||
.A
|
|
||||||
EM instructions without arguments have a single opcode assigned,
|
|
||||||
possibly escaped:
|
|
||||||
.DS
|
|
||||||
|
|
||||||
|--------------|
|
|
||||||
| opcode |
|
|
||||||
|--------------|
|
|
||||||
|
|
||||||
or
|
|
||||||
|
|
||||||
|--------------|--------------|
|
|
||||||
| escape | opcode |
|
|
||||||
|--------------|--------------|
|
|
||||||
|
|
||||||
.DE
|
|
||||||
The encoding for instructions with an argument is more complex.
|
|
||||||
Several instructions have an address from the global data area
|
|
||||||
as argument.
|
|
||||||
Other instructions have different opcodes for positive
|
|
||||||
and negative arguments.
|
|
||||||
.N 1
|
|
||||||
There is always an opcode that takes the next two bytes as argument,
|
|
||||||
high byte first:
|
|
||||||
.DS
|
|
||||||
|
|
||||||
|--------------|--------------|--------------|
|
|
||||||
| opcode | hibyte | lobyte |
|
|
||||||
|--------------|--------------|--------------|
|
|
||||||
|
|
||||||
or
|
|
||||||
|
|
||||||
|--------------|--------------|--------------|--------------|
|
|
||||||
| escape | opcode | hibyte | lobyte |
|
|
||||||
|--------------|--------------|--------------|--------------|
|
|
||||||
|
|
||||||
.DE
|
|
||||||
.DS
|
|
||||||
An extra escape is provided for instructions with four or eight byte arguments.
|
|
||||||
|
|
||||||
|--------------|--------------|--------------| |--------------|
|
|
||||||
| ESCAPE | opcode | hibyte |...| lobyte |
|
|
||||||
|--------------|--------------|--------------| |--------------|
|
|
||||||
|
|
||||||
.DE
|
|
||||||
For most instructions some argument values predominate.
|
|
||||||
The most frequent combinations of instruction and argument
|
|
||||||
will be encoded in a single byte, called a mini:
|
|
||||||
.DS
|
|
||||||
|
|
||||||
|---------------|
|
|
||||||
|opcode+argument| (mini)
|
|
||||||
|---------------|
|
|
||||||
|
|
||||||
.DE
|
|
||||||
The number of minis is restricted, because only
|
|
||||||
254 primary opcodes are available.
|
|
||||||
Many instructions have the bulk of their arguments
|
|
||||||
fall in the range 0 to 255.
|
|
||||||
Instructions that address global data have their arguments
|
|
||||||
distributed over a wider range,
|
|
||||||
but small values of the high byte are common.
|
|
||||||
For all these cases there is another encoding
|
|
||||||
that combines the instruction and the high byte of the argument
|
|
||||||
into a single opcode.
|
|
||||||
These opcodes are called shorties.
|
|
||||||
Shorties may be escaped.
|
|
||||||
.DS
|
|
||||||
|
|
||||||
|--------------|--------------|
|
|
||||||
| opcode+high | lobyte | (shortie)
|
|
||||||
|--------------|--------------|
|
|
||||||
|
|
||||||
or
|
|
||||||
|
|
||||||
|--------------|--------------|--------------|
|
|
||||||
| escape | opcode+high | lobyte |
|
|
||||||
|--------------|--------------|--------------|
|
|
||||||
|
|
||||||
.DE
|
|
||||||
Escaped shorties are useless if the normal encoding has a primary opcode.
|
|
||||||
Note that for some instruction-argument combinations
|
|
||||||
several different encodings are available.
|
|
||||||
It is the task of the assembler to select the shortest of these.
|
|
||||||
The savings by these mini and shortie
|
|
||||||
opcodes are considerable, about 55%.
|
|
||||||
.P
|
|
||||||
Further improvements are possible:
|
|
||||||
the arguments of
|
|
||||||
many instructions are a multiple of the wordsize.
|
|
||||||
Some do also not allow zero as an argument.
|
|
||||||
If these arguments are divided by the wordsize and,
|
|
||||||
when zero is not allowed, then decremented by 1, more of them can
|
|
||||||
be encoded as shortie or mini.
|
|
||||||
The arguments of some other instructions
|
|
||||||
rarely or never assume the value 0, but start at 1.
|
|
||||||
The value 1 is then encoded as 0,
|
|
||||||
2 as 1 and so on.
|
|
||||||
.P
|
|
||||||
Assigning opcodes to instructions by the assembler is completely
|
|
||||||
table driven.
|
|
||||||
For details see appendix B.
|
|
||||||
.S2 "Procedure descriptors"
|
|
||||||
The procedure identifiers used in the interpreter are indices
|
|
||||||
into a table of procedure descriptors.
|
|
||||||
Each descriptor contains:
|
|
||||||
.IS 6
|
|
||||||
.PS - 4
|
|
||||||
.PT 1.
|
|
||||||
the number of bytes to be reserved for locals at each
|
|
||||||
invocation.
|
|
||||||
.N
|
|
||||||
This is a pointer-szied integer.
|
|
||||||
.PT 2.
|
|
||||||
the start address of the procedure
|
|
||||||
.PE
|
|
||||||
.IE
|
|
||||||
.S2 "Load format"
|
|
||||||
The EM machine language load format defines the interface between
|
|
||||||
the EM assembler/loader and the EM machine itself.
|
|
||||||
A load file consists of a header, the program text to be executed,
|
|
||||||
a description of the global data area and the procedure descriptor table,
|
|
||||||
in this order.
|
|
||||||
All integers in the load file are presented with the
|
|
||||||
least significant byte first.
|
|
||||||
.P
|
|
||||||
The header has two parts: the first half (eight 16-bit integers)
|
|
||||||
aids in selecting
|
|
||||||
the correct EM machine or interpreter.
|
|
||||||
Some EM machines, for instance, may have hardware floating point
|
|
||||||
instructions.
|
|
||||||
.N
|
|
||||||
The header entries are as follows (bit 0 is rightmost):
|
|
||||||
.IS 2
|
|
||||||
.VS 1 0
|
|
||||||
.PS 1 4 "" :
|
|
||||||
.PT
|
|
||||||
magic number (07255)
|
|
||||||
.PT
|
|
||||||
flag bits with the following meaning:
|
|
||||||
.PS - 7 "" :
|
|
||||||
.PT bit 0
|
|
||||||
TEST; test for integer overflow etc.
|
|
||||||
.PT bit 1
|
|
||||||
PROFILE; for each source line: count the number of memory
|
|
||||||
cycles executed.
|
|
||||||
.PT bit 2
|
|
||||||
FLOW; for each source line: set a bit in a bit map table if
|
|
||||||
instructions on that line are executed.
|
|
||||||
.PT bit 3
|
|
||||||
COUNT; for each source line: increment a counter if that line
|
|
||||||
is entered.
|
|
||||||
.PT bit 4
|
|
||||||
REALS; set if a program uses floating point instructions.
|
|
||||||
.PT bit 5
|
|
||||||
EXTRA; more tests during compiler debugging.
|
|
||||||
.PE
|
|
||||||
.PT
|
|
||||||
number of unresolved references.
|
|
||||||
.PT
|
|
||||||
version number; used to detect obsolete EM load files.
|
|
||||||
.PT
|
|
||||||
wordsize ; the number of bytes in each machine word.
|
|
||||||
.PT
|
|
||||||
pointer size ; the number of bytes available for addressing.
|
|
||||||
.PT
|
|
||||||
unused
|
|
||||||
.PT
|
|
||||||
unused
|
|
||||||
.PE
|
|
||||||
.IE
|
|
||||||
The second part of the header (eight entries, of pointer size bytes each)
|
|
||||||
describes the load file itself:
|
|
||||||
.IS 2
|
|
||||||
.PS 1 4 "" :
|
|
||||||
.PT
|
|
||||||
NTEXT; the program text size in bytes.
|
|
||||||
.PT
|
|
||||||
NDATA; the number of load-file descriptors (see below).
|
|
||||||
.PT
|
|
||||||
NPROC; the number of entries in the procedure descriptor table.
|
|
||||||
.PT
|
|
||||||
ENTRY; procedure number of the procedure to start with.
|
|
||||||
.PT
|
|
||||||
NLINE; the maximum source line number.
|
|
||||||
.PT
|
|
||||||
SZDATA; the address of the lowest uninitialized data byte.
|
|
||||||
.PT
|
|
||||||
unused
|
|
||||||
.PT
|
|
||||||
unused
|
|
||||||
.PE
|
|
||||||
.IE
|
|
||||||
.P
|
|
||||||
The program text consists of NTEXT bytes.
|
|
||||||
NTEXT is always a multiple of the wordsize.
|
|
||||||
The first byte of the program text is the
|
|
||||||
first byte of the instruction address
|
|
||||||
space, i.e. it has address 0.
|
|
||||||
Pointers into the program text are found in the procedure descriptor
|
|
||||||
table where relocation is simple and in the global data area.
|
|
||||||
The initialization of the global data area allows easy
|
|
||||||
relocation of pointers into both address spaces.
|
|
||||||
.P
|
|
||||||
The global data area is described by the NDATA descriptors.
|
|
||||||
Each descriptor describes a number of consecutive words (of~wordsize)
|
|
||||||
and consists of a sequence of bytes.
|
|
||||||
While reading the descriptors from the load file, one can
|
|
||||||
initialize the global data area from low to high addresses.
|
|
||||||
The size of the initialized data area is given by SZDATA,
|
|
||||||
this number can be used to check the initialization.
|
|
||||||
.N
|
|
||||||
The header of each descriptor consists of a byte, describing the type,
|
|
||||||
and a count.
|
|
||||||
The number of bytes used for this (unsigned) count depends on the
|
|
||||||
type of the descriptor and
|
|
||||||
is either a pointer-sized integer
|
|
||||||
or one byte.
|
|
||||||
The meaning of the count depends on the descriptor type.
|
|
||||||
At load time an interpreter can
|
|
||||||
perform any conversion deemed necessary, such as
|
|
||||||
reordering bytes in integers
|
|
||||||
and pointers and adding base addresses to pointers.
|
|
||||||
.BP
|
|
||||||
.A
|
|
||||||
In the following pictures we show a graphical notation of the
|
|
||||||
initializers.
|
|
||||||
The leftmost rectangle represents the leading byte.
|
|
||||||
.N 1
|
|
||||||
.DS
|
|
||||||
.PS - 4 " "
|
|
||||||
Fields marked with
|
|
||||||
.N 1
|
|
||||||
.PT n
|
|
||||||
contain a pointer-sized integer used as a count
|
|
||||||
.PT m
|
|
||||||
contain a one-byte integer used as a count
|
|
||||||
.PT b
|
|
||||||
contain a one-byte integer
|
|
||||||
.PT w
|
|
||||||
contain a wordsized integer
|
|
||||||
.PT p
|
|
||||||
contain a data or instruction pointer
|
|
||||||
.PT s
|
|
||||||
contain a null terminated ASCII string
|
|
||||||
.PE 1
|
|
||||||
.DE 0
|
|
||||||
.VS 1 1
|
|
||||||
.DS
|
|
||||||
|
|
||||||
-------------------
|
|
||||||
| 0 | n | repeat last initialization n times
|
|
||||||
-------------------
|
|
||||||
.DE
|
|
||||||
.DS
|
|
||||||
---------
|
|
||||||
| 1 | m | m uninitialized words
|
|
||||||
---------
|
|
||||||
.DE
|
|
||||||
.DS
|
|
||||||
____________
|
|
||||||
/ bytes \e
|
|
||||||
----------------- -----
|
|
||||||
| 2 | m | b | b |...| b | m initialized bytes
|
|
||||||
----------------- -----
|
|
||||||
.DE
|
|
||||||
.DS
|
|
||||||
_________
|
|
||||||
/ word \e
|
|
||||||
-----------------------
|
|
||||||
| 3 | m | w |... m initialized wordsized integers
|
|
||||||
-----------------------
|
|
||||||
.DE
|
|
||||||
.DS
|
|
||||||
_________
|
|
||||||
/ pointer \e
|
|
||||||
-----------------------
|
|
||||||
| 4 | m | p |... m initialized data pointers
|
|
||||||
-----------------------
|
|
||||||
.DE
|
|
||||||
.DS
|
|
||||||
_________
|
|
||||||
/ pointer \e
|
|
||||||
-----------------------
|
|
||||||
| 5 | m | p |... m initialized instruction pointers
|
|
||||||
-----------------------
|
|
||||||
.DE
|
|
||||||
.DS
|
|
||||||
____________
|
|
||||||
/ bytes \e
|
|
||||||
-------------------------
|
|
||||||
| 6 | m | b | b |...| b | initialized integer of size m
|
|
||||||
-------------------------
|
|
||||||
.DE
|
|
||||||
.DS
|
|
||||||
____________
|
|
||||||
/ bytes \e
|
|
||||||
-------------------------
|
|
||||||
| 7 | m | b | b |...| b | initialized unsigned of size m
|
|
||||||
-------------------------
|
|
||||||
.DE
|
|
||||||
.DS
|
|
||||||
____________
|
|
||||||
/ string \e
|
|
||||||
-------------------------
|
|
||||||
| 8 | m | s | initialized float of size m
|
|
||||||
-------------------------
|
|
||||||
.DE 3
|
|
||||||
.PS - 8
|
|
||||||
.PT type~0:
|
|
||||||
If the last initialization initialized k bytes starting
|
|
||||||
at address \fIa\fP, do the same initialization again n times,
|
|
||||||
starting at \fIa\fP+k, \fIa\fP+2*k, .... \fIa\fP+n*k.
|
|
||||||
This is the only descriptor whose starting byte
|
|
||||||
is followed by an integer with the
|
|
||||||
size of a
|
|
||||||
pointer,
|
|
||||||
in all other descriptors the first byte is followed by a one-byte count.
|
|
||||||
This descriptor must be preceded by a descriptor of
|
|
||||||
another type.
|
|
||||||
.PT type~1:
|
|
||||||
Reserve m words, not explicitly initialized (BSS and HOL).
|
|
||||||
.PT type~2:
|
|
||||||
The m bytes following the descriptor header are
|
|
||||||
initializers for the next m bytes of the
|
|
||||||
global data area.
|
|
||||||
m is divisible by the wordsize.
|
|
||||||
.PT type~3:
|
|
||||||
The m words following the header are initializers for the next m words of the
|
|
||||||
global data area.
|
|
||||||
.PT type~4:
|
|
||||||
The m data address space pointers following the header are
|
|
||||||
initializers for the next
|
|
||||||
m data pointers in the global data area.
|
|
||||||
Interpreters that represent EM pointers by
|
|
||||||
target machine addresses must relocate all data pointers.
|
|
||||||
.PT type~5:
|
|
||||||
The m instruction address space pointers following the header are
|
|
||||||
initializers for the next
|
|
||||||
m instruction pointers in the global data area.
|
|
||||||
Interpreters that represent EM instruction pointers by
|
|
||||||
target machine addresses must relocate these pointers.
|
|
||||||
.PT type~6:
|
|
||||||
The m bytes following the header form
|
|
||||||
a signed integer number with a size of m bytes,
|
|
||||||
which is an initializer for the next m bytes
|
|
||||||
of the global data area.
|
|
||||||
m is governed by the same restrictions as for
|
|
||||||
transfer of objects to/from memory.
|
|
||||||
.PT type~7:
|
|
||||||
The m bytes following the header form
|
|
||||||
an unsigned integer number with a size of m bytes,
|
|
||||||
which is an initializer for the next m bytes
|
|
||||||
of the global data area.
|
|
||||||
m is governed by the same restrictions as for
|
|
||||||
transfer of objects to/from memory.
|
|
||||||
.PT type~8:
|
|
||||||
The header is followed by an ASCII string, null terminated, to
|
|
||||||
initialize, in global data,
|
|
||||||
a floating point number with a size of m bytes.
|
|
||||||
m is governed by the same restrictions as for
|
|
||||||
transfer of objects to/from memory.
|
|
||||||
The ASCII string contains the notation of a real as used in the
|
|
||||||
Pascal language.
|
|
||||||
.PE
|
|
||||||
.P
|
|
||||||
The NPROC procedure descriptors on the load file consist of
|
|
||||||
an instruction space address (of~pointer~size) and
|
|
||||||
an integer (of~pointer~size) specifying the number of bytes for
|
|
||||||
locals.
|
|
||||||
@@ -1,16 +0,0 @@
|
|||||||
.so /usr/lib/tmac/tmac.kun
|
|
||||||
.SS 6
|
|
||||||
.RP
|
|
||||||
.PL 12i 11i
|
|
||||||
.LL 89
|
|
||||||
.MS T E
|
|
||||||
\!.TL '%'''
|
|
||||||
.ME
|
|
||||||
.MS T O
|
|
||||||
\!.TL '''%'
|
|
||||||
.ME
|
|
||||||
.MS B
|
|
||||||
.sp 1
|
|
||||||
.ME
|
|
||||||
.SM S1 B
|
|
||||||
.SM S2 B
|
|
||||||
@@ -1,245 +0,0 @@
|
|||||||
.SN 5
|
|
||||||
.BP
|
|
||||||
.S1 "MAPPING OF EM DATA MEMORY ONTO TARGET MACHINE MEMORY"
|
|
||||||
The EM architecture is designed to be implemented
|
|
||||||
on many existing and future machines.
|
|
||||||
EM memory is highly fragmented to make
|
|
||||||
adaptation to various memory architectures possible.
|
|
||||||
Format and encoding of pointers is explicitly undefined.
|
|
||||||
.P
|
|
||||||
This chapter gives solutions to some of the
|
|
||||||
anticipated problems.
|
|
||||||
First, we describe a possible memory layout for machines
|
|
||||||
with 64K bytes of address space.
|
|
||||||
Here we use a member of the EM family with 2-byte word and pointer
|
|
||||||
size.
|
|
||||||
The most straightforward layout is shown in figure 2.
|
|
||||||
.N 1
|
|
||||||
.DS
|
|
||||||
65534 -> |-------------------------------|
|
|
||||||
|///////////////////////////////|
|
|
||||||
|//// unimplemented memory /////|
|
|
||||||
|///////////////////////////////|
|
|
||||||
ML -> |-------------------------------|
|
|
||||||
| |
|
|
||||||
| | <- LB
|
|
||||||
| stack and local area |
|
|
||||||
| |
|
|
||||||
|-------------------------------| <- SP
|
|
||||||
|///////////////////////////////|
|
|
||||||
|//////// inaccessible /////////|
|
|
||||||
|///////////////////////////////|
|
|
||||||
|-------------------------------| <- HP
|
|
||||||
| |
|
|
||||||
| heap area |
|
|
||||||
| |
|
|
||||||
| |
|
|
||||||
HB -> |-------------------------------|
|
|
||||||
| |
|
|
||||||
| global data area |
|
|
||||||
| |
|
|
||||||
EB -> |-------------------------------|
|
|
||||||
| |
|
|
||||||
| program text | <- PC
|
|
||||||
| |
|
|
||||||
| ( and tables ) |
|
|
||||||
| |
|
|
||||||
| |
|
|
||||||
PB -> |-------------------------------|
|
|
||||||
|///////////////////////////////|
|
|
||||||
|////////// undefined //////////|
|
|
||||||
|///////////////////////////////|
|
|
||||||
0 -> |-------------------------------|
|
|
||||||
|
|
||||||
Figure 2. Memory layout showing typical register
|
|
||||||
positions during execution of an EM program.
|
|
||||||
.DE 2
|
|
||||||
The base registers for the various memory pieces can be stored
|
|
||||||
in target machine registers or memory.
|
|
||||||
.IS
|
|
||||||
.N 1
|
|
||||||
.TS
|
|
||||||
tab(;);
|
|
||||||
l 1 l l l.
|
|
||||||
PB;:;program base;points to the base of the instruction address space.
|
|
||||||
EB;:;external base;points to the base of the data address space.
|
|
||||||
HB;:;heap base;points to the base of the heap area.
|
|
||||||
ML;:;memory limit;marks the high end of the addressable data space.
|
|
||||||
.TE 1
|
|
||||||
.IE
|
|
||||||
The stack grows from high
|
|
||||||
EM addresses to low EM addresses, and the heap the
|
|
||||||
other way.
|
|
||||||
The memory between SP and HP is not accessible,
|
|
||||||
but may be allocated later to the stack or the heap if needed.
|
|
||||||
The local data area is allocated starting at the high end of
|
|
||||||
memory.
|
|
||||||
.P
|
|
||||||
Because EM address 0 is not mapped onto target
|
|
||||||
address 0, a problem arises when pointers are used.
|
|
||||||
If a program pushed a constant, say 6, onto the stack,
|
|
||||||
and then tried to indirect through it,
|
|
||||||
the wrong word would be fetched,
|
|
||||||
because EM address 6 is mapped onto target address EB+6
|
|
||||||
and not target address 6 itself.
|
|
||||||
This particular problem is solved by explicitly declaring
|
|
||||||
the format of a pointer to be undefined,
|
|
||||||
so that using a constant as a pointer is completely illegal.
|
|
||||||
However, the general problem of mapping pointers still exists.
|
|
||||||
.P
|
|
||||||
There are two possible solutions.
|
|
||||||
In the first solution, EM pointers are represented
|
|
||||||
in the target machine as true EM addresses,
|
|
||||||
for example, a pointer to EM address 6 really is
|
|
||||||
stored as a 6 in the target machine.
|
|
||||||
This solution implies that every time a pointer is fetched
|
|
||||||
EB must be added before referencing
|
|
||||||
the target machine's memory.
|
|
||||||
If the target machine has powerful indexing
|
|
||||||
facilities, EB can be kept in a target machine register,
|
|
||||||
and the relocation can indeed be done on
|
|
||||||
every reference to the data address space
|
|
||||||
at a modest cost in speed.
|
|
||||||
.P
|
|
||||||
The other solution consists of having EM pointers
|
|
||||||
refer to the true target machine address.
|
|
||||||
Thus the instruction LAE 6 (Load Address of External 6)
|
|
||||||
would push the value of EB+6 onto the stack.
|
|
||||||
When this approach is chosen, back ends must know
|
|
||||||
how to offset from EB, to translate all
|
|
||||||
instructions that manipulate EM addresses.
|
|
||||||
However, the problem is not completely solved,
|
|
||||||
because a front end may have to initialize a pointer
|
|
||||||
in CON or ROM data to point to a global address.
|
|
||||||
This pointer must also be relocated by the back end or the interpreter.
|
|
||||||
.P
|
|
||||||
Although the EM stack grows from high to low EM addresses,
|
|
||||||
some machines have hardware PUSH and POP
|
|
||||||
instructions that require the stack to grow upwards.
|
|
||||||
If reasons of efficiency urge you to use these
|
|
||||||
instructions, then EM
|
|
||||||
can be implemented with the memory layout
|
|
||||||
upside down, as shown in figure 3.
|
|
||||||
This is possible because the pointer format is explicitly undefined.
|
|
||||||
The first element of a word array will have a
|
|
||||||
lower physical address than the second element.
|
|
||||||
.N 2
|
|
||||||
.DS
|
|
||||||
| | | |
|
|
||||||
| EB=60 | | ^ |
|
|
||||||
| | | | |
|
|
||||||
|-----------------| |-----------------|
|
|
||||||
105 | 45 | 44 | 104 214 | 41 | 40 | 215
|
|
||||||
|-----------------| |-----------------|
|
|
||||||
103 | 43 | 42 | 102 212 | 43 | 42 | 213
|
|
||||||
|-----------------| |-----------------|
|
|
||||||
101 | 41 | 40 | 100 210 | 45 | 44 | 211
|
|
||||||
|-----------------| |-----------------|
|
|
||||||
| | | | |
|
|
||||||
| v | | EB=255 |
|
|
||||||
| | | |
|
|
||||||
|
|
||||||
Type A Type B
|
|
||||||
.sp 2
|
|
||||||
Figure 3. Two possible memory implementations.
|
|
||||||
Numbers within the boxes are EM addresses.
|
|
||||||
The other numbers are physical addresses.
|
|
||||||
.DE 2
|
|
||||||
.A 0 0
|
|
||||||
So, we have two different EM memory implementations:
|
|
||||||
.IS
|
|
||||||
.PS - 4
|
|
||||||
.PT A~-
|
|
||||||
stack downwards
|
|
||||||
.PT B~-
|
|
||||||
stack upwards
|
|
||||||
.PE
|
|
||||||
.IE
|
|
||||||
.P
|
|
||||||
For each of these two possibilities we give the translation of
|
|
||||||
the EM instructions to push the third byte of a global data
|
|
||||||
block starting at EM address 40 onto the stack and to load the
|
|
||||||
word at address 40.
|
|
||||||
All translations assume a word and pointer size of two bytes.
|
|
||||||
The target machine used is a PDP-11 augmented with push and pop instructions.
|
|
||||||
Registers 'r0' and 'r1' are used and suffer from sign extension for byte
|
|
||||||
transfers.
|
|
||||||
Push $40 means push the constant 40, not word 40.
|
|
||||||
.P
|
|
||||||
The translation of the EM instructions depends on the pointer representation
|
|
||||||
used.
|
|
||||||
For each of the two solutions explained above the translation is given.
|
|
||||||
.P
|
|
||||||
First, the translation for the two implementations using EM addresses as
|
|
||||||
pointer representation:
|
|
||||||
.DS
|
|
||||||
.TS
|
|
||||||
tab(:), center;
|
|
||||||
l s l s l s
|
|
||||||
_ s _ s _ s
|
|
||||||
l 2 l 6 l 2 l 6 l 2 l.
|
|
||||||
EM:type A:type B
|
|
||||||
|
|
||||||
|
|
||||||
LAE:40:push:$40:push:$40
|
|
||||||
|
|
||||||
ADP:3:pop:r0:pop:r0
|
|
||||||
::add:$3,r0:add:$3,r0
|
|
||||||
::push:r0:push:r0
|
|
||||||
|
|
||||||
LOI:1:pop:r0:pop:r0
|
|
||||||
::-::neg:r0
|
|
||||||
::clr:r1:clr:r1
|
|
||||||
::bisb:eb(r0),r1:bisb:eb(r0),r1
|
|
||||||
::push:r1:push:r1
|
|
||||||
|
|
||||||
LOE:40:push:eb+40:push:eb-41
|
|
||||||
.TE
|
|
||||||
.DE
|
|
||||||
.BP
|
|
||||||
.P
|
|
||||||
The translation for the two implementations, if the target machine address is
|
|
||||||
used as pointer representation, is:
|
|
||||||
.N 1
|
|
||||||
.DS
|
|
||||||
.TS
|
|
||||||
tab(:), center;
|
|
||||||
l s l s l s
|
|
||||||
_ s _ s _ s
|
|
||||||
l 2 l 6 l 2 l 6 l 2 l.
|
|
||||||
EM:type A:type B
|
|
||||||
|
|
||||||
|
|
||||||
LAE:40:push:$eb+40:push:$eb-40
|
|
||||||
|
|
||||||
ADP:3:pop:r0:pop:r0
|
|
||||||
::add:$3,r0:sub:$3,r0
|
|
||||||
::push:r0:push:r0
|
|
||||||
|
|
||||||
LOI:1:pop:r0:pop:r0
|
|
||||||
::clr:r1:clr:r1
|
|
||||||
::bisb:(r0),r1:bisb:(r0),r1
|
|
||||||
::push:r1:push:r1
|
|
||||||
|
|
||||||
LOE:40:push:eb+40:push:eb-41
|
|
||||||
.TE
|
|
||||||
.DE
|
|
||||||
.P
|
|
||||||
The translation presented above is not intended to be optimal.
|
|
||||||
Most machines can handle these simple cases in one or two instructions.
|
|
||||||
It demonstrates, however, the flexibility of the EM design.
|
|
||||||
.P
|
|
||||||
There are several possibilities to implement EM on machines with
|
|
||||||
address spaces larger than 64k bytes.
|
|
||||||
For EM with two byte pointers one could allocate instruction and
|
|
||||||
data space each in a separate 64k piece of memory.
|
|
||||||
EM pointers still have to fit in two bytes,
|
|
||||||
but the base registers PB and EB may be loaded in hardware registers
|
|
||||||
wider than 16 bits, if available.
|
|
||||||
EM implementations can also make efficient use of a machine
|
|
||||||
with separate instruction and data space.
|
|
||||||
.P
|
|
||||||
EM with 32 bit pointers allows one to make use of machines
|
|
||||||
with large address spaces.
|
|
||||||
In a virtual, segmented memory system one could use a separate
|
|
||||||
segment for each fragment.
|
|
||||||
@@ -1,80 +0,0 @@
|
|||||||
.BP
|
|
||||||
.SN 2
|
|
||||||
.S1 MEMORY
|
|
||||||
The EM machine has two distinct address spaces,
|
|
||||||
one for instructions and one for data.
|
|
||||||
The data space is divided up into 8-bit bytes.
|
|
||||||
The smallest addressable unit is a byte.
|
|
||||||
Bytes are numbered consecutively from 0 to some maximum.
|
|
||||||
All sizes in EM are expressed in bytes.
|
|
||||||
.P
|
|
||||||
Some EM instructions can transfer objects containing several bytes
|
|
||||||
to and/or from memory.
|
|
||||||
The size of all objects larger than a word must be a multiple of
|
|
||||||
the wordsize.
|
|
||||||
The size of all objects smaller than a word must be a divisor
|
|
||||||
of the wordsize.
|
|
||||||
For example: if the wordsize is 2 bytes, objects of the sizes 1,
|
|
||||||
2, 4, 6,... are allowed.
|
|
||||||
The address of such an object is the lowest address of all bytes it contains.
|
|
||||||
For objects smaller than the wordsize, the
|
|
||||||
address must be a multiple of the object size.
|
|
||||||
For all other objects the address must be a multiple of the
|
|
||||||
wordsize.
|
|
||||||
For example, if an instruction transfers a 4-byte object to memory at
|
|
||||||
location \fIm\fP and the wordsize is 2,
|
|
||||||
\fIm\fP must be a multiple of 2 and the bytes at
|
|
||||||
locations \fIm\fP, \fIm\fP\|+\|1,\fIm\fP\|+\|2 and
|
|
||||||
\fIm\fP\|+\|3 are overwritten.
|
|
||||||
.P
|
|
||||||
The size of almost all objects in EM
|
|
||||||
is an integral number of words.
|
|
||||||
Only two operations are allowed on
|
|
||||||
objects whose size is a divisor of the wordsize:
|
|
||||||
push it onto the stack and pop it from the stack.
|
|
||||||
The addressing of these objects in memory is always indirect.
|
|
||||||
If such a small object is pushed onto the stack
|
|
||||||
it is assumed to be a small integer and stored
|
|
||||||
in the least significant part of a word.
|
|
||||||
The rest of the word is cleared to zero,
|
|
||||||
although
|
|
||||||
EM provides a way to sign-extend a small integer.
|
|
||||||
Popping a small object from the stack removes a word
|
|
||||||
from the stack, stores the least significant byte(s)
|
|
||||||
of this word in memory and discards the rest of the word.
|
|
||||||
.P
|
|
||||||
The format of pointers into both address spaces is explicitly undefined.
|
|
||||||
The size of a pointer, however, is fixed for a member of EM, so that
|
|
||||||
the compiler writer knows how much storage to allocate for a pointer.
|
|
||||||
.P
|
|
||||||
A minor problem is raised by the undefined pointer format.
|
|
||||||
Some languages, notably Pascal, require a special,
|
|
||||||
otherwise illegal, pointer value to represent the nil pointer.
|
|
||||||
The current Pascal-VU compiler uses the
|
|
||||||
integer value 0 as nil pointer.
|
|
||||||
This value is also used by many C programs as a normally impossible address.
|
|
||||||
A better solution would be to have a special
|
|
||||||
instruction loading an illegal pointer value,
|
|
||||||
but it is hard to imagine an implementation
|
|
||||||
for which the current solution is inadequate,
|
|
||||||
especially because the first word in the EM data space
|
|
||||||
is special and probably not the target of any pointer.
|
|
||||||
.P
|
|
||||||
The next two chapters describe the EM memory
|
|
||||||
in more detail.
|
|
||||||
One describes the instruction address space,
|
|
||||||
the other the data address space.
|
|
||||||
.P
|
|
||||||
A design goal of EM has been to allow
|
|
||||||
its implementation on a wide range of existing machines,
|
|
||||||
as well as allowing a new one to be built in hardware.
|
|
||||||
To this extent we have tried to minimize the demands
|
|
||||||
of EM on the memory structure of the target machine.
|
|
||||||
Therefore, apart from the logical partitioning,
|
|
||||||
EM memory is divided into 'fragments'.
|
|
||||||
A fragment consists of consecutive machine
|
|
||||||
words and has a base address and a size.
|
|
||||||
Pointer arithmetic is only defined within a fragment.
|
|
||||||
The only exception to this rule is comparison with the null
|
|
||||||
pointer.
|
|
||||||
All fragments must be word aligned.
|
|
||||||
@@ -1,5 +0,0 @@
|
|||||||
|
|
||||||
case $# in
|
|
||||||
1) make "$1".t ; ntlp "$1".t^lpr ;;
|
|
||||||
*) echo $0 heeft een argument nodig ;;
|
|
||||||
esac
|
|
||||||
@@ -1,4 +0,0 @@
|
|||||||
case $# in
|
|
||||||
1) make $1.t ; ntout $1.t ;;
|
|
||||||
*) echo $0 heeft een argument nodig ;;
|
|
||||||
esac
|
|
||||||
@@ -1,38 +0,0 @@
|
|||||||
.po 0
|
|
||||||
.TP 1
|
|
||||||
.ll 79
|
|
||||||
.sp 15
|
|
||||||
.ce 4
|
|
||||||
DESCRIPTION OF A MACHINE
|
|
||||||
ARCHITECTURE FOR USE WITH
|
|
||||||
BLOCK STRUCTURED LANGUAGES
|
|
||||||
.sp 6
|
|
||||||
.ce 4
|
|
||||||
Andrew S. Tanenbaum
|
|
||||||
Hans van Staveren
|
|
||||||
Ed G. Keizer
|
|
||||||
Johan W. Stevenson\v'-0.5m'*\v'0.5m'
|
|
||||||
.sp 2
|
|
||||||
.ce
|
|
||||||
August 1983
|
|
||||||
.sp 2
|
|
||||||
.ce
|
|
||||||
Informatica Rapport IR-81
|
|
||||||
.sp 13
|
|
||||||
Abstract
|
|
||||||
.sp 2
|
|
||||||
.ti +5
|
|
||||||
EM is a family of intermediate languages
|
|
||||||
designed for producing portable compilers.
|
|
||||||
A program called
|
|
||||||
.B front end
|
|
||||||
translates source programs to EM.
|
|
||||||
Another program,
|
|
||||||
.B back
|
|
||||||
.BW end ,
|
|
||||||
translates EM to the assembly language of the target machine.
|
|
||||||
Alternatively, the EM program can be assembled to a highly
|
|
||||||
efficient binary format for interpretation.
|
|
||||||
This document describes the EM languages in detail.
|
|
||||||
.sp 4
|
|
||||||
\v'-0.5m'*\v'0.5m' Present affiliation: NV Philips, Eindhoven
|
|
||||||
130
doc/em/types.nr
130
doc/em/types.nr
@@ -1,130 +0,0 @@
|
|||||||
.SN 6
|
|
||||||
.BP
|
|
||||||
.S1 "TYPE REPRESENTATIONS"
|
|
||||||
The representations used for typed objects are not precisely
|
|
||||||
specified by EM.
|
|
||||||
Sometimes we only specify that a typed object occupies a
|
|
||||||
certain amount of space and state no further restrictions.
|
|
||||||
If one wants to have a different representation of the value of
|
|
||||||
an object on the stack one has to use a convert instruction
|
|
||||||
in most cases.
|
|
||||||
We do specify some relations between the representations of
|
|
||||||
types.
|
|
||||||
This allows some intermixed use of operators for different types
|
|
||||||
on the same object(s).
|
|
||||||
For example, the instruction ZER pushes signed and
|
|
||||||
unsigned integers with the value zero and empty sets.
|
|
||||||
ZER has as only argument the size of the object.
|
|
||||||
.A
|
|
||||||
The representation of floating point numbers is a good example,
|
|
||||||
it allows widely varying implementations.
|
|
||||||
The only ways to create floating point numbers are via
|
|
||||||
initialization and via conversions from integer numbers.
|
|
||||||
Only by using conversions to integers and comparing
|
|
||||||
two floating point numbers with each other, can these numbers
|
|
||||||
be converted to human readable output.
|
|
||||||
Implementations may use base 10, base 2 or any other
|
|
||||||
base for exponents, and have freedom in choosing the range of
|
|
||||||
exponent and mantissa.
|
|
||||||
.A
|
|
||||||
Other types are more precisely described.
|
|
||||||
In the following paragraphs a description will be given of the
|
|
||||||
restrictions imposed on the representation of the types used.
|
|
||||||
A number \fBn\fP used in these paragraphs indicates the size of
|
|
||||||
the object in \fIbits\fP.
|
|
||||||
.S2 "Unsigned integers"
|
|
||||||
The range of unsigned integers is 0..2\v'-0.5m'\fBn\fP\v'0.5m'-1.
|
|
||||||
A binary representation is assumed.
|
|
||||||
The order of the bits within an object is knowingly left
|
|
||||||
unspecified.
|
|
||||||
Discussing bit order within each 8-bit byte is academic,
|
|
||||||
so the only real freedom of this specification lies in the byte
|
|
||||||
order.
|
|
||||||
We really do not care whether an implementation of a 4-byte
|
|
||||||
integer has its bytes in a particular order of significance.
|
|
||||||
This of course means that some sequences of instructions have
|
|
||||||
unpredictable effects.
|
|
||||||
For example:
|
|
||||||
.DS
|
|
||||||
LOC 258 ; STL 0 ; LAL 0 ; LOI 1 ( wordsize >=2 )
|
|
||||||
.DE
|
|
||||||
The value on the stack after executing this sequence
|
|
||||||
can be anything,
|
|
||||||
but will most likely be 1 or 2.
|
|
||||||
.A
|
|
||||||
Conversion between unsigned integers of different sizes have to
|
|
||||||
be done with explicit convert instructions.
|
|
||||||
One cannot simply pad an unsigned integer with zero's at either end
|
|
||||||
and expect a correct result.
|
|
||||||
.A
|
|
||||||
We assume existence of at least single word unsigned arithmetic
|
|
||||||
in any implementation.
|
|
||||||
.S2 "Signed Integers"
|
|
||||||
The range of signed integers is -2\v'-0.5m'\fBn\fP-1\v'0.5m'~..~2\v'-0.5m'\fBn\fP-1\v'0.5m'-1,
|
|
||||||
in other words the range of signed integers of \fBn\fP bits
|
|
||||||
using two's complement arithmetic.
|
|
||||||
The representation is the same as for unsigned integers except
|
|
||||||
the range 2\v'-0.5m'\fBn\fP-1\v'0.5m'~..~2\v'-0.5m'\fBn\fP\v'0.5m'-1 is mapped on the
|
|
||||||
range -2\v'-0.5m'\fBn\fP-1\v'0.5m'~..~-1.
|
|
||||||
In other words, the most significant bit is used as sign bit.
|
|
||||||
The convert instructions between signed and unsigned integers
|
|
||||||
of the same size can be used to catch errors.
|
|
||||||
.A
|
|
||||||
The value -2\v'-0.5m'\fBn\fP-1\v'0.5m' is used for undefined
|
|
||||||
signed integers.
|
|
||||||
EM implementations should trap when this value is used in an
|
|
||||||
operation on signed integers.
|
|
||||||
The instruction mask, accessed with SIM and LIM -~see chapter 9~- ,
|
|
||||||
can be used to disable such traps.
|
|
||||||
.A
|
|
||||||
We assume existence of at least single word signed arithmetic
|
|
||||||
in any implementation.
|
|
||||||
.BP
|
|
||||||
.S2 "Floating point values"
|
|
||||||
Floating point values must have a signed mantissa and a signed
|
|
||||||
exponent.
|
|
||||||
Although no base is specified, base 2 is the normal choice,
|
|
||||||
because the FEF instruction pushes the exponent in base 2.
|
|
||||||
.A
|
|
||||||
The implementation of floating point arithmetic is optional.
|
|
||||||
The compilers currently in use have runtime parameters for the
|
|
||||||
size of the floating point values they should use.
|
|
||||||
Common choices are 4 and/or 8 bytes.
|
|
||||||
.S2 Pointers
|
|
||||||
EM has two kinds of pointers: for instruction and for data
|
|
||||||
space.
|
|
||||||
Each kind can only be used for its own space, conversion between
|
|
||||||
these two subtypes is impossible.
|
|
||||||
We assume that pointers have a range from 0 upwards.
|
|
||||||
Any implementation may have holes in the pointer range between
|
|
||||||
fragments.
|
|
||||||
One can of course not expect to be able to address two megabyte
|
|
||||||
of memory using a 2-byte pointer.
|
|
||||||
Normally, a 2-byte pointer allows up to 65536 bytes of
|
|
||||||
addressable memory.
|
|
||||||
.A
|
|
||||||
Pointer representation has one restriction.
|
|
||||||
The pointer with the same representation as the integer zero of
|
|
||||||
the same size should be invalid.
|
|
||||||
Some languages and/or runtime systems represent the nil
|
|
||||||
pointer as zero.
|
|
||||||
.S2 "Bit sets"
|
|
||||||
All bit sets of size \fBn\fP are subsets of the set
|
|
||||||
{~i~|~i>=0,~i<\fBn\fP~}.
|
|
||||||
A bit set contains a bit for each element showing its
|
|
||||||
presence or absence.
|
|
||||||
Bit sets are subdivided into words.
|
|
||||||
The word with the lowest EM address governs the subset
|
|
||||||
{~i~|~i>=0,~i<\fBm\fP~}, where \fBm\fP is the number of bits in
|
|
||||||
a word.
|
|
||||||
The next higher words each govern the next higher \fBm\fP set elements.
|
|
||||||
The relation between a set with size of
|
|
||||||
a word and an unsigned integer word is that
|
|
||||||
the value of the unsigned integer is the summation of the
|
|
||||||
2\v'-0.5m'i\v'0.5m' where i is in the set.
|
|
||||||
.A
|
|
||||||
Example: a 2-word bit set (wordsize 2) containing the
|
|
||||||
elements 1, 6, 8, 15, 18, 21, 27 and 28 is composed of two
|
|
||||||
integers, e.g. at addresses 40 and 42.
|
|
||||||
The word at 40 contains the value 33090 (or~-32446),
|
|
||||||
the word at 42 contains the value 6180.
|
|
||||||
622
doc/install.doc
622
doc/install.doc
@@ -1,622 +0,0 @@
|
|||||||
.nr LL 7.5i
|
|
||||||
.nr PD 1v
|
|
||||||
.TL
|
|
||||||
Amsterdam Compiler Kit installation guide
|
|
||||||
.AU
|
|
||||||
Ed Keizer
|
|
||||||
.AI
|
|
||||||
Wiskundig Seminarium
|
|
||||||
Vrije Universiteit
|
|
||||||
Amsterdam
|
|
||||||
.NH
|
|
||||||
Introduction
|
|
||||||
.PP
|
|
||||||
This document
|
|
||||||
describes the process of installing Amsterdam Compiler Kit.
|
|
||||||
It depends on your combination of hard- and software how
|
|
||||||
hard it will be to install the kit.
|
|
||||||
This description is intended for a PDP 11/44 running
|
|
||||||
.UX
|
|
||||||
Version 7.
|
|
||||||
Installation on other PDP 11's should be easy, as long
|
|
||||||
as they have separate instruction and data space.
|
|
||||||
Installation on machine's without this feature, like PDP 11/34,
|
|
||||||
PDP 11/60 requires extensive surgery on some programs and is
|
|
||||||
thought of as impossible.
|
|
||||||
See chapter 6 for installation on other systems.
|
|
||||||
.NH
|
|
||||||
Restoring tree
|
|
||||||
.PP
|
|
||||||
The process of installing Amsterdam Compiler Kit is quite simple.
|
|
||||||
It is important that the original Amsterdam Compiler Kit
|
|
||||||
distribution tree structure is restored.
|
|
||||||
Proceed as follows
|
|
||||||
.IP " -" 10
|
|
||||||
Create a directory, for example /usr/em, on a device
|
|
||||||
with at least 20000 blocks left.
|
|
||||||
.IP " -"
|
|
||||||
Change to that directory (cd ...); it will be the working directory.
|
|
||||||
.IP " -"
|
|
||||||
Extract all files from the distribution medium, for instance
|
|
||||||
magtape:
|
|
||||||
\fBtar x\fP.
|
|
||||||
.IP " -"
|
|
||||||
Keep a copy of the original distribution to be able to repeat the process
|
|
||||||
of installation in case of disasters.
|
|
||||||
This copy is also useful as a reference point for diff-listings.
|
|
||||||
.LP
|
|
||||||
The directories in the tree contain the following information:
|
|
||||||
.nr PD 1v
|
|
||||||
.IP "lib" 14
|
|
||||||
.br
|
|
||||||
almost all binaries and shell files used by commands and
|
|
||||||
library em_data.a from misc/data
|
|
||||||
.IP "lib/ack"
|
|
||||||
.br
|
|
||||||
The command descriptor files used by the program ack.
|
|
||||||
.nr PD 0
|
|
||||||
.IP "bin"
|
|
||||||
.br
|
|
||||||
the few utilities that knot things together
|
|
||||||
.IP "etc"
|
|
||||||
.br
|
|
||||||
The MAIN description of EM sits here.
|
|
||||||
contains files (e.g. em_table) describing
|
|
||||||
the opcodes and pseudos in use,
|
|
||||||
the operands allowed, effect in stack etc. etc.
|
|
||||||
Make in this directory creates most of the files in h
|
|
||||||
.IP "include"
|
|
||||||
.br
|
|
||||||
More or less system independent include files needed by modules
|
|
||||||
in the C library from lang/cem/libcc.
|
|
||||||
Especially needed for "stdio".
|
|
||||||
.IP "h"
|
|
||||||
.br
|
|
||||||
The #include files for:
|
|
||||||
.nf
|
|
||||||
as_spec.h Used by EM assembler and interpreters.
|
|
||||||
em_abs.h Contains trap numbers and address for lin and fil
|
|
||||||
em_flag.h Definition of bits in array em_flag in lib/em_data.a
|
|
||||||
Describes parameters effect on flow of instructions
|
|
||||||
em_mes.h Definition of names for mes pseudo numbers
|
|
||||||
em_mnem.h instruction => compact mapping.
|
|
||||||
em_pseu.h pseudo instruction => compact mapping
|
|
||||||
em_ptyp.h Useful for compact code reading/writing,
|
|
||||||
defines classes of parameters
|
|
||||||
em_spec.h Definition of constants used in compact code
|
|
||||||
local.h Various definitions for local versions
|
|
||||||
pc_err.h Definitions of error numbers in Pascal
|
|
||||||
pc_file.h Macro's used in file handling in Pascal
|
|
||||||
em_path.h Pathnames used by \fIack\fP, intended
|
|
||||||
for all utilities
|
|
||||||
pc_size.h Sizes of objects used by Pascal compiler and
|
|
||||||
run-time system.
|
|
||||||
em_reg.h Definition of names for register types.
|
|
||||||
.IP "doc"
|
|
||||||
.br
|
|
||||||
Documentation
|
|
||||||
.nf
|
|
||||||
cg.doc Use and internal specification of the backend.
|
|
||||||
.br
|
|
||||||
regadd.doc Update for cg.doc concerning register variables
|
|
||||||
.br
|
|
||||||
regadd.doc Description of steps to add register variables.
|
|
||||||
.br
|
|
||||||
ack.doc Layout of description files needed for each machine.
|
|
||||||
.br
|
|
||||||
cref.doc C reference manual, addendum
|
|
||||||
.br
|
|
||||||
install.doc Ack Installation Guide
|
|
||||||
.br
|
|
||||||
pcref.doc Pascal reference manual, addendum
|
|
||||||
.br
|
|
||||||
peep.doc Description of the peephole optimizer
|
|
||||||
.br
|
|
||||||
em.doc EM reference manual
|
|
||||||
.br
|
|
||||||
toolkit.doc A general overview of the toolkit
|
|
||||||
.br
|
|
||||||
v7bugs.doc Bugs in the standard V7 system
|
|
||||||
.br
|
|
||||||
val.doc Pascal validation suite version 3 report
|
|
||||||
.nf
|
|
||||||
.IP "doc/em.doc"
|
|
||||||
.br
|
|
||||||
The EM-manual IR-81
|
|
||||||
.IP "doc/em.doc/int"
|
|
||||||
.br
|
|
||||||
The EM interpreter written in pascal
|
|
||||||
.IP "mkun"
|
|
||||||
.br
|
|
||||||
The PUBMAC macro package for nroff/troff from the Katholieke Universiteit at
|
|
||||||
Nijmegen.
|
|
||||||
It is used for the EM reference manual,
|
|
||||||
the Makefile installs the macro package in
|
|
||||||
/usr/lib/tmac/tmac.mkun*.
|
|
||||||
This package is in the public domain.
|
|
||||||
.IP "mach"
|
|
||||||
.br
|
|
||||||
just there to group the directories for all machines
|
|
||||||
these directories have sub-directories named:
|
|
||||||
.nf
|
|
||||||
as the assembler ( *.s + libraries => a.out )
|
|
||||||
cg the new backend ( *.m => *.s )
|
|
||||||
lib the libraries for all run-time systems
|
|
||||||
these libraries are used by the assembler.
|
|
||||||
libpc Used to create Pascal run-time system in 'lib'
|
|
||||||
libcc Used to create C run-time system in 'lib'
|
|
||||||
libem Sources for EM runtime system, result sits in 'lib'
|
|
||||||
test Various tests
|
|
||||||
dl Down-load programs
|
|
||||||
int Source for an interpreter
|
|
||||||
available are:
|
|
||||||
PMDS II 68000, wordsize 2, ptrsize 4
|
|
||||||
mach/m68k2
|
|
||||||
mach/m68k2/as
|
|
||||||
mach/m68k2/cg
|
|
||||||
mach/m68k2/libem
|
|
||||||
mach/m68k2/lib
|
|
||||||
mach/m68k2/dl
|
|
||||||
mach/m68k2/libpc
|
|
||||||
mach/m68k2/libcc
|
|
||||||
mach/m68k2/libsys
|
|
||||||
bare 6809
|
|
||||||
mach/6809
|
|
||||||
mach/6809/as
|
|
||||||
8080, wordsize 2, ptrsize 2
|
|
||||||
mach/8080
|
|
||||||
mach/8080/as
|
|
||||||
mach/8080/test
|
|
||||||
mach/8080/libcc
|
|
||||||
mach/8080/lib
|
|
||||||
bare 8086, wordsize 2, ptrsize 2
|
|
||||||
mach/i86
|
|
||||||
mach/i86/as
|
|
||||||
mach/i86/lib
|
|
||||||
mach/i86/libcc
|
|
||||||
mach/i86/dl
|
|
||||||
mach/i86/libem
|
|
||||||
mach/i86/libpc
|
|
||||||
mach/i86/saio (library for stand-alone EM on 86/12A )
|
|
||||||
pdp 11, UNIX/V7, wordsize 2, ptrsize 2
|
|
||||||
mach/pdp
|
|
||||||
mach/pdp/test
|
|
||||||
mach/pdp/libem
|
|
||||||
mach/pdp/lib
|
|
||||||
mach/pdp/libcc
|
|
||||||
mach/pdp/libpc
|
|
||||||
mach/pdp/cg
|
|
||||||
mach/pdp/int -PDP 11/44 EM interpreter
|
|
||||||
vax 780, UNIX V7, wordsize 4, ptrsize 4
|
|
||||||
mach/vax4
|
|
||||||
mach/vax4/cg
|
|
||||||
mach/vax4/lib
|
|
||||||
mach/vax4/libcc
|
|
||||||
mach/vax4/libem
|
|
||||||
mach/vax4/libpc
|
|
||||||
z80, CP/M, wordsize 2, ptrsize 2
|
|
||||||
mach/z80
|
|
||||||
mach/z80/as
|
|
||||||
mach/z80/libem
|
|
||||||
mach/z80/lib
|
|
||||||
mach/z80/libcc
|
|
||||||
mach/z80/libpc
|
|
||||||
mach/z80/int -Z80 EM interpreter
|
|
||||||
z80, nascom
|
|
||||||
mach/z80a
|
|
||||||
mach/z80a/dl
|
|
||||||
vax 11/780, Berkeley UNIX, wordsize 2, ptrsize 4
|
|
||||||
mach/vax2
|
|
||||||
mach/vax2/cg
|
|
||||||
mach/vax2/lib
|
|
||||||
mach/vax2/libpc
|
|
||||||
mach/vax2/libem
|
|
||||||
bare 6500, wordsize 2, ptrsize 2
|
|
||||||
mach/6500
|
|
||||||
mach/6500/as
|
|
||||||
mach/6500/dl
|
|
||||||
mach/6500/libem
|
|
||||||
mach/6500/lib
|
|
||||||
bare 6800, wordsize 2, ptrsize 2
|
|
||||||
mach/6800
|
|
||||||
mach/6800/as
|
|
||||||
EM virtual machine code, wordsize 2, ptrsize 2
|
|
||||||
mach/int
|
|
||||||
mach/int/libcc
|
|
||||||
mach/int/libpc
|
|
||||||
mach/int/lib
|
|
||||||
mach/int/test
|
|
||||||
The directory proto contains files used by most machines.
|
|
||||||
e.g. makefiles for libraries for C and Pascal
|
|
||||||
mach/proto
|
|
||||||
mach/proto/libg
|
|
||||||
.fi
|
|
||||||
.IP "emtest"
|
|
||||||
.br
|
|
||||||
Contains prototype of em test set.
|
|
||||||
.IP "man"
|
|
||||||
.br
|
|
||||||
Man files for various utilities
|
|
||||||
.IP "lang"
|
|
||||||
.br
|
|
||||||
just there to group the directories for all front-ends
|
|
||||||
.IP "lang/pc"
|
|
||||||
.br
|
|
||||||
Pascal front-end
|
|
||||||
.IP "lang/pc/libpc"
|
|
||||||
.br
|
|
||||||
Source of Pascal run-time system ( in EM or C )
|
|
||||||
.IP "lang/pc/test"
|
|
||||||
.br
|
|
||||||
Some test programs written in Pascal
|
|
||||||
.IP "lang/pc/pem"
|
|
||||||
.br
|
|
||||||
The compiler proper
|
|
||||||
.IP "lang/cem"
|
|
||||||
.br
|
|
||||||
C front-end
|
|
||||||
.IP "lang/cem/libcc"
|
|
||||||
.br
|
|
||||||
Directories with sources of C runtime system, libraries (in EM or C)
|
|
||||||
.IP "lang/cem/libcc/gen"
|
|
||||||
.br
|
|
||||||
Sources for routines in chapter III of UNIX programmers manual,
|
|
||||||
excluding STDIO
|
|
||||||
.IP "lang/cem/libcc/stdio"
|
|
||||||
.br
|
|
||||||
STDIO sources
|
|
||||||
.IP "lang/cem/libcc/mon"
|
|
||||||
.br
|
|
||||||
Sources for routines in chapter II, written in EM
|
|
||||||
.IP "lang/cem/comp"
|
|
||||||
.br
|
|
||||||
The compiler proper
|
|
||||||
.IP "lang/cem/ctest"
|
|
||||||
.br
|
|
||||||
C test set
|
|
||||||
.IP "lang/cem/ctest/cterr"
|
|
||||||
.br
|
|
||||||
Programs developed for pinpointing previous errors
|
|
||||||
.IP "lang/cem/ctest/ct*"
|
|
||||||
.br
|
|
||||||
The test programs.
|
|
||||||
.IP "util"
|
|
||||||
.br
|
|
||||||
Contains directories with various utilities
|
|
||||||
.IP "util/opt"
|
|
||||||
.br
|
|
||||||
EM peephole optimizer (*.k => *.m)
|
|
||||||
.IP "util/misc"
|
|
||||||
.br
|
|
||||||
Decode (*.[km] => *.e) + encode (*.e => *.k)
|
|
||||||
.IP "util/data"
|
|
||||||
.br
|
|
||||||
The C-code for `lib/em_data.a`
|
|
||||||
These sources are created by the Makefile in `etc`
|
|
||||||
.IP "util/ass"
|
|
||||||
.br
|
|
||||||
The EM assembler ( *.[km] + libraries => e.out )
|
|
||||||
.IP "util/arch"
|
|
||||||
.br
|
|
||||||
The archiver to be used for ALL EM utilities
|
|
||||||
.IP "util/cgg"
|
|
||||||
.br
|
|
||||||
A program needed for compiling backends.
|
|
||||||
.IP "util/cpp"
|
|
||||||
.br
|
|
||||||
The V7 C preprocessor.
|
|
||||||
.LP
|
|
||||||
All pathnames mentioned in the text of this document are relative to the
|
|
||||||
working directory, unless they start with '/'.
|
|
||||||
.PP
|
|
||||||
The person doing the installation needs permission to write in the
|
|
||||||
directories of the Amsterdam Compiler Kit distribution tree.
|
|
||||||
Preferably you should log in as sys (uid=3,gid=0).
|
|
||||||
.NH
|
|
||||||
Pathnames
|
|
||||||
.PP
|
|
||||||
Absolute pathnames are concentrated in "h/em_path.h".
|
|
||||||
Only the pascal runtime system and the utility \fIack\fP use
|
|
||||||
absolute pathnames to access files in the kit.
|
|
||||||
The tree is distributed with /usr/em as the working
|
|
||||||
directory.
|
|
||||||
The definition of EM_HOME in em_path.h should be altered to
|
|
||||||
specify the root
|
|
||||||
directory for the Compiler Kit distribution on your system.
|
|
||||||
The trailing " in the definition of EM_HOME is intentionally
|
|
||||||
missing!
|
|
||||||
Em_path.h also specifies which directory should be used for
|
|
||||||
temporary files.
|
|
||||||
Most programs from the kit do indeed use that directory
|
|
||||||
although some remain stubborn and use /tmp or /usr/tmp.
|
|
||||||
.LP
|
|
||||||
The shape of the tree should not be altered lightly because
|
|
||||||
most Makefiles and the
|
|
||||||
utility \fIack\fP know the shape of the ACK tree.
|
|
||||||
All pathnames in all Makefiles are relative, that is do not
|
|
||||||
have "/" as the first character.
|
|
||||||
The knowledge of the utility \fIack\fP about the shape of the tree is
|
|
||||||
concentrated in the files in the directory lib/ack.
|
|
||||||
.NH
|
|
||||||
Commands
|
|
||||||
.PP
|
|
||||||
The kit is distributed with all available commands in the bin
|
|
||||||
directory.
|
|
||||||
The commands distributed are:
|
|
||||||
.IP "\fIack\fP, \fIacc\fP, \fIapc\fP and their links"
|
|
||||||
.br
|
|
||||||
They are used to compile the Pascal, C, etc... programs.
|
|
||||||
.IP \fIarch\fP
|
|
||||||
.br
|
|
||||||
The archiver used for the EM- and universal assembler.
|
|
||||||
.IP "\fIem\fP and \fIeminform\fP"
|
|
||||||
.br
|
|
||||||
The EM interpretator for the PDP-11 and the program to unravel
|
|
||||||
its post-mortem information.
|
|
||||||
.LP
|
|
||||||
We currently make the kit available to our users by telling
|
|
||||||
them that they should include the bin directory of the kit in
|
|
||||||
their PATH shell variable.
|
|
||||||
The programs will still work when moved to a different
|
|
||||||
directory.
|
|
||||||
The copying should preferably be done with tar, since links are
|
|
||||||
heavily used.
|
|
||||||
Renaming of the programs linked to \fIack\fP will not always
|
|
||||||
produce the desired result.
|
|
||||||
This program uses its call name as an argument.
|
|
||||||
Any call name not being \fIcc\fP, \fIacc\fP, \fIpc\fP or \fIapc\fP will be
|
|
||||||
interpreted as the name of a 'machine description' and the
|
|
||||||
program will try to find a description file with that name.
|
|
||||||
All recompilations will only touch the utilities in the bin
|
|
||||||
directory, not your own copies.
|
|
||||||
.NH
|
|
||||||
Options
|
|
||||||
.PP
|
|
||||||
There is one important option in h/local.h.
|
|
||||||
The utility \fIack\fP uses a default machine name when called
|
|
||||||
as \fIacc\fP, \fIcc\fP, \fIapc\fP, \fIpc\fP or \fIack\fP.
|
|
||||||
The machine name used for default is determined by the
|
|
||||||
definition of ACKM in h/local.h.
|
|
||||||
The current definition is \fIpdp\fP.
|
|
||||||
.PP
|
|
||||||
The distribution is tailored to one specific opreating system per CPU type.
|
|
||||||
For some of these CPU's it is possible to tailor the distribution to another
|
|
||||||
operating system.
|
|
||||||
The steps to be taken are described in READ_ME (or README) files in the
|
|
||||||
subdirectories of the directory in EM_HOME/mach for that particular machine.
|
|
||||||
For example: The vax2 distribution is tailoerd to BSD4.1, but has #define's
|
|
||||||
for BSD4.1c and BSD4.2.
|
|
||||||
For the names and places of these define's look in EM_HOME/mach/vax2/cg and
|
|
||||||
EM_HOME/mach/vax2/libem.
|
|
||||||
.NH
|
|
||||||
Recompilation
|
|
||||||
.PP
|
|
||||||
The kit comes with binaries in the directories \fBbin\fP and
|
|
||||||
\fBlib\fP.
|
|
||||||
Some directories among mach/*/lib contain archives with object files,
|
|
||||||
notably mach/pdp/lib.
|
|
||||||
The binaries and object files are for a PDP 11/44 with floating
|
|
||||||
point running UNIX V7.
|
|
||||||
.PP
|
|
||||||
Almost all directories contain a "Makefile" or a shell command file called
|
|
||||||
"make".
|
|
||||||
Apart from commands applying to that specific directory these
|
|
||||||
files all recognize a few special commands.
|
|
||||||
When called with one of these they will apply the command to
|
|
||||||
their own directory and all subdirectories.
|
|
||||||
The special commands are:
|
|
||||||
.IP "install" 20
|
|
||||||
recompile and install all binaries and libraries.
|
|
||||||
.br
|
|
||||||
Some Makefiles allow errors to occur in the programs they call.
|
|
||||||
They ignore such errors and notify the user with the message
|
|
||||||
"~....... error code n: ignored".
|
|
||||||
Whenever such a message appears in the output you can ignore it
|
|
||||||
too.
|
|
||||||
.br
|
|
||||||
The installation of the PUBMAC macro package is not done
|
|
||||||
automatically from the higher level directory.
|
|
||||||
.IP "cmp"
|
|
||||||
recompile all binaries and libraries and compare them to the
|
|
||||||
ones already installed.
|
|
||||||
.IP pr
|
|
||||||
print the sources and documentation on the standard output.
|
|
||||||
.IP opr
|
|
||||||
make pr | opr
|
|
||||||
.br
|
|
||||||
Opr should be an off-line printer daemon.
|
|
||||||
On some systems it exists under another name e.g. lpr.
|
|
||||||
The easiest way to call such a spooler is using a shell script
|
|
||||||
with the name opr that calls lpr.
|
|
||||||
This script should be placed in /usr/bin or EM_HOME/bin or
|
|
||||||
one of the directories in your PATH.
|
|
||||||
.IP clean
|
|
||||||
remove all files not needed for day-to-day use,
|
|
||||||
that is binaries not in bin or lib, object files etc.
|
|
||||||
.LP
|
|
||||||
Example:
|
|
||||||
.nf
|
|
||||||
.sp 1
|
|
||||||
make install
|
|
||||||
.sp 1
|
|
||||||
.fi
|
|
||||||
given as command in the home directory will cause
|
|
||||||
recompilation of all programs in the kit.
|
|
||||||
.LP
|
|
||||||
Recompilation of the complete kit lasts about 9 hours an a PDP
|
|
||||||
11/44.
|
|
||||||
.NH 2
|
|
||||||
Recompilation on a different machine.
|
|
||||||
.PP
|
|
||||||
Installation on other systems will often require recompilation
|
|
||||||
of all programs.
|
|
||||||
The presence of a C compiler is essential for recompilation.
|
|
||||||
Except the Pascal compiler proper all programs are written in C.
|
|
||||||
Some modules are derived from \fIyacc\fP sources.
|
|
||||||
Retranslating these programs from that yacc source is not
|
|
||||||
necessary, although it might improve performance.
|
|
||||||
Some versions of \fIyacc\fP 'know' that the resulting C programs will
|
|
||||||
run on a 32-bit int machine.
|
|
||||||
C modules produced by such a \fIyacc\fP are not portable and
|
|
||||||
should not be used to (cross)compile programs for 16-bit machines.
|
|
||||||
We assume a version UNIX which, apart from the C-compiler,
|
|
||||||
contains most normal utilities, like ed, sed, grep, make, the
|
|
||||||
Bourne shell etc.
|
|
||||||
All Makefiles use the system C-compiler.
|
|
||||||
The existence of a backend for your system is of course essential
|
|
||||||
if you wish to produce executable files for that system.
|
|
||||||
When the backend exists it is also possible to boot the Pascal
|
|
||||||
Compiler,
|
|
||||||
that is written in Pascal itself.
|
|
||||||
The kit contains the compact code files for the 2/2 and 2/4
|
|
||||||
versions of the Pascal compiler.
|
|
||||||
The current version of this compiler can only be used on machines
|
|
||||||
with a 16-bit word size and 16- or 32-bit pointers.
|
|
||||||
The Makefile automatically tries to boot the Pascal compiler
|
|
||||||
from one of these compact code files, if the compiler proves
|
|
||||||
unable to compile itself.
|
|
||||||
.PP
|
|
||||||
The native assemblers and loaders are used on PDP-11 and VAX.
|
|
||||||
The description files in lib/ack for other systems use our
|
|
||||||
universal assembler.
|
|
||||||
The load file produced by this assembler is not directly
|
|
||||||
usable in any system known to us,
|
|
||||||
but has to be converted before it can be put to use.
|
|
||||||
The \fIdl\fP programs present for some machines unravel
|
|
||||||
these load files and transmit commands to load memory
|
|
||||||
to a microprocessor over a serial line.
|
|
||||||
The PDP-11 version of our universal assembler is supplied
|
|
||||||
with a conversion program.
|
|
||||||
The file man/a.out.5 contains a description of the format of
|
|
||||||
the universal assembler load file,
|
|
||||||
it might be useful to those who wish or need to write their
|
|
||||||
own conversion programs.
|
|
||||||
.br
|
|
||||||
Berkeley UNIX for the VAX'en has (at least) three different
|
|
||||||
versions, BSD4.1a, BSD4.1c and BSD4.2. The READ_ME files in the
|
|
||||||
directories mach/vax2/cg, mach/vax2/libem, mach/vax4/cg and
|
|
||||||
mach/vax4/libem tell you how to adapt the vax2 and vax4 backend
|
|
||||||
to these versions.
|
|
||||||
.NH 2
|
|
||||||
Recompiling libraries
|
|
||||||
.PP
|
|
||||||
The kit contains sources for part II and III of the C-library, except
|
|
||||||
the math functions, they are grabbed from our V7 system and sometimes
|
|
||||||
altered in a EM dependent way or replaced altogether when the original
|
|
||||||
was in assembly.
|
|
||||||
These files can be used to make libraries for the Ack C-compiler.
|
|
||||||
The recompilation process uses a few include files.
|
|
||||||
The include directory in the EM home directory contains a few more
|
|
||||||
or less system independent include files.
|
|
||||||
The system dependent include files are fetched from /usr/include
|
|
||||||
on the system you use to recompile.
|
|
||||||
This may lead to several problems.
|
|
||||||
Sometimes the system differs so much from V7 that certain manifest constants
|
|
||||||
do not exist any more.
|
|
||||||
At other times these include files were written for a compiler without
|
|
||||||
a restriction on name length.
|
|
||||||
In that case - I've seen it happen - people tend to use differing
|
|
||||||
identifiers that are identical in the first eight characters.
|
|
||||||
All these problems you have to solve yourself,
|
|
||||||
the libraries are only included as an extra and too much system
|
|
||||||
dependent to give any guarantees.
|
|
||||||
.NH
|
|
||||||
Fixes to the UNIX V7 system
|
|
||||||
.PP
|
|
||||||
UNIX System V7 has a few bugs that prevent a part of or the whole kit
|
|
||||||
from working properly.
|
|
||||||
To be honest, we do not know which of the following changes are
|
|
||||||
essential to the functioning of our kit.
|
|
||||||
.PP
|
|
||||||
The file "doc/v7bugs.doc" gives for each of the following bugs
|
|
||||||
a small test program and a diff listing of the source files that have to be
|
|
||||||
modified.
|
|
||||||
.IP 1
|
|
||||||
Bug in the C optimizer for unsigned comparison
|
|
||||||
.nr PD 0
|
|
||||||
.IP 2
|
|
||||||
The loader 'ld' fails for large data and text portions
|
|
||||||
.IP 3
|
|
||||||
Floating point registers are not saved if more memory is needed.
|
|
||||||
.IP 4
|
|
||||||
Floating point registers are not copied to child in fork().
|
|
||||||
.nr PD 1v
|
|
||||||
.LP
|
|
||||||
Use the test programs to see if the errors are present in your system
|
|
||||||
and to check if the modifications are effective.
|
|
||||||
.NH
|
|
||||||
Testing
|
|
||||||
.PP
|
|
||||||
Test sets are available in Pascal, C and EM assembly.
|
|
||||||
.IP em 8
|
|
||||||
.br
|
|
||||||
The directory emtest contains a few EM test programs.
|
|
||||||
The EM assembly files in these tests must be transformed into
|
|
||||||
load files, thereby avoiding use of the EM optimizer.
|
|
||||||
These tests use the LIN and NOP instructions to mark the passing of each
|
|
||||||
test.
|
|
||||||
The NOP instruction prints the current line number during the
|
|
||||||
test phase.
|
|
||||||
Each test notifies its correctness by calling LIN with a unique
|
|
||||||
number followed by a NOP which prints this line number.
|
|
||||||
The test finishes normally with 0 as the last number printed
|
|
||||||
In all other cases a bug showed its
|
|
||||||
existence.
|
|
||||||
.IP Pascal
|
|
||||||
.br
|
|
||||||
The directory lang/pc/test contains a few pascal test programs.
|
|
||||||
All these programs print the number of errors found and a
|
|
||||||
identification of these errors.
|
|
||||||
.IP C
|
|
||||||
.br
|
|
||||||
The sub-directories in lang/cem/ctest contain C test programs.
|
|
||||||
The idea behind these tests is:
|
|
||||||
when you have a program called xx.c, compile it into xx.cem.
|
|
||||||
Run it with standard output to xx.cem.r, compare this file to
|
|
||||||
xx.cem.g, a file containing the 'ideal' output.
|
|
||||||
Any differences will point to implementation differences or
|
|
||||||
bugs.
|
|
||||||
Giving the command "run gen" or plain "run" starts this
|
|
||||||
process.
|
|
||||||
The differences will be presented on standard output.
|
|
||||||
The contents of the result files depend on the wordsize,
|
|
||||||
the xx.cem.g files on the distribution are intended for a
|
|
||||||
16-bit machine.
|
|
||||||
.NH
|
|
||||||
Documentation
|
|
||||||
.PP
|
|
||||||
Manual pages for Amsterdam Compiler Kit can be copied
|
|
||||||
to "/usr/man/man?" by the
|
|
||||||
following commands:
|
|
||||||
.DS
|
|
||||||
cd man
|
|
||||||
make install
|
|
||||||
.DE
|
|
||||||
.LP
|
|
||||||
Several documents are provided:
|
|
||||||
.DS
|
|
||||||
doc/toolkit.doc: a general overview
|
|
||||||
doc/pcref.doc: the Pascal-frontend reference manual
|
|
||||||
doc/val.doc: the results of running the Pascal Validation Suite
|
|
||||||
doc/cref.doc: the C-frontend manual
|
|
||||||
doc/em.doc: a description of the EM machine architecture
|
|
||||||
doc/peep.doc: internal documentation for the peephole optimizer
|
|
||||||
doc/cg.doc: documentation for backend writers and maintainers
|
|
||||||
doc/regadd.doc: addendum to previous document describing register variables
|
|
||||||
doc/install.doc: this document
|
|
||||||
.DE
|
|
||||||
.LP
|
|
||||||
The Validation Suite is a collection of more than 200 Pascal programs,
|
|
||||||
designed by Brian Wichmann and Arthur Sale to test Pascal compilers.
|
|
||||||
We are not allowed to distribute it, but you may
|
|
||||||
request a copy from
|
|
||||||
.DS
|
|
||||||
Richard J. Cichelli
|
|
||||||
A.N.P.A.
|
|
||||||
1350 Sullivan Trail
|
|
||||||
P.O. Box 598
|
|
||||||
Easton, Pennsylvania 18042
|
|
||||||
USA
|
|
||||||
.DE
|
|
||||||
.LP
|
|
||||||
Good luck.
|
|
||||||
1511
doc/pcref.doc
1511
doc/pcref.doc
File diff suppressed because it is too large
Load Diff
505
doc/peep.doc
505
doc/peep.doc
@@ -1,505 +0,0 @@
|
|||||||
.TL
|
|
||||||
Internal documentation on the peephole optimizer
|
|
||||||
.br
|
|
||||||
from the Amsterdam Compiler Kit
|
|
||||||
.NH 1
|
|
||||||
Introduction
|
|
||||||
.PP
|
|
||||||
Part of the Amsterdam Compiler Kit is a program to do
|
|
||||||
peephole optimization on an EM program.
|
|
||||||
The optimizer scans the program to match patterns from a table
|
|
||||||
and if found makes the optimization from the table,
|
|
||||||
and with the result of the optimization
|
|
||||||
it tries to find yet another optimization
|
|
||||||
continuing until no more optimizations are found.
|
|
||||||
.PP
|
|
||||||
Furthermore it does some optimizations that can not be called
|
|
||||||
peephole optimizations for historical reasons,
|
|
||||||
like branch chaining and the deletion of unreachable code.
|
|
||||||
.PP
|
|
||||||
The peephole optimizer consists of three parts
|
|
||||||
.IP 1)
|
|
||||||
A driving table
|
|
||||||
.IP 2)
|
|
||||||
A program translating the table to internal format
|
|
||||||
.IP 3)
|
|
||||||
C code compiled with the table to make the optimizer proper
|
|
||||||
.PP
|
|
||||||
In this document the table format, internal format and
|
|
||||||
data structures in the optimizer will be explained,
|
|
||||||
plus a hint on what the code does where it might not be obvious.
|
|
||||||
It is a simple program mostly.
|
|
||||||
.NH 1
|
|
||||||
Table format
|
|
||||||
.PP
|
|
||||||
The driving table consists of pattern/replacement pairs,
|
|
||||||
in principle one per line,
|
|
||||||
although a line starting with white space is considered
|
|
||||||
a continuation line for the previous.
|
|
||||||
The general format is:
|
|
||||||
.DS
|
|
||||||
optimization : pattern ':' replacement '\en'
|
|
||||||
.sp
|
|
||||||
pattern : EMlist optional_boolean_expression
|
|
||||||
.sp
|
|
||||||
replacement : EM_plus_operand_list
|
|
||||||
.DE
|
|
||||||
Example of a simple one
|
|
||||||
.DS
|
|
||||||
loc stl $1==0 : zrl $2
|
|
||||||
.DE
|
|
||||||
There is no real limit for the length of the pattern or the replacement,
|
|
||||||
the replacement might even be longer than the pattern,
|
|
||||||
and expressions can be made arbitrarily complicated.
|
|
||||||
.PP
|
|
||||||
The expressions in the table are made of the following pieces:
|
|
||||||
.IP -
|
|
||||||
Integer constants
|
|
||||||
.IP -
|
|
||||||
$\fIn\fP, standing for the operand of the \fIn\fP'th EM
|
|
||||||
instruction in the pattern,
|
|
||||||
undefined if that instruction has no operand.
|
|
||||||
.IP -
|
|
||||||
w, standing for the wordsize of the code optimized.
|
|
||||||
.IP -
|
|
||||||
p, for the pointersize.
|
|
||||||
.IP -
|
|
||||||
defined(expr), true if expression is defined
|
|
||||||
.IP -
|
|
||||||
samesign(expr,expr), true if expressions have the same sign.
|
|
||||||
.IP -
|
|
||||||
sfit(expr,expr), ufit(expr,expr),
|
|
||||||
true if the first expression fits signed or unsigned in the number
|
|
||||||
of bits given in the second expression.
|
|
||||||
.IP -
|
|
||||||
rotate(expr,expr),
|
|
||||||
first expression rotated left the number of bits given by the second expression.
|
|
||||||
.IP -
|
|
||||||
notreg(expr),
|
|
||||||
true if the local with the expression as number is not a candidate to put
|
|
||||||
in a register.
|
|
||||||
.IP -
|
|
||||||
rom(\fIn\fP,expr), contents of the rom descriptor at index expr that
|
|
||||||
is associated with the global label that should be the argument of
|
|
||||||
the \fIn\fP'th EM instruction.
|
|
||||||
Undefined if such a thing does not exist.
|
|
||||||
.PP
|
|
||||||
The usual arithmetic operators may be used on integer values,
|
|
||||||
if any operand is undefined the expression is undefined,
|
|
||||||
except for the defined() function above.
|
|
||||||
An undefined expression used for its truth value is false.
|
|
||||||
All arithmetic on local label operands is forbidden,
|
|
||||||
only things allowed are tests for equality.
|
|
||||||
Arithmetic on global labels makes sense,
|
|
||||||
i.e. one can add a global label and a constant,
|
|
||||||
but not two global labels.
|
|
||||||
.PP
|
|
||||||
In the table one can use five additional EM instructions in patterns.
|
|
||||||
These are:
|
|
||||||
.IP lab
|
|
||||||
Stands for a local label
|
|
||||||
.IP LLP
|
|
||||||
Load Local Pointer, translates into a
|
|
||||||
.B lol
|
|
||||||
or into a
|
|
||||||
.B ldl
|
|
||||||
depending on the relationship between wordsize and pointersize.
|
|
||||||
.IP LEP
|
|
||||||
Load External Pointer, translates into a
|
|
||||||
.B loe
|
|
||||||
or into a
|
|
||||||
.B lde .
|
|
||||||
.IP SLP
|
|
||||||
Store Local Pointer,
|
|
||||||
.B stl
|
|
||||||
or
|
|
||||||
.B sdl .
|
|
||||||
.IP SEP
|
|
||||||
Store External Pointer,
|
|
||||||
.B ste
|
|
||||||
or
|
|
||||||
.B sde .
|
|
||||||
.PP
|
|
||||||
There is only one peephole optimizer,
|
|
||||||
so the substitutions to be made for the last four instructions
|
|
||||||
are made at run time before the first optimizations are made.
|
|
||||||
.NH 1
|
|
||||||
Internal format
|
|
||||||
.PP
|
|
||||||
The translating program,
|
|
||||||
.I mktab
|
|
||||||
converts the table into an array of bytes where all
|
|
||||||
patterns follow unaligned.
|
|
||||||
Format of a pattern is:
|
|
||||||
.IP 1)
|
|
||||||
One byte for high byte of hash value,
|
|
||||||
will be explained later on.
|
|
||||||
.IP 2)
|
|
||||||
Two bytes for the index of the next pattern in a chain.
|
|
||||||
.IP 3)
|
|
||||||
An integer\u*\d,
|
|
||||||
.FS
|
|
||||||
* An integer is encoded as a byte when less than 255,
|
|
||||||
otherwise as a byte containing 255 followed by two
|
|
||||||
bytes with the real value.
|
|
||||||
.FE
|
|
||||||
pattern length.
|
|
||||||
.IP 4)
|
|
||||||
The list of pattern opcodes, one per byte.
|
|
||||||
.IP 5)
|
|
||||||
An integer expression index, 0 if not used.
|
|
||||||
.IP 6)
|
|
||||||
An integer, replacement length.
|
|
||||||
.IP 7)
|
|
||||||
A list of pairs consisting of a one byte opcode and an integer
|
|
||||||
expression index.
|
|
||||||
.PP
|
|
||||||
The expressions are kept in an array of triples,
|
|
||||||
implementing a binary tree.
|
|
||||||
The
|
|
||||||
.I mktab
|
|
||||||
program tries to minimize the number of triples by reusing
|
|
||||||
duplicates and even reverses the operands of commutative operators
|
|
||||||
when doing so would spare a triple.
|
|
||||||
.NH 1
|
|
||||||
A tour through the sources
|
|
||||||
.PP
|
|
||||||
Now we will walk through the sources and note things of interest.
|
|
||||||
.NH 2
|
|
||||||
The header files
|
|
||||||
.PP
|
|
||||||
The header files are the place where data structures and options reside.
|
|
||||||
.NH 3
|
|
||||||
alloc.h
|
|
||||||
.PP
|
|
||||||
In the header file alloc.h several defines can be used to select various
|
|
||||||
kinds of core allocation schemes.
|
|
||||||
This is important on small machines like the PDP-11 since a complete
|
|
||||||
procedure must be in core at the same space,
|
|
||||||
and the peephole optimizer should not be the limiting factor in
|
|
||||||
determining the maximum size of procedures if possible.
|
|
||||||
Options are:
|
|
||||||
.IP -
|
|
||||||
USEMALLOC, standard malloc() and free() are used instead of the own
|
|
||||||
core allocation package.
|
|
||||||
Not recommended unless the own package does not work on some bizarre
|
|
||||||
machine.
|
|
||||||
.IP -
|
|
||||||
COREDEBUG, prints large amounts of information about core management.
|
|
||||||
Better not define it unless you change the code and it stops working.
|
|
||||||
.IP -
|
|
||||||
SEPID, if you define this you will get an extra procedure that will
|
|
||||||
go through a lot of work to scrape the last bytes together if the
|
|
||||||
system won't provide more.
|
|
||||||
This is not a good idea if memory is scarce and code and data reside
|
|
||||||
in the same spaces, since the room used by the procedure might well
|
|
||||||
be more than the room saved.
|
|
||||||
.IP -
|
|
||||||
STACKROOM, number of shorts used in stack space.
|
|
||||||
This is used if memory is scarce and stack space and data space are
|
|
||||||
different.
|
|
||||||
On the PDP-11 a UNIX process starts with an 8K stack segment which
|
|
||||||
cannot be transferred to the data segment.
|
|
||||||
Under these conditions one can use a lot of the stack space for storage.
|
|
||||||
.NH 3
|
|
||||||
assert.h
|
|
||||||
.PP
|
|
||||||
Just defines the assert macro.
|
|
||||||
When compiled with -DNDEBUG all asserts will be off.
|
|
||||||
.NH 3
|
|
||||||
ext.h
|
|
||||||
.PP
|
|
||||||
Gives external definitions of variables used by more than one module.
|
|
||||||
.NH 3
|
|
||||||
line.h
|
|
||||||
.PP
|
|
||||||
Defines the structures used to keep instructions,
|
|
||||||
one structure per line of EM code,
|
|
||||||
and the structure to keep arguments of pseudos,
|
|
||||||
one structure per argument.
|
|
||||||
Both structures essentially contain a pointer to the next,
|
|
||||||
a type,
|
|
||||||
and a union containing information depending on the type.
|
|
||||||
Core is allocated only for the part of the union used.
|
|
||||||
.PP
|
|
||||||
The
|
|
||||||
.I
|
|
||||||
struct line
|
|
||||||
.R
|
|
||||||
has a very compact encoding for small integers,
|
|
||||||
they are encoded in the type field.
|
|
||||||
On the PDP-11 this gives a line structure of only 4 bytes for most
|
|
||||||
instructions.
|
|
||||||
.NH 3
|
|
||||||
lookup.h
|
|
||||||
.PP
|
|
||||||
Contains definition of the struct used for symbol table management,
|
|
||||||
global labels and procedure names are kept in one table.
|
|
||||||
.NH 3
|
|
||||||
optim.h
|
|
||||||
.PP
|
|
||||||
If one defines the DIAGOPT option in this header file,
|
|
||||||
for every optimization performed a number is written on stderr.
|
|
||||||
The number gives the number of the pattern in the table
|
|
||||||
or one of the four special numbers in this header file.
|
|
||||||
.NH 3
|
|
||||||
param.h
|
|
||||||
.PP
|
|
||||||
Contains one settable option,
|
|
||||||
LONGOFF.
|
|
||||||
If this is not defined the optimizer can only optimize programs
|
|
||||||
with wordsize 2 and pointersize 2.
|
|
||||||
Set this only if it must be run on a Z80 or something pathetic like that.
|
|
||||||
.PP
|
|
||||||
Other defines here should not be touched.
|
|
||||||
.NH 3
|
|
||||||
pattern.h
|
|
||||||
.PP
|
|
||||||
Contains defines of indices in a pattern,
|
|
||||||
definition of the expression triples,
|
|
||||||
definitions of the various expression operators
|
|
||||||
and definition of the result struct where expression results are put.
|
|
||||||
.PP
|
|
||||||
This header file is the main one that is also included by
|
|
||||||
.I mktab .
|
|
||||||
.NH 3
|
|
||||||
proinf.h
|
|
||||||
.PP
|
|
||||||
This one contains definitions
|
|
||||||
for the local label table structs
|
|
||||||
and for the struct where all information for one procedure is kept.
|
|
||||||
This is in one struct so it can be saved easily when recursive
|
|
||||||
procedures have to be resolved.
|
|
||||||
.NH 3
|
|
||||||
types.h
|
|
||||||
.PP
|
|
||||||
Collection of typedefs to be used by almost all modules.
|
|
||||||
.NH 2
|
|
||||||
The C code itself.
|
|
||||||
.PP
|
|
||||||
The C code will now be the center of our attention.
|
|
||||||
We will make a walk through the sources and we will try
|
|
||||||
to follow the sources in a logical order.
|
|
||||||
So we will start at
|
|
||||||
.NH 3
|
|
||||||
main.c
|
|
||||||
.PP
|
|
||||||
The main.c module contains the main() function.
|
|
||||||
Here nothing spectacular happens,
|
|
||||||
only thing of interest is the handling of flags:
|
|
||||||
.IP -L
|
|
||||||
This is an instruction to the peephole optimizer to perform
|
|
||||||
one of its auxiliary functions, the generation of a library module.
|
|
||||||
This makes the peephole optimizer write its output on a temporary file,
|
|
||||||
and at the end making the real output by first generating a list
|
|
||||||
of exported symbols and then copying the temporary file behind it.
|
|
||||||
.IP -n
|
|
||||||
Disables all optimization.
|
|
||||||
Only thing the optimizer does now is filling in the blank after the
|
|
||||||
.I END
|
|
||||||
pseudo and resolving recursive procedures.
|
|
||||||
.PP
|
|
||||||
The place where main() is left is the call to getlines() which brings
|
|
||||||
us to
|
|
||||||
.NH 3
|
|
||||||
getline.c
|
|
||||||
.PP
|
|
||||||
This module reads the EM code and constructs a list of
|
|
||||||
.I
|
|
||||||
struct line
|
|
||||||
.R
|
|
||||||
records,
|
|
||||||
linked together backwards,
|
|
||||||
i.e. the first instruction read is the last in the list.
|
|
||||||
Pseudos are handled here also,
|
|
||||||
for most pseudos this just means that a chain of argument records
|
|
||||||
is linked into the linked line list but some pseudos get special attention:
|
|
||||||
.IP exc
|
|
||||||
This pseudo is acted upon right away.
|
|
||||||
Lines read are shuffled around according to instruction.
|
|
||||||
.IP mes
|
|
||||||
Some messages are acted upon.
|
|
||||||
These are:
|
|
||||||
.RS
|
|
||||||
.IP ms_err 8
|
|
||||||
The input is drained, just in case it is a pipe.
|
|
||||||
After that the optimizer exits.
|
|
||||||
.IP ms_opt
|
|
||||||
The do not optimize flag is set.
|
|
||||||
Acts just like -n on the command line.
|
|
||||||
.IP ms_emx
|
|
||||||
The word- and pointersize are read,
|
|
||||||
complain if we are not able to handle this.
|
|
||||||
.IP ms_reg
|
|
||||||
We take notice of the offset of this local.
|
|
||||||
See also comments in the description of peephole.c
|
|
||||||
.RE
|
|
||||||
.IP pro
|
|
||||||
A new procedure starts, if we are already in one save the status,
|
|
||||||
else process collected input.
|
|
||||||
Collect information about this procedure and if already in a procedure
|
|
||||||
call getlines() recursively.
|
|
||||||
.IP end
|
|
||||||
Process collected input.
|
|
||||||
.PP
|
|
||||||
The phrase "process collected input" is used twice,
|
|
||||||
which brings us to
|
|
||||||
.NH 3
|
|
||||||
process.c
|
|
||||||
.PP
|
|
||||||
This module contains the entry point process() which is called at any
|
|
||||||
time the collected input must be processed.
|
|
||||||
It calls a variety of other routines to get the real work done.
|
|
||||||
Routines in this module are in chronological order:
|
|
||||||
.IP symknown 12
|
|
||||||
Marks all symbols seen until now as known,
|
|
||||||
i.e. it is now known whether their scope is local or global.
|
|
||||||
This information is used again during output.
|
|
||||||
.IP symvalue
|
|
||||||
Runs through the chain of pseudos to give values to data labels.
|
|
||||||
This needs an extra pass.
|
|
||||||
It cannot be done during the getlines pass, since an
|
|
||||||
.B exc
|
|
||||||
pseudo could destroy things.
|
|
||||||
Nor can it be done during the backward pass since it is impossible
|
|
||||||
to do good fragment numbering backward.
|
|
||||||
.IP checklocs
|
|
||||||
Checks whether all local labels referenced are defined.
|
|
||||||
It needs to be sure about this since otherwise the
|
|
||||||
semi global optimizations made cannot work.
|
|
||||||
.IP relabel
|
|
||||||
This routine finds the final destination for each label in the procedure.
|
|
||||||
Labels followed by unconditional branches or other labels are marked during
|
|
||||||
the peephole fase and this leeds to chains of identical labels.
|
|
||||||
These chains are followed here, and in the local label table each label
|
|
||||||
has associated with it its replacement label, after this procedure is run.
|
|
||||||
Care is taken in this routine to prevent a loop in the program to
|
|
||||||
cause the optimizer to loop.
|
|
||||||
.IP cleanlocals
|
|
||||||
This routine empties the local label table after everything
|
|
||||||
is processed.
|
|
||||||
.PP
|
|
||||||
But before this can all be done,
|
|
||||||
the backward linked list of instructions first has to be reversed,
|
|
||||||
so here comes
|
|
||||||
.NH 3
|
|
||||||
backward.c
|
|
||||||
.PP
|
|
||||||
The routine backward has a number of functions:
|
|
||||||
.IP -
|
|
||||||
It reverses the backward linked list, making two forward linked lists,
|
|
||||||
one for the instructions and one for the pseudos.
|
|
||||||
.IP -
|
|
||||||
It notes the last occurrence of data labels in the backward linked list
|
|
||||||
and puts it in the global symbol table.
|
|
||||||
This is of course the first occurence in the procedure.
|
|
||||||
This information is needed to decide whether the symbols are global
|
|
||||||
or local to this module.
|
|
||||||
.IP -
|
|
||||||
It decides about the fragment boundaries of data blocks.
|
|
||||||
Fragments are numbered backwards starting at 3.
|
|
||||||
This is done to be able to make the type of an expression
|
|
||||||
containing a symbol equal to its fragment.
|
|
||||||
This type can then not clash with the types integer and local label.
|
|
||||||
.IP -
|
|
||||||
It allocates a rom buffer to every data label with a rom behind
|
|
||||||
it, if that rom contains only plain integers at the start.
|
|
||||||
.PP
|
|
||||||
The first thing done after process() has called backward() and some
|
|
||||||
of its own little routines is a call to the real routine,
|
|
||||||
the one that does the work the program was written for
|
|
||||||
.NH 3
|
|
||||||
peephole.c
|
|
||||||
.PP
|
|
||||||
The first routines in peephole.c
|
|
||||||
implement a linked list for the offsets of local variables
|
|
||||||
that are candidates for a register implementation.
|
|
||||||
Several patterns use the notreg() function,
|
|
||||||
since it is forbidden to combine a load of that variable
|
|
||||||
with the load of another and
|
|
||||||
it is not allowed to take the address of that variable.
|
|
||||||
.PP
|
|
||||||
The routine peephole hashes the patterns the first time it is called
|
|
||||||
after which it doesn't do much more than calling optimize.
|
|
||||||
But first hashpatterns().
|
|
||||||
.PP
|
|
||||||
The patterns are hashed at run time of the optimizer because of
|
|
||||||
the
|
|
||||||
.B LLP ,
|
|
||||||
.B LEP ,
|
|
||||||
.B SLP
|
|
||||||
and
|
|
||||||
.B SEP
|
|
||||||
instructions added to the instruction set in this optimizer.
|
|
||||||
These are first replaced everywhere in the table by the correct
|
|
||||||
replacement after which the first three instructions of the
|
|
||||||
pattern are hashed and the pattern is linked into one of the
|
|
||||||
256 linked lists.
|
|
||||||
There is a define CHK_HASH in this module that you
|
|
||||||
can set if you do not trust the randomness of the hashing
|
|
||||||
function.
|
|
||||||
.PP
|
|
||||||
The attention now shifts to optimize().
|
|
||||||
This routine calls basicblock() for every piece of code between two labels.
|
|
||||||
It also notes which labels have another label or a branch behind them
|
|
||||||
so the relabel() routine from process.c can do something with that.
|
|
||||||
.PP
|
|
||||||
Basicblock() keeps making passes over its basic block
|
|
||||||
until no more optimizations are found.
|
|
||||||
This might be inefficient if there is a long basicblock with some
|
|
||||||
deep recursive optimization in one part of it.
|
|
||||||
The entire basic block is then scanned a lot of times just for
|
|
||||||
that one piece.
|
|
||||||
The alternative is backing up after making an optimization and running
|
|
||||||
through the same code again, but that is difficult
|
|
||||||
in a single linked list.
|
|
||||||
.PP
|
|
||||||
It hashes instructions and calls trypat() for every pattern that has
|
|
||||||
a full hash value match,
|
|
||||||
i.e. lower byte and upper byte equal.
|
|
||||||
Longest pattern is tried first.
|
|
||||||
.PP
|
|
||||||
Trypat() checks length and opcodes of the pattern.
|
|
||||||
If correct it fills the iargs[] array with argument values
|
|
||||||
and calculates the expression.
|
|
||||||
If that is also correct the work shifts to tryrepl().
|
|
||||||
.PP
|
|
||||||
Tryrepl() generates the list of replacement instructions,
|
|
||||||
links it into the list and returns true.
|
|
||||||
Why then the name tryrepl() if it always succeeds?
|
|
||||||
Well, there is a mechanism in the optimizer,
|
|
||||||
unused until today that makes it possible to do optimizations that cannot
|
|
||||||
be described by the table.
|
|
||||||
It is possible to give a number as a replacement which will cause the
|
|
||||||
optimizer to call a routine special() to do some work.
|
|
||||||
This routine might decide not to do an optimization and return false.
|
|
||||||
.PP
|
|
||||||
The last routine that is called from process() is putline()
|
|
||||||
to write the optimized code, bringing us to
|
|
||||||
.NH 3
|
|
||||||
putline.c
|
|
||||||
.PP
|
|
||||||
The major part of putline.c is the standard set of routines
|
|
||||||
that makes EM compact code.
|
|
||||||
The extra functions performed are:
|
|
||||||
.IP -
|
|
||||||
For every occurence of a global symbol it might be necessary to
|
|
||||||
output a
|
|
||||||
.B exa ,
|
|
||||||
.B exp ,
|
|
||||||
.B ina
|
|
||||||
or
|
|
||||||
.B inp
|
|
||||||
pseudo instruction.
|
|
||||||
That task is performed.
|
|
||||||
.IP -
|
|
||||||
The
|
|
||||||
.B lin
|
|
||||||
instructions are optimized here,
|
|
||||||
.B lni
|
|
||||||
instructions added for
|
|
||||||
.B lin
|
|
||||||
instructions and superfluous
|
|
||||||
.B lin
|
|
||||||
instructions deleted.
|
|
||||||
|
|
||||||
132
doc/regadd.doc
132
doc/regadd.doc
@@ -1,132 +0,0 @@
|
|||||||
.TL
|
|
||||||
Addition of register variables to an existing table.
|
|
||||||
.NH 1
|
|
||||||
Introduction
|
|
||||||
.PP
|
|
||||||
This is a short description of the newest feature in the
|
|
||||||
table driven code generator for the Amsterdam Compiler Kit.
|
|
||||||
It describes how to add register variables to an existing table.
|
|
||||||
This assumes you have the distribution of October 1983 or later.
|
|
||||||
It is not clear whether you should read this when starting with
|
|
||||||
a table for a new machine,
|
|
||||||
or whether you should wait till the table is well debugged already.
|
|
||||||
.NH 1
|
|
||||||
Modifications to the table itself.
|
|
||||||
.NH 2
|
|
||||||
Register section
|
|
||||||
.PP
|
|
||||||
You can add just before the properties of the register one
|
|
||||||
of the following:
|
|
||||||
.IP - 2
|
|
||||||
regvar
|
|
||||||
.IP -
|
|
||||||
regvar ( pointer )
|
|
||||||
.IP -
|
|
||||||
regvar ( loop )
|
|
||||||
.IP -
|
|
||||||
regvar ( float )
|
|
||||||
.LP
|
|
||||||
All register variables of one type must be of the same size,
|
|
||||||
and they may have no subregisters.
|
|
||||||
.NH 2
|
|
||||||
Codesection
|
|
||||||
.PP
|
|
||||||
.IP - 2
|
|
||||||
Two pseudo functions are added to the list allowed inside expressions:
|
|
||||||
.RS
|
|
||||||
.IP 1) 3
|
|
||||||
inreg ( expr ) has as a parameter the offset of a local,
|
|
||||||
and returns 0,1 or 2:
|
|
||||||
.RS
|
|
||||||
.IP 2: 3
|
|
||||||
if the variable is in a register.
|
|
||||||
.IP 1:
|
|
||||||
if the variable could be in a register but isn't.
|
|
||||||
.IP 0:
|
|
||||||
if the variable cannot be in a register.
|
|
||||||
.RE
|
|
||||||
.IP 2)
|
|
||||||
regvar ( expr ) returns the register associated with the variable.
|
|
||||||
Undefined if it is not in a register.
|
|
||||||
So regvar ( expr ) is defined if and only if inreg (expr ) == 2.
|
|
||||||
.RE
|
|
||||||
.IP -
|
|
||||||
It is now possible to remove() a register expression,
|
|
||||||
this is of course needed for a store into a register local.
|
|
||||||
.IP -
|
|
||||||
The return out of a procedure may now involve register restores,
|
|
||||||
so the special word 'return' in the table will invoke a user defined
|
|
||||||
function.
|
|
||||||
.NH 1
|
|
||||||
Modifications to mach.c
|
|
||||||
.PP
|
|
||||||
If register variables are used in a table, the program
|
|
||||||
.I cgg
|
|
||||||
will define the word REGVARS during compilation of the sources.
|
|
||||||
So the following functions described here should be bracketed
|
|
||||||
by #ifdef REGVARS and #endif.
|
|
||||||
.IP - 2
|
|
||||||
regscore(off,size,typ,freq,totyp) long off;
|
|
||||||
.br
|
|
||||||
This function should assign a score to a register variable,
|
|
||||||
the score should preferably be the estimated number of bytes
|
|
||||||
gained when it is put in a register.
|
|
||||||
Off and size are the offset and size of the variable,
|
|
||||||
typ is the type, that is reg_any, reg_pointer, reg_loop or reg_float.
|
|
||||||
Freq is the number of times it occurs statically, and totyp
|
|
||||||
is the type of the register it is planned to go into.
|
|
||||||
.br
|
|
||||||
Keep in mind that the gain should be net, that is the cost for
|
|
||||||
register save/restore sequences and the cost of initialisation
|
|
||||||
in the case of parameters should already be included.
|
|
||||||
.IP -
|
|
||||||
i_regsave()
|
|
||||||
.br
|
|
||||||
This function is called at the start of a procedure, just before
|
|
||||||
register saves are done.
|
|
||||||
It can be used to initialise some variables if needed.
|
|
||||||
.IP -
|
|
||||||
f_regsave()
|
|
||||||
.br
|
|
||||||
This function is called at end of the register save sequence.
|
|
||||||
It can be used to do the real saving if multiple register move
|
|
||||||
instructions are available.
|
|
||||||
.IP -
|
|
||||||
regsave(regstr,off,size) char *regstr; long off;
|
|
||||||
.br
|
|
||||||
Should either do the real saving or set up a table to have
|
|
||||||
it done by f_regsave.
|
|
||||||
Note that initialisation of parameters should also be done,
|
|
||||||
or planned here.
|
|
||||||
.IP -
|
|
||||||
regreturn()
|
|
||||||
.br
|
|
||||||
Should restore saved registers and return.
|
|
||||||
The function result is already in the function return area by now.
|
|
||||||
.NH 1
|
|
||||||
Examples
|
|
||||||
.PP
|
|
||||||
Here are some examples out of the PDP 11 table
|
|
||||||
.DS
|
|
||||||
lol inreg($1)==2| | | regvar($1) | |
|
|
||||||
|
|
||||||
lil inreg($1)==2| | | {regdef2, regvar($1)} | |
|
|
||||||
|
|
||||||
stl inreg($1)==2| xsource2 |
|
|
||||||
remove(regvar($1))
|
|
||||||
move(%[1],regvar($1)) | | |
|
|
||||||
|
|
||||||
inl inreg($1)==2| | remove(regvar($1))
|
|
||||||
"inc %(regvar($1)%)"
|
|
||||||
setcc(regvar($1)) | | |
|
|
||||||
.DE
|
|
||||||
.NH 1
|
|
||||||
Afterthoughts.
|
|
||||||
.PP
|
|
||||||
At the time of this writing the tables for the PDP 11 and the M68000 and
|
|
||||||
the VAX are converted, in all cases the two byte wordsize versions.
|
|
||||||
No big problems have occurred, but experience has shown that it is
|
|
||||||
necessary to check your table carefully for all patterns with locals in them
|
|
||||||
because if you forget one code will be generated by that one coderule
|
|
||||||
to use the memoryslot the local is not in.
|
|
||||||
|
|
||||||
896
doc/toolkit.doc
896
doc/toolkit.doc
@@ -1,896 +0,0 @@
|
|||||||
.RP
|
|
||||||
.ND
|
|
||||||
.nr LL 78m
|
|
||||||
.tr ~
|
|
||||||
.ds as *
|
|
||||||
.TL
|
|
||||||
A Practical Tool Kit for Making Portable Compilers
|
|
||||||
.AU
|
|
||||||
Andrew S. Tanenbaum
|
|
||||||
Hans van Staveren
|
|
||||||
E. G. Keizer
|
|
||||||
Johan W. Stevenson
|
|
||||||
.AI
|
|
||||||
Mathematics Dept.
|
|
||||||
Vrije Universiteit
|
|
||||||
Amsterdam, The Netherlands
|
|
||||||
.AB
|
|
||||||
The Amsterdam Compiler Kit is an integrated collection of programs designed to
|
|
||||||
simplify the task of producing portable (cross) compilers and interpreters.
|
|
||||||
For each language to be compiled, a program (called a front end)
|
|
||||||
must be written to
|
|
||||||
translate the source program into a common intermediate code.
|
|
||||||
This intermediate code can be optimized and then either directly interpreted
|
|
||||||
or translated to the assembly language of the desired target machine.
|
|
||||||
The paper describes the various pieces of the tool kit in some detail, as well
|
|
||||||
as discussing the overall strategy.
|
|
||||||
.sp
|
|
||||||
Keywords: Compiler, Interpreter, Portability, Translator
|
|
||||||
.sp
|
|
||||||
CR Categories: 4.12, 4.13, 4.22
|
|
||||||
.sp 12
|
|
||||||
Author's present addresses:
|
|
||||||
A.S. Tanenbaum, H. van Staveren, E.G. Keizer: Mathematics
|
|
||||||
Dept., Vrije Universiteit, Postbus 7161, 1007 MC Amsterdam,
|
|
||||||
The Netherlands
|
|
||||||
|
|
||||||
J.W. Stevenson: NV Philips, S&I, T&M, Building TQ V5, Eindhoven,
|
|
||||||
The Netherlands
|
|
||||||
.AE
|
|
||||||
.NH 1
|
|
||||||
Introduction
|
|
||||||
.PP
|
|
||||||
As more and more organizations acquire many micro- and minicomputers,
|
|
||||||
the need for portable compilers is becoming more and more acute.
|
|
||||||
The present situation, in which each hardware vendor provides its own
|
|
||||||
compilers -- each with its own deficiencies and extensions, and none of them
|
|
||||||
compatible -- leaves much to be desired.
|
|
||||||
The ideal situation would be an integrated system containing a family
|
|
||||||
of (cross) compilers, each compiler accepting a standard source language and
|
|
||||||
producing code for a wide variety of target machines.
|
|
||||||
Furthermore, the compilers should be compatible, so programs written in
|
|
||||||
one language can call procedures written in another language.
|
|
||||||
Finally, the system should be designed so as to make adding new languages
|
|
||||||
and new machines easy.
|
|
||||||
Such an integrated system is being built at the Vrije Universiteit.
|
|
||||||
Its design and implementation is the subject of this article.
|
|
||||||
.PP
|
|
||||||
Our compiler building system, which is called the "Amsterdam Compiler Kit"
|
|
||||||
(ACK), can be thought of as a "tool kit."
|
|
||||||
It consists of a number of parts that can be combined to form compilers
|
|
||||||
(and interpreters) with various properties.
|
|
||||||
The tool kit is based on an idea (UNCOL) that was first suggested in 1960
|
|
||||||
[7], but which never really caught on then.
|
|
||||||
The problem which UNCOL attempts to solve is how to make a compiler for
|
|
||||||
each of
|
|
||||||
.I N
|
|
||||||
languages on
|
|
||||||
.I M
|
|
||||||
different machines without having to write
|
|
||||||
.I N
|
|
||||||
x
|
|
||||||
.I M
|
|
||||||
programs.
|
|
||||||
.PP
|
|
||||||
As shown in Fig. 1, the UNCOL approach is to write
|
|
||||||
.I N
|
|
||||||
"front ends," each
|
|
||||||
of which translates one source language to a common intermediate language,
|
|
||||||
UNCOL (UNiversal Computer Oriented Language), and
|
|
||||||
.I M
|
|
||||||
"back ends," each
|
|
||||||
of which translates programs in UNCOL to a specific machine language.
|
|
||||||
Under these conditions, only
|
|
||||||
.I N
|
|
||||||
+
|
|
||||||
.I M
|
|
||||||
programs must be written to provide all
|
|
||||||
.I N
|
|
||||||
languages on all
|
|
||||||
.I M
|
|
||||||
machines, instead of
|
|
||||||
.I N
|
|
||||||
x
|
|
||||||
.I M
|
|
||||||
programs.
|
|
||||||
.PP
|
|
||||||
Various researchers have attempted to design a suitable UNCOL
|
|
||||||
[2,8], but none of these have become popular.
|
|
||||||
It is our belief that previous attempts have failed because they have been
|
|
||||||
too ambitious, that is, they have tried to cover all languages
|
|
||||||
and all machines using a single UNCOL.
|
|
||||||
Our approach is more modest: we cater only to algebraic languages
|
|
||||||
and machines whose memory consists of 8-bit bytes, each with its own address.
|
|
||||||
Typical languages that could be handled include
|
|
||||||
Ada, ALGOL 60, ALGOL 68, BASIC, C, FORTRAN,
|
|
||||||
Modula, Pascal, PL/I, PL/M, PLAIN, and RATFOR,
|
|
||||||
whereas COBOL, LISP, and SNOBOL would be less efficient.
|
|
||||||
Examples of machines that could be included are the Intel 8080 and 8086,
|
|
||||||
Motorola 6800, 6809, and 68000, Zilog Z80 and Z8000, DEC PDP-11 and VAX,
|
|
||||||
and IBM 370 but not the Burroughs 6700, CDC Cyber, or Univac 1108 (because
|
|
||||||
they are not byte-oriented).
|
|
||||||
With these restrictions, we believe the old UNCOL idea can be used as the
|
|
||||||
basis of a practical compiler-building system.
|
|
||||||
.KF
|
|
||||||
.sp 15P
|
|
||||||
.ce 1
|
|
||||||
Fig. 1. The UNCOL model.
|
|
||||||
.sp
|
|
||||||
.KE
|
|
||||||
.NH 1
|
|
||||||
An Overview of the Amsterdam Compiler Kit
|
|
||||||
.PP
|
|
||||||
The tool kit consists of eight components:
|
|
||||||
.sp
|
|
||||||
1. The preprocessor.
|
|
||||||
2. The front ends.
|
|
||||||
3. The peephole optimizer.
|
|
||||||
4. The global optimizer.
|
|
||||||
5. The back end.
|
|
||||||
6. The target machine optimizer.
|
|
||||||
7. The universal assembler/linker.
|
|
||||||
8. The utility package.
|
|
||||||
.sp
|
|
||||||
.PP
|
|
||||||
A fully optimizing compiler,
|
|
||||||
depicted in Fig. 2, has seven cascaded phases.
|
|
||||||
Conceptually, each component reads an input file and writes a
|
|
||||||
transformed output file to be used as input to the next component.
|
|
||||||
In practice, some components may use temporary files to allow multiple
|
|
||||||
passes over the input or internal intermediate files.
|
|
||||||
.KF
|
|
||||||
.sp 12P
|
|
||||||
.ce 1
|
|
||||||
Fig. 2. Structure of the Amsterdam Compiler Kit.
|
|
||||||
.sp
|
|
||||||
.KE
|
|
||||||
.PP
|
|
||||||
In the following paragraphs we will briefly describe each component.
|
|
||||||
After this overview, we will look at all of them again in more detail.
|
|
||||||
A program to be compiled is first fed into the (language independent)
|
|
||||||
preprocessor, which provides a simple macro facility,
|
|
||||||
and similar textual facilties.
|
|
||||||
The preprocessor's output is a legal program in one of the programming
|
|
||||||
languages supported, whereas the input is a program possibly augmented
|
|
||||||
with macros, etc.
|
|
||||||
.PP
|
|
||||||
This output goes into the appropriate front end, whose job it is to
|
|
||||||
produce intermediate code.
|
|
||||||
This intermediate code (our UNCOL) is the machine language for a simple
|
|
||||||
stack machine called EM (Encoding Machine).
|
|
||||||
A typical front end might build a parse tree from the input, and then
|
|
||||||
use the parse tree to generate EM code, which is similar to reverse Polish.
|
|
||||||
In order to perform this work, the front end has to maintain tables of
|
|
||||||
declared variables, labels, etc., determine where to place the
|
|
||||||
data structures in memory, and so on.
|
|
||||||
.PP
|
|
||||||
The EM code generated by the front end is fed into the peephole optimizer,
|
|
||||||
which scans it with a window of a few instructions, replacing certain
|
|
||||||
inefficient code sequences by better ones.
|
|
||||||
Such a search is important because EM contains instructions to handle
|
|
||||||
numerous important special cases efficiently
|
|
||||||
(e.g., incrementing a variable by 1).
|
|
||||||
It is our strategy to relieve the front ends of the burden of hunting for
|
|
||||||
special cases because there are many front ends and only one peephole
|
|
||||||
optimizer.
|
|
||||||
By handling the special cases in the peephole optimizer,
|
|
||||||
the front ends become simpler, easier to write and easier to maintain.
|
|
||||||
.PP
|
|
||||||
Following the peephole optimizer is a global optimizer [5], which
|
|
||||||
unlike the peephole optimizer, examines the program as a whole.
|
|
||||||
It builds a data flow graph to make possible a variety of
|
|
||||||
global optimizations,
|
|
||||||
among them, moving invariant code out of loops, avoiding redundant
|
|
||||||
computations, live/dead analysis and eliminating tail recursion.
|
|
||||||
Note that the output of the global optimizer is still EM code.
|
|
||||||
.PP
|
|
||||||
Next comes the back end, which differs from the front ends in a
|
|
||||||
fundamental way.
|
|
||||||
Each front end is a separate program, whereas the back end is a single
|
|
||||||
program that is driven by a machine dependent driving table.
|
|
||||||
The driving table for a specific machine tells how the EM code is mapped
|
|
||||||
onto the machine's assembly language.
|
|
||||||
Although a simple driving table might just macro expand each EM instruction
|
|
||||||
into a sequence of target machine instructions, a much more sophisticated
|
|
||||||
translation strategy is normally used, as described later.
|
|
||||||
For speed, the back end does not actually read in the driving table at run time.
|
|
||||||
Instead, the tables are compiled along with the back end in advance, resulting
|
|
||||||
in one binary program per machine.
|
|
||||||
.PP
|
|
||||||
The output of the back end is a program in the assembly language of some
|
|
||||||
particular machine.
|
|
||||||
The next component in the pipeline reads this program and performs peephole
|
|
||||||
optimization on it.
|
|
||||||
The optimizations performed here involve idiosyncracies
|
|
||||||
of the target machine that cannot be performed in the machine-independent
|
|
||||||
EM-to-EM peephole optimizer.
|
|
||||||
Typically these optimizations take advantage of special instructions or special
|
|
||||||
addressing modes.
|
|
||||||
.PP
|
|
||||||
The optimized target machine assembly code then goes into the final
|
|
||||||
component in the pipeline, the universal assembler/linker.
|
|
||||||
This program assembles the input to object format, extracting routines from
|
|
||||||
libraries and including them as needed.
|
|
||||||
.PP
|
|
||||||
The final component of the tool kit is the utility package, which contains
|
|
||||||
various test programs, interpreters for EM code,
|
|
||||||
EM libraries, conversion programs, and other aids for the implementer and
|
|
||||||
user.
|
|
||||||
.NH 1
|
|
||||||
The Preprocessor
|
|
||||||
.PP
|
|
||||||
The function of the preprocessor is to extend all the programming languages
|
|
||||||
by adding certain generally useful facilities to them in a uniform way.
|
|
||||||
One of these is a simple macro system, in which the user can give names to
|
|
||||||
character strings.
|
|
||||||
The names can be used in the program, with the knowledge that they will be
|
|
||||||
macro expanded prior to being input to the front end.
|
|
||||||
Macros can be used for named constants, expanding short "procedures"
|
|
||||||
in line, etc.
|
|
||||||
.PP
|
|
||||||
Another useful facility provided by the preprocessor is the ability to
|
|
||||||
include compile-time libraries.
|
|
||||||
On large projects, it is common to have all the declarations and definitions
|
|
||||||
gathered together in a few files that are textually included in the programs
|
|
||||||
by instructing the preprocessor to read them in, thus fooling the front end
|
|
||||||
into thinking that they were part of the source program.
|
|
||||||
.PP
|
|
||||||
A third feature of the preprocessor is conditional compilation.
|
|
||||||
The input program can be split up into labeled sections.
|
|
||||||
By setting flags, some of the sections can be deleted by the preprocessor,
|
|
||||||
thus allowing a family of slightly different programs to be conveniently stored
|
|
||||||
on a single file.
|
|
||||||
.NH 1
|
|
||||||
The Front Ends
|
|
||||||
.PP
|
|
||||||
A front end is a program that converts input in some source language to a
|
|
||||||
program in EM.
|
|
||||||
At present, front ends
|
|
||||||
exist or are in preparation for Pascal, C, and Plain, and are being considered
|
|
||||||
for Ada, ALGOL 68, FORTRAN 77, and Modula 2.
|
|
||||||
Each of the present front ends is independent of all the other ones,
|
|
||||||
although a general-purpose, table-driven front end is conceivable, provided
|
|
||||||
one can devise a way to express the semantics of the source language in the
|
|
||||||
driving tables.
|
|
||||||
The Pascal front end uses a top-down parsing algorithm (recursive descent),
|
|
||||||
whereas the C and Plain front ends are bottom-up.
|
|
||||||
.PP
|
|
||||||
All front ends, independent of the language being compiled,
|
|
||||||
produce a common intermediate code called EM, which is
|
|
||||||
the assembly language for a simple stack machine.
|
|
||||||
The EM machine is based on a memory architecture
|
|
||||||
containing a stack for local variables, a (static) data area for variables
|
|
||||||
declared in the outermost block and global to the whole program, and a heap
|
|
||||||
for dynamic data structures.
|
|
||||||
In some ways EM resembles P-code [6], but is more general, since it is
|
|
||||||
intended for a wider class of languages than just Pascal.
|
|
||||||
.PP
|
|
||||||
The EM instruction set has been described elsewhere
|
|
||||||
[9,10,11]
|
|
||||||
so we will only briefly summarize it here.
|
|
||||||
Instructions exist to:
|
|
||||||
.sp
|
|
||||||
1. Load a variable or constant of some length onto the stack.
|
|
||||||
2. Store the top item on the stack in memory.
|
|
||||||
3. Add, subtract, multiply, divide, etc. the top two stack items.
|
|
||||||
4. Examine the top one or two stack items and branch conditionally.
|
|
||||||
5. Call procedures and return from them.
|
|
||||||
.sp
|
|
||||||
.PP
|
|
||||||
Loads and stores come in several variations, corresponding to the most common
|
|
||||||
programming language semantics, for example, constants, simple variables,
|
|
||||||
fields of a record, elements of an array, and so on.
|
|
||||||
Distinctions are also made between variables local to the current block
|
|
||||||
(i.e., stack frame), those in the outermost block (static storage), and those
|
|
||||||
at intermediate lexicographic levels, which are accessed by following the
|
|
||||||
static chain at run time.
|
|
||||||
.PP
|
|
||||||
All arithmetic instructions have a type (integer, unsigned, real,
|
|
||||||
pointer, or set) and an
|
|
||||||
operand length, which may either be explicit or may be popped from the stack
|
|
||||||
at run time.
|
|
||||||
Monadic branch instructions pop an item from the stack and branch if it is
|
|
||||||
less than zero, less than or equal to zero, etc.
|
|
||||||
Dyadic branch instructions pop two items, compare them, and branch accordingly.
|
|
||||||
.PP
|
|
||||||
In addition to these basic EM instructions, there is a collection of special
|
|
||||||
purpose instructions (e.g., to increment a local variable), which are typically
|
|
||||||
produced from the simple ones by the peephole optimizer.
|
|
||||||
Although the complete EM instruction set contains nearly 150 instructions,
|
|
||||||
only about 60 of them are really primitive; the rest are simply abbreviations
|
|
||||||
for commonly occurring EM instruction sequences.
|
|
||||||
.PP
|
|
||||||
Of particular interest is the way object sizes are parametrized.
|
|
||||||
The front ends allow the user to indicate how many bytes an integer, real, etc.
|
|
||||||
should occupy.
|
|
||||||
Given this information, the front ends can allocate memory, determining
|
|
||||||
the placement of variables within the stack frame.
|
|
||||||
Sizes for primitive types are restricted to 8, 16, 32, 64, etc. bits.
|
|
||||||
The front ends are also parametrized by the target machine's word length
|
|
||||||
and address size so they can tell, for example, how many "load" instructions
|
|
||||||
to generate to move a 32-bit integer.
|
|
||||||
In the examples used henceforth,
|
|
||||||
we will assume a 16-bit word size and 16-bit integers.
|
|
||||||
.PP
|
|
||||||
Since only byte-addressable target machines are permitted,
|
|
||||||
it is nearly
|
|
||||||
always possible to implement any requested sizes on any target machine.
|
|
||||||
For example, the designer of the back end tables for the Z80 should provide
|
|
||||||
code for 8-, 16-, and 32-bit arithmetic.
|
|
||||||
In our view, the Pascal, C, or Plain programmer specifies what lengths
|
|
||||||
are needed,
|
|
||||||
without reference to the target machine,
|
|
||||||
and the back end provides it.
|
|
||||||
This approach greatly enhances portability.
|
|
||||||
While it is true that doing all arithmetic using 32-bit integers on the Z80
|
|
||||||
will not be terribly fast, we feel that if that is what the programmer needs,
|
|
||||||
it should be possible to implement it.
|
|
||||||
.PP
|
|
||||||
Like all assembly languages, EM has not only machine instructions, but also
|
|
||||||
pseudoinstructions.
|
|
||||||
These are used to indicate the start and end of each procedure, allocate
|
|
||||||
and initialize storage for data, and similar functions.
|
|
||||||
One particularly important pseudoinstruction is the one that is used to
|
|
||||||
transmit information to the back end for optimization purposes.
|
|
||||||
It can be used to suggest variables that are good candidates to assign to
|
|
||||||
registers, delimit the scope of loops, indicate that certain variables
|
|
||||||
contain a useful value (next operation is a load) or not (next operation is
|
|
||||||
a store), and various other things.
|
|
||||||
.NH 1
|
|
||||||
The Peephole Optimizer
|
|
||||||
.PP
|
|
||||||
The peephole optimizer reads in unoptimized EM programs and writes out
|
|
||||||
optimized ones.
|
|
||||||
Both the input and output are expressed in a highly compact code, rather than
|
|
||||||
in ASCII, to reduce the i/o time, which would otherwise dominate the CPU
|
|
||||||
time.
|
|
||||||
The program itself is table driven, and is, by and large, ignorant of the
|
|
||||||
semantics of EM.
|
|
||||||
The knowledge of EM is contained in a
|
|
||||||
language- and machine-independent table consisting of about 400
|
|
||||||
pattern-replacement pairs.
|
|
||||||
We will briefly describe the kinds of optimizations it performs below;
|
|
||||||
a more complete discussion can be found in [9].
|
|
||||||
.PP
|
|
||||||
Each line in the driving table describes one optimization, consisting of a
|
|
||||||
pattern part and a replacement part.
|
|
||||||
The pattern part is a series of one or more EM instructions and a boolean
|
|
||||||
expression.
|
|
||||||
The replacement part is a series of EM instructions with operands.
|
|
||||||
A typical optimization might be:
|
|
||||||
.sp
|
|
||||||
LOL LOC ADI STL ($1 = $4) and ($2 = 1) and ($3 = 2) ==> INL $1
|
|
||||||
.sp
|
|
||||||
where the text prior to the ==> symbol is the pattern and the text after it is
|
|
||||||
the replacement.
|
|
||||||
LOL loads a local variable onto the stack, LOC loads a constant onto the stack,
|
|
||||||
ADI is integer addition, and STL is store local.
|
|
||||||
The pattern specifies that four consecutive EM instructions are present, with
|
|
||||||
the indicated opcodes, and that furthermore the operand of the first
|
|
||||||
instruction (denoted by $1) and the fourth instruction (denoted by $4) are the
|
|
||||||
same, the constant pushed by LOC is 1, and the size of the integers added by
|
|
||||||
ADI is 2 bytes.
|
|
||||||
(EM instructions have at most one operand, so it is not necessary to specify
|
|
||||||
the operand number.)
|
|
||||||
Under these conditions, the four instructions can be replaced by a single INL
|
|
||||||
(increment local) instruction whose operand is equal to that of LOL.
|
|
||||||
.PP
|
|
||||||
Although the optimizations cover a wide range, the main ones
|
|
||||||
can be roughly divided into the following categories.
|
|
||||||
\fIConstant folding\fR
|
|
||||||
is used to evaluate constant expressions, such as 2*3~+~7 at
|
|
||||||
compile time instead of run time.
|
|
||||||
\fIStrength reduction\fR
|
|
||||||
is used to replace one operation, such as multiply, by
|
|
||||||
another, such as shift.
|
|
||||||
\fIReordering of expressions\fR
|
|
||||||
helps in cases like -K/5, which can be better
|
|
||||||
evaluated as K/-5, because the former requires
|
|
||||||
a division and a negation, whereas the latter requires only a division.
|
|
||||||
\fINull instructions\fR
|
|
||||||
include resetting the stack pointer after a call with 0 parameters,
|
|
||||||
offsetting zero bytes to access the
|
|
||||||
first element of a record, or jumping to the next instruction.
|
|
||||||
\fISpecial instructions\fR
|
|
||||||
are those like INL, which deal with common special cases
|
|
||||||
such as adding one to a variable or comparing something to zero.
|
|
||||||
\fIGroup moves\fR
|
|
||||||
are useful because a sequence
|
|
||||||
of consecutive moves can often be replaced with EM code
|
|
||||||
that allows the back end to generate a loop instead of in line code.
|
|
||||||
\fIDead code elimination\fR
|
|
||||||
is a technique for removing unreachable statements, possibly made unreachable
|
|
||||||
by previous optimizations.
|
|
||||||
\fIBranch chain compression\fR
|
|
||||||
can be applied when a branch instruction jumps to another branch instruction.
|
|
||||||
The first branch can jump directly to the final destination instead of
|
|
||||||
indirectly.
|
|
||||||
.PP
|
|
||||||
The last two optimizations logically belong in the global optimizer but are
|
|
||||||
in the local optimizer for historical reasons (meaning that the local
|
|
||||||
optimizer has been the only optimizer for many years and the optimizations were
|
|
||||||
easy to do there).
|
|
||||||
.NH 1
|
|
||||||
The Global Optimizer
|
|
||||||
.PP
|
|
||||||
In contrast to the peephole optimizer, which examines the EM code a few lines
|
|
||||||
at a time through a small window, the global optimizer examines the
|
|
||||||
program's large scale structure.
|
|
||||||
Three distinct types of optimizations can be found here:
|
|
||||||
.sp
|
|
||||||
1. Interprocedural optimizations.
|
|
||||||
2. Intraprocedural optimizations.
|
|
||||||
3. Basic block optimizations.
|
|
||||||
.sp
|
|
||||||
We will now look at each of these in turn.
|
|
||||||
.PP
|
|
||||||
Interprocedural optimizations are those spanning procedure boundaries.
|
|
||||||
The most important one is deciding to expand procedures in line,
|
|
||||||
especially short procedures that occur in loops and pass several parameters.
|
|
||||||
If it takes more time or memory to pass the parameters than to do the work,
|
|
||||||
the program can be improved by eliminating the procedure.
|
|
||||||
The inverse optimization -- discovering long common code sequences and
|
|
||||||
turning them into a procedure -- is also possible, but much more difficult.
|
|
||||||
Like much of the global optimizer's work, the decision to make or not make
|
|
||||||
a certain program transformation is a heuristic one, based on knowledge of
|
|
||||||
how the back end works, how most target machines are organized, etc.
|
|
||||||
.PP
|
|
||||||
The heart of the global optimizer is its analysis of individual
|
|
||||||
procedures.
|
|
||||||
To perform this analysis, the optimizer must locate the basic blocks,
|
|
||||||
instruction sequences which can be entered only at the top and exited
|
|
||||||
only at the bottom.
|
|
||||||
It then constructs a data flow graph, with the basic blocks as nodes and
|
|
||||||
jumps between blocks as arcs.
|
|
||||||
.PP
|
|
||||||
From the data flow graph, many important properties of the program can be
|
|
||||||
discovered and exploited.
|
|
||||||
Chief among these is the presence of loops, indicated by cycles in the graph.
|
|
||||||
One important optimization is looking for code that can be moved outside the
|
|
||||||
loop, either prior to it or subsequent to it.
|
|
||||||
Such code motion saves execution time, although it does not save memory.
|
|
||||||
Unrolling loops is also possible and desirable in some cases.
|
|
||||||
.PP
|
|
||||||
Another area in which global analysis of loops is especially important is
|
|
||||||
in register allocation.
|
|
||||||
While it is true that EM does not have any registers to allocate,
|
|
||||||
the optimizer can easily collect information to allow the
|
|
||||||
back end to allocate registers wisely.
|
|
||||||
For example, the global optimizer can collect static frequency-of-use
|
|
||||||
and live/dead information about variables.
|
|
||||||
(A variable is dead at some point in the program if its current value is
|
|
||||||
not needed, i.e., the next reference to it overwrites it rather than
|
|
||||||
reading it; if the current value will eventually be used, the variable is
|
|
||||||
live.)
|
|
||||||
If two variables are never simultaneously live over some interval of code
|
|
||||||
(e.g., the body of a loop), they can be packed into a single variable,
|
|
||||||
which, if used often enough, may warrant being assigned to a register.
|
|
||||||
.PP
|
|
||||||
Many loops involve arrays: this leads to other optimizations.
|
|
||||||
If an array is accessed sequentially, with each iteration using the next
|
|
||||||
higher numbered element, code improvement is often possible.
|
|
||||||
Typically, a pointer to the bottom element of each array can be set up
|
|
||||||
prior to the loop.
|
|
||||||
Within the loop the element is accessed indirectly via the pointer, which is
|
|
||||||
also incremented by the element size on each iteration.
|
|
||||||
If the target machine has an autoincrement addressing mode and the pointer
|
|
||||||
is assigned to a register, an array access can often be done in a single
|
|
||||||
instruction.
|
|
||||||
.PP
|
|
||||||
Other intraprocedural optimizations include removing tail recursion
|
|
||||||
(last statement is a recursive call to the procedure itself),
|
|
||||||
topologically sorting the basic blocks to minimize the number of branch
|
|
||||||
instructions, and common subexpression recognition.
|
|
||||||
.PP
|
|
||||||
The third general class of optimizations done by the global optimizer is
|
|
||||||
improving the structure of a basic block.
|
|
||||||
For the most part these involve transforming arithmetic or boolean
|
|
||||||
expressions into forms that are likely to result in better target code.
|
|
||||||
As a simple example, A~+~B*C can be converted to B*C~+~A.
|
|
||||||
The latter can often
|
|
||||||
be handled by loading B into a register, multiplying the register by C, and
|
|
||||||
then adding in A, whereas the former may involve first putting A into a
|
|
||||||
temporary, depending on the details of the code generation table.
|
|
||||||
Another example of this kind of basic block optimization is transforming
|
|
||||||
-B~+~A~<~0 into the equivalent, but simpler, A~<~B.
|
|
||||||
.NH 1
|
|
||||||
The Back End
|
|
||||||
.PP
|
|
||||||
The back end reads a stream of EM instructions and generates assembly code
|
|
||||||
for the target machine.
|
|
||||||
Although the algorithm itself is machine independent, for each target
|
|
||||||
machine a machine dependent driving table must be supplied.
|
|
||||||
The driving table effectively defines the mapping of EM code to target code.
|
|
||||||
.PP
|
|
||||||
It will be convenient to think of the EM instructions being read as a
|
|
||||||
stream of tokens.
|
|
||||||
For didactic purposes, we will concentrate on two kinds of tokens:
|
|
||||||
those that load something onto the stack, and those that perform some operation
|
|
||||||
on the top one or two values on the stack.
|
|
||||||
The back end maintains at compile time a simulated stack whose behavior
|
|
||||||
mirrors what the stack of a hardware EM machine would do at run time.
|
|
||||||
If the current input token is a load instruction, a new entry is pushed onto
|
|
||||||
the simulated stack.
|
|
||||||
.PP
|
|
||||||
Consider, as an example, the EM code produced for the statement K~:=~I~+~7.
|
|
||||||
If K and I are
|
|
||||||
2-byte local variables, it will normally be LOL I; LOC 7; ADI~2; STL K.
|
|
||||||
Initially the simulated stack is empty.
|
|
||||||
After the first token has been read and processed, the simulated stack will
|
|
||||||
contain a stack token of type MEM with attributes telling that it is a local,
|
|
||||||
giving its address, etc.
|
|
||||||
After the second token has been read and processed, the top two tokens on the
|
|
||||||
simulated stack will be CON (constant) on top and MEM directly underneath it.
|
|
||||||
.PP
|
|
||||||
At this point the back end reads the ADI~2 token and
|
|
||||||
looks in the driving table to find a line or lines that define the
|
|
||||||
action to be taken for ADI~2.
|
|
||||||
For a typical multiregister machine, instructions will exist to add constants
|
|
||||||
to registers, but not to memory.
|
|
||||||
Consequently, the driving table will not contain an entry for ADI~2 with stack
|
|
||||||
configuration CON, MEM.
|
|
||||||
.PP
|
|
||||||
The back end is now faced with the problem of how to get from its
|
|
||||||
current stack configuration, CON, MEM, which is not listed, to one that is
|
|
||||||
listed.
|
|
||||||
The table will normally contain rules (which we call "coercions")
|
|
||||||
for converting between CON, REG, MEM, and similar tokens.
|
|
||||||
Therefore the back end attempts to "coerce" the stack into a configuration
|
|
||||||
that
|
|
||||||
.I is
|
|
||||||
present in the table.
|
|
||||||
A typical coercion rule might tell how to convert a MEM into
|
|
||||||
a REG, namely by performing the actions of allocating a
|
|
||||||
register and emitting code to move the memory word to that register.
|
|
||||||
Having transformed the compile-time stack into a configuration allowed for
|
|
||||||
ADI~2, the rule can be carried out.
|
|
||||||
A typical rule
|
|
||||||
for ADI~2 might have stack configuration REG, MEM
|
|
||||||
and would emit code to add the MEM to the REG, leaving the stack
|
|
||||||
with a single REG token instead of the REG and MEM tokens present before the
|
|
||||||
ADI~2.
|
|
||||||
.PP
|
|
||||||
In general, there will be more than one possible coercion path.
|
|
||||||
Assuming reasonable coercion rules for our example,
|
|
||||||
we might be able to convert
|
|
||||||
CON MEM into CON REG by loading the variable I into a register.
|
|
||||||
Alternatively, we could coerce CON to REG by loading the constant into a register.
|
|
||||||
The first coercion path does the add by first loading I into a register and
|
|
||||||
then adding 7 to it.
|
|
||||||
The second path first loads 7 into a register and then adds I to it.
|
|
||||||
On machines with a fast LOAD IMMEDIATE instruction for small constants
|
|
||||||
but no fast ADD IMMEDIATE, or vice
|
|
||||||
versa, one code sequence will be preferable to the other.
|
|
||||||
.PP
|
|
||||||
In fact, we actually have more choices than suggested above.
|
|
||||||
In both coercion paths a register must be allocated.
|
|
||||||
On many machines, not every register can be used in every operation, so the
|
|
||||||
choice may be important.
|
|
||||||
On some machines, for example, the operand of a multiply must be in an odd
|
|
||||||
register.
|
|
||||||
To summarize, from any state (i.e., token and stack configuration), a
|
|
||||||
variety of choices can be made, leading to a variety of different target
|
|
||||||
code sequences.
|
|
||||||
.PP
|
|
||||||
To decide which of the various code sequences to emit, the back end must have
|
|
||||||
some information about the time and memory cost of each one.
|
|
||||||
To provide this information, each rule in the driving table, including
|
|
||||||
coercions, specifies both the time and memory cost of the code emitted when
|
|
||||||
the rule is applied.
|
|
||||||
The back end can then simply try each of the legal possibilities (including all
|
|
||||||
the possible register allocations) to find the cheapest one.
|
|
||||||
.PP
|
|
||||||
This situation is similar to that found in a chess or other game-playing
|
|
||||||
program, in which from any state a finite number of moves can be made.
|
|
||||||
Just as in a chess program, the back end can look at all the "moves" that can
|
|
||||||
be made from each state reachable from the original state, and thus find the
|
|
||||||
sequence that gives the minimum cost to a depth of one.
|
|
||||||
More generally, the back end can evaluate all paths corresponding to accepting
|
|
||||||
the next
|
|
||||||
.I N
|
|
||||||
input tokens, find the cheapest one, and then make the first move along
|
|
||||||
that path, precisely the way a chess program would.
|
|
||||||
.PP
|
|
||||||
Since the back end is analogous to both a parser and a chess playing program,
|
|
||||||
some clarifying remarks may be helpful.
|
|
||||||
First, chess programs and the back end must do some look ahead, whereas the
|
|
||||||
parser for a well-designed grammar can usually suffice with one input token
|
|
||||||
because grammars are supposed to be unambiguous.
|
|
||||||
In contrast, many legal mappings
|
|
||||||
from a sequence of EM instructions to target code may exist.
|
|
||||||
Second, like a parser but unlike a chess program, the back end has perfect
|
|
||||||
information -- it does not have to contend with an unpredictable opponent's
|
|
||||||
moves.
|
|
||||||
Third, chess programs normally make a static evaluation of the board and
|
|
||||||
label the
|
|
||||||
.I nodes
|
|
||||||
of the tree with the resulting scores.
|
|
||||||
The back end, in contrast, associates costs with
|
|
||||||
.I arcs
|
|
||||||
(moves) rather than nodes (states).
|
|
||||||
However, the difference is not essential, since it could
|
|
||||||
also label each node with the cumulative cost from the root to that node.
|
|
||||||
.PP
|
|
||||||
As mentioned above, the cost field in the table contains
|
|
||||||
.I both
|
|
||||||
the time and memory costs for the code emitted.
|
|
||||||
It should be clear that the back end could use either one
|
|
||||||
or some linear combination of them as the scoring function for evaluating moves.
|
|
||||||
A user can instruct the compiler to optimize for time or for memory or
|
|
||||||
for, say, 0.3 x time + 0.7 x memory.
|
|
||||||
Thus the same compiler can provide a wide range of performance options to
|
|
||||||
the user.
|
|
||||||
The writer of the back end table can take advantage of this flexibility by
|
|
||||||
providing several code sequences with different tradeoffs for each EM
|
|
||||||
instruction (e.g., in line code vs. call to a run time routine).
|
|
||||||
.PP
|
|
||||||
In addition to the time-space tradeoffs, by specifying the depth of search
|
|
||||||
parameter,
|
|
||||||
.I N ,
|
|
||||||
the user can effectively also tradeoff compile time vs. object
|
|
||||||
code quality, for whatever code metric has been chosen.
|
|
||||||
In summary, by combining the properties of a parser and a game playing program,
|
|
||||||
it is possible to make a code generator that is table driven,
|
|
||||||
highly flexible, and has the ability to produce good code from a
|
|
||||||
stack machine intermediate code.
|
|
||||||
.NH 1
|
|
||||||
The Target Machine Optimizer
|
|
||||||
.PP
|
|
||||||
In the model of Fig 2., the peephole optimizer comes before the global
|
|
||||||
optimizer.
|
|
||||||
It may happen that the code produced by the global optimizer can also
|
|
||||||
be improved by another round of peephole optimization.
|
|
||||||
Conceivably, the system could have been designed to iterate peephole and
|
|
||||||
global optimizations until no more of either could be performed.
|
|
||||||
.PP
|
|
||||||
However, both of these optimizations are done on the machine independent
|
|
||||||
EM code.
|
|
||||||
Neither is able to take advantage of the peculiarities and idiosyncracies with
|
|
||||||
which most target machines are well endowed.
|
|
||||||
It is the function of the final
|
|
||||||
optimizer to do any (peephole) optimizations that still remain.
|
|
||||||
.PP
|
|
||||||
The algorithm used here is the same as in the EM peephole optimizer.
|
|
||||||
In fact, if it were not for the differences between EM syntax, which is
|
|
||||||
very restricted, and target assembly language syntax,
|
|
||||||
which is less so, precisely the same program could be used for both.
|
|
||||||
Nevertheless, the same ideas apply concerning patterns and replacements, so
|
|
||||||
our discussion of this optimizer will be restricted to one example.
|
|
||||||
.PP
|
|
||||||
To see what the target optimizer might do, consider the
|
|
||||||
PDP-11 instruction sequence sub #2,r0; mov (r0),x.
|
|
||||||
First 2 is subtracted from register 0, then the word pointed to by it
|
|
||||||
is moved to x.
|
|
||||||
The PDP-11 happens to have an addressing mode to perform this sequence in
|
|
||||||
one instruction: mov -(r0),x.
|
|
||||||
Although it is conceivable that this instruction could be included in the
|
|
||||||
back end driving table for the PDP-11, it is awkward to do so because it
|
|
||||||
can occur in so many contexts.
|
|
||||||
It is much easier to catch things like this in a separate program.
|
|
||||||
.NH 1
|
|
||||||
The Universal Assembler/Linker
|
|
||||||
.PP
|
|
||||||
Although assembly languages for different machines may appear very different
|
|
||||||
at first glance, they have a surprisingly large intersection.
|
|
||||||
We have been able to construct an assembler/linker that is almost entirely
|
|
||||||
independent of the assembly language being processed.
|
|
||||||
To tailor the program to a specific assembly language, it is necessary to
|
|
||||||
supply a table giving the list of instructions, the bit patterns required for
|
|
||||||
each one, and the language syntax.
|
|
||||||
The machine independent part of the assembler/linker is then compiled with the
|
|
||||||
table to produce an assembler and linker for a particular target machine.
|
|
||||||
Experience has shown that writing the necessary table for a new machine can be
|
|
||||||
done in less than a week.
|
|
||||||
.PP
|
|
||||||
To enforce a modicum of uniformity, we have chosen to use a common set of
|
|
||||||
pseudoinstructions for all target machines.
|
|
||||||
They are used to initialize memory, allocate uninitialized memory, determine the
|
|
||||||
current segment, and similar functions found in most assemblers.
|
|
||||||
.PP
|
|
||||||
The assembler is also a linker.
|
|
||||||
After assembling a program, it checks to see if there are any
|
|
||||||
unsatisfied external references.
|
|
||||||
If so, it begins reading the libraries to find the necessary routines, including
|
|
||||||
them in the object file as it finds them.
|
|
||||||
This approach requires libraries to be maintained in assembly language form,
|
|
||||||
but eliminates the need for inventing a language to express relocatable
|
|
||||||
object programs in a machine independent way.
|
|
||||||
It also simplifies the assembler, since producing absolute object code is
|
|
||||||
easier than producing relocatable object code.
|
|
||||||
Finally, although assembly language libraries may be somewhat larger than
|
|
||||||
relocatable object module libraries, the loss in speed due to having more
|
|
||||||
input may be more than compensated for by not having to pass an intermediate
|
|
||||||
file between the assembler and linker.
|
|
||||||
.NH 1
|
|
||||||
The Utility Package
|
|
||||||
.PP
|
|
||||||
The utility package is a collection of programs designed to aid the
|
|
||||||
implementers of new front ends or new back ends.
|
|
||||||
The most useful ones are the test programs.
|
|
||||||
For example, one test set, EMTEST, systematically checks out a back end by
|
|
||||||
executing an ever larger subset of the EM instructions.
|
|
||||||
It starts out by testing LOC, LOL and a few of the other essential instructions.
|
|
||||||
If these appear to work, it then tries out new instructions one at a time,
|
|
||||||
adding them to the set of instructions "known" to work as they pass the tests.
|
|
||||||
.PP
|
|
||||||
Each instruction is tested with a variety of operands chosen from values
|
|
||||||
where problems can be expected.
|
|
||||||
For example, on target machines which have 16-bit index registers but only
|
|
||||||
allow 8-bit displacements, a fundamentally different algorithm may be needed
|
|
||||||
for accessing
|
|
||||||
the first few bytes of local variables and those with offsets of thousands.
|
|
||||||
The test programs have been carefully designed to thoroughly test all relevant
|
|
||||||
cases.
|
|
||||||
.PP
|
|
||||||
In addition to EMTEST, test programs in Pascal, C, and other languages are also
|
|
||||||
available.
|
|
||||||
A typical test is:
|
|
||||||
.sp
|
|
||||||
i := 9; \fBif\fP i + 250 <> 259 \fBthen\fP error(16);
|
|
||||||
.sp
|
|
||||||
Like EMTEST, the other test programs systematically exercise all features of the
|
|
||||||
language being tested, and do so in a way that makes it possible to pinpoint
|
|
||||||
errors precisely.
|
|
||||||
While it has been said that testing can only demonstrate the presence of errors
|
|
||||||
and not their absence, our experience is that
|
|
||||||
the test programs have been invaluable in debugging new parts of the system
|
|
||||||
quickly.
|
|
||||||
.PP
|
|
||||||
Other utilities include programs to convert
|
|
||||||
the highly compact EM code produced by front ends to ASCII and vice versa,
|
|
||||||
programs to build various internal tables from human writable input formats,
|
|
||||||
a variety of libraries written in or compiled to EM to make them portable,
|
|
||||||
an EM assembler, and EM interpreters for various machines.
|
|
||||||
.PP
|
|
||||||
Interpreting the EM code instead of translating it to target machine language
|
|
||||||
is useful for several reasons.
|
|
||||||
First, the interpreters provide extensive run time diagnostics including
|
|
||||||
an option to list the original source program (in Pascal, C, etc.) with the
|
|
||||||
execution frequency or execution time for each source line printed in the
|
|
||||||
left margin.
|
|
||||||
Second, since an EM program is typically about one-third the size of a
|
|
||||||
compiled program, large programs can be executed on small machines.
|
|
||||||
Third, running the EM code directly makes it easier to pinpoint errors in
|
|
||||||
the EM output of front ends still being debugged.
|
|
||||||
.NH 1
|
|
||||||
Summary and Conclusions
|
|
||||||
.PP
|
|
||||||
The Amsterdam Compiler Kit is a tool kit for building
|
|
||||||
portable (cross) compilers and interpreters.
|
|
||||||
The main pieces of the kit are the front ends, which convert source programs
|
|
||||||
to EM code, optimizers, which improve the EM code, and back ends, which convert
|
|
||||||
the EM code to target assembly language.
|
|
||||||
The kit is highly modular, so writing one front end
|
|
||||||
(and its associated runtime routines)
|
|
||||||
is sufficient to implement
|
|
||||||
a new language on a dozen or more machines, and writing one back end table
|
|
||||||
and one universal assembler/linker table is all that is needed to bring up all
|
|
||||||
the previously implemented languages on a new machine.
|
|
||||||
In this manner, the contents, and hopefully the usefulness, of the toolkit
|
|
||||||
will increase in time.
|
|
||||||
.PP
|
|
||||||
We believe the principal lesson to be learned from our work is that the old
|
|
||||||
UNCOL idea is basically a sound way to produce compilers, provided suitable
|
|
||||||
restrictions are placed on the source languages and target machines.
|
|
||||||
We also believe that although compilers produced by this technology may not
|
|
||||||
be equal to the very best handcrafted compilers,
|
|
||||||
in terms of object code quality, they are certainly
|
|
||||||
competitive with many existing compilers.
|
|
||||||
However, when one factors in the cost of producing the compiler,
|
|
||||||
the possible slight loss in performance may be more than compensated for by the
|
|
||||||
large decrease in production cost.
|
|
||||||
As a consequence of our work and similar work by other researchers [1,3,4],
|
|
||||||
we expect integrated compiler building kits to become increasingly popular
|
|
||||||
in the near future.
|
|
||||||
.PP
|
|
||||||
The toolkit is now available for various computers running the
|
|
||||||
.UX
|
|
||||||
operating system.
|
|
||||||
For information, contact the authors.
|
|
||||||
.NH 1
|
|
||||||
References
|
|
||||||
.LP
|
|
||||||
.nr r 0 1
|
|
||||||
.in +4
|
|
||||||
.ti -4
|
|
||||||
\fB~\n+r.\fR Graham, S.L.
|
|
||||||
Table-Driven Code Generation.
|
|
||||||
.I "Computer~13" ,
|
|
||||||
8 (August 1980), 25-34.
|
|
||||||
.PP
|
|
||||||
A discussion of systematic ways to do code generation,
|
|
||||||
in particular, the idea of having a table with templates that match parts of
|
|
||||||
the parse tree and convert them into machine instructions.
|
|
||||||
.sp 2
|
|
||||||
.ti -4
|
|
||||||
\fB~\n+r.\fR Haddon, B.K., and Waite, W.M.
|
|
||||||
Experience with the Universal Intermediate Language Janus.
|
|
||||||
.I "Software Practice & Experience~8" ,
|
|
||||||
5 (Sept.-Oct. 1978), 601-616.
|
|
||||||
.PP
|
|
||||||
An intermediate language for use with ALGOL 68, Pascal, etc. is described.
|
|
||||||
The paper discusses some problems encountered and how they were dealt with.
|
|
||||||
.sp 2
|
|
||||||
.ti -4
|
|
||||||
\fB~\n+r.\fR Johnson, S.C.
|
|
||||||
A Portable Compiler: Theory and Practice.
|
|
||||||
.I "Ann. ACM Symp. Prin. Prog. Lang." ,
|
|
||||||
Jan. 1978.
|
|
||||||
.PP
|
|
||||||
A cogent discussion of the portable C compiler.
|
|
||||||
Particularly interesting are the author's thoughts on the value of
|
|
||||||
computer science theory.
|
|
||||||
.sp 2
|
|
||||||
.ti -4
|
|
||||||
\fB~\n+r.\fR Leverett, B.W., Cattell, R.G.G, Hobbs, S.O., Newcomer, J.M.,
|
|
||||||
Reiner, A.H., Schatz, B.R., and Wulf, W.A.
|
|
||||||
An Overview of the Production-Quality Compiler-Compiler Project.
|
|
||||||
.I Computer~13 ,
|
|
||||||
8 (August 1980), 38-49.
|
|
||||||
.PP
|
|
||||||
PQCC is a system for building compilers similar in concept but differing in
|
|
||||||
details from the Amsterdam Compiler Kit.
|
|
||||||
The paper describes the intermediate representation used and the code generation
|
|
||||||
strategy.
|
|
||||||
.sp 2
|
|
||||||
.ti -4
|
|
||||||
\fB~\n+r.\fR Lowry, E.S., and Medlock, C.W.
|
|
||||||
Object Code Optimization.
|
|
||||||
.I "Commun.~ACM~12",
|
|
||||||
(Jan. 1969), 13-22.
|
|
||||||
.PP
|
|
||||||
A classic paper on global object code optimization.
|
|
||||||
It covers data flow analysis, common subexpressions, code motion, register
|
|
||||||
allocation and other techniques.
|
|
||||||
.sp 2
|
|
||||||
.ti -4
|
|
||||||
\fB~\n+r.\fR Nori, K.V., Ammann, U., Jensen, K., Nageli, H.
|
|
||||||
The Pascal P Compiler Implementation Notes.
|
|
||||||
Eidgen. Tech. Hochschule, Zurich, 1975.
|
|
||||||
.PP
|
|
||||||
A description of the original P-code machine, used to transport the Pascal-P
|
|
||||||
compiler to new computers.
|
|
||||||
.sp 2
|
|
||||||
.ti -4
|
|
||||||
\fB~\n+r.\fR Steel, T.B., Jr. UNCOL: the Myth and the Fact. in
|
|
||||||
.I "Ann. Rev. Auto. Prog."
|
|
||||||
Goodman, R. (ed.), vol 2., (1960), 325-344.
|
|
||||||
.PP
|
|
||||||
An introduction to the UNCOL idea by its originator.
|
|
||||||
.sp 2
|
|
||||||
.ti -4
|
|
||||||
\fB~\n+r.\fR Steel, T.B., Jr.
|
|
||||||
A First Version of UNCOL.
|
|
||||||
.I "Proc. Western Joint Comp. Conf." ,
|
|
||||||
(1961), 371-377.
|
|
||||||
.PP
|
|
||||||
The first detailed proposal for an UNCOL. By current standards it is a
|
|
||||||
primitive language, but it is interesting for its historical perspective.
|
|
||||||
.sp 2
|
|
||||||
.ti -4
|
|
||||||
\fB~\n+r.\fR Tanenbaum, A.S., van Staveren, H., and Stevenson, J.W.
|
|
||||||
Using Peephole Optimization on Intermediate Code.
|
|
||||||
.I "ACM Trans. Prog. Lang. and Sys. 3" ,
|
|
||||||
1 (Jan. 1982) pp. 21-36.
|
|
||||||
.PP
|
|
||||||
A detailed description of a table-driven peephole optimizer.
|
|
||||||
The driving table provides a list of patterns to match as well as the
|
|
||||||
replacement text to use for each successful match.
|
|
||||||
.sp 2
|
|
||||||
.ti -4
|
|
||||||
\fB\n+r.\fR Tanenbaum, A.S., Stevenson, J.W., Keizer, E.G., and van Staveren, H.
|
|
||||||
Description of an Experimental Machine Architecture for use with Block
|
|
||||||
Structured Languages.
|
|
||||||
Informatica Rapport 81, Vrije Universiteit, Amsterdam, 1983.
|
|
||||||
.PP
|
|
||||||
The defining document for EM.
|
|
||||||
.sp 2
|
|
||||||
.ti -4
|
|
||||||
\fB\n+r.\fR Tanenbaum, A.S.
|
|
||||||
Implications of Structured Programming for Machine Architecture.
|
|
||||||
.I "Comm. ACM~21" ,
|
|
||||||
3 (March 1978), 237-246.
|
|
||||||
.PP
|
|
||||||
The background and motivation for the design of EM.
|
|
||||||
This early version emphasized the idea of interpreting the intermediate
|
|
||||||
code (then called EM-1) rather than compiling it.
|
|
||||||
302
doc/v7bugs.doc
302
doc/v7bugs.doc
@@ -1,302 +0,0 @@
|
|||||||
.wh 0 hd
|
|
||||||
.wh 60 fo
|
|
||||||
.de hd
|
|
||||||
'sp 5
|
|
||||||
..
|
|
||||||
.de fo
|
|
||||||
'bp
|
|
||||||
..
|
|
||||||
.nr e 0 1
|
|
||||||
.de ER
|
|
||||||
.br
|
|
||||||
.ne 20
|
|
||||||
.sp 2
|
|
||||||
.in 5
|
|
||||||
.ti -5
|
|
||||||
ERROR \\n+e:
|
|
||||||
..
|
|
||||||
.de PS
|
|
||||||
.sp
|
|
||||||
.nf
|
|
||||||
.in +5
|
|
||||||
..
|
|
||||||
.de PE
|
|
||||||
.sp
|
|
||||||
.fi
|
|
||||||
.in -5
|
|
||||||
..
|
|
||||||
.sp 3
|
|
||||||
.ce
|
|
||||||
UNIX version 7 bugs
|
|
||||||
.sp 3
|
|
||||||
This document describes the UNIX version 7 errors fixed at the
|
|
||||||
Vrije Universiteit, Amsterdam.
|
|
||||||
Several of these are discovered at the VU.
|
|
||||||
Others are quoted from a list of bugs distributed by BellLabs.
|
|
||||||
.sp
|
|
||||||
For each error the differences between the original and modified
|
|
||||||
source files are given,
|
|
||||||
as well as a test program.
|
|
||||||
.ER
|
|
||||||
C optimizer bug for unsigned comparison
|
|
||||||
.sp
|
|
||||||
The following C program caused an IOT trap, while it should not
|
|
||||||
(compile with 'cc -O prog.c'):
|
|
||||||
.PS
|
|
||||||
unsigned i = 0;
|
|
||||||
|
|
||||||
main() {
|
|
||||||
register j;
|
|
||||||
|
|
||||||
j = -1;
|
|
||||||
if (i > 40000)
|
|
||||||
abort();
|
|
||||||
}
|
|
||||||
.PE
|
|
||||||
BellLabs suggests to make the following patch in c21.c:
|
|
||||||
.PS
|
|
||||||
/* modified /usr/src/cmd/c/c21.c */
|
|
||||||
|
|
||||||
189 if (r==0) {
|
|
||||||
190 /* next 2 lines replaced as indicated by
|
|
||||||
191 * Bell Labs bug distribution ( v7optbug )
|
|
||||||
192 p->back->back->forw = p->forw;
|
|
||||||
193 p->forw->back = p->back->back;
|
|
||||||
194 End of lines changed */
|
|
||||||
195 if (p->forw->op==CBR
|
|
||||||
196 || p->forw->op==SXT
|
|
||||||
197 || p->forw->op==CFCC) {
|
|
||||||
198 p->back->forw = p->forw;
|
|
||||||
199 p->forw->back = p->back;
|
|
||||||
200 } else {
|
|
||||||
201 p->back->back->forw = p->forw;
|
|
||||||
202 p->forw->back = p->back->back;
|
|
||||||
203 }
|
|
||||||
204 /* End of new lines */
|
|
||||||
205 decref(p->ref);
|
|
||||||
206 p = p->back->back;
|
|
||||||
207 nchange++;
|
|
||||||
208 } else if (r>0) {
|
|
||||||
.PE
|
|
||||||
Use the previous program to test before and after the modification.
|
|
||||||
.ER
|
|
||||||
The loader fails for large data or text portions
|
|
||||||
.sp
|
|
||||||
The loader 'ld' produces a "local symbol botch" error
|
|
||||||
for the following C program.
|
|
||||||
.PS
|
|
||||||
int big1[10000] = {
|
|
||||||
1
|
|
||||||
};
|
|
||||||
int big2[10000] = {
|
|
||||||
2
|
|
||||||
};
|
|
||||||
|
|
||||||
main() {
|
|
||||||
printf("loader is fine\\n");
|
|
||||||
}
|
|
||||||
.PE
|
|
||||||
We have made the following fix:
|
|
||||||
.PS
|
|
||||||
/* original /usr/src/cmd/ld.c */
|
|
||||||
|
|
||||||
113 struct {
|
|
||||||
114 int fmagic;
|
|
||||||
115 int tsize;
|
|
||||||
116 int dsize;
|
|
||||||
117 int bsize;
|
|
||||||
118 int ssize;
|
|
||||||
119 int entry;
|
|
||||||
120 int pad;
|
|
||||||
121 int relflg;
|
|
||||||
122 } filhdr;
|
|
||||||
|
|
||||||
/* modified /usr/src/cmd/ld.c */
|
|
||||||
|
|
||||||
113 /*
|
|
||||||
114 * The original Version 7 loader had problems loading large
|
|
||||||
115 * text or data portions.
|
|
||||||
116 * Why not include <a.out.h> ???
|
|
||||||
117 * then they would be declared unsigned
|
|
||||||
118 */
|
|
||||||
119 struct {
|
|
||||||
120 int fmagic;
|
|
||||||
121 unsigned tsize; /* not int !!! */
|
|
||||||
122 unsigned dsize; /* not int !!! */
|
|
||||||
123 unsigned bsize; /* not int !!! */
|
|
||||||
124 unsigned ssize; /* not int !!! */
|
|
||||||
125 unsigned entry; /* not int !!! */
|
|
||||||
126 unsigned pad; /* not int !!! */
|
|
||||||
127 unsigned relflg; /* not int !!! */
|
|
||||||
128 } filhdr;
|
|
||||||
.PE
|
|
||||||
.ER
|
|
||||||
Floating point registers
|
|
||||||
.sp
|
|
||||||
When a program is swapped to disk if it needs more memory,
|
|
||||||
then the floating point registers were not saved, so that
|
|
||||||
it may have different registers when it is restarted.
|
|
||||||
A small assembly program demonstrates this for the status register.
|
|
||||||
If the error is not fixed, then the program generates an IOT error.
|
|
||||||
A "memory fault" is generated if all is fine.
|
|
||||||
.PS
|
|
||||||
start: ldfps $7400
|
|
||||||
1: stfps r0
|
|
||||||
mov r0,-(sp)
|
|
||||||
cmp r0,$7400
|
|
||||||
beq 1b
|
|
||||||
4
|
|
||||||
.PE
|
|
||||||
You have to dig into the kernel to fix it.
|
|
||||||
The following patch will do:
|
|
||||||
.PS
|
|
||||||
/* original /usr/sys/sys/slp.c */
|
|
||||||
|
|
||||||
563 a2 = malloc(coremap, newsize);
|
|
||||||
564 if(a2 == NULL) {
|
|
||||||
565 xswap(p, 1, n);
|
|
||||||
566 p->p_flag |= SSWAP;
|
|
||||||
567 qswtch();
|
|
||||||
568 /* no return */
|
|
||||||
569 }
|
|
||||||
|
|
||||||
/* modified /usr/sys/sys/slp.c */
|
|
||||||
|
|
||||||
590 a2 = malloc(coremap, newsize);
|
|
||||||
591 if(a2 == NULL) {
|
|
||||||
592 #ifdef FPBUG
|
|
||||||
593 /*
|
|
||||||
594 * copy floating point register and status,
|
|
||||||
595 * but only if you must switch processes
|
|
||||||
596 */
|
|
||||||
597 if(u.u_fpsaved == 0) {
|
|
||||||
598 savfp(&u.u_fps);
|
|
||||||
599 u.u_fpsaved = 1;
|
|
||||||
600 }
|
|
||||||
601 #endif
|
|
||||||
602 xswap(p, 1, n);
|
|
||||||
603 p->p_flag |= SSWAP;
|
|
||||||
604 qswtch();
|
|
||||||
605 /* no return */
|
|
||||||
606 }
|
|
||||||
.PE
|
|
||||||
.ER
|
|
||||||
Floating point registers.
|
|
||||||
.sp
|
|
||||||
A similar problem arises when a process forks.
|
|
||||||
The child will have random floating point registers as is
|
|
||||||
demonstrated by the following assembly language program.
|
|
||||||
The child process will die by an IOT trap and the father prints
|
|
||||||
the message "child failed".
|
|
||||||
.PS
|
|
||||||
exit = 1.
|
|
||||||
fork = 2.
|
|
||||||
write = 4.
|
|
||||||
wait = 7.
|
|
||||||
|
|
||||||
start: ldfps $7400
|
|
||||||
sys fork
|
|
||||||
br child
|
|
||||||
sys wait
|
|
||||||
tst r1
|
|
||||||
bne bad
|
|
||||||
stfps r2
|
|
||||||
cmp r2,$7400
|
|
||||||
beq start
|
|
||||||
4
|
|
||||||
child: stfps r2
|
|
||||||
cmp r2,$7400
|
|
||||||
beq ex
|
|
||||||
4
|
|
||||||
bad: clr r0
|
|
||||||
sys write;mess;13.
|
|
||||||
ex: clr r0
|
|
||||||
sys exit
|
|
||||||
|
|
||||||
.data
|
|
||||||
mess: <child failed\\n>
|
|
||||||
.PE
|
|
||||||
The same file slp.c should be patched as follows:
|
|
||||||
.PS
|
|
||||||
/* original /usr/sys/sys/slp.c */
|
|
||||||
|
|
||||||
499 /*
|
|
||||||
500 * When the resume is executed for the new process,
|
|
||||||
501 * here's where it will resume.
|
|
||||||
502 */
|
|
||||||
503 if (save(u.u_ssav)) {
|
|
||||||
504 sureg();
|
|
||||||
505 return(1);
|
|
||||||
506 }
|
|
||||||
507 a2 = malloc(coremap, n);
|
|
||||||
508 /*
|
|
||||||
509 * If there is not enough core for the
|
|
||||||
510 * new process, swap out the current process to generate the
|
|
||||||
511 * copy.
|
|
||||||
512 */
|
|
||||||
|
|
||||||
/* modified /usr/sys/sys/slp.c */
|
|
||||||
|
|
||||||
519 /*
|
|
||||||
520 * When the resume is executed for the new process,
|
|
||||||
521 * here's where it will resume.
|
|
||||||
522 */
|
|
||||||
523 if (save(u.u_ssav)) {
|
|
||||||
524 sureg();
|
|
||||||
525 return(1);
|
|
||||||
526 }
|
|
||||||
527 #ifdef FPBUG
|
|
||||||
528 /* copy the floating point registers and status to child */
|
|
||||||
529 if(u.u_fpsaved == 0) {
|
|
||||||
530 savfp(&u.u_fps);
|
|
||||||
531 u.u_fpsaved = 1;
|
|
||||||
532 }
|
|
||||||
533 #endif
|
|
||||||
534 a2 = malloc(coremap, n);
|
|
||||||
535 /*
|
|
||||||
536 * If there is not enough core for the
|
|
||||||
537 * new process, swap out the current process to generate the
|
|
||||||
538 * copy.
|
|
||||||
539 */
|
|
||||||
.PE
|
|
||||||
.ER
|
|
||||||
/usr/src/libc/v6/stat.c
|
|
||||||
.sp
|
|
||||||
Some system calls are changed from version 6 to version 7.
|
|
||||||
A library of system call entries, that make a version 6 UNIX look like
|
|
||||||
a version 7 system, is provided to enable you to run some
|
|
||||||
useful version 7 utilities, like 'tar', on UNIX-6.
|
|
||||||
The entry for 'stat' contained two bugs:
|
|
||||||
the 24-bit file size was incorrectly converted to 32 bits
|
|
||||||
(sign extension of bit 15)
|
|
||||||
and the uid/gid fields suffered from sign extension.
|
|
||||||
.sp
|
|
||||||
Transferring your files from version 6 to version 7 using 'tar'
|
|
||||||
will fail for all files for which
|
|
||||||
.sp
|
|
||||||
( (size & 0100000) != 0 )
|
|
||||||
.sp
|
|
||||||
These two errors are fixed if stat.c is modified as follows:
|
|
||||||
.PS
|
|
||||||
/* original /usr/src/libc/v6/stat.c */
|
|
||||||
|
|
||||||
11 char os_size0;
|
|
||||||
12 short os_size1;
|
|
||||||
13 short os_addr[8];
|
|
||||||
|
|
||||||
49 buf->st_nlink = osbuf.os_nlinks;
|
|
||||||
50 buf->st_uid = osbuf.os_uid;
|
|
||||||
51 buf->st_gid = osbuf.os_gid;
|
|
||||||
52 buf->st_rdev = 0;
|
|
||||||
|
|
||||||
/* modified /usr/src/libc/v6/stat.c */
|
|
||||||
|
|
||||||
11 char os_size0;
|
|
||||||
12 unsigned os_size1;
|
|
||||||
13 short os_addr[8];
|
|
||||||
|
|
||||||
49 buf->st_nlink = osbuf.os_nlinks;
|
|
||||||
50 buf->st_uid = osbuf.os_uid & 0377;
|
|
||||||
51 buf->st_gid = osbuf.os_gid & 0377;
|
|
||||||
52 buf->st_rdev = 0;
|
|
||||||
.PE
|
|
||||||
752
doc/val.doc
752
doc/val.doc
@@ -1,752 +0,0 @@
|
|||||||
.ll 72
|
|
||||||
.wh 0 hd
|
|
||||||
.wh 60 fo
|
|
||||||
.de hd
|
|
||||||
'sp 5
|
|
||||||
..
|
|
||||||
.de fo
|
|
||||||
'bp
|
|
||||||
..
|
|
||||||
.tr ~
|
|
||||||
. PARAGRAPH
|
|
||||||
.de PP
|
|
||||||
.sp
|
|
||||||
..
|
|
||||||
. CHAPTER
|
|
||||||
.de CH
|
|
||||||
.br
|
|
||||||
.ne 15
|
|
||||||
.sp 3
|
|
||||||
.in 0
|
|
||||||
\\fB\\$1\\fR
|
|
||||||
.in 5
|
|
||||||
.PP
|
|
||||||
..
|
|
||||||
. SUBCHAPTER
|
|
||||||
.de SH
|
|
||||||
.br
|
|
||||||
.ne 10
|
|
||||||
.sp
|
|
||||||
.in 5
|
|
||||||
\\fB\\$1\\fR
|
|
||||||
.in 10
|
|
||||||
.PP
|
|
||||||
..
|
|
||||||
. INDENT START
|
|
||||||
.de IS
|
|
||||||
.sp
|
|
||||||
.in +5
|
|
||||||
..
|
|
||||||
. INDENT END
|
|
||||||
.de IE
|
|
||||||
.in -5
|
|
||||||
.sp
|
|
||||||
..
|
|
||||||
. DOUBLE INDENT START
|
|
||||||
.de DS
|
|
||||||
.sp
|
|
||||||
.in +5
|
|
||||||
.ll -5
|
|
||||||
..
|
|
||||||
. DOUBLE INDENT END
|
|
||||||
.de DE
|
|
||||||
.ll +5
|
|
||||||
.in -5
|
|
||||||
.sp
|
|
||||||
..
|
|
||||||
. EQUATION START
|
|
||||||
.de EQ
|
|
||||||
.sp
|
|
||||||
.nf
|
|
||||||
..
|
|
||||||
. EQUATION END
|
|
||||||
.de EN
|
|
||||||
.fi
|
|
||||||
.sp
|
|
||||||
..
|
|
||||||
. TEST
|
|
||||||
.de TT
|
|
||||||
.ti -5
|
|
||||||
Test~\\$1:~
|
|
||||||
.br
|
|
||||||
..
|
|
||||||
. IMPLEMENTATION 1
|
|
||||||
.de I1
|
|
||||||
.br
|
|
||||||
Implementation~1:
|
|
||||||
..
|
|
||||||
. IMPLEMENTATION 2
|
|
||||||
.de I2
|
|
||||||
.br
|
|
||||||
Implementation~2:
|
|
||||||
..
|
|
||||||
.de CS
|
|
||||||
.br
|
|
||||||
~-~\\
|
|
||||||
..
|
|
||||||
.br
|
|
||||||
.fi
|
|
||||||
.sp 5
|
|
||||||
.ce
|
|
||||||
\fBPascal Validation Suite Report\fR
|
|
||||||
.CH "Pascal processor identification"
|
|
||||||
The ACK-Pascal compiler produces code for an EM machine
|
|
||||||
as defined in [1].
|
|
||||||
It is up to the implementor of the EM machine whether errors like
|
|
||||||
integer overflow, undefined operand and range bound error are recognized or not.
|
|
||||||
Therefore it depends on the EM machine implementation whether these errors
|
|
||||||
are recognized in Pascal programs or not.
|
|
||||||
The validation suite results of all known implementations are given.
|
|
||||||
.PP
|
|
||||||
There does not (yet) exist a hardware EM machine.
|
|
||||||
Therefore, EM programs must be interpreted, or translated into
|
|
||||||
instructions for a target machine.
|
|
||||||
The following implementations currently exist:
|
|
||||||
.IS
|
|
||||||
.I1
|
|
||||||
an interpreter running on a PDP-11 (using UNIX).
|
|
||||||
The normal mode of operation for this interpreter is to check
|
|
||||||
for undefined integers, overflow, range errors etc.
|
|
||||||
.sp
|
|
||||||
.I2
|
|
||||||
a translator into PDP-11 instructions (using UNIX).
|
|
||||||
Less checks are performed than in the interpreter, because the translator
|
|
||||||
is intended to speed up the execution of well-debugged programs.
|
|
||||||
.IE
|
|
||||||
.CH "Test Conditions"
|
|
||||||
Tester: E.G. Keizer
|
|
||||||
.br
|
|
||||||
Date: October 1983
|
|
||||||
.br
|
|
||||||
Validation Suite version: 3.0
|
|
||||||
.PP
|
|
||||||
The final test run is made with a slightly
|
|
||||||
modified validation suite.
|
|
||||||
.SH "Erroneous programs"
|
|
||||||
Some test did not conform to the standard proposal of February 1979.
|
|
||||||
It is this version of the standard proposal that is used
|
|
||||||
by the authors of the validation suite.
|
|
||||||
.IS
|
|
||||||
.TT 6.6.3.7-4
|
|
||||||
The semicolon between high and integer on line 17 is replaced
|
|
||||||
by a colon.
|
|
||||||
.sp
|
|
||||||
.TT 6.7.2.2-13
|
|
||||||
The div operator on line 14 replaced by mod.
|
|
||||||
.CH "Conformance tests"
|
|
||||||
Number of tests passed = 150
|
|
||||||
.br
|
|
||||||
Number of tests failed = 6
|
|
||||||
.SH "Details of failed tests"
|
|
||||||
.IS
|
|
||||||
.TT 6.1.2-1
|
|
||||||
Character sequences starting with the 8 characters 'procedur'
|
|
||||||
or 'function' are
|
|
||||||
erroneously classified as the word-symbols 'procedure' and 'function'.
|
|
||||||
.sp
|
|
||||||
.TT 6.1.3-2
|
|
||||||
Identifiers identical in the first eight characters, but
|
|
||||||
differing in ninth or higher numbered characters are treated as
|
|
||||||
identical.
|
|
||||||
.sp
|
|
||||||
.TT 6.5.1-1
|
|
||||||
ACK-Pascal requires all formal program parameters to be
|
|
||||||
declared with type \fIfile\fP.
|
|
||||||
.sp
|
|
||||||
.TT 6.6.6.5-1
|
|
||||||
Gives run-time error eof seen at call to eoln.
|
|
||||||
A have a hunch that this is a error in the suit.
|
|
||||||
.sp
|
|
||||||
.TT 6.6.4.1-1
|
|
||||||
Redefining the names of some standard procedures leads to incorrect
|
|
||||||
behaviour of the runtime system.
|
|
||||||
In this case it crashes without a sensible error message.
|
|
||||||
.sp
|
|
||||||
.TT 6.9.3.5.1-1
|
|
||||||
This test can not be translated by our compiler because two
|
|
||||||
non-identical variables are used in the same block with the same first eight
|
|
||||||
characters.
|
|
||||||
The test passed after replacement of one of those names.
|
|
||||||
.IE
|
|
||||||
.CH "Deviance tests"
|
|
||||||
Number of deviations correctly detected = 120
|
|
||||||
.br
|
|
||||||
Number of tests not detecting deviations = 20
|
|
||||||
.SH "Details of deviations"
|
|
||||||
The following tests are compiled without a proper error
|
|
||||||
indication although they do
|
|
||||||
not conform to the standard.
|
|
||||||
.IS
|
|
||||||
.TT 6.1.6-5
|
|
||||||
ACK-Pascal allows labels in the range 0..32767.
|
|
||||||
A warning is produced when testing for deviations from the
|
|
||||||
standard.
|
|
||||||
.sp
|
|
||||||
.TT 6.1.8-5
|
|
||||||
A missing space between a number and a word symbol is not
|
|
||||||
detected.
|
|
||||||
.sp
|
|
||||||
.TT 6.2.2-8
|
|
||||||
.TT 6.3-6
|
|
||||||
.TT 6.4.1-3
|
|
||||||
.TT 6.6.1-3
|
|
||||||
.TT 6.6.1-4
|
|
||||||
Undetected scope error. The scope of an identifier should start at the
|
|
||||||
beginning of the block in which it is declared.
|
|
||||||
In the ACK-Pascal compiler the scope starts just after the declaration,
|
|
||||||
however.
|
|
||||||
.sp
|
|
||||||
.TT 6.4.3.3-7
|
|
||||||
The values of fields from one variant are accessible from
|
|
||||||
another variant.
|
|
||||||
The correlation is exact.
|
|
||||||
.sp
|
|
||||||
.TT 6.6.3.3-4
|
|
||||||
The passing as a variable parameter of the selector of a
|
|
||||||
variant part is not detected.
|
|
||||||
A runtime error is produced because the variant selector is not
|
|
||||||
initialized.
|
|
||||||
.sp
|
|
||||||
.TT 6.8.2.4-2
|
|
||||||
.TT 6.8.2.4-3
|
|
||||||
.TT 6.8.2.4-4
|
|
||||||
.TT 6.8.2.4-5
|
|
||||||
.TT 6.8.2.4-6
|
|
||||||
The ACK-Pascal compiler does not restrict the places from where
|
|
||||||
you may jump to a label by means of a goto-statement.
|
|
||||||
.sp
|
|
||||||
.TT 6.8.3.9-5
|
|
||||||
.TT 6.8.3.9-6
|
|
||||||
.TT 6.8.3.9-7
|
|
||||||
.TT 6.8.3.9-16
|
|
||||||
There are no errors produced for assignments to a variable
|
|
||||||
in use as control-variable of a for-statement.
|
|
||||||
.TT 6.8.3.9-8
|
|
||||||
.TT 6.8.3.9-9
|
|
||||||
Use of a controlled variable after leaving the loop without
|
|
||||||
intervening initialization is not detected.
|
|
||||||
.IE
|
|
||||||
.CH "Error handling"
|
|
||||||
The results depend on the EM implementation.
|
|
||||||
.sp
|
|
||||||
Number of errors correctly detected =
|
|
||||||
.in +5
|
|
||||||
.I1
|
|
||||||
32
|
|
||||||
.I2
|
|
||||||
17
|
|
||||||
.in -5
|
|
||||||
Number of errors not detected =
|
|
||||||
.in +5
|
|
||||||
.I1
|
|
||||||
21
|
|
||||||
.I2
|
|
||||||
36
|
|
||||||
.in -5
|
|
||||||
Number of errors incorrectly detected =
|
|
||||||
.in +5
|
|
||||||
.I1
|
|
||||||
2
|
|
||||||
.I2
|
|
||||||
2
|
|
||||||
.in -5
|
|
||||||
.SH "Details of errors not detected"
|
|
||||||
The following test fails because the ACK-Pascal compiler only
|
|
||||||
generates a warning that does not prevent to run the tests.
|
|
||||||
.IS
|
|
||||||
.TT 6.6.2-8
|
|
||||||
A warning is produced if there is no assignment to a function-identifier.
|
|
||||||
.IE
|
|
||||||
With this test the ACK-Pascal compiler issues an error message for a legal
|
|
||||||
construct not directly related to the error to be detected.
|
|
||||||
.IS
|
|
||||||
.TT 6.5.5-2
|
|
||||||
Program does not compile.
|
|
||||||
Buffer variable of text file is not allowed as variable
|
|
||||||
parameter.
|
|
||||||
.IE
|
|
||||||
The following errors are not detected at all.
|
|
||||||
.IS
|
|
||||||
.TT 6.2.1-11
|
|
||||||
.I2
|
|
||||||
The use of an undefined integer is not caught as an error.
|
|
||||||
.sp
|
|
||||||
.TT 6.4.3.3-10
|
|
||||||
.TT 6.4.3.3-11
|
|
||||||
.TT 6.4.3.3-12
|
|
||||||
.TT 6.4.3.3-13
|
|
||||||
The notion of 'current variant' is not implemented, not even if a tagfield
|
|
||||||
is present.
|
|
||||||
.sp
|
|
||||||
.TT 6.4.5-15
|
|
||||||
.TT 6.4.6-9
|
|
||||||
.TT 6.4.6-10
|
|
||||||
.TT 6.4.6-11
|
|
||||||
.TT 6.5.3.2-2
|
|
||||||
.I2
|
|
||||||
Subrange bounds are not checked.
|
|
||||||
.sp
|
|
||||||
.TT 6.4.6-12
|
|
||||||
.TT 6.4.6-13
|
|
||||||
.TT 6.7.2.4-4
|
|
||||||
If the base-type of a set is a subrange, then the set elements are not checked
|
|
||||||
against the bounds of the subrange.
|
|
||||||
Only the host-type of this subrange-type is relevant for ACK-Pascal.
|
|
||||||
.sp
|
|
||||||
.TT 6.5.4-1
|
|
||||||
.I2
|
|
||||||
Nil pointers are not detected.
|
|
||||||
.sp
|
|
||||||
.TT 6.5.4-2
|
|
||||||
.I2
|
|
||||||
Undefined pointers are not detected.
|
|
||||||
.sp
|
|
||||||
.TT 6.5.5-3
|
|
||||||
Changing the file position while the window is in use as actual variable
|
|
||||||
parameter or as an element of the record variable list of a with-statement
|
|
||||||
is not detected.
|
|
||||||
.sp
|
|
||||||
.TT 6.6.2-9
|
|
||||||
An undefined function result is not detected,
|
|
||||||
because it is never used in an expression.
|
|
||||||
.sp
|
|
||||||
.TT 6.6.5.3-6
|
|
||||||
.TT 6.6.5.3-7
|
|
||||||
Disposing a variable while it is in use as actual variable parameter or
|
|
||||||
as an element of the record variable list of a with-statement is not detected.
|
|
||||||
.sp
|
|
||||||
.TT 6.6.5.3-8
|
|
||||||
.TT 6.6.5.3-9
|
|
||||||
.TT 6.6.5.3-10
|
|
||||||
It is not detected that a record variable, created with the variant form
|
|
||||||
of new, is used as an operand in an expression or as the variable in an
|
|
||||||
assignment or as an actual value parameter.
|
|
||||||
.sp
|
|
||||||
.TT 6.6.5.3-11
|
|
||||||
Use of a variable that is not reinitialized after a dispose is
|
|
||||||
not detected.
|
|
||||||
.sp
|
|
||||||
.TT 6.6.6.4-4
|
|
||||||
.TT 6.6.6.4-5
|
|
||||||
.TT 6.6.6.4-7
|
|
||||||
.I2
|
|
||||||
There are no range checks for pred, succ and chr.
|
|
||||||
.sp
|
|
||||||
.TT 6.6.6.5-6
|
|
||||||
ACK-Pascal considers a rewrite of a file as a defining
|
|
||||||
occurence.
|
|
||||||
.sp
|
|
||||||
.TT 6.7.2.2-8
|
|
||||||
.TT 6.7.2.2-9
|
|
||||||
.TT 6.7.2.2-10
|
|
||||||
.TT 6.7.2.2-12
|
|
||||||
.I2
|
|
||||||
Division by 0 or integer overflow is not detected.
|
|
||||||
.sp
|
|
||||||
.TT 6.8.3.9-18
|
|
||||||
The use of the some control variable in two nested for
|
|
||||||
statements in not detected.
|
|
||||||
.sp
|
|
||||||
.TT 6.8.3.9-19
|
|
||||||
Access of a control variable after leaving the loop results in
|
|
||||||
the final-value, although an error should be produced.
|
|
||||||
.sp
|
|
||||||
.TT 6.9.3.2-3
|
|
||||||
The program stops with a file not open error.
|
|
||||||
The rewrite before the write is missing in the program.
|
|
||||||
.sp
|
|
||||||
.TT 6.9.3.2-4
|
|
||||||
.TT 6.9.3.2-5
|
|
||||||
Illegal FracDigits values are not detected.
|
|
||||||
.CH "Implementation dependence"
|
|
||||||
Number of tests run = 14
|
|
||||||
.br
|
|
||||||
Number of tests incorrectly handled = 0
|
|
||||||
.SH "Details of implementation dependence"
|
|
||||||
.IS
|
|
||||||
.TT 6.1.9-5
|
|
||||||
Alternate comment delimiters are implemented
|
|
||||||
.sp
|
|
||||||
.TT 6.1.9-6
|
|
||||||
The equivalent symbols @ for ^, (. for [ and .) for ] are not
|
|
||||||
implemented.
|
|
||||||
.sp
|
|
||||||
.TT 6.4.2.2-10
|
|
||||||
Maxint = 32767
|
|
||||||
.sp
|
|
||||||
.TT 6.4.3.4-5
|
|
||||||
Only elements with non-negative ordinal value are allowed in sets.
|
|
||||||
.sp
|
|
||||||
.TT 6.6.6.1-1
|
|
||||||
Standard procedures and functions are not allowed as parameters.
|
|
||||||
.sp
|
|
||||||
.TT 6.6.6.2-11
|
|
||||||
Details of the machine characteristics regarding real numbers:
|
|
||||||
.IS
|
|
||||||
.nf
|
|
||||||
beta = 2
|
|
||||||
t = 56
|
|
||||||
rnd = 1
|
|
||||||
ngrd = 0
|
|
||||||
machep = -56
|
|
||||||
negep = -56
|
|
||||||
iexp = 8
|
|
||||||
minexp = -128
|
|
||||||
maxexp = 127
|
|
||||||
eps = 1.387779e-17
|
|
||||||
epsneg = 1.387779e-17
|
|
||||||
xmin = 2.938736e-39
|
|
||||||
xmax = 1.701412e+38
|
|
||||||
.fi
|
|
||||||
.IE
|
|
||||||
.sp
|
|
||||||
.TT 6.7.2.3-3
|
|
||||||
.TT 6.7.2.3-4
|
|
||||||
All operands of boolean expressions are evaluated.
|
|
||||||
.sp
|
|
||||||
.TT 6.8.2.2-1
|
|
||||||
.TT 6.8.2.2-2
|
|
||||||
The expression in an assignment statement is evaluated
|
|
||||||
before the variable selection if this involves pointer
|
|
||||||
dereferencing or array indexing.
|
|
||||||
.sp
|
|
||||||
.TT 6.8.2.3-2
|
|
||||||
Actual parameters are evaluated in reverse order.
|
|
||||||
.sp
|
|
||||||
.TT 6.9.3.2-6
|
|
||||||
The default width for integer, Boolean and real are 6, 5 and 13.
|
|
||||||
.sp
|
|
||||||
.TT 6.9.3.5.1-2
|
|
||||||
The number of digits written in an exponent is 2.
|
|
||||||
.sp
|
|
||||||
.TT 6.9.3.6-1
|
|
||||||
The representations of true and false are (~true) and (false).
|
|
||||||
The parenthesis serve to indicate width.
|
|
||||||
.IE
|
|
||||||
.CH "Quality measurement"
|
|
||||||
Number of tests run = 60
|
|
||||||
.br
|
|
||||||
Number of tests handled incorrectly = 1
|
|
||||||
.SH "Results of tests"
|
|
||||||
Several test perform operations on reals on indicate the error
|
|
||||||
introduced by these operations.
|
|
||||||
For each of these tests the following two quality measures are extracted:
|
|
||||||
.sp
|
|
||||||
.in +5
|
|
||||||
maxRE:~~maximum relative error
|
|
||||||
.br
|
|
||||||
rmsRE:~~root-mean-square relative error
|
|
||||||
.in -5
|
|
||||||
.sp 2
|
|
||||||
.IS
|
|
||||||
.TT 1.2-1
|
|
||||||
.I1
|
|
||||||
25 thousand Whetstone instructions per second.
|
|
||||||
.I2
|
|
||||||
169 thousand Whetstone instructions per second.
|
|
||||||
.sp
|
|
||||||
.TT 1.2-2
|
|
||||||
The value of (TRUEACC-ACC)*2^56/100000 is 1.4 .
|
|
||||||
This is well within the bounds specified in [3].
|
|
||||||
.br
|
|
||||||
The GAMM measure is:
|
|
||||||
.I1
|
|
||||||
238 microseconds
|
|
||||||
.I2
|
|
||||||
26.3 microseconds.
|
|
||||||
.sp
|
|
||||||
.TT 1.2-3
|
|
||||||
The number of procedure calls calculated in this test exceeds
|
|
||||||
the maximum integer value.
|
|
||||||
The program stops indicating overflow.
|
|
||||||
.sp
|
|
||||||
.TT 6.1.3-3
|
|
||||||
The number of significant characters for identifiers is 8.
|
|
||||||
.sp
|
|
||||||
.TT 6.1.5-8
|
|
||||||
There is no maximum to the line length.
|
|
||||||
.sp
|
|
||||||
.TT 6.1.5-9
|
|
||||||
The error message "too many digits" is given for numbers larger
|
|
||||||
than maxint.
|
|
||||||
.sp
|
|
||||||
.TT 6.1.5-10
|
|
||||||
.TT 6.1.5-11
|
|
||||||
.TT 6.1.5-12
|
|
||||||
Normal values are allowed for real constants and variables.
|
|
||||||
.sp
|
|
||||||
.TT 6.1.7-14
|
|
||||||
A reasonably large number of strings is allowed.
|
|
||||||
.sp
|
|
||||||
.TT 6.1.8-6
|
|
||||||
No warning is given for possibly unclosed comments.
|
|
||||||
.sp
|
|
||||||
.TT 6.2.1-12
|
|
||||||
.TT 6.2.1-13
|
|
||||||
.TT 6.2.1-14
|
|
||||||
.TT 6.2.1-15
|
|
||||||
.TT 6.5.1-2
|
|
||||||
Large lists of declarations are possible in each block.
|
|
||||||
.sp
|
|
||||||
.TT 6.4.3.2-6
|
|
||||||
An 'array[integer] of' is not allowed.
|
|
||||||
.sp
|
|
||||||
.TT 6.4.3.2-7
|
|
||||||
.TT 6.4.3.2-8
|
|
||||||
Large values are allowed for arrays and indices.
|
|
||||||
.sp
|
|
||||||
.TT 6.4.3.3-14
|
|
||||||
Large amounts of case-constant values are allowed in variants.
|
|
||||||
.sp
|
|
||||||
.TT 6.4.3.3-15
|
|
||||||
Large amounts of record sections can appear in the fixed part of
|
|
||||||
a record.
|
|
||||||
.sp
|
|
||||||
.TT 6.4.3.3-16
|
|
||||||
Large amounts of variants are allowed in a record.
|
|
||||||
.TT 6.4.3.4-4
|
|
||||||
Size and speed of Warshall's algorithm depend on the
|
|
||||||
implementation of EM:
|
|
||||||
.IS
|
|
||||||
.I1
|
|
||||||
.br
|
|
||||||
size: 122 bytes
|
|
||||||
.br
|
|
||||||
speed: 5.2 seconds
|
|
||||||
.sp
|
|
||||||
.I2
|
|
||||||
.br
|
|
||||||
size: 196 bytes
|
|
||||||
.br
|
|
||||||
speed: 0.7 seconds
|
|
||||||
.IE
|
|
||||||
.TT 6.5.3.2-3
|
|
||||||
Deep nesting of array indices is allowed.
|
|
||||||
.sp
|
|
||||||
.TT 6.5.3.2-4
|
|
||||||
.TT 6.5.3.2-5
|
|
||||||
Arrays can have at least 8 dimensions.
|
|
||||||
.sp
|
|
||||||
.TT 6.6.1-8
|
|
||||||
Deep static nesting of procedure is allowed.
|
|
||||||
.sp
|
|
||||||
.TT 6.6.3.1-6
|
|
||||||
Large amounts of formal parameters are allowed.
|
|
||||||
.sp
|
|
||||||
.TT 6.6.5.3-12
|
|
||||||
Dispose is fully implemented.
|
|
||||||
.sp
|
|
||||||
.TT 6.6.6.2-6
|
|
||||||
Test sqrt(x): no errors.
|
|
||||||
The error is within acceptable bounds.
|
|
||||||
.in +5
|
|
||||||
maxRE:~~2~**~-55.50
|
|
||||||
.br
|
|
||||||
rmsRE:~~2~**~-57.53
|
|
||||||
.in -5
|
|
||||||
.sp
|
|
||||||
.TT 6.6.6.2-7
|
|
||||||
Test arctan(x): may cause underflow or overflow errors.
|
|
||||||
The error is within acceptable bounds.
|
|
||||||
.in +5
|
|
||||||
.br
|
|
||||||
maxRE:~~2~**~-55.00
|
|
||||||
.br
|
|
||||||
rmsRE:~~2~**~-56.36
|
|
||||||
.in -5
|
|
||||||
.sp
|
|
||||||
.TT 6.6.6.2-8
|
|
||||||
Test exp(x): may cause underflow or overflow errors.
|
|
||||||
The error is not within acceptable bounds.
|
|
||||||
.in +5
|
|
||||||
maxRE:~~2~**~-50.03
|
|
||||||
.br
|
|
||||||
rmsRE:~~2~**~-51.03
|
|
||||||
.in -5
|
|
||||||
.sp
|
|
||||||
.TT 6.6.6.2-9
|
|
||||||
Test sin(x): may cause underflow errors.
|
|
||||||
The error is not within acceptable bounds.
|
|
||||||
.in +5
|
|
||||||
maxRE:~~2~**~-38.20
|
|
||||||
.br
|
|
||||||
rmsRE:~~2~**~-43.68
|
|
||||||
.in -5
|
|
||||||
.sp
|
|
||||||
Test cos(x): may cause underflow errors.
|
|
||||||
The error is not within acceptable bounds.
|
|
||||||
.in +5
|
|
||||||
maxRE:~~2~**~-41.33
|
|
||||||
.br
|
|
||||||
rmsRE:~~2~**~-46.62
|
|
||||||
.in -5
|
|
||||||
.sp
|
|
||||||
.TT 6.6.6.2-10
|
|
||||||
Test ln(x):
|
|
||||||
The error is not within acceptable bounds.
|
|
||||||
.in +5
|
|
||||||
maxRE:~~2~**~-54.05
|
|
||||||
.br
|
|
||||||
rmsRE:~~2~**~-55.77
|
|
||||||
.in -5
|
|
||||||
.sp
|
|
||||||
.TT 6.7.1-3
|
|
||||||
.TT 6.7.1-4
|
|
||||||
.TT 6.7.1-5
|
|
||||||
Complex nested expressions are allowed.
|
|
||||||
.sp
|
|
||||||
.TT 6.7.2.2-14
|
|
||||||
Test real division:
|
|
||||||
The error is within acceptable bounds.
|
|
||||||
.in +5
|
|
||||||
maxRE:~~0
|
|
||||||
.br
|
|
||||||
rmsRE:~~0
|
|
||||||
.in -5
|
|
||||||
.sp
|
|
||||||
.TT 6.7.2.2-15
|
|
||||||
Operations of reals in the integer range are exact.
|
|
||||||
.sp
|
|
||||||
.TT 6.7.3-1
|
|
||||||
.TT 6.8.3.2-1
|
|
||||||
.TT 6.8.3.4-2
|
|
||||||
.TT 6.8.3.5-15
|
|
||||||
.TT 6.8.3.7-4
|
|
||||||
.TT 6.8.3.8-3
|
|
||||||
.TT 6.8.3.9-20
|
|
||||||
.TT 6.8.3.10-7
|
|
||||||
Static deep nesting of function calls,
|
|
||||||
compound statements, if statements, case statements, repeat
|
|
||||||
loops, while loops, for loops and with statements is possible.
|
|
||||||
.sp
|
|
||||||
.TT 6.8.3.2-2
|
|
||||||
Large amounts of statements are allowed in a compound
|
|
||||||
statement.
|
|
||||||
.sp
|
|
||||||
.TT 6.8.3.5-12
|
|
||||||
The compiler requires case constants to be compatible with
|
|
||||||
the case selector.
|
|
||||||
.sp
|
|
||||||
.TT 6.8.3.5-13
|
|
||||||
.TT 6.8.3.5-14
|
|
||||||
Large case statements are possible.
|
|
||||||
.sp
|
|
||||||
.TT 6.9-2
|
|
||||||
Recursive IO on the same file is well-behaved.
|
|
||||||
.sp
|
|
||||||
.TT 6.9.1-6
|
|
||||||
The reading of real values from a text file is done with
|
|
||||||
sufficient accuracy.
|
|
||||||
.in +5
|
|
||||||
maxRE:~~2~**~-54.61
|
|
||||||
.br
|
|
||||||
rmsRE:~~2~**~-56.32
|
|
||||||
.in -5
|
|
||||||
.sp
|
|
||||||
.TT 6.9.1-7
|
|
||||||
.TT 6.9.2-2
|
|
||||||
.TT 6.9.3-3
|
|
||||||
.TT 6.9.4-2
|
|
||||||
Read, readln, write and writeln may have large amounts of
|
|
||||||
parameters.
|
|
||||||
.sp
|
|
||||||
.TT 6.9.1-8
|
|
||||||
The loss of precision for reals written on a text file and read
|
|
||||||
back is:
|
|
||||||
.in +5
|
|
||||||
maxRE:~~2~**~-53.95
|
|
||||||
.br
|
|
||||||
rmsRE:~~2~**~-55.90
|
|
||||||
.in -5
|
|
||||||
.sp
|
|
||||||
.TT 6.9.3-2
|
|
||||||
File IO buffers without trailing marker are correctly flushed.
|
|
||||||
.sp
|
|
||||||
.TT 6.9.3.5.2-2
|
|
||||||
Reals are written with sufficient accuracy.
|
|
||||||
.in +5
|
|
||||||
maxRE:~~0
|
|
||||||
.br
|
|
||||||
rmsRE:~~0
|
|
||||||
.in -5
|
|
||||||
.IE
|
|
||||||
.CH "Level 1 conformance tests"
|
|
||||||
Number of test passed = 4
|
|
||||||
.br
|
|
||||||
Number of tests failed = 1
|
|
||||||
.SH "Details of failed tests"
|
|
||||||
.IS
|
|
||||||
.TT 6.6.3.7-4
|
|
||||||
An expression indicated by parenthesis whose
|
|
||||||
value is a conformant array is not allowed.
|
|
||||||
.IE
|
|
||||||
.CH "Level 1 deviance tests"
|
|
||||||
Number of deviations correctly detected = 4
|
|
||||||
.br
|
|
||||||
Number of tests not detecting deviations = 0
|
|
||||||
.IE
|
|
||||||
.CH "Level 1 error handling"
|
|
||||||
The results depend on the EM implementation.
|
|
||||||
.sp
|
|
||||||
Number of errors correctly detected =
|
|
||||||
.in +5
|
|
||||||
.I1
|
|
||||||
1
|
|
||||||
.I2
|
|
||||||
0
|
|
||||||
.in -5
|
|
||||||
Number of errors not detected =
|
|
||||||
.in +5
|
|
||||||
.I1
|
|
||||||
0
|
|
||||||
.I2
|
|
||||||
1
|
|
||||||
.in -5
|
|
||||||
.SH "Details of errors not detected"
|
|
||||||
.IS
|
|
||||||
.TT 6.6.3.7-9
|
|
||||||
.I2
|
|
||||||
Subrange bounds are not checked.
|
|
||||||
.IE
|
|
||||||
.CH "Level 1 quality measurement"
|
|
||||||
Number of tests run = 1
|
|
||||||
.SH "Results of test"
|
|
||||||
.IS
|
|
||||||
.TT 6.6.3.7-10
|
|
||||||
Large conformant arrays are allowed.
|
|
||||||
.IE
|
|
||||||
.CH "Extensions"
|
|
||||||
Number of tests run = 3
|
|
||||||
.SH Details of test failed
|
|
||||||
.IS
|
|
||||||
.TT 6.1.9-7
|
|
||||||
The alternative relational operators are not allowed.
|
|
||||||
.sp
|
|
||||||
.TT 6.1.9-8
|
|
||||||
The alternative symbols for colon, semicolon and assignment are
|
|
||||||
not allowed.
|
|
||||||
.sp
|
|
||||||
.TT 6.8.3.5-16
|
|
||||||
The otherwise selector in case statements is not allowed.
|
|
||||||
.IE
|
|
||||||
.CH "References"
|
|
||||||
.ti -5
|
|
||||||
[1]~~\
|
|
||||||
A.S.Tanenbaum, E.G.Keizer, J.W.Stevenson, Hans van Staveren,
|
|
||||||
"Description of a machine architecture for use with block structured
|
|
||||||
languages",
|
|
||||||
Informatica rapport IR-81.
|
|
||||||
.ti -5
|
|
||||||
[2]~~\
|
|
||||||
ISO standard proposal ISO/TC97/SC5-N462, dated February 1979.
|
|
||||||
The same proposal, in slightly modified form, can be found in:
|
|
||||||
A.M.Addyman e.a., "A draft description of Pascal",
|
|
||||||
Software, practice and experience, May 1979.
|
|
||||||
An improved version, received March 1980,
|
|
||||||
is followed as much as possible for the
|
|
||||||
current ACK-Pascal.
|
|
||||||
.ti -5
|
|
||||||
[3]~~\
|
|
||||||
B. A. Wichman and J du Croz,
|
|
||||||
A program to calculate the GAMM measure, Computer Journal,
|
|
||||||
November 1979.
|
|
||||||
352
etc/ip_spec.t
352
etc/ip_spec.t
@@ -1,352 +0,0 @@
|
|||||||
aar mwPo 1 34
|
|
||||||
adf sP 1 35
|
|
||||||
adi mwPo 2 36
|
|
||||||
adp 2 38
|
|
||||||
adp mPo 2 39
|
|
||||||
adp sP 1 41
|
|
||||||
adp sN 1 42
|
|
||||||
ads mwPo 1 43
|
|
||||||
and mwPo 1 44
|
|
||||||
asp mwPo 5 45
|
|
||||||
asp swP 1 50
|
|
||||||
beq 2 51
|
|
||||||
beq sP 1 52
|
|
||||||
bge sP 1 53
|
|
||||||
bgt sP 1 54
|
|
||||||
ble sP 1 55
|
|
||||||
blm sP 1 56
|
|
||||||
blt sP 1 57
|
|
||||||
bne sP 1 58
|
|
||||||
bra 2 59
|
|
||||||
bra sN 2 60
|
|
||||||
bra sP 2 62
|
|
||||||
cal mPo 28 64
|
|
||||||
cal sP 1 92
|
|
||||||
cff - 93
|
|
||||||
cif - 94
|
|
||||||
cii - 95
|
|
||||||
cmf sP 1 96
|
|
||||||
cmi mwPo 2 97
|
|
||||||
cmp - 99
|
|
||||||
cms sP 1 100
|
|
||||||
csa mwPo 1 101
|
|
||||||
csb mwPo 1 102
|
|
||||||
dec - 103
|
|
||||||
dee sw 1 104
|
|
||||||
del swN 1 105
|
|
||||||
dup mwPo 1 106
|
|
||||||
dvf sP 1 107
|
|
||||||
dvi mwPo 1 108
|
|
||||||
fil 2 109
|
|
||||||
inc - 110
|
|
||||||
ine w2 111
|
|
||||||
ine sw 1 112
|
|
||||||
inl mwN 3 113
|
|
||||||
inl swN 1 116
|
|
||||||
inn sP 1 117
|
|
||||||
ior mwPo 1 118
|
|
||||||
ior sP 1 119
|
|
||||||
lae 2 120
|
|
||||||
lae sw 7 121
|
|
||||||
lal P2 128
|
|
||||||
lal N2 129
|
|
||||||
lal m 1 130
|
|
||||||
lal mN 1 131
|
|
||||||
lal swP 1 132
|
|
||||||
lal swN 2 133
|
|
||||||
lar mwPo 1 135
|
|
||||||
ldc mP 1 136
|
|
||||||
lde w2 137
|
|
||||||
lde sw 1 138
|
|
||||||
ldl mP 1 139
|
|
||||||
ldl swN 1 140
|
|
||||||
lfr mwPo 2 141
|
|
||||||
lfr sP 1 143
|
|
||||||
lil swN 1 144
|
|
||||||
lil swP 1 145
|
|
||||||
lil mwP 2 146
|
|
||||||
lin 2 148
|
|
||||||
lin sP 1 149
|
|
||||||
lni - 150
|
|
||||||
loc 2 151
|
|
||||||
loc mP 34 0
|
|
||||||
loc mN 1 152
|
|
||||||
loc sP 1 153
|
|
||||||
loc sN 1 154
|
|
||||||
loe w2 155
|
|
||||||
loe sw 5 156
|
|
||||||
lof 2 161
|
|
||||||
lof mwPo 4 162
|
|
||||||
lof sP 1 166
|
|
||||||
loi 2 167
|
|
||||||
loi mPo 1 168
|
|
||||||
loi mwPo 4 169
|
|
||||||
loi sP 1 173
|
|
||||||
lol wP2 174
|
|
||||||
lol wN2 175
|
|
||||||
lol mwP 4 176
|
|
||||||
lol mwN 8 180
|
|
||||||
lol swP 1 188
|
|
||||||
lol swN 1 189
|
|
||||||
lxa mPo 1 190
|
|
||||||
lxl mPo 2 191
|
|
||||||
mlf sP 1 193
|
|
||||||
mli mwPo 2 194
|
|
||||||
rck mwPo 1 196
|
|
||||||
ret mwP 2 197
|
|
||||||
ret sP 1 199
|
|
||||||
rmi mwPo 1 200
|
|
||||||
sar mwPo 1 201
|
|
||||||
sbf sP 1 202
|
|
||||||
sbi mwPo 2 203
|
|
||||||
sdl swN 1 205
|
|
||||||
set sP 1 206
|
|
||||||
sil swN 1 207
|
|
||||||
sil swP 1 208
|
|
||||||
sli mwPo 1 209
|
|
||||||
ste w2 210
|
|
||||||
ste sw 3 211
|
|
||||||
stf 2 214
|
|
||||||
stf mwPo 2 215
|
|
||||||
stf sP 1 217
|
|
||||||
sti mPo 1 218
|
|
||||||
sti mwPo 4 219
|
|
||||||
sti sP 1 223
|
|
||||||
stl wP2 224
|
|
||||||
stl wN2 225
|
|
||||||
stl mwP 2 226
|
|
||||||
stl mwN 5 228
|
|
||||||
stl swN 1 233
|
|
||||||
teq - 234
|
|
||||||
tgt - 235
|
|
||||||
tlt - 236
|
|
||||||
tne - 237
|
|
||||||
zeq 2 238
|
|
||||||
zeq sP 2 239
|
|
||||||
zer sP 1 241
|
|
||||||
zge sP 1 242
|
|
||||||
zgt sP 1 243
|
|
||||||
zle sP 1 244
|
|
||||||
zlt sP 1 245
|
|
||||||
zne sP 1 246
|
|
||||||
zne sN 1 247
|
|
||||||
zre w2 248
|
|
||||||
zre sw 1 249
|
|
||||||
zrl mwN 2 250
|
|
||||||
zrl swN 1 252
|
|
||||||
zrl wN2 253
|
|
||||||
aar e2 0
|
|
||||||
aar e- 1
|
|
||||||
adf e2 2
|
|
||||||
adf e- 3
|
|
||||||
adi e2 4
|
|
||||||
adi e- 5
|
|
||||||
ads e2 6
|
|
||||||
ads e- 7
|
|
||||||
adu e2 8
|
|
||||||
adu e- 9
|
|
||||||
and e2 10
|
|
||||||
and e- 11
|
|
||||||
asp ew2 12
|
|
||||||
ass e2 13
|
|
||||||
ass e- 14
|
|
||||||
bge e2 15
|
|
||||||
bgt e2 16
|
|
||||||
ble e2 17
|
|
||||||
blm e2 18
|
|
||||||
bls e2 19
|
|
||||||
bls e- 20
|
|
||||||
blt e2 21
|
|
||||||
bne e2 22
|
|
||||||
cai e- 23
|
|
||||||
cal e2 24
|
|
||||||
cfi e- 25
|
|
||||||
cfu e- 26
|
|
||||||
ciu e- 27
|
|
||||||
cmf e2 28
|
|
||||||
cmf e- 29
|
|
||||||
cmi e2 30
|
|
||||||
cmi e- 31
|
|
||||||
cms e2 32
|
|
||||||
cms e- 33
|
|
||||||
cmu e2 34
|
|
||||||
cmu e- 35
|
|
||||||
com e2 36
|
|
||||||
com e- 37
|
|
||||||
csa e2 38
|
|
||||||
csa e- 39
|
|
||||||
csb e2 40
|
|
||||||
csb e- 41
|
|
||||||
cuf e- 42
|
|
||||||
cui e- 43
|
|
||||||
cuu e- 44
|
|
||||||
dee ew2 45
|
|
||||||
del ewP2 46
|
|
||||||
del ewN2 47
|
|
||||||
dup e2 48
|
|
||||||
dus e2 49
|
|
||||||
dus e- 50
|
|
||||||
dvf e2 51
|
|
||||||
dvf e- 52
|
|
||||||
dvi e2 53
|
|
||||||
dvi e- 54
|
|
||||||
dvu e2 55
|
|
||||||
dvu e- 56
|
|
||||||
fef e2 57
|
|
||||||
fef e- 58
|
|
||||||
fif e2 59
|
|
||||||
fif e- 60
|
|
||||||
inl ewP2 61
|
|
||||||
inl ewN2 62
|
|
||||||
inn e2 63
|
|
||||||
inn e- 64
|
|
||||||
ior e2 65
|
|
||||||
ior e- 66
|
|
||||||
lar e2 67
|
|
||||||
lar e- 68
|
|
||||||
ldc e2 69
|
|
||||||
ldf e2 70
|
|
||||||
ldl ewP2 71
|
|
||||||
ldl ewN2 72
|
|
||||||
lfr e2 73
|
|
||||||
lil ewP2 74
|
|
||||||
lil ewN2 75
|
|
||||||
lim e- 76
|
|
||||||
los e2 77
|
|
||||||
los e- 78
|
|
||||||
lor esP 1 79
|
|
||||||
lpi e2 80
|
|
||||||
lxa e2 81
|
|
||||||
lxl e2 82
|
|
||||||
mlf e2 83
|
|
||||||
mlf e- 84
|
|
||||||
mli e2 85
|
|
||||||
mli e- 86
|
|
||||||
mlu e2 87
|
|
||||||
mlu e- 88
|
|
||||||
mon e- 89
|
|
||||||
ngf e2 90
|
|
||||||
ngf e- 91
|
|
||||||
ngi e2 92
|
|
||||||
ngi e- 93
|
|
||||||
nop e- 94
|
|
||||||
rck e2 95
|
|
||||||
rck e- 96
|
|
||||||
ret e2 97
|
|
||||||
rmi e2 98
|
|
||||||
rmi e- 99
|
|
||||||
rmu e2 100
|
|
||||||
rmu e- 101
|
|
||||||
rol e2 102
|
|
||||||
rol e- 103
|
|
||||||
ror e2 104
|
|
||||||
ror e- 105
|
|
||||||
rtt e- 106
|
|
||||||
sar e2 107
|
|
||||||
sar e- 108
|
|
||||||
sbf e2 109
|
|
||||||
sbf e- 110
|
|
||||||
sbi e2 111
|
|
||||||
sbi e- 112
|
|
||||||
sbs e2 113
|
|
||||||
sbs e- 114
|
|
||||||
sbu e2 115
|
|
||||||
sbu e- 116
|
|
||||||
sde e2 117
|
|
||||||
sdf e2 118
|
|
||||||
sdl ewP2 119
|
|
||||||
sdl ewN2 120
|
|
||||||
set e2 121
|
|
||||||
set e- 122
|
|
||||||
sig e- 123
|
|
||||||
sil ewP2 124
|
|
||||||
sil ewN2 125
|
|
||||||
sim e- 126
|
|
||||||
sli e2 127
|
|
||||||
sli e- 128
|
|
||||||
slu e2 129
|
|
||||||
slu e- 130
|
|
||||||
sri e2 131
|
|
||||||
sri e- 132
|
|
||||||
sru e2 133
|
|
||||||
sru e- 134
|
|
||||||
sti e2 135
|
|
||||||
sts e2 136
|
|
||||||
sts e- 137
|
|
||||||
str esP 1 138
|
|
||||||
tge e- 139
|
|
||||||
tle e- 140
|
|
||||||
trp e- 141
|
|
||||||
xor e2 142
|
|
||||||
xor e- 143
|
|
||||||
zer e2 144
|
|
||||||
zer e- 145
|
|
||||||
zge e2 146
|
|
||||||
zgt e2 147
|
|
||||||
zle e2 148
|
|
||||||
zlt e2 149
|
|
||||||
zne e2 150
|
|
||||||
zrf e2 151
|
|
||||||
zrf e- 152
|
|
||||||
zrl ewP2 153
|
|
||||||
dch e- 154
|
|
||||||
exg esP 1 155
|
|
||||||
exg e2 156
|
|
||||||
exg e- 157
|
|
||||||
lpb e- 158
|
|
||||||
gto e2 159
|
|
||||||
ldc 4 0
|
|
||||||
lae 4 1
|
|
||||||
lal P4 2
|
|
||||||
lal N4 3
|
|
||||||
lde w4 4
|
|
||||||
ldf 4 5
|
|
||||||
ldl wP4 6
|
|
||||||
ldl wN4 7
|
|
||||||
lil wP4 8
|
|
||||||
lil wN4 9
|
|
||||||
loc 4 10
|
|
||||||
loe w4 11
|
|
||||||
lof 4 12
|
|
||||||
lol wP4 13
|
|
||||||
lol wN4 14
|
|
||||||
lpi 4 15
|
|
||||||
adp 4 16
|
|
||||||
asp w4 17
|
|
||||||
beq 4 18
|
|
||||||
bge 4 19
|
|
||||||
bgt 4 20
|
|
||||||
ble 4 21
|
|
||||||
blm 4 22
|
|
||||||
blt 4 23
|
|
||||||
bne 4 24
|
|
||||||
bra 4 25
|
|
||||||
cal 4 26
|
|
||||||
dee w4 27
|
|
||||||
del wP4 28
|
|
||||||
del wN4 29
|
|
||||||
fil 4 30
|
|
||||||
gto 4 31
|
|
||||||
ine w4 32
|
|
||||||
inl wP4 33
|
|
||||||
inl wN4 34
|
|
||||||
lin 4 35
|
|
||||||
sde 4 36
|
|
||||||
sdf 4 37
|
|
||||||
sdl wP4 38
|
|
||||||
sdl wN4 39
|
|
||||||
sil wP4 40
|
|
||||||
sil wN4 41
|
|
||||||
ste w4 42
|
|
||||||
stf 4 43
|
|
||||||
stl wP4 44
|
|
||||||
stl wN4 45
|
|
||||||
zeq 4 46
|
|
||||||
zge 4 47
|
|
||||||
zgt 4 48
|
|
||||||
zle 4 49
|
|
||||||
zlt 4 50
|
|
||||||
zne 4 51
|
|
||||||
zre w4 52
|
|
||||||
zrl wP4 53
|
|
||||||
zrl wN4 54
|
|
||||||
@@ -29,8 +29,11 @@ install: pem
|
|||||||
cp pem $(PEM)
|
cp pem $(PEM)
|
||||||
|
|
||||||
distr:
|
distr:
|
||||||
ln pem.p pem22.p ; apc -mpdp -c.m -I$h pem22.p ; rm -f pem22.p
|
rm -f pem2[24].p
|
||||||
ln pem.p pem24.p ; apc -mvax2 -c.m -I$h pem24.p ; rm -f pem24.p
|
co -rdistr2 -p pem.p >pem22.p
|
||||||
|
apc -mpdp -c.m -I$h pem22.p ; rm -f pem22.p
|
||||||
|
co -rdistr2 -p pem.p >pem24.p
|
||||||
|
apc -mvax2 -c.m -I$h pem24.p ; rm -f pem24.p
|
||||||
clean:
|
clean:
|
||||||
-rm -f pem pem.out *.[os] *.old
|
-rm -f pem pem.out *.[os] *.old
|
||||||
|
|
||||||
|
|||||||
@@ -1,20 +0,0 @@
|
|||||||
/* A program to move the file pem??.m to pem.m */
|
|
||||||
/* Called when "apc pem.p" fails. It is assumed that the binary
|
|
||||||
file is incorrect in that case and has to be created from the compact
|
|
||||||
code file.
|
|
||||||
This program selects the correct compact code file for each combination
|
|
||||||
of word and pointer size.
|
|
||||||
It will return an error code if the move failed
|
|
||||||
*/
|
|
||||||
main(argc) {
|
|
||||||
char copy[100] ;
|
|
||||||
|
|
||||||
if ( argc!=1 ) {
|
|
||||||
printf("No arguments allowed\n") ;
|
|
||||||
exit(1) ;
|
|
||||||
}
|
|
||||||
|
|
||||||
sprintf(copy,"cp pem%d%d.m pem.m", EM_WSIZE, EM_PSIZE) ;
|
|
||||||
printf("%s\n",copy) ;
|
|
||||||
return system(copy) ;
|
|
||||||
}
|
|
||||||
3139
lang/pc/pem/pem.p
3139
lang/pc/pem/pem.p
File diff suppressed because it is too large
Load Diff
@@ -1,34 +0,0 @@
|
|||||||
# $Header$
|
|
||||||
|
|
||||||
all: testC testI
|
|
||||||
|
|
||||||
testI:
|
|
||||||
# int t1.p; em
|
|
||||||
int t2.p; em
|
|
||||||
int t3.p; em e.out f1 f2 f3 f4 f5 f6
|
|
||||||
int t4.p; em
|
|
||||||
int t5.p; em
|
|
||||||
int tstenc.p; em
|
|
||||||
int tstgto.p; em
|
|
||||||
rm -f e.out f?
|
|
||||||
|
|
||||||
testC:
|
|
||||||
apc t1.p; a.out
|
|
||||||
apc t2.p; a.out
|
|
||||||
apc t3.p; a.out f1 f2 f3 f4 f5 f6
|
|
||||||
apc t4.p; a.out
|
|
||||||
apc t5.p; a.out
|
|
||||||
apc tstenc.p; a.out
|
|
||||||
apc tstgto.p; a.out
|
|
||||||
rm -f a.out f?
|
|
||||||
|
|
||||||
install cmp:
|
|
||||||
|
|
||||||
clean:
|
|
||||||
-rm -f [ea].out f?
|
|
||||||
|
|
||||||
opr:
|
|
||||||
make pr | opr
|
|
||||||
|
|
||||||
pr:
|
|
||||||
@pr t[12345].p tstenc.p
|
|
||||||
@@ -1,226 +0,0 @@
|
|||||||
{ $Header$ }
|
|
||||||
|
|
||||||
procedure machar (var ibeta , it , irnd , ngrd , machep , negep , iexp,
|
|
||||||
minexp , maxexp : integer ; var eps , epsneg , xmin , xmax : real ) ;
|
|
||||||
var trapped:boolean;
|
|
||||||
|
|
||||||
procedure encaps(procedure p; procedure q(i:integer)); extern;
|
|
||||||
procedure trap(i:integer); extern;
|
|
||||||
|
|
||||||
procedure catch(i:integer);
|
|
||||||
const underflo=5;
|
|
||||||
begin if i=underflo then trapped:=true else trap(i) end;
|
|
||||||
|
|
||||||
procedure work;
|
|
||||||
var
|
|
||||||
|
|
||||||
|
|
||||||
{ This subroutine is intended to determine the characteristics
|
|
||||||
of the floating-point arithmetic system that are specified
|
|
||||||
below. The first three are determined according to an
|
|
||||||
algorithm due to M. Malcolm, CACM 15 (1972), pp. 949-951,
|
|
||||||
incorporating some, but not all, of the improvements
|
|
||||||
suggested by M. Gentleman and S. Marovich, CACM 17 (1974),
|
|
||||||
pp. 276-277. The version given here is for single precision.
|
|
||||||
|
|
||||||
Latest revision - October 1, 1976.
|
|
||||||
|
|
||||||
Author - W. J. Cody
|
|
||||||
Argonne National Laboratory
|
|
||||||
|
|
||||||
Revised for Pascal - R. A. Freak
|
|
||||||
University of Tasmania
|
|
||||||
Hobart
|
|
||||||
Tasmania
|
|
||||||
|
|
||||||
ibeta is the radix of the floating-point representation
|
|
||||||
it is the number of base ibeta digits in the floating-point
|
|
||||||
significand
|
|
||||||
irnd = 0 if the arithmetic chops,
|
|
||||||
1 if the arithmetic rounds
|
|
||||||
ngrd = 0 if irnd=1, or if irnd=0 and only it base ibeta
|
|
||||||
digits participate in the post normalization shift
|
|
||||||
of the floating-point significand in multiplication
|
|
||||||
1 if irnd=0 and more than it base ibeta digits
|
|
||||||
participate in the post normalization shift of the
|
|
||||||
floating-point significand in multiplication
|
|
||||||
machep is the exponent on the smallest positive floating-point
|
|
||||||
number eps such that 1.0+eps <> 1.0
|
|
||||||
negeps is the exponent on the smallest positive fl. pt. no.
|
|
||||||
negeps such that 1.0-negeps <> 1.0, except that
|
|
||||||
negeps is bounded below by it-3
|
|
||||||
iexp is the number of bits (decimal places if ibeta = 10)
|
|
||||||
reserved for the representation of the exponent of
|
|
||||||
a floating-point number
|
|
||||||
minexp is the exponent of the smallest positive fl. pt. no.
|
|
||||||
xmin
|
|
||||||
maxexp is the exponent of the largest finite floating-point
|
|
||||||
number xmax
|
|
||||||
eps is the smallest positive floating-point number such
|
|
||||||
that 1.0+eps <> 1.0. in particular,
|
|
||||||
eps = ibeta**machep
|
|
||||||
epsneg is the smallest positive floating-point number such
|
|
||||||
that 1.0-eps <> 1.0 (except that the exponent
|
|
||||||
negeps is bounded below by it-3). in particular
|
|
||||||
epsneg = ibeta**negep
|
|
||||||
xmin is the smallest positive floating-point number. in
|
|
||||||
particular, xmin = ibeta ** minexp
|
|
||||||
xmax is the largest finite floating-point number. in
|
|
||||||
particular xmax = (1.0-epsneg) * ibeta ** maxexp
|
|
||||||
note - on some machines xmax will be only the
|
|
||||||
second, or perhaps third, largest number, being
|
|
||||||
too small by 1 or 2 units in the last digit of
|
|
||||||
the significand.
|
|
||||||
|
|
||||||
}
|
|
||||||
|
|
||||||
i , iz , j , k , mx : integer ;
|
|
||||||
a , b , beta , betain , betam1 , one , y , z , zero : real ;
|
|
||||||
|
|
||||||
begin
|
|
||||||
irnd := 1 ;
|
|
||||||
one := ( irnd );
|
|
||||||
a := one + one ;
|
|
||||||
b := a ;
|
|
||||||
zero := 0.0 ;
|
|
||||||
{
|
|
||||||
determine ibeta,beta ala Malcolm
|
|
||||||
}
|
|
||||||
while ( ( ( a + one ) - a ) - one = zero ) do begin
|
|
||||||
a := a + a ;
|
|
||||||
end ;
|
|
||||||
while ( ( a + b ) - a = zero ) do begin
|
|
||||||
b := b + b ;
|
|
||||||
end ;
|
|
||||||
ibeta := trunc ( ( a + b ) - a );
|
|
||||||
beta := ( ibeta );
|
|
||||||
betam1 := beta - one ;
|
|
||||||
{
|
|
||||||
determine irnd,ngrd,it
|
|
||||||
}
|
|
||||||
if ( ( a + betam1 ) - a = zero ) then irnd := 0 ;
|
|
||||||
it := 0 ;
|
|
||||||
a := one ;
|
|
||||||
repeat begin
|
|
||||||
it := it + 1 ;
|
|
||||||
a := a * beta ;
|
|
||||||
end until ( ( ( a + one ) - a ) - one <> zero ) ;
|
|
||||||
{
|
|
||||||
determine negep, epsneg
|
|
||||||
}
|
|
||||||
negep := it + 3 ;
|
|
||||||
a := one ;
|
|
||||||
|
|
||||||
for i := 1 to negep do begin
|
|
||||||
a := a / beta ;
|
|
||||||
end ;
|
|
||||||
|
|
||||||
while ( ( one - a ) - one = zero ) do begin
|
|
||||||
a := a * beta ;
|
|
||||||
negep := negep - 1 ;
|
|
||||||
end ;
|
|
||||||
negep := - negep ;
|
|
||||||
epsneg := a ;
|
|
||||||
{
|
|
||||||
determine machep, eps
|
|
||||||
}
|
|
||||||
machep := negep ;
|
|
||||||
while ( ( one + a ) - one = zero ) do begin
|
|
||||||
a := a * beta ;
|
|
||||||
machep := machep + 1 ;
|
|
||||||
end ;
|
|
||||||
eps := a ;
|
|
||||||
{
|
|
||||||
determine ngrd
|
|
||||||
}
|
|
||||||
ngrd := 0 ;
|
|
||||||
if(( irnd = 0) and((( one + eps) * one - one) <> zero)) then
|
|
||||||
ngrd := 1 ;
|
|
||||||
{
|
|
||||||
determine iexp, minexp, xmin
|
|
||||||
|
|
||||||
loop to determine largest i such that
|
|
||||||
(1/beta) ** (2**(i))
|
|
||||||
does not underflow
|
|
||||||
exit from loop is signall by an underflow
|
|
||||||
}
|
|
||||||
i := 0 ;
|
|
||||||
betain := one / beta ;
|
|
||||||
z := betain ;
|
|
||||||
trapped:=false;
|
|
||||||
repeat begin
|
|
||||||
y := z ;
|
|
||||||
z := y * y ;
|
|
||||||
{
|
|
||||||
check for underflow
|
|
||||||
}
|
|
||||||
i := i + 1 ;
|
|
||||||
end until trapped;
|
|
||||||
i := i - 1;
|
|
||||||
k := 1 ;
|
|
||||||
{
|
|
||||||
determine k such that (1/beta)**k does not underflow
|
|
||||||
|
|
||||||
first set k = 2 ** i
|
|
||||||
}
|
|
||||||
|
|
||||||
for j := 1 to i do begin
|
|
||||||
k := k + k ;
|
|
||||||
end ;
|
|
||||||
|
|
||||||
iexp := i + 1 ;
|
|
||||||
mx := k + k ;
|
|
||||||
if ( ibeta = 10 ) then begin
|
|
||||||
{
|
|
||||||
for decimal machines only }
|
|
||||||
iexp := 2 ;
|
|
||||||
iz := ibeta ;
|
|
||||||
while ( k >= iz ) do begin
|
|
||||||
iz := iz * ibeta ;
|
|
||||||
iexp := iexp + 1 ;
|
|
||||||
end ;
|
|
||||||
mx := iz + iz - 1 ;
|
|
||||||
end;
|
|
||||||
trapped:=false;
|
|
||||||
repeat begin
|
|
||||||
{
|
|
||||||
loop to construct xmin
|
|
||||||
exit from loop is signalled by an underflow
|
|
||||||
}
|
|
||||||
xmin := y ;
|
|
||||||
y := y * betain ;
|
|
||||||
k := k + 1 ;
|
|
||||||
end until trapped;
|
|
||||||
k := k - 1;
|
|
||||||
minexp := - k ;
|
|
||||||
{ determine maxexp, xmax
|
|
||||||
}
|
|
||||||
if ( ( mx <= k + k - 3 ) and ( ibeta <> 10 ) ) then begin
|
|
||||||
mx := mx + mx ;
|
|
||||||
iexp := iexp + 1 ;
|
|
||||||
end;
|
|
||||||
maxexp := mx + minexp ;
|
|
||||||
{ adjust for machines with implicit leading
|
|
||||||
bit in binary significand and machines with
|
|
||||||
radix point at extreme right of significand
|
|
||||||
}
|
|
||||||
i := maxexp + minexp ;
|
|
||||||
if ( ( ibeta = 2 ) and ( i = 0 ) ) then maxexp := maxexp - 1 ;
|
|
||||||
if ( i > 20 ) then maxexp := maxexp - 3 ;
|
|
||||||
xmax := one - epsneg ;
|
|
||||||
if ( xmax * one <> xmax ) then xmax := one - beta * epsneg ;
|
|
||||||
xmax := ( xmax * betain * betain * betain ) / xmin ;
|
|
||||||
i := maxexp + minexp + 3 ;
|
|
||||||
if ( i > 0 ) then begin
|
|
||||||
|
|
||||||
for j := 1 to i do begin
|
|
||||||
xmax := xmax * beta ;
|
|
||||||
end ;
|
|
||||||
end;
|
|
||||||
|
|
||||||
end;
|
|
||||||
|
|
||||||
begin
|
|
||||||
trapped:=false;
|
|
||||||
encaps(work,catch);
|
|
||||||
end;
|
|
||||||
@@ -1,677 +0,0 @@
|
|||||||
#
|
|
||||||
{
|
|
||||||
(c) copyright 1983 by the Vrije Universiteit, Amsterdam, The Netherlands.
|
|
||||||
|
|
||||||
This product is part of the Amsterdam Compiler Kit.
|
|
||||||
|
|
||||||
Permission to use, sell, duplicate or disclose this software must be
|
|
||||||
obtained in writing. Requests for such permissions may be sent to
|
|
||||||
|
|
||||||
Dr. Andrew S. Tanenbaum
|
|
||||||
Wiskundig Seminarium
|
|
||||||
Vrije Universiteit
|
|
||||||
Postbox 7161
|
|
||||||
1007 MC Amsterdam
|
|
||||||
The Netherlands
|
|
||||||
|
|
||||||
}
|
|
||||||
|
|
||||||
program t1(input,output);
|
|
||||||
|
|
||||||
{ This program can be used to test out PASCAL compilers }
|
|
||||||
|
|
||||||
const
|
|
||||||
rcsversion='$Header$';
|
|
||||||
ONE=1; TWO=2; TEN=10; FIFTY=50; MINONE=-1;
|
|
||||||
#ifndef NOFLOAT
|
|
||||||
RR1=1.0; RR1H=1.5; RR2=2.0; RR3=3.0; RR4=4.0; RRMINONE=-1.0;
|
|
||||||
#endif
|
|
||||||
yes=true; no=false;
|
|
||||||
kew='q';
|
|
||||||
#ifndef NOFLOAT
|
|
||||||
eps = 2.0e-7; { This constant is machine dependent }
|
|
||||||
#endif
|
|
||||||
|
|
||||||
type wavelength = (red,blue,yellow,purple,white,gray,pink,black,fuchia,maple,
|
|
||||||
violet,darkred,darkblue,darkyellow,darkwhite,darkpink,darkblack);
|
|
||||||
ww2= 1939..1945;
|
|
||||||
#ifndef NOFLOAT
|
|
||||||
tp2= record c1:char; i,j:integer; p:boolean; x:real end;
|
|
||||||
#else
|
|
||||||
tp2= record c1:char; i,j:integer; p:boolean end;
|
|
||||||
#endif
|
|
||||||
single= array [0..0] of integer;
|
|
||||||
spectrum= set of wavelength;
|
|
||||||
np = ^node;
|
|
||||||
node = record val:integer; next: np end;
|
|
||||||
|
|
||||||
var t,pct,ect:integer;
|
|
||||||
i,j,k,l,m:integer;
|
|
||||||
#ifndef NOFLOAT
|
|
||||||
x,y,z:real;
|
|
||||||
#endif
|
|
||||||
p,q,r:boolean;
|
|
||||||
c1,c2,c3:char;
|
|
||||||
sr1,sr2,sr3: 1939..1945;
|
|
||||||
bar: packed array[0..3] of 0..255;
|
|
||||||
color,hue,tint: wavelength;
|
|
||||||
grat:spectrum;
|
|
||||||
a1: array [-10..+10] of integer;
|
|
||||||
#ifndef NOFLOAT
|
|
||||||
a2: array [ww2] of real;
|
|
||||||
#endif
|
|
||||||
a3: array[wavelength] of boolean;
|
|
||||||
a4: array[(mouse,house)] of char;
|
|
||||||
a5: array[50..52,(bat,cat),boolean,ww2] of integer;
|
|
||||||
a6: packed array[0..10,0..3,0..3] of char;
|
|
||||||
r1,r2: tp2;
|
|
||||||
#ifndef NOFLOAT
|
|
||||||
r3: packed record c1:char; i,j:integer; p:boolean; x:real end;
|
|
||||||
#else
|
|
||||||
r3: packed record c1:char; i,j:integer; p:boolean end;
|
|
||||||
#endif
|
|
||||||
colors: set of wavelength;
|
|
||||||
beasts: set of (pig,cow,chicken,farmersdaughter);
|
|
||||||
bits: set of 0..1;
|
|
||||||
p1: ^integer;
|
|
||||||
p2: ^tp2;
|
|
||||||
p3: ^single;
|
|
||||||
p4: ^spectrum;
|
|
||||||
head,tail: np;
|
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
procedure e(n:integer);
|
|
||||||
begin
|
|
||||||
ect := ect + 1;
|
|
||||||
writeln(' Error', n:3,' in test ', t)
|
|
||||||
end;
|
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
function inc(k:integer):integer; begin inc := k+1 end;
|
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
{************************************************************************}
|
|
||||||
procedure tst1;
|
|
||||||
{ Arithmetic on constants }
|
|
||||||
begin t:=1; pct := pct + 1;
|
|
||||||
if 1+1 <> 2 then e(1);
|
|
||||||
if ONE+ONE <> TWO then e(2);
|
|
||||||
if ONE+MINONE <> 0 then e(3);
|
|
||||||
if ONE-TWO <> MINONE then e(4);
|
|
||||||
if TWO-MINONE <> 3 then e(5);
|
|
||||||
if TWO*TWO <> 4 then e(6);
|
|
||||||
if 100*MINONE <> -100 then e(7);
|
|
||||||
if 50*ONE <> 50 then e(8);
|
|
||||||
if 50*9 <> 450 then e(9);
|
|
||||||
if 50*TEN <> 500 then e(10);
|
|
||||||
if 60 div TWO <> 30 then e(11);
|
|
||||||
if FIFTY div TWO <> 25 then e(12);
|
|
||||||
if -2 div 1 <> -2 then e(13);
|
|
||||||
if -3 div 1 <> -3 then e(14);
|
|
||||||
if -3 div 2 <> -1 then e(15);
|
|
||||||
if ((1+2+3) * (2+3+4) * (3+5+5)) div 2 <> ((3 * ((5+3+2)*10)+51)*6) div 6
|
|
||||||
then e(16);
|
|
||||||
if (1000*2 + 5*7 + 13) div 8 <> 2*2*2*2*4*4 then e(17);
|
|
||||||
if (1 * 2 * 3 * 4 * 5 * 6 * 7) div 5040 <>
|
|
||||||
5040 div 7 div 6 div 5 div 4 div 3 div 2 then e(18);
|
|
||||||
if -(-(-(-(-(-(-(-(-(1))))))))) <> -1 then e(19);
|
|
||||||
if -1 -1 -1 -1 -1 <> -5 then e(20);
|
|
||||||
if - 1 <> -(((((((((((((1))))))))))))) then e(21);
|
|
||||||
if -4 * (-5) <> 20 then e(22);
|
|
||||||
if (9999-8) mod 97 <> 309 mod 3 then e(23);
|
|
||||||
if 2<1 then e(24);
|
|
||||||
if 2 <= 1 then e(25);
|
|
||||||
if 2 = 3 then e(26);
|
|
||||||
if 2 <> 2 then e(27);
|
|
||||||
if 2 >= 3 then e(28);
|
|
||||||
if 2 > 3 then e(29);
|
|
||||||
if 2+0 <> 2 then e(30);
|
|
||||||
if 2-0 <> 2 then e(31);
|
|
||||||
if 2*0 <> 0 then e(32);
|
|
||||||
if 0+2 <> 2 then e(33);
|
|
||||||
if 0-2 <> -2 then e(34);
|
|
||||||
if 0*2 <> 0 then e(35);
|
|
||||||
if 0 div 1 <> 0 then e(36);
|
|
||||||
if -0 <> 0 then e(37);
|
|
||||||
if 0 - 0 <> 0 then e(38);
|
|
||||||
if 0 * 0 <> 0 then e(39);
|
|
||||||
end;
|
|
||||||
|
|
||||||
{************************************************************************}
|
|
||||||
procedure tst2;
|
|
||||||
{ Arithmetic on global integer variables }
|
|
||||||
begin t:=2; pct := pct + 1;
|
|
||||||
i:=1; j:=2; k:=3; l:=4; m:=10;
|
|
||||||
if i+j <> k then e(1);
|
|
||||||
if i+k <> l then e(2);
|
|
||||||
if j-k <> -i then e(3);
|
|
||||||
if j*(j+k) <> m then e(4);
|
|
||||||
if -m <> -(k+k+l) then e(5);
|
|
||||||
if i div i <> 1 then e(6);
|
|
||||||
if m*m div m <> m then e(7);
|
|
||||||
if 10*m <> 100 then e(8);
|
|
||||||
if m*(-10) <> -100 then e(9);
|
|
||||||
if j div k <> 0 then e(10);
|
|
||||||
if 100 div k <> 33 then e(11);
|
|
||||||
if i+j*k+l+m mod j + 50 div k <> 27 then e(12);
|
|
||||||
if j*k*m div 6 <> 10 then e(13);
|
|
||||||
if (k>4) or (k>=4) or (k=4) then e(14);
|
|
||||||
if (m<j) or (m<=j) or (m=j) then e(15);
|
|
||||||
if k <> i+j then e(16);
|
|
||||||
if j < i then e(17);
|
|
||||||
if j <= i then e(18);
|
|
||||||
if j = i then e(19);
|
|
||||||
if j <> j then e(20);
|
|
||||||
if i >= j then e(21);
|
|
||||||
if i > j then e(22);
|
|
||||||
end;
|
|
||||||
|
|
||||||
#ifndef NOFLOAT
|
|
||||||
|
|
||||||
{************************************************************************}
|
|
||||||
procedure tst3;
|
|
||||||
{ Real arithmetic }
|
|
||||||
begin t:=3; pct := pct + 1;
|
|
||||||
if abs(1.0+1.0-2.0) > eps then e(1);
|
|
||||||
if abs(1e10-1e10) > eps then e(2);
|
|
||||||
if abs(RR1+RR1H+RR2+RR3+RR4+RRMINONE-10.5) > eps then e(3);
|
|
||||||
if abs(1.0e-1 * 1.0e1 - 100e-2) > eps then e(4);
|
|
||||||
if abs(10.0/3.0*3.0/10.0-100e-2) > eps then e(5);
|
|
||||||
if 0.0e0 <> 0 then e(6);
|
|
||||||
if abs(32767.0-32767.0) > eps then e(7);
|
|
||||||
if abs(1.0+2+5+3.0e0+5.0e+0+140e-1-30.000)/100 > eps then e(8);
|
|
||||||
if abs(-1+(-1)+(-1.0)+(-1e0)+(-1e+0)+(-1e-0) + ((((6)))) ) > eps then e(9);
|
|
||||||
|
|
||||||
x:=1.50; y:=3.00; z:= 0.10;
|
|
||||||
if abs(5*y*z-x) > eps then e(10);
|
|
||||||
if abs(y*y*y/z*x-405) > eps then e(11);
|
|
||||||
x:=1.1; y:= 1.2;
|
|
||||||
if y<x then e(12);
|
|
||||||
if y <= x then e(13);
|
|
||||||
if y = x then e(14);
|
|
||||||
if x <> x then e(15);
|
|
||||||
if x >= y then e(16);
|
|
||||||
if x >y then e(17);
|
|
||||||
end;
|
|
||||||
|
|
||||||
#endif
|
|
||||||
|
|
||||||
|
|
||||||
{************************************************************************}
|
|
||||||
procedure tst4;
|
|
||||||
{ Boolean expressions }
|
|
||||||
begin t:=4; pct := pct + 1;
|
|
||||||
if not yes = true then e(1);
|
|
||||||
if not no = false then e(2);
|
|
||||||
if yes = no then e(3);
|
|
||||||
if not true = not false then e(4);
|
|
||||||
if true and false then e(5);
|
|
||||||
if false or false then e(6);
|
|
||||||
|
|
||||||
p:=true; q:=true; r:=false;
|
|
||||||
if not p then e(7);
|
|
||||||
if r then e(8);
|
|
||||||
if p and r then e(9);
|
|
||||||
if p and not q then e(10);
|
|
||||||
if not p or not q then e(11);
|
|
||||||
if (p and r) or (q and r) then e(12);
|
|
||||||
if p and q and r then e(13);
|
|
||||||
if (p or q) = r then e(14);
|
|
||||||
end;
|
|
||||||
|
|
||||||
{************************************************************************}
|
|
||||||
procedure tst5;
|
|
||||||
{ Characters, Subranges, Enumerated types }
|
|
||||||
begin t:=5; pct := pct + 1;
|
|
||||||
if 'q' <> kew then e(1);
|
|
||||||
c1 := 'a'; c2 := 'b'; c3 := 'a';
|
|
||||||
if c1 = c2 then e(2);
|
|
||||||
if c1 <> c3 then e(3);
|
|
||||||
|
|
||||||
sr1:=1939; sr2:=1945; sr3:=1939;
|
|
||||||
if sr1=sr2 then e(4);
|
|
||||||
if sr1<>sr3 then e(5);
|
|
||||||
|
|
||||||
color := yellow; hue := blue; tint := yellow;
|
|
||||||
if color = hue then e(6);
|
|
||||||
if color <> tint then e(7);
|
|
||||||
end;
|
|
||||||
|
|
||||||
|
|
||||||
{************************************************************************}
|
|
||||||
procedure tst6;
|
|
||||||
{ Global arrays }
|
|
||||||
var i,j,k:integer;
|
|
||||||
begin t:=6; pct := pct + 1;
|
|
||||||
for i:= -10 to 10 do a1[i] := i*i;
|
|
||||||
if (a1[-10]<>100) or (a1[9]<>81) then e(1);
|
|
||||||
|
|
||||||
#ifndef NOFLOAT
|
|
||||||
for i:=1939 to 1945 do a2[i]:=i-1938.5;
|
|
||||||
if (abs(a2[1939]-0.5) > eps) or (abs(a2[1945]-6.5) > eps) then e(2);
|
|
||||||
#endif
|
|
||||||
|
|
||||||
color := yellow;
|
|
||||||
a3[blue] := true; a3[yellow] := true;
|
|
||||||
if (a3[blue]<>true) or (a3[yellow]<>true) then e(3);
|
|
||||||
a3[blue] := false; a3[yellow] := false;
|
|
||||||
if (a3[blue]<>false) or (a3[yellow]<>false) then e(4);
|
|
||||||
|
|
||||||
a4[mouse]:='m'; a4[house]:='h';
|
|
||||||
if (a4[mouse] <> 'm') or (a4[house]<>'h' ) then e(5);
|
|
||||||
|
|
||||||
for i:=1939 to 1945 do a5[51,bat,false,i]:=300+i;
|
|
||||||
if a5[51,bat,false,1940] <> 2240 then e(6);
|
|
||||||
for i:=50 to 52 do a5[i,cat,true,1943]:=200+i;
|
|
||||||
if (a5[50,cat,true,1943] <> 250) or (a5[52,cat,true,1943] <> 252) then e(7);
|
|
||||||
|
|
||||||
for i:= -10 to 10 do a1[i]:= 0;
|
|
||||||
for i:= 0 to 10 do a1[i div 2 + i div 2]:= i+1;
|
|
||||||
if(a1[0]<>2) or (a1[5]<>0) or (a1[8]<>10) then e(8);
|
|
||||||
|
|
||||||
for i:= 0 to 10 do
|
|
||||||
for j:= 0 to 3 do
|
|
||||||
for k:= 0 to 3 do
|
|
||||||
if ( (i+j+k) div 2) * 2 = i+j+k then a6[i,j,k]:='e' else a6[i,j,k]:='o';
|
|
||||||
if (a6[2,2,2]<>'e') or (a6[2,2,3]<>'o') or (a6[0,3,1]<>'e') then e(9);
|
|
||||||
end;
|
|
||||||
|
|
||||||
|
|
||||||
#ifndef NOFLOAT
|
|
||||||
|
|
||||||
{************************************************************************}
|
|
||||||
procedure tst7;
|
|
||||||
{ Global records }
|
|
||||||
begin t:=7; pct := pct + 1;
|
|
||||||
r1.c1:='x'; r1.i:=40; r1.j:=50; r1.p:=true; r1.x:=3.0;
|
|
||||||
c1:='a'; i:=0; j:=0; p:=false; x:=100.0;
|
|
||||||
if (r1.c1<>'x') or (r1.i<>40) or (r1.p<>true) or (r1.x<>3.0) then e(1);
|
|
||||||
r2:=r1;
|
|
||||||
if (r2.c1<>'x') or (r2.i<>40) or (r2.p<>true) or (r2.x<>3.0) then e(2);
|
|
||||||
i:=r1.i; p:=r1.p; c1:=r1.c1; x:=r1.x;
|
|
||||||
if (c1<>'x') or (i<>40) or (p<>true) or (x<>3.0) then e(3);
|
|
||||||
r3.c1:='x'; r3.i:=40; r3.j:=50; r3.p:=true; r3.x:=3.0;
|
|
||||||
if (r3.c1<>'x') or (r3.i<>40) or (r3.p<>true) or (r3.x<>3.0) then e(4);
|
|
||||||
end;
|
|
||||||
|
|
||||||
#else
|
|
||||||
|
|
||||||
{************************************************************************}
|
|
||||||
procedure tst7;
|
|
||||||
{ Global records }
|
|
||||||
begin t:=7; pct := pct + 1;
|
|
||||||
r1.c1:='x'; r1.i:=40; r1.j:=50; r1.p:=true;
|
|
||||||
c1:='a'; i:=0; j:=0; p:=false;
|
|
||||||
if (r1.c1<>'x') or (r1.i<>40) or (r1.p<>true) then e(1);
|
|
||||||
r2:=r1;
|
|
||||||
if (r2.c1<>'x') or (r2.i<>40) or (r2.p<>true) then e(2);
|
|
||||||
i:=r1.i; p:=r1.p; c1:=r1.c1;
|
|
||||||
if (c1<>'x') or (i<>40) or (p<>true) then e(3);
|
|
||||||
r3.c1:='x'; r3.i:=40; r3.j:=50; r3.p:=true;
|
|
||||||
if (r3.c1<>'x') or (r3.i<>40) or (r3.p<>true) then e(4);
|
|
||||||
end;
|
|
||||||
|
|
||||||
#endif
|
|
||||||
|
|
||||||
|
|
||||||
{************************************************************************}
|
|
||||||
procedure tst8;
|
|
||||||
{ Global sets }
|
|
||||||
begin t:=8; pct := pct + 1;
|
|
||||||
colors := [];
|
|
||||||
colors := colors + [];
|
|
||||||
if colors <> [] then e(1);
|
|
||||||
colors := colors + [red];
|
|
||||||
if colors <> [red] then e(2);
|
|
||||||
colors := colors + [blue];
|
|
||||||
if colors <> [red,blue] then e(3);
|
|
||||||
if colors <> [blue,red] then e(4);
|
|
||||||
colors := colors - [red];
|
|
||||||
if colors <> [blue] then e(5);
|
|
||||||
beasts := [chicken] + [chicken,pig];
|
|
||||||
if beasts <> [pig,chicken] then e(6);
|
|
||||||
beasts := [] - [farmersdaughter] + [cow] - [cow];
|
|
||||||
if beasts <> [] then e(7);
|
|
||||||
bits := [0] + [1] - [0];
|
|
||||||
if bits <> [1] then e(8);
|
|
||||||
bits := [] + [] + [] -[] + [0] + [] + [] - [0];
|
|
||||||
if bits <> [] then e(9);
|
|
||||||
if not ([] <= [red]) then e(10);
|
|
||||||
if [red] >= [blue] then e(11);
|
|
||||||
if [red] <= [blue] then e(12);
|
|
||||||
if [red] = [blue] then e(13);
|
|
||||||
if not ([red] <= [red,blue]) then e(14);
|
|
||||||
if not ([red,blue] <= [red,yellow,blue]) then e(15);
|
|
||||||
if not ([blue,yellow] >= [blue] + [yellow]) then e(16);
|
|
||||||
grat := [ red,blue,yellow,purple,white,gray,pink,black,fuchia,maple,
|
|
||||||
violet,darkred,darkblue,darkyellow,darkwhite,darkpink,darkblack];
|
|
||||||
if grat<>[red,blue,yellow,purple,white,gray,pink,black,fuchia,maple,violet,
|
|
||||||
darkred,darkblue,darkyellow,darkwhite,darkpink,darkblack] then e(17);
|
|
||||||
if not ([10] <= [10]) then e(18);
|
|
||||||
end;
|
|
||||||
|
|
||||||
|
|
||||||
{************************************************************************}
|
|
||||||
procedure tst9;
|
|
||||||
{ Global pointers }
|
|
||||||
begin t:=9; pct := pct + 1;
|
|
||||||
new(p1); new(p2); new(p3); new(p4);
|
|
||||||
p1^ := 1066;
|
|
||||||
if p1^ <> 1066 then e(1);
|
|
||||||
p2^.i := 1215;
|
|
||||||
if p2^.i <> 1215 then e(2);
|
|
||||||
p3^[0]:= 1566;
|
|
||||||
if p3^[0] <> 1566 then e(3);
|
|
||||||
p4^ := [red];
|
|
||||||
if p4^ <> [red] then e(4);
|
|
||||||
end;
|
|
||||||
|
|
||||||
|
|
||||||
{************************************************************************}
|
|
||||||
procedure tst10;
|
|
||||||
{ More global pointers }
|
|
||||||
var i:integer;
|
|
||||||
begin t:=10; pct := pct + 1;
|
|
||||||
head := nil;
|
|
||||||
for i:= 1 to 100 do
|
|
||||||
begin new(tail); tail^.val:=100+i; tail^.next :=head; head:= tail end;
|
|
||||||
if (tail^.val<>200) or (tail^.next^.val<>199) then e(1);
|
|
||||||
if tail^.next^.next^.next^.next^.next^.next^.next^.next^.val<> 192 then e(2);
|
|
||||||
tail^.next^.next^.next^.val := 30;
|
|
||||||
if tail^.next^.next^.next^.val <> 30 then e(3);
|
|
||||||
end;
|
|
||||||
|
|
||||||
|
|
||||||
{************************************************************************}
|
|
||||||
procedure tst11;
|
|
||||||
{ Arithmetic on local integer variables }
|
|
||||||
var i,j,k,l,m:integer;
|
|
||||||
begin t:=11; pct := pct + 1;
|
|
||||||
i:=1; j:=2; k:=3; l:=4; m:=10;
|
|
||||||
if i+j <> k then e(1);
|
|
||||||
if i+k <> l then e(2);
|
|
||||||
if j-k <> -i then e(3);
|
|
||||||
if j*(j+k) <> m then e(4);
|
|
||||||
if -m <> -(k+k+l) then e(5);
|
|
||||||
if i div i <> 1 then e(6);
|
|
||||||
if m*m div m <> m then e(7);
|
|
||||||
if 10*m <> 100 then e(8);
|
|
||||||
if m*(-10) <> -100 then e(9);
|
|
||||||
if j div k <> 0 then e(10);
|
|
||||||
if 100 div k <> 33 then e(11);
|
|
||||||
if i+j*k+l+m mod j + 50 div k <> 27 then e(12);
|
|
||||||
if j*k*m div 6 <> 10 then e(13);
|
|
||||||
if (k>4) or (k>=4) or (k=4) then e(14);
|
|
||||||
if (m<j) or (m<=j) or (m=j) then e(15);
|
|
||||||
if k <> i+j then e(16);
|
|
||||||
end;
|
|
||||||
|
|
||||||
#ifndef NOFLOAT
|
|
||||||
|
|
||||||
{************************************************************************}
|
|
||||||
procedure tst12;
|
|
||||||
{ Real arithmetic on locals }
|
|
||||||
var x,y,z:real;
|
|
||||||
begin t:=12; pct := pct + 1;
|
|
||||||
|
|
||||||
x:=1.50; y:=3.00; z:= 0.10;
|
|
||||||
if abs(5*y*z-x) > eps then e(10);
|
|
||||||
if abs(y*y*y/z*x-405) > eps then e(11);
|
|
||||||
x:=1.1; y:= 1.2;
|
|
||||||
if y<x then e(12);
|
|
||||||
if y <= x then e(13);
|
|
||||||
if y = x then e(14);
|
|
||||||
if x <> x then e(15);
|
|
||||||
if x >= y then e(16);
|
|
||||||
if x >y then e(17);
|
|
||||||
end;
|
|
||||||
|
|
||||||
#endif
|
|
||||||
|
|
||||||
|
|
||||||
{************************************************************************}
|
|
||||||
procedure tst13;
|
|
||||||
{ Boolean expressions using locals }
|
|
||||||
var pp,qq,rr:boolean;
|
|
||||||
begin t:=13; pct := pct + 1;
|
|
||||||
if not yes = true then e(1);
|
|
||||||
if not no = false then e(2);
|
|
||||||
if yes = no then e(3);
|
|
||||||
if not true = not false then e(4);
|
|
||||||
if true and false then e(5);
|
|
||||||
if false or false then e(6);
|
|
||||||
|
|
||||||
pp:=true; qq:=true; rr:=false;
|
|
||||||
if not pp then e(7);
|
|
||||||
if rr then e(8);
|
|
||||||
if pp and rr then e(9);
|
|
||||||
if pp and not qq then e(10);
|
|
||||||
if not pp or not qq then e(11);
|
|
||||||
if (pp and rr) or (qq and rr) then e(12);
|
|
||||||
if pp and qq and rr then e(13);
|
|
||||||
if (pp or qq) = rr then e(14);
|
|
||||||
end;
|
|
||||||
|
|
||||||
{************************************************************************}
|
|
||||||
procedure tst14;
|
|
||||||
{ Characters, Subranges, Enumerated types using locals }
|
|
||||||
var cc1,cc2,cc3:char;
|
|
||||||
sr1,sr2,sr3: 1939..1945;
|
|
||||||
color,hue,tint: (ochre,magenta);
|
|
||||||
begin t:=14; pct := pct + 1;
|
|
||||||
if 'q' <> kew then e(1);
|
|
||||||
cc1 := 'a'; cc2 := 'b'; cc3 := 'a';
|
|
||||||
if cc1 = cc2 then e(2);
|
|
||||||
if cc1 <> cc3 then e(3);
|
|
||||||
|
|
||||||
sr1:=1939; sr2:=1945; sr3:=1939;
|
|
||||||
if sr1=sr2 then e(4);
|
|
||||||
if sr1<>sr3 then e(5);
|
|
||||||
bar[0]:=200; bar[1]:=255; bar[2]:=255; bar[3]:=203;
|
|
||||||
if (bar[0]<>200) or (bar[1]<>255) or (bar[2]<>255) or (bar[3]<>203) then e(6);
|
|
||||||
|
|
||||||
color := ochre; hue:=magenta; tint := ochre;
|
|
||||||
if color = hue then e(7);
|
|
||||||
if color <> tint then e(8);
|
|
||||||
end;
|
|
||||||
|
|
||||||
|
|
||||||
{************************************************************************}
|
|
||||||
procedure tst15;
|
|
||||||
{ Local arrays }
|
|
||||||
type colour = (magenta,ochre);
|
|
||||||
var aa1: array [-10..+10] of integer;
|
|
||||||
#ifndef NOFLOAT
|
|
||||||
aa2: array [ww2] of real;
|
|
||||||
#endif
|
|
||||||
aa3: array[colour] of boolean;
|
|
||||||
aa4: array[(mouse,house,louse)] of char;
|
|
||||||
aa5: array[50..52,(bat,cat),boolean,ww2] of integer;
|
|
||||||
aa6: packed array[0..10,0..3,0..3] of char;
|
|
||||||
i,j,k:integer;
|
|
||||||
begin t:=15; pct := pct + 1;
|
|
||||||
for i:= -10 to 10 do aa1[i] := i*i;
|
|
||||||
if (aa1[-10]<>100) or (aa1[9]<>81) then e(1);
|
|
||||||
|
|
||||||
#ifndef NOFLOAT
|
|
||||||
for i:=1939 to 1945 do aa2[i]:=i-1938.5;
|
|
||||||
if (abs(aa2[1939]-0.5) > eps) or (abs(aa2[1945]-6.5) > eps) then e(2);
|
|
||||||
#endif
|
|
||||||
|
|
||||||
aa3[magenta] := true; aa3[ochre] := true;
|
|
||||||
if (aa3[magenta]<>true) or (aa3[ochre]<>true) then e(3);
|
|
||||||
aa3[magenta] := false; aa3[ochre] := false;
|
|
||||||
if (aa3[magenta]<>false) or (aa3[ochre]<>false) then e(4);
|
|
||||||
|
|
||||||
aa4[mouse]:='m'; aa4[house]:='h'; aa4[louse]:='l';
|
|
||||||
if (aa4[mouse] <> 'm') or (aa4[house]<>'h' ) or (aa4[louse]<>'l') then e(5);
|
|
||||||
|
|
||||||
for i:=1939 to 1945 do aa5[51,bat,false,i]:=300+i;
|
|
||||||
if aa5[51,bat,false,1940] <> 2240 then e(6);
|
|
||||||
for i:=50 to 52 do aa5[i,cat,true,1943]:=200+i;
|
|
||||||
if (aa5[50,cat,true,1943] <> 250) or (aa5[52,cat,true,1943] <> 252) then e(7);
|
|
||||||
|
|
||||||
for i:= -10 to 10 do aa1[i]:= 0;
|
|
||||||
for i:= 0 to 10 do aa1[i div 2 + i div 2]:= i+1;
|
|
||||||
if(aa1[0]<>2) or (aa1[5]<>0) or (aa1[8]<>10) then e(8);
|
|
||||||
|
|
||||||
for i:= 0 to 10 do
|
|
||||||
for j:= 0 to 3 do
|
|
||||||
for k:= 0 to 3 do
|
|
||||||
if ( (i+j+k) div 2) * 2 = i+j+k then aa6[i,j,k]:='e' else aa6[i,j,k]:='o';
|
|
||||||
if (aa6[2,2,2]<>'e') or (aa6[2,2,3]<>'o') or (aa6[0,3,1]<>'e') then e(9);
|
|
||||||
end;
|
|
||||||
|
|
||||||
|
|
||||||
#ifndef NOFLOAT
|
|
||||||
|
|
||||||
{************************************************************************}
|
|
||||||
procedure tst16;
|
|
||||||
{ Local records }
|
|
||||||
var r1,r2: tp2;
|
|
||||||
r3: packed record c1:char; i,j:integer; p:boolean; x:real end;
|
|
||||||
begin t:=16; pct := pct + 1;
|
|
||||||
r1.c1:='x'; r1.i:=40; r1.j:=50; r1.p:=true; r1.x:=3.0;
|
|
||||||
c1:='a'; i:=0; j:=0; p:=false; x:=100.0;
|
|
||||||
if (r1.c1<>'x') or (r1.i<>40) or (r1.p<>true) or (r1.x<>3.0) then e(1);
|
|
||||||
r2:=r1;
|
|
||||||
if (r2.c1<>'x') or (r2.i<>40) or (r2.p<>true) or (r2.x<>3.0) then e(2);
|
|
||||||
i:=r1.i; p:=r1.p; c1:=r1.c1; x:=r1.x;
|
|
||||||
if (c1<>'x') or (i<>40) or (p<>true) or (x<>3.0) then e(3);
|
|
||||||
r3.c1:='x'; r3.i:=40; r3.j:=50; r3.p:=true; r3.x:=3.0;
|
|
||||||
if (r3.c1<>'x') or (r3.i<>40) or (r3.p<>true) or (r3.x<>3.0) then e(4);
|
|
||||||
end;
|
|
||||||
|
|
||||||
#else
|
|
||||||
{************************************************************************}
|
|
||||||
procedure tst16;
|
|
||||||
{ Local records }
|
|
||||||
var r1,r2: tp2;
|
|
||||||
r3: packed record c1:char; i,j:integer; p:boolean end;
|
|
||||||
begin t:=16; pct := pct + 1;
|
|
||||||
r1.c1:='x'; r1.i:=40; r1.j:=50; r1.p:=true;
|
|
||||||
c1:='a'; i:=0; j:=0; p:=false;
|
|
||||||
if (r1.c1<>'x') or (r1.i<>40) or (r1.p<>true) then e(1);
|
|
||||||
r2:=r1;
|
|
||||||
if (r2.c1<>'x') or (r2.i<>40) or (r2.p<>true) then e(2);
|
|
||||||
i:=r1.i; p:=r1.p; c1:=r1.c1;
|
|
||||||
if (c1<>'x') or (i<>40) or (p<>true) then e(3);
|
|
||||||
r3.c1:='x'; r3.i:=40; r3.j:=50; r3.p:=true;
|
|
||||||
if (r3.c1<>'x') or (r3.i<>40) or (r3.p<>true) then e(4);
|
|
||||||
end;
|
|
||||||
|
|
||||||
#endif
|
|
||||||
|
|
||||||
{************************************************************************}
|
|
||||||
procedure tst17;
|
|
||||||
{ Local sets }
|
|
||||||
var colors: set of (pink,green,orange,red);
|
|
||||||
beasts: set of (pig,cow,chicken,farmersdaughter);
|
|
||||||
bits: set of 0..1;
|
|
||||||
begin t:=17; pct := pct + 1;
|
|
||||||
colors := [];
|
|
||||||
colors := colors + [];
|
|
||||||
if colors <> [] then e(1);
|
|
||||||
colors := colors + [pink];
|
|
||||||
if colors <> [pink] then e(2);
|
|
||||||
colors := colors + [green];
|
|
||||||
if colors <> [pink,green] then e(3);
|
|
||||||
if colors <> [green,pink] then e(4);
|
|
||||||
colors := colors - [pink,orange];
|
|
||||||
if colors <> [green] then e(5);
|
|
||||||
beasts := [chicken] + [chicken,pig];
|
|
||||||
if beasts <> [pig,chicken] then e(6);
|
|
||||||
beasts := [] - [farmersdaughter] + [cow] - [cow];
|
|
||||||
if beasts <> [] then e(7);
|
|
||||||
bits := [0] + [1] - [0];
|
|
||||||
if bits <> [1] then e(8);
|
|
||||||
bits := [] + [] + [] + [0] + [] + [0];
|
|
||||||
if bits <> [0] then e(9);
|
|
||||||
if ord(red) <> 3 then e(10);
|
|
||||||
end;
|
|
||||||
|
|
||||||
|
|
||||||
{************************************************************************}
|
|
||||||
procedure tst18;
|
|
||||||
{ Local pointers }
|
|
||||||
type rainbow = set of (pink,purple,chartreuse);
|
|
||||||
var p1: ^integer;
|
|
||||||
p2: ^tp2;
|
|
||||||
p3: ^single;
|
|
||||||
p4: ^rainbow;
|
|
||||||
begin t:=18; pct := pct + 1;
|
|
||||||
new(p1); new(p2); new(p3); new(p4);
|
|
||||||
p1^ := 1066;
|
|
||||||
if p1^ <> 1066 then e(1);
|
|
||||||
p2^.i := 1215;
|
|
||||||
if p2^.i <> 1215 then e(2);
|
|
||||||
p3^[0]:= 1566;
|
|
||||||
if p3^[0] <> 1566 then e(3);
|
|
||||||
p4^ := [pink] + [purple] + [purple,chartreuse] - [purple];
|
|
||||||
if p4^ <> [pink,chartreuse] then e(4);
|
|
||||||
end;
|
|
||||||
|
|
||||||
|
|
||||||
{************************************************************************}
|
|
||||||
procedure tst19;
|
|
||||||
var head,tail: np; i:integer;
|
|
||||||
begin t:=19; pct := pct + 1;
|
|
||||||
head := nil;
|
|
||||||
for i:= 1 to 100 do
|
|
||||||
begin new(tail); tail^.val:=100+i; tail^.next :=head; head:= tail end;
|
|
||||||
if (tail^.val<>200) or (tail^.next^.val<>199) then e(1);
|
|
||||||
if tail^.next^.next^.next^.next^.next^.next^.next^.next^.val<> 192 then e(2);
|
|
||||||
tail^.next^.next^.next^.val := 30;
|
|
||||||
if tail^.next^.next^.next^.val <> 30 then e(3);
|
|
||||||
end;
|
|
||||||
|
|
||||||
#ifndef NOFLOAT
|
|
||||||
|
|
||||||
{************************************************************************}
|
|
||||||
procedure tst20;
|
|
||||||
{ Mixed local and global }
|
|
||||||
var li:integer;
|
|
||||||
lx:real;
|
|
||||||
begin t:=20; pct := pct + 1;
|
|
||||||
li:=6; i:=li; if i<>6 then e(1);
|
|
||||||
i:=6; li:=i; if li <> 6 then e(2);
|
|
||||||
lx := 3.5; x:=lx; if x <> 3.5 then e(3);
|
|
||||||
x:= 4.5; lx:= x; if lx <> 4.5 then e(4);
|
|
||||||
end;
|
|
||||||
|
|
||||||
#else
|
|
||||||
{************************************************************************}
|
|
||||||
procedure tst20;
|
|
||||||
{ Mixed local and global }
|
|
||||||
var li:integer;
|
|
||||||
begin t:=20; pct := pct + 1;
|
|
||||||
li:=6; i:=li; if i<>6 then e(1);
|
|
||||||
i:=6; li:=i; if li <> 6 then e(2);
|
|
||||||
end;
|
|
||||||
|
|
||||||
#endif
|
|
||||||
|
|
||||||
|
|
||||||
{************************************************************************}
|
|
||||||
|
|
||||||
{ Main Program }
|
|
||||||
begin ect := 0; pct := 0;
|
|
||||||
#ifndef NOFLOAT
|
|
||||||
tst1; tst2; tst3; tst4; tst5; tst6; tst7; tst8;
|
|
||||||
tst9; tst10; tst11; tst12; tst13; tst14; tst15; tst16;
|
|
||||||
tst17; tst18; tst19; tst20;
|
|
||||||
|
|
||||||
#else
|
|
||||||
|
|
||||||
tst1; tst2; tst4; tst5; tst6; tst7; tst8;
|
|
||||||
tst9; tst10; tst11; tst13; tst14; tst15; tst16;
|
|
||||||
tst17; tst18; tst19; tst20;
|
|
||||||
|
|
||||||
#endif
|
|
||||||
write('Program t1:',pct:3,' tests completed.');
|
|
||||||
writeln('Number of errors = ',ect:0);
|
|
||||||
end.
|
|
||||||
@@ -1,739 +0,0 @@
|
|||||||
#
|
|
||||||
{
|
|
||||||
(c) copyright 1983 by the Vrije Universiteit, Amsterdam, The Netherlands.
|
|
||||||
|
|
||||||
This product is part of the Amsterdam Compiler Kit.
|
|
||||||
|
|
||||||
Permission to use, sell, duplicate or disclose this software must be
|
|
||||||
obtained in writing. Requests for such permissions may be sent to
|
|
||||||
|
|
||||||
Dr. Andrew S. Tanenbaum
|
|
||||||
Wiskundig Seminarium
|
|
||||||
Vrije Universiteit
|
|
||||||
Postbox 7161
|
|
||||||
1007 MC Amsterdam
|
|
||||||
The Netherlands
|
|
||||||
|
|
||||||
}
|
|
||||||
program t2(input,output);
|
|
||||||
|
|
||||||
{ This program can be used to test out PASCAL compilers }
|
|
||||||
|
|
||||||
const
|
|
||||||
rcsversion='$Header$';
|
|
||||||
kew='q';
|
|
||||||
#ifndef NOFLOAT
|
|
||||||
eps = 2.0e-7; { This constant is machine dependent }
|
|
||||||
#endif
|
|
||||||
|
|
||||||
type wavelength = (red,blue,yellow);
|
|
||||||
tp2= record c1:char; i,j:integer; p:boolean; x:real end;
|
|
||||||
single= array [0..0] of integer;
|
|
||||||
spectrum= set of wavelength;
|
|
||||||
np= ^node;
|
|
||||||
node = record val:integer; next: np end;
|
|
||||||
|
|
||||||
var t,pct,ect:integer;
|
|
||||||
i,j,k,l:integer;
|
|
||||||
#ifndef NOFLOAT
|
|
||||||
w,x,y,z:real;
|
|
||||||
#endif
|
|
||||||
p:boolean;
|
|
||||||
d:char;
|
|
||||||
color: wavelength;
|
|
||||||
head: np;
|
|
||||||
|
|
||||||
|
|
||||||
function twice(k:integer):integer; begin twice := 2*k end;
|
|
||||||
function inc(k:integer):integer; begin inc := k+1 end;
|
|
||||||
|
|
||||||
procedure e(n:integer);
|
|
||||||
begin
|
|
||||||
ect := ect + 1;
|
|
||||||
writeln(' Error', n:3,' in test ', t)
|
|
||||||
end;
|
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
{************************************************************************}
|
|
||||||
procedure tst21;
|
|
||||||
{ Test things packed }
|
|
||||||
var i:integer; c:char;
|
|
||||||
r1: packed record c:char; b:boolean; i:integer end;
|
|
||||||
r2: packed record c:char; i:integer; b:boolean; j:integer end;
|
|
||||||
#ifndef NOFLOAT
|
|
||||||
r3: packed record c:char; r:real end;
|
|
||||||
#else
|
|
||||||
r3: packed record c:char end;
|
|
||||||
#endif
|
|
||||||
r4: packed record i:0..10; j:integer end;
|
|
||||||
r5: packed record x:array[1..3] of char; i:integer end;
|
|
||||||
r6: packed record x: packed array[1..3] of char; i:integer end;
|
|
||||||
r7: packed record c:char; x:packed array[1..3] of char end;
|
|
||||||
r8: packed record c:char; x:packed array[1..3] of integer end;
|
|
||||||
r9: record x:packed record c:char; i:integer end; i:integer; c:char end;
|
|
||||||
r10:packed record a:0..100; b:0..100; c:char; d:char end;
|
|
||||||
|
|
||||||
a1: packed array[1..3] of char;
|
|
||||||
a2: packed array[1..3] of integer;
|
|
||||||
#ifndef NOFLOAT
|
|
||||||
a3: packed array[1..7] of real;
|
|
||||||
#endif
|
|
||||||
a4: packed array[1..7] of array[1..11] of char;
|
|
||||||
a5: packed array[1..5] of array[1..11] of integer;
|
|
||||||
a6: packed array[1..9] of packed array[1..11] of char;
|
|
||||||
a7: packed array[1..3] of packed array[1..5] of integer;
|
|
||||||
begin t:=21; pct := pct + 1;
|
|
||||||
#ifndef NOFLOAT
|
|
||||||
i:=4; x:=3.5; c:='x'; p:=true;
|
|
||||||
#else
|
|
||||||
i:=4; c:='x'; p:=true;
|
|
||||||
#endif
|
|
||||||
|
|
||||||
r1.c:='a'; r1.b:=true; r1.i:=i; p:=r1.b; j:=r1.i;
|
|
||||||
r2.c:=c; r2.i:=i; r2.b:=p; r2.j:=i; j:=r2.i; j:=r2.j;
|
|
||||||
#ifndef NOFLOAT
|
|
||||||
r3.c:=c; r3.r:=x; y:=r3.r;
|
|
||||||
#else
|
|
||||||
r3.c:=c;
|
|
||||||
#endif
|
|
||||||
r4.i:=i; r4.j:=i; j:=r4.i; j:=r4.j;
|
|
||||||
r5.x[i-2]:=c; r5.i:=i; j:=r5.i;
|
|
||||||
r6.x[i-1]:=c; r6.i:=i; j:=r6.i;
|
|
||||||
r7.c:=c; r7.x[i-1]:=c; d:=r7.c; d:=r7.x[i-1];
|
|
||||||
r8.c:=c; r8.x[i-1]:=5; j:=r8.x[i-1];
|
|
||||||
r9.x.c:=c; r9.x.i:=i; r9.c:=c; j:=r9.x.i;
|
|
||||||
|
|
||||||
if (r1.c <> 'a') or (r1.b <> true) or (r1.i <> 4) then e(1);
|
|
||||||
if (r2.c<>'x') or (r2.i<>4) or (r2.b<>p) or (r2.j<>4) then e(2);
|
|
||||||
#ifndef NOFLOAT
|
|
||||||
if (r3.c<>'x') or (r3.r<>3.5) then e(3);
|
|
||||||
#else
|
|
||||||
if (r3.c<>'x') then e(3);
|
|
||||||
#endif
|
|
||||||
if (r4.i<>4) or (r4.j<>4) then e(4);
|
|
||||||
if (r5.x[2]<>'x') or (r5.i<>4) then e(5);
|
|
||||||
if (r6.x[3]<>'x') or (r6.i<>4) then e(6);
|
|
||||||
if (r7.c<>'x') or (r7.x[3]<>'x') or (c<>d) then e(7);
|
|
||||||
if (r8.c<>'x') or (r8.x[3]<>5) then e(8);
|
|
||||||
if (r9.x.c<>'x') or (r9.x.i<>4) or (r9.c<>'x') then e(9);
|
|
||||||
|
|
||||||
#ifndef NOFLOAT
|
|
||||||
i:=4; a1[i-1]:=c; a2[i-1]:=i; a3[i]:=x;
|
|
||||||
#else
|
|
||||||
i:=4; a1[i-1]:=c; a2[i-1]:=i;
|
|
||||||
#endif
|
|
||||||
a4[i][i+1]:=c;
|
|
||||||
a5[i][i+1]:=i; j:=a5[i][i+1];
|
|
||||||
a6[i][i+1]:=c;
|
|
||||||
a7[i-1][i+1]:=i; j:=a7[i-1][i+1];
|
|
||||||
|
|
||||||
if a1[i-1] <> 'x' then e(10);
|
|
||||||
if a2[i-1] <> 4 then e(11);
|
|
||||||
#ifndef NOFLOAT
|
|
||||||
if a3[i] <> 3.5 then e(12);
|
|
||||||
#endif
|
|
||||||
if a4[i][i+1] <> 'x' then e(13);
|
|
||||||
if a5[i][i+1] <> 4 then e(14);
|
|
||||||
if a6[i][i+1] <> 'x' then e(15);
|
|
||||||
if a7[i-1][i+1] <> 4 then e(16);
|
|
||||||
|
|
||||||
i:=75; c:='s';
|
|
||||||
r10.a:=i; r10.b:=i+1; r10.c:='x'; r10.d:=c;
|
|
||||||
if (r10.a<>i) or (r10.b<>76) or (r10.c<>'x') or (r10.d<>'s') then e(17);
|
|
||||||
i:=r10.a; if i<>75 then e(18);
|
|
||||||
i:=r10.b; if i<>76 then e(19);
|
|
||||||
c:=r10.c; if c<>'x'then e(20);
|
|
||||||
c:=r10.d; if c<>'s'then e(21);
|
|
||||||
end;
|
|
||||||
|
|
||||||
|
|
||||||
{************************************************************************}
|
|
||||||
procedure tst22;
|
|
||||||
{ References to intermediate lexical levels }
|
|
||||||
type wavelength = (pink,green,orange);
|
|
||||||
ww2= 1939..1945;
|
|
||||||
#ifndef NOFLOAT
|
|
||||||
tp2= record c1:char; i,j:integer; p:boolean; x:real end;
|
|
||||||
#else
|
|
||||||
tp2= record c1:char; i,j:integer; p:boolean end;
|
|
||||||
#endif
|
|
||||||
single= array [0..0] of integer;
|
|
||||||
spectrum= set of wavelength;
|
|
||||||
pnode = ^node;
|
|
||||||
node = record val:integer; next: pnode end;
|
|
||||||
vec1 = array[-10..+10] of integer;
|
|
||||||
|
|
||||||
var j,k,m:integer;
|
|
||||||
#ifndef NOFLOAT
|
|
||||||
x,y,z:real;
|
|
||||||
#endif
|
|
||||||
p,q,r:boolean;
|
|
||||||
c1,c2,c3:char;
|
|
||||||
sr1,sr2,sr3: 1939..1945;
|
|
||||||
color,hue,tint: wavelength;
|
|
||||||
a1: vec1;
|
|
||||||
#ifndef NOFLOAT
|
|
||||||
a2: array [ww2] of real;
|
|
||||||
#endif
|
|
||||||
a3: array[wavelength] of boolean;
|
|
||||||
a4: array[(mouse,house)] of char;
|
|
||||||
a5: array[50..52,(bat,cat,rat),boolean,ww2] of integer;
|
|
||||||
a6: packed array[0..10,0..3,0..3] of char;
|
|
||||||
r1,r2: tp2;
|
|
||||||
#ifndef NOFLOAT
|
|
||||||
r3: packed record c1:char; i,j:integer; p:boolean; x:real end;
|
|
||||||
#else
|
|
||||||
r3: packed record c1:char; i,j:integer; p:boolean end;
|
|
||||||
#endif
|
|
||||||
colors: spectrum;
|
|
||||||
beasts: set of (pig,chicken,farmersdaughter);
|
|
||||||
bits: set of 0..1;
|
|
||||||
p1: ^integer;
|
|
||||||
p2: ^tp2;
|
|
||||||
p3: ^single;
|
|
||||||
p4: ^spectrum;
|
|
||||||
tail: np;
|
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
procedure tst2201;
|
|
||||||
{ Arithmetic on intermediate level integer variables }
|
|
||||||
begin t:=2201; pct := pct + 1;
|
|
||||||
i:=1; j:=2; k:=3; l:=4; m:=10;
|
|
||||||
if i+j <> k then e(1);
|
|
||||||
if i+k <> l then e(2);
|
|
||||||
if j-k <> -i then e(3);
|
|
||||||
if j*(j+k) <> m then e(4);
|
|
||||||
if -m <> -(k+k+l) then e(5);
|
|
||||||
if i div i <> 1 then e(6);
|
|
||||||
if m*m div m <> m then e(7);
|
|
||||||
if 10*m <> 100 then e(8);
|
|
||||||
if m*(-10) <> -100 then e(9);
|
|
||||||
if j div k <> 0 then e(10);
|
|
||||||
if 100 div k <> 33 then e(11);
|
|
||||||
if i+j*k+l+m mod j + 50 div k <> 27 then e(12);
|
|
||||||
if j*k*m div 6 <> 10 then e(13);
|
|
||||||
if (k>4) or (k>=4) or (k=4) then e(14);
|
|
||||||
if (m<j) or (m<=j) or (m=j) then e(15);
|
|
||||||
if k <> i+j then e(16);
|
|
||||||
end;
|
|
||||||
|
|
||||||
#ifndef NOFLOAT
|
|
||||||
|
|
||||||
procedure tst2202;
|
|
||||||
{ Real arithmetic using intermediate level variables }
|
|
||||||
begin t:=2202; pct := pct + 1;
|
|
||||||
|
|
||||||
x:=1.50; y:=3.00; z:= 0.10;
|
|
||||||
if abs(5*y*z-x) > eps then e(10);
|
|
||||||
if abs(y*y*y/z*x-405) > eps then e(11);
|
|
||||||
x:=1.1; y:= 1.2;
|
|
||||||
if y<x then e(12);
|
|
||||||
if y <= x then e(13);
|
|
||||||
if y = x then e(14);
|
|
||||||
if x <> x then e(15);
|
|
||||||
if x >= y then e(16);
|
|
||||||
if x >y then e(17);
|
|
||||||
end;
|
|
||||||
|
|
||||||
#endif
|
|
||||||
procedure tst2203;
|
|
||||||
{ Boolean expressions using intermediate level varibales }
|
|
||||||
begin t:=2203; pct := pct + 1;
|
|
||||||
p:=true; q:=true; r:=false;
|
|
||||||
if not p then e(7);
|
|
||||||
if r then e(8);
|
|
||||||
if p and r then e(9);
|
|
||||||
if p and not q then e(10);
|
|
||||||
if not p or not q then e(11);
|
|
||||||
if (p and r) or (q and r) then e(12);
|
|
||||||
if p and q and r then e(13);
|
|
||||||
if (p or q) = r then e(14);
|
|
||||||
end;
|
|
||||||
|
|
||||||
procedure tst2204;
|
|
||||||
{ Characters, Subranges, Enumerated types using intermediate level vars }
|
|
||||||
begin t:=2204; pct := pct + 1;
|
|
||||||
if 'q' <> kew then e(1);
|
|
||||||
c1 := 'a'; c2 := 'b'; c3 := 'a';
|
|
||||||
if c1 = c2 then e(2);
|
|
||||||
if c1 <> c3 then e(3);
|
|
||||||
|
|
||||||
sr1:=1939; sr2:=1945; sr3:=1939;
|
|
||||||
if sr1=sr2 then e(4);
|
|
||||||
if sr1<>sr3 then e(5);
|
|
||||||
|
|
||||||
color := orange; hue := green; tint := orange;
|
|
||||||
if color = hue then e(6);
|
|
||||||
if color <> tint then e(7);
|
|
||||||
end;
|
|
||||||
|
|
||||||
|
|
||||||
procedure tst2205;
|
|
||||||
{ Intermediate level arrays }
|
|
||||||
var i,l,o:integer;
|
|
||||||
begin t:=2205; pct := pct + 1;
|
|
||||||
for i:= -10 to 10 do a1[i] := i*i;
|
|
||||||
if (a1[-10]<>100) or (a1[9]<>81) then e(1);
|
|
||||||
|
|
||||||
#ifndef NOFLOAT
|
|
||||||
for i:=1939 to 1945 do a2[i]:=i-1938.5;
|
|
||||||
if (abs(a2[1939]-0.5) > eps) or (abs(a2[1945]-6.5) > eps) then e(2);
|
|
||||||
#endif
|
|
||||||
|
|
||||||
color := orange;
|
|
||||||
a3[green] := true; a3[orange] := true;
|
|
||||||
if (a3[green]<>true) or (a3[orange]<>true) then e(3);
|
|
||||||
a3[green] := false; a3[orange] := false;
|
|
||||||
if (a3[green]<>false) or (a3[orange]<>false) then e(4);
|
|
||||||
|
|
||||||
a4[mouse]:='m'; a4[house]:='h';
|
|
||||||
if (a4[mouse] <> 'm') or (a4[house]<>'h' ) then e(5);
|
|
||||||
|
|
||||||
for i:=1939 to 1945 do a5[51,bat,false,i]:=300+i;
|
|
||||||
if a5[51,bat,false,1940] <> 2240 then e(6);
|
|
||||||
for i:=50 to 52 do a5[i,cat,true,1943]:=200+i;
|
|
||||||
if (a5[50,cat,true,1943] <> 250) or (a5[52,cat,true,1943] <> 252) then e(7);
|
|
||||||
|
|
||||||
for i:= -10 to 10 do a1[i]:= 0;
|
|
||||||
for i:= 0 to 10 do a1[i div 2 + i div 2]:= i+1;
|
|
||||||
if(a1[0]<>2) or (a1[5]<>0) or (a1[8]<>10) then e(8);
|
|
||||||
|
|
||||||
for i:= 0 to 10 do
|
|
||||||
for l:= 0 to 3 do
|
|
||||||
for o:= 0 to 3 do
|
|
||||||
if ( (i+l+o) div 2) * 2 = i+l+o then a6[i,l,o]:='e' else a6[i,l,o]:='o';
|
|
||||||
if (a6[2,2,2]<>'e') or (a6[2,2,3]<>'o') or (a6[0,3,1]<>'e') then e(9);
|
|
||||||
end;
|
|
||||||
|
|
||||||
#ifndef NOFLOAT
|
|
||||||
|
|
||||||
procedure tst2206;
|
|
||||||
{ Intermediate level records }
|
|
||||||
begin t:=2206; pct := pct + 1;
|
|
||||||
r1.c1:='x'; r1.i:=40; r1.j:=50; r1.p:=true; r1.x:=3.0;
|
|
||||||
c1:='a'; i:=0; j:=0; p:=false; x:=100.0;
|
|
||||||
if (r1.c1<>'x') or (r1.i<>40) or (r1.p<>true) or (r1.x<>3.0) then e(1);
|
|
||||||
r2:=r1;
|
|
||||||
if (r2.c1<>'x') or (r2.i<>40) or (r2.p<>true) or (r2.x<>3.0) then e(2);
|
|
||||||
i:=r1.i; p:=r1.p; c1:=r1.c1; x:=r1.x;
|
|
||||||
if (c1<>'x') or (i<>40) or (p<>true) or (x<>3.0) then e(3);
|
|
||||||
r3.c1:='x'; r3.i:=40; r3.j:=50; r3.p:=true; r3.x:=3.0;
|
|
||||||
if (r3.c1<>'x') or (r3.i<>40) or (r3.p<>true) or (r3.x<>3.0) then e(4);
|
|
||||||
end;
|
|
||||||
|
|
||||||
#else
|
|
||||||
|
|
||||||
procedure tst2206;
|
|
||||||
{ Intermediate level records }
|
|
||||||
begin t:=2206; pct := pct + 1;
|
|
||||||
r1.c1:='x'; r1.i:=40; r1.j:=50; r1.p:=true;
|
|
||||||
c1:='a'; i:=0; j:=0; p:=false;
|
|
||||||
if (r1.c1<>'x') or (r1.i<>40) or (r1.p<>true) then e(1);
|
|
||||||
r2:=r1;
|
|
||||||
if (r2.c1<>'x') or (r2.i<>40) or (r2.p<>true) then e(2);
|
|
||||||
i:=r1.i; p:=r1.p; c1:=r1.c1;
|
|
||||||
if (c1<>'x') or (i<>40) or (p<>true) then e(3);
|
|
||||||
r3.c1:='x'; r3.i:=40; r3.j:=50; r3.p:=true;
|
|
||||||
if (r3.c1<>'x') or (r3.i<>40) or (r3.p<>true) then e(4);
|
|
||||||
end;
|
|
||||||
|
|
||||||
#endif
|
|
||||||
procedure tst2207;
|
|
||||||
{ Intermediate level sets }
|
|
||||||
begin t:=2207; pct := pct + 1;
|
|
||||||
colors := [];
|
|
||||||
colors := colors + [];
|
|
||||||
if colors <> [] then e(1);
|
|
||||||
colors := colors + [pink];
|
|
||||||
if colors <> [pink] then e(2);
|
|
||||||
colors := colors + [green];
|
|
||||||
if colors <> [pink,green] then e(3);
|
|
||||||
if colors <> [green,pink] then e(4);
|
|
||||||
colors := colors - [pink];
|
|
||||||
if colors <> [green] then e(5);
|
|
||||||
beasts := [chicken] + [chicken,pig];
|
|
||||||
if beasts <> [pig,chicken] then e(6);
|
|
||||||
beasts := [] - [farmersdaughter];
|
|
||||||
if beasts <> [] then e(7);
|
|
||||||
bits := [0] + [1] - [0];
|
|
||||||
if bits <> [1] then e(8);
|
|
||||||
end;
|
|
||||||
|
|
||||||
|
|
||||||
procedure tst2208;
|
|
||||||
{ Pointers }
|
|
||||||
begin t:=2208; pct := pct + 1;
|
|
||||||
new(p1); new(p2); new(p3); new(p4);
|
|
||||||
p1^ := 1066;
|
|
||||||
if p1^ <> 1066 then e(1);
|
|
||||||
p2^.i := 1215;
|
|
||||||
if p2^.i <> 1215 then e(2);
|
|
||||||
p3^[0]:= 1566;
|
|
||||||
if p3^[0] <> 1566 then e(3);
|
|
||||||
p4^ := [pink];
|
|
||||||
if p4^ <> [pink] then e(4);
|
|
||||||
end;
|
|
||||||
|
|
||||||
|
|
||||||
procedure tst2209;
|
|
||||||
var i:integer;
|
|
||||||
begin t:=2209; pct := pct + 1;
|
|
||||||
head := nil;
|
|
||||||
for i:= 1 to 100 do
|
|
||||||
begin new(tail); tail^.val:=100+i; tail^.next :=head; head:= tail end;
|
|
||||||
if (tail^.val<>200) or (tail^.next^.val<>199) then e(1);
|
|
||||||
if tail^.next^.next^.next^.next^.next^.next^.next^.next^.val<> 192 then e(2);
|
|
||||||
tail^.next^.next^.next^.val := 30;
|
|
||||||
if tail^.next^.next^.next^.val <> 30 then e(3);
|
|
||||||
end;
|
|
||||||
begin t:=22; pct:=pct+1;
|
|
||||||
#ifndef NOFLOAT
|
|
||||||
tst2201; tst2202; tst2203; tst2204; tst2205; tst2206;
|
|
||||||
#else
|
|
||||||
tst2201; tst2203; tst2204; tst2205; tst2206;
|
|
||||||
#endif
|
|
||||||
tst2207; tst2208; tst2209;
|
|
||||||
end;
|
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
{************************************************************************}
|
|
||||||
procedure tst25;
|
|
||||||
{ Statement sequencing }
|
|
||||||
label 0,1,2,3;
|
|
||||||
procedure tst2501;
|
|
||||||
begin t:=2501;
|
|
||||||
goto 0;
|
|
||||||
e(1);
|
|
||||||
end;
|
|
||||||
begin t:=25; pct:=pct+1;
|
|
||||||
tst2501;
|
|
||||||
e(1);
|
|
||||||
0:
|
|
||||||
;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;
|
|
||||||
;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;
|
|
||||||
;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;
|
|
||||||
;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;
|
|
||||||
;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;
|
|
||||||
i:=0;
|
|
||||||
1: if i>10 then goto 3 else goto 2;
|
|
||||||
e(2);
|
|
||||||
2: i:=i+1; goto 1;
|
|
||||||
e(3);
|
|
||||||
3:
|
|
||||||
end;
|
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
{************************************************************************}
|
|
||||||
procedure tst26;
|
|
||||||
{ More data structures }
|
|
||||||
type x = array[1..5] of integer;
|
|
||||||
ta = array [1..5] of array [1..5] of x;
|
|
||||||
tb = array [1..5] of record p1: ^x; p2: ^x end;
|
|
||||||
tr = record c: record b: record a: integer end end end ;
|
|
||||||
|
|
||||||
var low,i,j,k:integer; a:ta; b:tb; r:tr; hi:integer;
|
|
||||||
|
|
||||||
procedure tst2601(w:ta; x:tb; y:tr);
|
|
||||||
var i,j,k: integer;
|
|
||||||
begin t:=2601; pct:=pct+1;
|
|
||||||
for i:= 1 to 5 do for j:= 1 to 5 do for k:=1 to 5 do
|
|
||||||
if w[i][j][k] <> i*i + 7*j + k then e(1);
|
|
||||||
if (x[1].p1^[1] <> -9) or (x[2].p2^[4]<> -39) then e(2);
|
|
||||||
if y.c.b.a <> 102 then e(3);
|
|
||||||
end;
|
|
||||||
|
|
||||||
begin t:=26; pct:=pct+1;
|
|
||||||
low := 1000; hi := 1001;
|
|
||||||
for i:= 1 to 5 do for j:=1 to 5 do for k:= 1 to 5 do a[i][j][k] :=i*i+7*j+k;
|
|
||||||
new(b[1].p1); new(b[2].p2);
|
|
||||||
b[1].p1^[1] := -9; b[2].p2^[4] := -39;
|
|
||||||
r.c.b.a := 102;
|
|
||||||
tst2601(a,b,r);
|
|
||||||
t:=26;
|
|
||||||
if(low <> 1000) or (hi <> 1001) then e(1);
|
|
||||||
end;
|
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
{************************************************************************}
|
|
||||||
procedure tst27;
|
|
||||||
{ Assignments }
|
|
||||||
begin t:=27; pct := pct+1;
|
|
||||||
i:=3; j:=2; k:= -100;
|
|
||||||
l:= 1+(i*(j+(i*(j+(i*(j+(i*(3+j*(i*1+j*2)))))))));
|
|
||||||
if l <> 1456 then e(1);
|
|
||||||
l:= ((((((((((((((((((((((((((((((((0))))))))))))))))))))))))))))))));
|
|
||||||
if l <> 0 then e(2);
|
|
||||||
l:=(((i*j)+(3*i)-5) div 10)*(((i*j)+(3*i)-5) div 10)*(((i*j)+(3*i)-5) div 10)
|
|
||||||
+ (((i*j)+(3*i)-5) div 10)*(((i*j)+(3*i)-5) div 10)*(((i*j)+(3*i)-5) div 10);
|
|
||||||
if l <> 2 then e(3);
|
|
||||||
|
|
||||||
l:=((j+j) div 4) * ((j+j) div 4) * ((j+j) div 4)* (j div 3 + j div 4 + 3)+
|
|
||||||
((j+j) div 4) * ((j+j) div 4) * ((j+j) div 4)* (j div 3 + j div 4 + 3);
|
|
||||||
if l <> 6 then e(4);
|
|
||||||
i:=j*j*j*j*j*j*j*j*j*j*j*j*j*j - 16383;
|
|
||||||
if i <>1 then e(5);
|
|
||||||
l:=(i+(i+(i+(i+(i+(i+(i+(i+(i+(i+(i+(i+(i+(i+(i+(i))))))))))))))));
|
|
||||||
if l <> 16 then e(6);
|
|
||||||
l:= (((((((((((((((((j)+j)+j)+j)+j)+j)+j)+j)+j)+j)+j)+j)+j)+j)+j)+j)+j);
|
|
||||||
if l <> 34 then e(7);
|
|
||||||
l:= (-(-(-(-(-(-(-(-(-(j))))))))));
|
|
||||||
if l <> -2 then e(8);
|
|
||||||
|
|
||||||
#ifndef NOFLOAT
|
|
||||||
x:= 0.1; y:=0.2; z:=0.3;
|
|
||||||
w:=(((((x+y)/z)*2.0)+(((x+y)/z)*2.0)+(((x+y)/z)*2.0)+(((x+y)/z)*2.0))*
|
|
||||||
((((x+y)/z)*2.0)+(((x+y)/z)*2.0)+(((x+y)/z)*2.0)+(((x+y)/z)*2.0))*
|
|
||||||
((((x+y)/z)*2.0)+(((x+y)/z)*2.0)+(((x+y)/z)*2.0)+(((x+y)/z)*2.0))*
|
|
||||||
((((x+y)/z)*2.0)+(((x+y)/z)*2.0)+(((x+y)/z)*2.0)+(((x+y)/z)*2.0))*
|
|
||||||
((((x+y)/z)*2.0)+(((x+y)/z)*2.0)+(((x+y)/z)*2.0)+(((x+y)/z)*2.0)))-1;
|
|
||||||
if abs(w-32767) > 0.0001 then e(9);
|
|
||||||
|
|
||||||
i:= trunc(100*y+0.5); if i <> 20 then e(10);
|
|
||||||
i:= 32767; w:=i; if w <> 32767 then e(11);
|
|
||||||
#endif
|
|
||||||
end;
|
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
{************************************************************************}
|
|
||||||
procedure tst28;
|
|
||||||
{ Calls }
|
|
||||||
var i:integer;
|
|
||||||
function ack(m,n:integer):integer;
|
|
||||||
begin if m=0
|
|
||||||
then ack := n+1
|
|
||||||
else if n=0
|
|
||||||
then ack := ack(m-1,1)
|
|
||||||
else ack := ack(m-1,ack(m,n-1))
|
|
||||||
end;
|
|
||||||
|
|
||||||
procedure fib(a:integer; var b:integer); { Fibonacci nrs }
|
|
||||||
var i,j:integer;
|
|
||||||
begin
|
|
||||||
if (a=1) or (a=2) then b:=1 else
|
|
||||||
begin fib(a-1,i); fib(a-2,j); b:=i+j end
|
|
||||||
end;
|
|
||||||
|
|
||||||
begin t:=28; pct:= pct+1;
|
|
||||||
if ack(2,2) <> 7 then e(1);
|
|
||||||
if ack(3,3) <> 61 then e(2);
|
|
||||||
if ack(3,5) <> 253 then e(3);
|
|
||||||
if ack(2,100) <> 203 then e(4);
|
|
||||||
fib(10,i); if i <> 55 then e(5);
|
|
||||||
fib(20,i); if i <> 6765 then e(6);
|
|
||||||
end;
|
|
||||||
|
|
||||||
|
|
||||||
{************************************************************************}
|
|
||||||
procedure tst29;
|
|
||||||
{ Loops }
|
|
||||||
var i,l:integer; p:boolean;
|
|
||||||
begin t:= 29; pct:=pct+1;
|
|
||||||
j:=5;
|
|
||||||
k:=0; for i:=1 to j do k:=k+1; if k<>5 then e(1);
|
|
||||||
k:=0; for i:=5 to j do k:=k+1; if k<>1 then e(2);
|
|
||||||
k:=0; for i:=6 to j do k:=k+1; if k<>0 then e(3);
|
|
||||||
k:=0; for i:=-1 downto -j do k:=k+1; if k<>5 then e(4);
|
|
||||||
k:=0; for i:=-5 downto -j do k:=k+1; if k<>1 then e(5);
|
|
||||||
k:=0; for i:=-6 downto j do k:=k+1; if k<>0 then e(6);
|
|
||||||
k:=0; for i:=1 downto 10 do k:=k+1; if k<>0 then e(7);
|
|
||||||
|
|
||||||
k:=0; for l:=1 to j do k:=k+1; if k<>5 then e(8);
|
|
||||||
k:=0; for l:=5 to j do k:=k+1; if k<>1 then e(9);
|
|
||||||
k:=0; for l:=6 to j do k:=k+1; if k<>0 then e(10);
|
|
||||||
k:=0; for l:=-1 downto -j do k:=k+1; if k<>5 then e(11);
|
|
||||||
k:=0; for l:=-5 downto -j do k:=k+1; if k<>1 then e(12);
|
|
||||||
k:=0; for l:=-6 downto j do k:=k+1; if k<>0 then e(13);
|
|
||||||
k:=0; for l:=1 downto 10 do k:=k+1; if k<>0 then e(14);
|
|
||||||
k:=0; for p:= true downto false do k:=k+1; if k<>2 then e(15);
|
|
||||||
k:=0; for p:= false to true do k:=k+1; if k<>2 then e(16);
|
|
||||||
|
|
||||||
k:=0; while k<0 do k:=k+1; if k<>0 then e(17);
|
|
||||||
k:=0; repeat k:=k+1; until k>0; if k<> 1 then e(18);
|
|
||||||
k:=0; repeat k:=k+1; until k > 15; if k <> 16 then e(18);
|
|
||||||
k:=0; while k<=10 do k:=k+1; if k<> 11 then e(19);
|
|
||||||
end;
|
|
||||||
|
|
||||||
{************************************************************************}
|
|
||||||
procedure tst30;
|
|
||||||
{ case statements }
|
|
||||||
begin t:=30; pct:=pct+1;
|
|
||||||
i:=3; k:=0;
|
|
||||||
case i*i-7 of
|
|
||||||
0: k:=0; 1: k:=0; 2: k:=1; 3,4: k:=0
|
|
||||||
end;
|
|
||||||
if k<>1 then e(1);
|
|
||||||
|
|
||||||
color := red; k:=0;
|
|
||||||
case color of
|
|
||||||
red: k:=1; blue: k:=0; yellow: k:=0
|
|
||||||
end;
|
|
||||||
if k<>1 then e(2);
|
|
||||||
|
|
||||||
k:=0;
|
|
||||||
case color of
|
|
||||||
red,blue: k:=1; yellow: k:=0
|
|
||||||
end;
|
|
||||||
if k<>1 then e(3);
|
|
||||||
end;
|
|
||||||
#ifndef NOFLOAT
|
|
||||||
|
|
||||||
{************************************************************************}
|
|
||||||
procedure tst31;
|
|
||||||
{ with statements }
|
|
||||||
var ra: record i:integer; x:real; p:tp2; q:single;
|
|
||||||
a2: record a3: tp2 end
|
|
||||||
end;
|
|
||||||
rb: record j: integer; y:real; pp:tp2; qq:single end;
|
|
||||||
begin t:=31; pct:=pct+1;
|
|
||||||
i:=0; x:=0;
|
|
||||||
ra.i:=-3006; ra.x:=-6000.23; ra.q[0]:=35; ra.p.i:=20;
|
|
||||||
with ra do
|
|
||||||
begin if (i<>-3006) or (x<>-6000.23) or (q[0]<>35)
|
|
||||||
or (p.i<>20) then e(2);
|
|
||||||
|
|
||||||
i:=300; x:= 200.5; q[0]:=35; p.i:=-10
|
|
||||||
end;
|
|
||||||
if (ra.i<>300) or (ra.x<>200.5) or (ra.q[0]<>35) or (ra.p.i<>-10) then e(3);
|
|
||||||
with ra.p do if i <> -10 then e(4);
|
|
||||||
|
|
||||||
i:= -23;
|
|
||||||
ra.a2.a3.i := -909;
|
|
||||||
with ra do if a2.a3.i <> -909 then e(5);
|
|
||||||
with ra.a2 do if a3.i <> -909 then e(6);
|
|
||||||
with ra.a2.a3 do if i <> -909 then e(7);
|
|
||||||
with ra.a2 do i:=5;
|
|
||||||
if (i<>5) or (ra.a2.a3.i <> -909) then e(8);
|
|
||||||
with ra.a2.a3 do i:= 6;
|
|
||||||
if i<>5 then e(9);
|
|
||||||
if ra.a2.a3.i <> 6 then e(10);
|
|
||||||
|
|
||||||
with ra,rb do
|
|
||||||
begin x:=3.5; y:=6.5; i:=3; j:=9 end;
|
|
||||||
if (ra.x<>3.5) or (rb.y<>6.5) or (ra.i<>3) or (rb.j<>9) then e(11);
|
|
||||||
end;
|
|
||||||
|
|
||||||
#else
|
|
||||||
|
|
||||||
{************************************************************************}
|
|
||||||
procedure tst31;
|
|
||||||
{ with statements }
|
|
||||||
var ra: record i:integer; p:tp2; q:single;
|
|
||||||
a2: record a3: tp2 end
|
|
||||||
end;
|
|
||||||
rb: record j: integer; pp:tp2; qq:single end;
|
|
||||||
begin t:=31; pct:=pct+1;
|
|
||||||
#ifndef NOFLOAT
|
|
||||||
i:=0; x:=0;
|
|
||||||
#else
|
|
||||||
i:=0;
|
|
||||||
#endif
|
|
||||||
ra.i:=-3006; ra.q[0]:=35; ra.p.i:=20;
|
|
||||||
with ra do
|
|
||||||
begin if (i<>-3006) or (q[0]<>35)
|
|
||||||
or (p.i<>20) then e(2);
|
|
||||||
|
|
||||||
i:=300; q[0]:=35; p.i:=-10
|
|
||||||
end;
|
|
||||||
if (ra.i<>300) or (ra.q[0]<>35) or (ra.p.i<>-10) then e(3);
|
|
||||||
with ra.p do if i <> -10 then e(4);
|
|
||||||
|
|
||||||
i:= -23;
|
|
||||||
ra.a2.a3.i := -909;
|
|
||||||
with ra do if a2.a3.i <> -909 then e(5);
|
|
||||||
with ra.a2 do if a3.i <> -909 then e(6);
|
|
||||||
with ra.a2.a3 do if i <> -909 then e(7);
|
|
||||||
with ra.a2 do i:=5;
|
|
||||||
if (i<>5) or (ra.a2.a3.i <> -909) then e(8);
|
|
||||||
with ra.a2.a3 do i:= 6;
|
|
||||||
if i<>5 then e(9);
|
|
||||||
if ra.a2.a3.i <> 6 then e(10);
|
|
||||||
|
|
||||||
with ra,rb do
|
|
||||||
begin i:=3; j:=9 end;
|
|
||||||
if (ra.i<>3) or (rb.j<>9) then e(11);
|
|
||||||
end;
|
|
||||||
|
|
||||||
|
|
||||||
#endif
|
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
{************************************************************************}
|
|
||||||
procedure tst32;
|
|
||||||
{ Standard procedures }
|
|
||||||
begin t:=32; pct:=pct+1;
|
|
||||||
if abs(-1) <> 1 then e(1);
|
|
||||||
i:= -5; if abs(i) <> 5 then e(2);
|
|
||||||
#ifndef NOFLOAT
|
|
||||||
x:=-2.0; if abs(x) <> 2.0 then e(3);
|
|
||||||
#endif
|
|
||||||
if odd(5) = false then e(4);
|
|
||||||
if odd(4) then e(5);
|
|
||||||
if sqr(i) <> 25 then e(6);
|
|
||||||
if succ(i) <> -4 then e(7);
|
|
||||||
if succ(red) <> blue then e(8);
|
|
||||||
if pred(blue) <> red then e(9);
|
|
||||||
if ord(red) <> 0 then e(10);
|
|
||||||
if ord(succ(succ(red))) <> 2 then e(11);
|
|
||||||
if chr(ord(chr(ord(chr(ord('u')))))) <> 'u' then e(12);
|
|
||||||
if ord(chr(ord(chr(ord(chr(50)))))) <> 50 then e(13);
|
|
||||||
#ifndef NOFLOAT
|
|
||||||
if abs(trunc(5.2)-5.0) > eps then e(14);
|
|
||||||
if abs(sin(3.1415926536)) > 10*eps then e(15);
|
|
||||||
if abs(exp(1.0)-2.7182818) > 0.0001 then e(16);
|
|
||||||
if abs(ln(exp(1.0))- 1.0) > 3*eps then e(17);
|
|
||||||
if abs(sqrt(25.0)-5.0) > eps then e(18);
|
|
||||||
if abs(arctan(1.0) - 3.1415926535/4.0) > 0.0001 then e(19);
|
|
||||||
if abs(ln(arctan(1)*4) - 1.144729886) > 0.000001 then e(20);
|
|
||||||
if abs(sin(1) - 0.841470985 ) > 0.000001 then e(21);
|
|
||||||
if abs(cos(1) - 0.540302306) > 0.000001 then e(22);
|
|
||||||
if abs(sqrt(2) - 1.4142135623) > 0.000001 then e(23);
|
|
||||||
if abs(sqrt(10) - 3.1622776601) > 0.000001 then e(24);
|
|
||||||
if abs(sqrt(1000.0) - 31.622776602) > 0.00001 then e(25);
|
|
||||||
#endif
|
|
||||||
end;
|
|
||||||
|
|
||||||
|
|
||||||
{***************************************************************************}
|
|
||||||
procedure tst33;
|
|
||||||
{ Functions }
|
|
||||||
var i,j,k,l,m: integer;
|
|
||||||
begin t:=33; pct := pct+1;
|
|
||||||
i:=1; j:=2; k:=3; l:=4; m:=10;
|
|
||||||
if twice(k) <> m-l then e(1);
|
|
||||||
if twice(1) <> 2 then e(2);
|
|
||||||
if twice(k+1) <> twice(l) then e(3);
|
|
||||||
if twice(twice(twice(inc(twice(inc(3)))))) <> 72 then e(4);
|
|
||||||
if twice(inc(j+twice(inc(twice(i+1+inc(k)+inc(k))+twice(2)))))<>106
|
|
||||||
then e(5);
|
|
||||||
if twice(1) + twice(2) * twice(3) <> 26 then e(6);
|
|
||||||
if 3 <> 0 + twice(1) + 1 then e(7);
|
|
||||||
if 0 <> 0 * twice(m) then e(8);
|
|
||||||
end;
|
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
{**********************************************************************}
|
|
||||||
|
|
||||||
{ Main Program }
|
|
||||||
begin ect := 0; pct := 0;
|
|
||||||
tst21; tst22; tst25; tst26; tst27; tst28; tst29; tst30; tst31; tst32; tst33;
|
|
||||||
|
|
||||||
write('Program t2:',pct:3,' tests completed.');
|
|
||||||
writeln('Number of errors = ',ect:0);
|
|
||||||
end.
|
|
||||||
@@ -1,333 +0,0 @@
|
|||||||
{
|
|
||||||
(c) copyright 1983 by the Vrije Universiteit, Amsterdam, The Netherlands.
|
|
||||||
|
|
||||||
This product is part of the Amsterdam Compiler Kit.
|
|
||||||
|
|
||||||
Permission to use, sell, duplicate or disclose this software must be
|
|
||||||
obtained in writing. Requests for such permissions may be sent to
|
|
||||||
|
|
||||||
Dr. Andrew S. Tanenbaum
|
|
||||||
Wiskundig Seminarium
|
|
||||||
Vrije Universiteit
|
|
||||||
Postbox 7161
|
|
||||||
1007 MC Amsterdam
|
|
||||||
The Netherlands
|
|
||||||
|
|
||||||
}
|
|
||||||
{$i64 : sets of integers contain 64 bits}
|
|
||||||
program t3(input,output,f1,f2,f3,f4,f5,f6);
|
|
||||||
|
|
||||||
{ The Berkeley and EM-1 compilers both can handle this program }
|
|
||||||
|
|
||||||
const rcsversion='$Header$';
|
|
||||||
type wavelength = (red,blue,yellow,q1,q2,q3,q4,q5,q6,q7,q8,q9,q10,q11,
|
|
||||||
pink,green,orange);
|
|
||||||
spectrum= set of wavelength;
|
|
||||||
bit = 0..1;
|
|
||||||
tp3= packed record c1:char; i:integer; p:boolean; x:real end;
|
|
||||||
tp4= record c1:char; i:integer; p:boolean; x:real end;
|
|
||||||
vec1 = array [-10..+10] of integer;
|
|
||||||
vrec = record case t:boolean of false:(r:real); true:(b:bit) end;
|
|
||||||
|
|
||||||
var t,pct,ect:integer;
|
|
||||||
i,j,k,l:integer;
|
|
||||||
x,y: real;
|
|
||||||
p:boolean;
|
|
||||||
c2:char;
|
|
||||||
a1: vec1;
|
|
||||||
c: array [1..20] of char;
|
|
||||||
r3: tp3;
|
|
||||||
r4: tp4;
|
|
||||||
vr: vrec;
|
|
||||||
colors: spectrum;
|
|
||||||
letters,cset:set of char;
|
|
||||||
f1: text;
|
|
||||||
f2: file of spectrum;
|
|
||||||
f3: file of tp3;
|
|
||||||
f4: file of tp4;
|
|
||||||
f5: file of vec1;
|
|
||||||
f6: file of vrec;
|
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
procedure e(n:integer);
|
|
||||||
begin
|
|
||||||
ect := ect + 1;
|
|
||||||
writeln(' Error', n:3,' in test ', t)
|
|
||||||
end;
|
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
{************************************************************************}
|
|
||||||
procedure tst34;
|
|
||||||
{ Global files }
|
|
||||||
var i:integer; c1:char;
|
|
||||||
begin t:=34; pct := pct + 1;
|
|
||||||
rewrite(f1);
|
|
||||||
if not eof(f1) then e(1);
|
|
||||||
write(f1,'abc',20+7:2,'a':2); writeln(f1);
|
|
||||||
write(f1,'xyz');
|
|
||||||
i:=-3000; write(f1,i:5);
|
|
||||||
reset(f1);
|
|
||||||
if eof(f1) or eoln(f1) then e(2);
|
|
||||||
for i:=1 to 17 do read(f1,c[i]);
|
|
||||||
if(c[1]<>'a') or (c[3]<>'c') or (c[5]<>'7') or (c[8]<>' ') or
|
|
||||||
(c[12]<>'-') or (c[13]<>'3') or (c[16]<>'0') then e(3);
|
|
||||||
if not eof(f1) then e(4);
|
|
||||||
rewrite(f1);
|
|
||||||
for i:= 32 to 127 do write(f1,chr(i));
|
|
||||||
reset(f1); p:= false;
|
|
||||||
for i:= 32 to 127 do begin read(f1,c1); if ord(c1) <> i then p:=true end;
|
|
||||||
if p then e(5);
|
|
||||||
rewrite(f1);
|
|
||||||
for c1 := 'a' to 'z' do write(f1,c1);
|
|
||||||
reset(f1); p:= false;
|
|
||||||
for c1 := 'a' to 'z' do begin read(f1,c2); if c2 <> c1 then p:=true end;
|
|
||||||
if p then e(6);
|
|
||||||
end;
|
|
||||||
|
|
||||||
procedure tst36;
|
|
||||||
var i,j:integer;
|
|
||||||
begin t:=36; pct:=pct+1;
|
|
||||||
rewrite(f2); rewrite(f3); rewrite(f4); rewrite(f5); rewrite(f6);
|
|
||||||
colors := []; f2^ := colors; put(f2);
|
|
||||||
colors := [red]; f2^ := colors; put(f2);
|
|
||||||
colors := [red,blue]; f2^ := colors; put(f2);
|
|
||||||
colors := [yellow,blue]; f2^ := colors; put(f2);
|
|
||||||
reset(f2);
|
|
||||||
colors := f2^; get(f2); if colors <> [] then e(4);
|
|
||||||
colors := f2^; get(f2); if colors <> [red] then e(5);
|
|
||||||
colors := f2^; get(f2); if colors <> [blue,red] then e(6);
|
|
||||||
colors := f2^; get(f2); if colors <> [blue,yellow] then e(7);
|
|
||||||
r3.c1:='w'; r3.i:= -100; r3.x:=303.56; r3.p:=true; f3^:=r3; put(f3);
|
|
||||||
r3.c1:='y'; r3.i:= -35; r3.x:=26.32; f3^:=r3; put(f3);
|
|
||||||
r3.c1:='q'; r3.i:= +29; r3.x:=10.00; f3^:=r3; put(f3);
|
|
||||||
r3.c1:='j'; r3.i:= 8; r3.x:=10000; f3^:=r3; put(f3);
|
|
||||||
for i:= 1 to 1000 do begin f3^ := r3; put(f3) end;
|
|
||||||
reset(f3);
|
|
||||||
r3 := f3^; get(f3);
|
|
||||||
if (r3.c1<>'w') or (r3.i<>-100) or (r3.x<>303.56) then e(8);
|
|
||||||
r3 := f3^; get(f3);
|
|
||||||
if (r3.c1<>'y') or (r3.i<> -35) or (r3.x<> 26.32) then e(9);
|
|
||||||
r3 := f3^; get(f3);
|
|
||||||
if (r3.c1<>'q') or (r3.i<> 29) or (r3.x<> 10.00) then e(10);
|
|
||||||
r3 := f3^; get(f3);
|
|
||||||
if (r3.c1<>'j') or (r3.i<> 8) or (r3.x<> 10000) then e(11);
|
|
||||||
|
|
||||||
r4.c1:='w'; r4.i:= -100; r4.x:=303.56; r4.p:=true; f4^:=r4; put(f4);
|
|
||||||
r4.c1:='y'; r4.i:= -35; r4.x:=26.32; f4^:=r4; put(f4);
|
|
||||||
r4.c1:='q'; r4.i:= +29; r4.x:=10.00; f4^:=r4; put(f4);
|
|
||||||
r4.c1:='j'; r4.i:= 8; r4.x:=10000; f4^:=r4; put(f4);
|
|
||||||
for i:= 1 to 1000 do begin f4^ := r4; put(f4) end;
|
|
||||||
reset(f4);
|
|
||||||
r4 := f4^; get(f4);
|
|
||||||
if (r4.c1<>'w') or (r4.i<>-100) or (r4.x<>303.56) then e(12);
|
|
||||||
r4 := f4^; get(f4);
|
|
||||||
if (r4.c1<>'y') or (r4.i<> -35) or (r4.x<> 26.32) then e(13);
|
|
||||||
r4 := f4^; get(f4);
|
|
||||||
if (r4.c1<>'q') or (r4.i<> 29) or (r4.x<> 10.00) then e(13);
|
|
||||||
r4 := f4^; get(f4);
|
|
||||||
if (r4.c1<>'j') or (r4.i<> 8) or (r4.x<> 10000) then e(14);
|
|
||||||
|
|
||||||
for j:= 1 to 100 do
|
|
||||||
begin for i:= -10 to +10 do a1[i] := i*j; f5^ := a1; put(f5); end;
|
|
||||||
reset(f5);
|
|
||||||
for j:= 1 to 99 do
|
|
||||||
begin a1:=f5^; get(f5); for i:= -10 to +10 do if a1[i]<> i*j then e(14) end;
|
|
||||||
|
|
||||||
vr.t:=false;
|
|
||||||
for i:= 1 to 1000 do begin vr.r:=i+0.5; f6^:=vr; put(f6) ; p:=true; end;
|
|
||||||
reset(f6); p:=false;
|
|
||||||
for i:= 1 to 999 do
|
|
||||||
begin vr:=f6^; get(f6); if vr.r <> i+0.5 then p:=true end;
|
|
||||||
if p then e(15);
|
|
||||||
rewrite(f6);
|
|
||||||
if not eof(f6) then e(16);
|
|
||||||
for i:= 1 to 1000 do begin vr.b:=i mod 2; f6^:=vr; put(f6) end;
|
|
||||||
reset(f6);
|
|
||||||
if eof(f6) then e(17);
|
|
||||||
p:=false;
|
|
||||||
for i:= 1 to 1000 do
|
|
||||||
begin vr:=f6^; get(f6); if vr.b <> i mod 2 then p:=true end;
|
|
||||||
if not eof(f6) then e(18);
|
|
||||||
if p then e(19);
|
|
||||||
|
|
||||||
rewrite(f1);
|
|
||||||
f1^:=chr(10);
|
|
||||||
put(f1);
|
|
||||||
reset(f1);
|
|
||||||
if ord(f1^) <> 32 then e(20);
|
|
||||||
|
|
||||||
rewrite(f1);
|
|
||||||
x:=0.0625; write(f1,x:6:4, x:6:2);
|
|
||||||
reset(f1); read(f1,y); if y <> 0.0625 then e(21);
|
|
||||||
reset(f1); for i:= 1 to 12 do begin c[i]:= f1^; get(f1) end;
|
|
||||||
if (c[1]<>'0') or (c[2]<>'.') or (c[4]<>'6') then e(22);
|
|
||||||
if (c[7]<>' ') or (c[9]<>'0') or (c[10]<>'.') or (c[12]<>'6') then e(23);
|
|
||||||
end;
|
|
||||||
|
|
||||||
{************************************************************************}
|
|
||||||
procedure tst35;
|
|
||||||
{ Local files }
|
|
||||||
var g1: text;
|
|
||||||
g2: file of spectrum;
|
|
||||||
g3: file of tp4;
|
|
||||||
g4: file of vec1;
|
|
||||||
i,j:integer;
|
|
||||||
begin t:=35; pct := pct + 1;
|
|
||||||
rewrite(g1); rewrite(g2); rewrite(g3); rewrite(g4);
|
|
||||||
if (not (eof(g1) and eof(g4))) then e(1);
|
|
||||||
writeln(g1,'abc', 20+7:2,'a':2);
|
|
||||||
write(g1,'xyz');
|
|
||||||
reset(g1);
|
|
||||||
if eof(g1) or eoln(g1) then e(2);
|
|
||||||
read(g1,c[1]); read(g1,c[2]); read(g1,c[3],c[4],c[5],c[6],c[7]);
|
|
||||||
if (c[1]<>'a') or (c[3]<>'c') or (c[4]<>'2') or (c[7]<>'a') then e(3);
|
|
||||||
if not eoln(g1) then e(4)
|
|
||||||
else readln(g1);
|
|
||||||
for i:=1 to 2 do read(g1,c[8+i]);
|
|
||||||
if c[10]<>'y' then e(5);
|
|
||||||
if eof(g1) or eoln(g1) then e(6);
|
|
||||||
colors := []; g2^ := colors; put(g2);
|
|
||||||
colors := [pink]; g2^ := colors; put(g2);
|
|
||||||
colors := [pink,green]; g2^ := colors; put(g2);
|
|
||||||
colors := [orange,green]; g2^ := colors; put(g2);
|
|
||||||
reset(g2);
|
|
||||||
colors := g2^; get(g2); if colors <> [] then e(7);
|
|
||||||
colors := g2^; get(g2); if colors <> [pink] then e(8);
|
|
||||||
colors := g2^; get(g2); if colors <> [green,pink] then e(9);
|
|
||||||
colors := g2^; get(g2); if colors <> [green,orange] then e(10);
|
|
||||||
r4.c1:='w'; r4.i:= -100; r4.x:=303.56; g3^:=r4; put(g3);
|
|
||||||
r4.c1:='y'; r4.i:= -35; r4.x:=26.32; g3^:=r4; put(g3);
|
|
||||||
r4.c1:='q'; r4.i:= +29; r4.x:=10.00; g3^:=r4; put(g3);
|
|
||||||
r4.c1:='j'; r4.i:= 8; r4.x:=10000; g3^:=r4; put(g3);
|
|
||||||
for i:= 1 to 1000 do begin g3^ := r4; put(g3) end;
|
|
||||||
reset(g3);
|
|
||||||
if eof(g3) then e(11);
|
|
||||||
r4 := g3^; get(g3);
|
|
||||||
if (r4.c1<>'w') or (r4.i<>-100) or (r4.x<>303.56) then e(12);
|
|
||||||
r4 := g3^; get(g3);
|
|
||||||
if (r4.c1<>'y') or (r4.i<> -35) or (r4.x<> 26.32) then e(13);
|
|
||||||
r4 := g3^; get(g3);
|
|
||||||
if (r4.c1<>'q') or (r4.i<> 29) or (r4.x<> 10.00) then e(14);
|
|
||||||
r4 := g3^; get(g3);
|
|
||||||
if (r4.c1<>'j') or (r4.i<> 8) or (r4.x<> 10000) then e(15);
|
|
||||||
|
|
||||||
for j:= 1 to 100 do
|
|
||||||
begin for i:= -10 to +10 do a1[i] := i*j; g4^ := a1; put(g4) end;
|
|
||||||
reset(g4);
|
|
||||||
for j:= 1 to 100 do
|
|
||||||
begin a1:=g4^; get(g4); for i:= -10 to +10 do if a1[i]<>i*j then e(16) end;
|
|
||||||
if not eof(g2) then e(17);
|
|
||||||
colors:=[q1,q2,q3,q4,q5,q6,q7,q8,q9,q10,q11];
|
|
||||||
end;
|
|
||||||
|
|
||||||
|
|
||||||
{***********************************************************************}
|
|
||||||
procedure tst37;
|
|
||||||
{ Intermediate level files }
|
|
||||||
var g1: text;
|
|
||||||
g2: file of spectrum;
|
|
||||||
g3: file of tp4;
|
|
||||||
g4: file of vec1;
|
|
||||||
|
|
||||||
procedure tst3701;
|
|
||||||
var i,j:integer;
|
|
||||||
begin t:=3701; pct := pct + 1;
|
|
||||||
rewrite(g1); rewrite(g2); rewrite(g3); rewrite(g4);
|
|
||||||
if (not (eof(g1) and eof(g4))) then e(1);
|
|
||||||
writeln(g1,'abc', 20+7:2,'a':2);
|
|
||||||
write(g1,'xyz');
|
|
||||||
reset(g1);
|
|
||||||
if eof(g1) or eoln(g1) then e(2);
|
|
||||||
read(g1,c[1]); read(g1,c[2]); read(g1,c[3],c[4],c[5],c[6],c[7]);
|
|
||||||
if (c[1]<>'a') or (c[3]<>'c') or (c[4]<>'2') or (c[7]<>'a') then e(3);
|
|
||||||
if not eoln(g1) then e(4)
|
|
||||||
else readln(g1);
|
|
||||||
for i:=1 to 2 do read(g1,c[8+i]);
|
|
||||||
if c[10]<>'y' then e(5);
|
|
||||||
if eof(g1) or eoln(g1) then e(6);
|
|
||||||
colors := []; g2^ := colors; put(g2);
|
|
||||||
colors := [pink]; g2^ := colors; put(g2);
|
|
||||||
colors := [pink,green]; g2^ := colors; put(g2);
|
|
||||||
colors := [orange,green]; g2^ := colors; put(g2);
|
|
||||||
reset(g2);
|
|
||||||
colors := g2^; get(g2); if colors <> [] then e(7);
|
|
||||||
colors := g2^; get(g2); if colors <> [pink] then e(8);
|
|
||||||
colors := g2^; get(g2); if colors <> [green,pink] then e(9);
|
|
||||||
colors := g2^; get(g2); if colors <> [green,orange] then e(10);
|
|
||||||
r4.c1:='w'; r4.i:= -100; r4.x:=303.56; g3^:=r4; put(g3);
|
|
||||||
r4.c1:='y'; r4.i:= -35; r4.x:=26.32; g3^:=r4; put(g3);
|
|
||||||
r4.c1:='q'; r4.i:= +29; r4.x:=10.00; g3^:=r4; put(g3);
|
|
||||||
r4.c1:='j'; r4.i:= 8; r4.x:=10000; g3^:=r4; put(g3);
|
|
||||||
for i:= 1 to 1000 do begin g3^ := r4; put(g3) end;
|
|
||||||
reset(g3);
|
|
||||||
if eof(g3) then e(11);
|
|
||||||
r4 := g3^; get(g3);
|
|
||||||
if (r4.c1<>'w') or (r4.i<>-100) or (r4.x<>303.56) then e(12);
|
|
||||||
r4 := g3^; get(g3);
|
|
||||||
if (r4.c1<>'y') or (r4.i<> -35) or (r4.x<> 26.32) then e(13);
|
|
||||||
r4 := g3^; get(g3);
|
|
||||||
if (r4.c1<>'q') or (r4.i<> 29) or (r4.x<> 10.00) then e(14);
|
|
||||||
r4 := g3^; get(g3);
|
|
||||||
if (r4.c1<>'j') or (r4.i<> 8) or (r4.x<> 10000) then e(15);
|
|
||||||
|
|
||||||
for j:= 1 to 100 do
|
|
||||||
begin for i:= -10 to +10 do a1[i] := i*j; g4^ := a1; put(g4) end;
|
|
||||||
reset(g4);
|
|
||||||
for j:= 1 to 100 do
|
|
||||||
begin a1:=g4^; get(g4); for i:= -10 to +10 do if a1[i]<>i*j then e(16) end;
|
|
||||||
end;
|
|
||||||
|
|
||||||
begin t:=37; pct := pct+1;
|
|
||||||
tst3701;
|
|
||||||
t:=37;
|
|
||||||
if not eof(g2) then e(1);
|
|
||||||
end;
|
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
{***********************************************************************}
|
|
||||||
procedure tst38;
|
|
||||||
{ Advanced set theory }
|
|
||||||
begin t:=38; pct := pct + 1;
|
|
||||||
if [50] >= [49,51] then e(1);
|
|
||||||
if [10] <= [9,11] then e(2);
|
|
||||||
if not ([50] <= [49..51]) then e(3);
|
|
||||||
i:=1; j:=2; k:=3; l:=5;
|
|
||||||
if [i] + [j] <> [i,j] then e(4);
|
|
||||||
if [i] + [j] <> [i..j] then e(5);
|
|
||||||
if [j..i] <> [] then e(6);
|
|
||||||
if [j..l] + [j..k] <> [2,3,4,5] then e(7);
|
|
||||||
if ([1..k, l..8] + [10]) * [k..7, 2, l] <> [2,3,l..7] then e(8);
|
|
||||||
if [i..9] - [j..l] <> [1,l+1..k*k] then e(9);
|
|
||||||
if [k..j] <> [i..j] * [k..l] then e(10);
|
|
||||||
if not ([k..10] <= [i..15]) then e(11);
|
|
||||||
if not ([k-1..k*l] <= [i..15]) then e(12);
|
|
||||||
|
|
||||||
letters := ['a','b', 'z'];
|
|
||||||
if letters <> ['a', 'b', 'z'] then e(13);
|
|
||||||
cset := ['a'] + ['b', 'c', 'z'] - ['c','d'];
|
|
||||||
if cset <> letters then e(14);
|
|
||||||
cset := ['a'..'e'];
|
|
||||||
if cset <> ['a', 'b', 'c', 'd', 'e'] then e(15);
|
|
||||||
cset := ['a'..'z', '0'..'9', '+','-','*','/','.',':','(',')','{','}'];
|
|
||||||
if not ('+' in cset) or not ('.' in cset) or not ('}' in cset) then e(16);
|
|
||||||
letters := ['a'..'z' , '0'..'9'];
|
|
||||||
if letters >= cset then e(17);
|
|
||||||
end;
|
|
||||||
|
|
||||||
|
|
||||||
{***********************************************************************}
|
|
||||||
|
|
||||||
{ Main program }
|
|
||||||
begin ect:=0; pct:=0;
|
|
||||||
tst34; tst35; tst36; tst37; tst38;
|
|
||||||
write('Program t3:',pct:3,' tests completed.');
|
|
||||||
writeln('Number of errors = ',ect:0);
|
|
||||||
end.
|
|
||||||
@@ -1,411 +0,0 @@
|
|||||||
#
|
|
||||||
{
|
|
||||||
(c) copyright 1983 by the Vrije Universiteit, Amsterdam, The Netherlands.
|
|
||||||
|
|
||||||
This product is part of the Amsterdam Compiler Kit.
|
|
||||||
|
|
||||||
Permission to use, sell, duplicate or disclose this software must be
|
|
||||||
obtained in writing. Requests for such permissions may be sent to
|
|
||||||
|
|
||||||
Dr. Andrew S. Tanenbaum
|
|
||||||
Wiskundig Seminarium
|
|
||||||
Vrije Universiteit
|
|
||||||
Postbox 7161
|
|
||||||
1007 MC Amsterdam
|
|
||||||
The Netherlands
|
|
||||||
|
|
||||||
}
|
|
||||||
|
|
||||||
program t4(input,output);
|
|
||||||
{ Tests for the EM-1 compiler }
|
|
||||||
const rcsversion='$Header$';
|
|
||||||
type vec = array[1..1000] of integer;
|
|
||||||
spectrum = set of (red,blue,yellow);
|
|
||||||
#ifndef NOFLOAT
|
|
||||||
tp2 = record c1:char;i,j:integer; p:boolean; x:real end;
|
|
||||||
#else
|
|
||||||
tp2 = record c1:char;i,j:integer; p:boolean end;
|
|
||||||
#endif
|
|
||||||
cmat = array[0..3,0..7] of ^spectrum;
|
|
||||||
single = array [0..0] of integer;
|
|
||||||
np = ^node;
|
|
||||||
node = record val: integer; next: np end;
|
|
||||||
|
|
||||||
var t,ect,pct:integer;
|
|
||||||
r1: tp2;
|
|
||||||
pt1,pt2: ^vec;
|
|
||||||
pt3:^integer;
|
|
||||||
mk: ^integer;
|
|
||||||
i,j: integer;
|
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
procedure e(n:integer);
|
|
||||||
begin
|
|
||||||
ect := ect + 1;
|
|
||||||
writeln(' Error', n:3,' in test ', t)
|
|
||||||
end;
|
|
||||||
|
|
||||||
function inc(k:integer):integer; begin inc := k+1 end;
|
|
||||||
function twice(k:integer):integer; begin twice := 2*k end;
|
|
||||||
function decr(k:integer):integer; begin decr := k-1 end;
|
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
procedure tst40;
|
|
||||||
{ Mark and Release }
|
|
||||||
var i:integer;
|
|
||||||
procedure grab;
|
|
||||||
var i:integer;
|
|
||||||
begin
|
|
||||||
for i:=1 to 10 do new(pt1);
|
|
||||||
for i:=1 to 1000 do new(pt3);
|
|
||||||
end;
|
|
||||||
|
|
||||||
begin t:= 40; pct:=pct+1;
|
|
||||||
for i:=1 to 10 do
|
|
||||||
begin
|
|
||||||
mark(mk);
|
|
||||||
new(pt2);
|
|
||||||
grab;
|
|
||||||
release(mk)
|
|
||||||
end;
|
|
||||||
end;
|
|
||||||
|
|
||||||
|
|
||||||
procedure tst41;
|
|
||||||
{ Empty sets }
|
|
||||||
begin t:=41; pct := pct + 1;
|
|
||||||
if red in [] then e(1);
|
|
||||||
if ([] <> []) then e(2);
|
|
||||||
if not ([] = []) then e(3);
|
|
||||||
if not([] <=[]) then e(4);
|
|
||||||
if not ( [] >= []) then e(5);
|
|
||||||
end;
|
|
||||||
|
|
||||||
|
|
||||||
{************************************************************************}
|
|
||||||
procedure tst42;
|
|
||||||
{ Record variants. These tests are machine dependent }
|
|
||||||
var s:record b:boolean; case t:boolean of false:(c:char);true:(d:cmat) end;
|
|
||||||
w: packed record
|
|
||||||
case z:boolean of
|
|
||||||
false: (x:array[0..20] of integer);
|
|
||||||
true: (a,b,c,d,e,f,g,h,i,j,k,l:char)
|
|
||||||
end;
|
|
||||||
|
|
||||||
y: record
|
|
||||||
case z:boolean of
|
|
||||||
false: (x:array[0..20] of integer);
|
|
||||||
true: (a,b,c,d,e,f,g,h,i,j,k,l:char)
|
|
||||||
end;
|
|
||||||
i:integer;
|
|
||||||
begin t:=42; pct:=pct+1;
|
|
||||||
s.t:=false; s.c:='x'; if s.c <> 'x' then e(1);
|
|
||||||
for i:=0 to 20 do begin w.x[i]:=-1; y.x[i]:=-1 end;
|
|
||||||
w.a:=chr(0); w.f:=chr(0);
|
|
||||||
y.a:=chr(0); y.f:=chr(0);
|
|
||||||
if (ord(w.a) <> 0) or (ord(w.b) <> 255) then e(3);
|
|
||||||
if (ord(w.c) <> 255) or (ord(w.d)<>255) then e(4);
|
|
||||||
if (ord(w.e) <> 255) or (ord(w.f) <> 0) then e(5);
|
|
||||||
if ord(y.a) <> 0 then e(6);
|
|
||||||
if ord(y.f) <> 0 then e(7);
|
|
||||||
end;
|
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
{************************************************************************}
|
|
||||||
procedure tst43;
|
|
||||||
{ Procedure and function parameters }
|
|
||||||
function incr(k:integer):integer; begin incr := k+1 end;
|
|
||||||
function double(k:integer):integer; begin double := 2*k end;
|
|
||||||
function eval(function f(a:integer):integer; a:integer):integer;
|
|
||||||
begin eval:=f(a) end;
|
|
||||||
function apply(function f(a:integer):integer; a:integer):integer;
|
|
||||||
begin apply:=eval(f,a) end;
|
|
||||||
|
|
||||||
procedure x1(function f(a:integer):integer; a:integer; var r:integer);
|
|
||||||
procedure x2(function g(c:integer):integer; b:integer; var s:integer);
|
|
||||||
begin s:=apply(g,b); end;
|
|
||||||
begin x2(f, a+a, r) end;
|
|
||||||
|
|
||||||
procedure p0(procedure p(x:integer); i,j:integer);
|
|
||||||
begin
|
|
||||||
if j=0 then p(i) else p0(p,i+j,j-1)
|
|
||||||
end;
|
|
||||||
|
|
||||||
procedure p1(a,b,c,d:integer);
|
|
||||||
var k:integer;
|
|
||||||
procedure p2(x:integer);
|
|
||||||
begin k:= x*x end;
|
|
||||||
begin k:=0;
|
|
||||||
p0(p2,a,b);
|
|
||||||
if k <> c then e(d);
|
|
||||||
end;
|
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
begin t:=43; pct := pct+1;
|
|
||||||
i:=10; j:=20;
|
|
||||||
if incr(0) <> 1 then e(1);
|
|
||||||
if decr(i) <> 9 then e(2);
|
|
||||||
if double(i+j) <> 60 then e(3);
|
|
||||||
if incr(double(j)) <> 41 then e(4);
|
|
||||||
if decr(double(incr(double(i)))) <> 41 then e(5);
|
|
||||||
if incr(incr(incr(incr(incr(5))))) <> 10 then e(6);
|
|
||||||
if eval(incr,i) <> 11 then e(7);
|
|
||||||
if eval(decr,3) <> 2 then e(8);
|
|
||||||
if incr(eval(double,15)) <> 31 then e(9);
|
|
||||||
if apply(incr,3) <> 4 then e(10);
|
|
||||||
|
|
||||||
x1(double,i,j); if j <> 40 then e(11);
|
|
||||||
x1(incr,i+3,j); if j <> 27 then e(12);
|
|
||||||
p1(3,5,324,13);
|
|
||||||
p1(10,4,400,14);
|
|
||||||
p1(1,8,1369,15);
|
|
||||||
j:=1;
|
|
||||||
if inc(incr(twice(double(inc(incr(twice(double(j)))))))) <> 26 then e(13);
|
|
||||||
end;
|
|
||||||
|
|
||||||
|
|
||||||
{************************************************************************}
|
|
||||||
procedure tst44;
|
|
||||||
{ Value parameters }
|
|
||||||
type ww2 = array[-10..+10] of tp2;
|
|
||||||
arra = array[-10..+10] of integer;
|
|
||||||
reca = record k:single; s:spectrum end;
|
|
||||||
pa = np;
|
|
||||||
#ifndef NOFLOAT
|
|
||||||
var l1:integer; xr:real; xb:boolean; xc:char; xar:cmat; xnode:pa;
|
|
||||||
#else
|
|
||||||
var l1:integer; xb:boolean; xc:char; xar:cmat; xnode:pa;
|
|
||||||
#endif
|
|
||||||
vec1: arra; vec2: ww2;
|
|
||||||
s2:spectrum; rec1: reca;
|
|
||||||
zero:0..0;
|
|
||||||
|
|
||||||
#ifndef NOFLOAT
|
|
||||||
procedure tst4401(pl1:integer; pxr:real; pxb:boolean; pxc:char;
|
|
||||||
#else
|
|
||||||
procedure tst4401(pl1:integer; pxb:boolean; pxc:char;
|
|
||||||
#endif
|
|
||||||
pxar:cmat; pxnode:pa; pxtp2:tp2;
|
|
||||||
pvec1:arra; pvec2:ww2; prec1:reca;
|
|
||||||
ps1,ps2:spectrum; psin:single; i,j:integer);
|
|
||||||
begin t:=4401; pct:=pct+1;
|
|
||||||
if pl1<>29 then e(1);
|
|
||||||
#ifndef NOFLOAT
|
|
||||||
if pxr<>-0.31 then e(2);
|
|
||||||
#endif
|
|
||||||
if pxb <> false then e(3);
|
|
||||||
if pxc <> 'k' then e(4);
|
|
||||||
if (pxar[1,1]^<>[red,blue]) or (pxar[2,2]^ <> [yellow]) then e(5);
|
|
||||||
if (pxnode^.val <> 105) or (pxnode^.next^.val <> 106) then e(6);
|
|
||||||
#ifndef NOFLOAT
|
|
||||||
if (pxtp2.c1 <> 'w') or (pxtp2.x <> 20.3) then e(7);
|
|
||||||
#else
|
|
||||||
if (pxtp2.c1 <> 'w') then e(7);
|
|
||||||
#endif
|
|
||||||
if pvec1[10] <> -996 then e(8);
|
|
||||||
#ifndef NOFLOAT
|
|
||||||
if pvec2[zero].x <> -300 then e(9);
|
|
||||||
#endif
|
|
||||||
if (prec1.k[zero] <> -421) or (prec1.s <> []) then e(10);
|
|
||||||
if (ps1<>[]) or (ps2<>[red]) then e(11);
|
|
||||||
if psin[zero] <> -421 then e(12);
|
|
||||||
if i <> -421 then e(13);
|
|
||||||
if j <> 106 then e(14);
|
|
||||||
|
|
||||||
pl1:=0; pxc:=' '; pxb:=true;
|
|
||||||
pxar[1,1]^:=[]; pxar[2,2]^:=[];
|
|
||||||
pxnode^.val:=0; pxnode^.next^.val:=1;
|
|
||||||
pxtp2.c1:=' ';
|
|
||||||
pvec1[10]:=0;
|
|
||||||
#ifndef NOFLOAT
|
|
||||||
pvec2[zero].x:=0;
|
|
||||||
#endif
|
|
||||||
prec1.k[zero]:=0;
|
|
||||||
psin[0]:=0; i:=0; j:=0;
|
|
||||||
end;
|
|
||||||
|
|
||||||
begin t:=44; pct:=pct+1;
|
|
||||||
zero:=0;
|
|
||||||
#ifndef NOFLOAT
|
|
||||||
l1:=29; xr:=-0.31; xb:=false; xc:='k';
|
|
||||||
#else
|
|
||||||
l1:=29; xb:=false; xc:='k';
|
|
||||||
#endif
|
|
||||||
new(xar[1,1]); xar[1,1]^ := [red,blue];
|
|
||||||
new(xar[2,2]); xar[2,2]^ := [yellow];
|
|
||||||
new(xar[1,2]); xar[1,2]^ := [yellow];
|
|
||||||
new(xnode); xnode^.val :=105;
|
|
||||||
new(xnode^.next); xnode^.next^.val :=106;
|
|
||||||
#ifndef NOFLOAT
|
|
||||||
r1.c1:='w'; r1.x:=20.3;
|
|
||||||
vec1[10] := -996; vec2[zero].x := -300;
|
|
||||||
#else
|
|
||||||
r1.c1:='w';
|
|
||||||
vec1[10] := -996;
|
|
||||||
#endif
|
|
||||||
rec1.k[zero]:=-421; rec1.s :=[];
|
|
||||||
s2:=[red];
|
|
||||||
|
|
||||||
#ifndef NOFLOAT
|
|
||||||
tst4401(l1, xr, xb, xc, xar, xnode, r1, vec1, vec2, rec1,
|
|
||||||
#else
|
|
||||||
tst4401(l1, xb, xc, xar, xnode, r1, vec1, vec2, rec1,
|
|
||||||
#endif
|
|
||||||
[], s2, rec1.k, rec1.k[zero], xnode^.next^.val);;
|
|
||||||
t:=44;
|
|
||||||
|
|
||||||
if l1<>29 then e(1);
|
|
||||||
#ifndef NOFLOAT
|
|
||||||
if xr<> -0.31 then e(2);
|
|
||||||
#endif
|
|
||||||
if xb <> false then e(3);
|
|
||||||
if xc <> 'k' then e(4);
|
|
||||||
if (xar[1,1]^ <> []) or (xar[2,2]^ <> []) then e(5);
|
|
||||||
if xar[1,2]^ <> [yellow] then e(6);
|
|
||||||
if (xnode^.val <> 0) or (xnode^.next^.val <> 1) then e(7);
|
|
||||||
#ifndef NOFLOAT
|
|
||||||
if (r1.c1 <> 'w') or (r1.x <> 20.3) then e(8);
|
|
||||||
#else
|
|
||||||
if (r1.c1 <> 'w') then e(8);
|
|
||||||
#endif
|
|
||||||
if vec1[10] <> -996 then e(9);
|
|
||||||
#ifndef NOFLOAT
|
|
||||||
if vec2[zero].x <> -300 then e(10);
|
|
||||||
#endif
|
|
||||||
if (rec1.k[zero] <> -421) or (rec1.s <> []) then e(11);
|
|
||||||
if s2 <> [red] then e(12);
|
|
||||||
end;
|
|
||||||
|
|
||||||
|
|
||||||
{************************************************************************}
|
|
||||||
procedure tst45;
|
|
||||||
{ Var parameters }
|
|
||||||
type ww2 = array[-10..+10] of tp2;
|
|
||||||
arra = array[-10..+10] of integer;
|
|
||||||
reca = record k:single; s:spectrum end;
|
|
||||||
pa = np;
|
|
||||||
#ifndef NOFLOAT
|
|
||||||
var l1:integer; xr:real; xb:boolean; xc:char; xar:cmat; xnode:pa;
|
|
||||||
#else
|
|
||||||
var l1:integer; xb:boolean; xc:char; xar:cmat; xnode:pa;
|
|
||||||
#endif
|
|
||||||
vec1: arra; vec2: ww2;
|
|
||||||
s1,s2:spectrum; rec1: reca;
|
|
||||||
zero:0..0;
|
|
||||||
|
|
||||||
#ifndef NOFLOAT
|
|
||||||
procedure tst4501(var pl1:integer; var pxr:real; var pxb:boolean; var pxc:char;
|
|
||||||
#else
|
|
||||||
procedure tst4501(var pl1:integer; var pxb:boolean; var pxc:char;
|
|
||||||
#endif
|
|
||||||
var pxar:cmat; var pxnode:pa; var pxtp2:tp2;
|
|
||||||
var pvec1:arra; var pvec2:ww2; var prec1:reca;
|
|
||||||
var ps1,ps2:spectrum; var psin:single; var i,j:integer);
|
|
||||||
begin t:=4501; pct:=pct+1;
|
|
||||||
if pl1<>29 then e(1);
|
|
||||||
#ifndef NOFLOAT
|
|
||||||
if pxr<>-0.31 then e(2);
|
|
||||||
#endif
|
|
||||||
if pxb <> false then e(3);
|
|
||||||
if pxc <> 'k' then e(4);
|
|
||||||
if (pxar[1,1]^<>[red,blue]) or (pxar[2,2]^ <> [yellow]) then e(5);
|
|
||||||
if (pxnode^.val <> 105) or (pxnode^.next^.val <> 106) then e(6);
|
|
||||||
#ifndef NOFLOAT
|
|
||||||
if (pxtp2.c1 <> 'w') or (pxtp2.x <> 20.3) then e(7);
|
|
||||||
#else
|
|
||||||
if (pxtp2.c1 <> 'w') then e(7);
|
|
||||||
#endif
|
|
||||||
if pvec1[10] <> -996 then e(8);
|
|
||||||
#ifndef NOFLOAT
|
|
||||||
if pvec2[zero].x <> -300 then e(9);
|
|
||||||
#endif
|
|
||||||
if (prec1.k[zero] <> -421) or (prec1.s <> []) then e(10);
|
|
||||||
if (ps1<>[]) or (ps2<>[red]) then e(11);
|
|
||||||
if psin[zero] <> -421 then e(12);
|
|
||||||
if i <> -421 then e(13);
|
|
||||||
if j <> 106 then e(14);
|
|
||||||
|
|
||||||
#ifndef NOFLOAT
|
|
||||||
pl1:=0; pxr:=0; pxc:=' '; pxb:=true;
|
|
||||||
#else
|
|
||||||
pl1:=0; pxc:=' '; pxb:=true;
|
|
||||||
#endif
|
|
||||||
pxar[1,1]^:=[]; pxar[2,2]^:=[];
|
|
||||||
pxnode^.val:=0; pxnode^.next^.val:=1;
|
|
||||||
pxtp2.c1:=' ';
|
|
||||||
#ifndef NOFLOAT
|
|
||||||
pxtp2.x := 0;
|
|
||||||
#endif
|
|
||||||
pvec1[10]:=0;
|
|
||||||
#ifndef NOFLOAT
|
|
||||||
pvec2[zero].x:=0;
|
|
||||||
#endif
|
|
||||||
prec1.k[zero]:=0;
|
|
||||||
psin[0]:=0; i:=223; j:=445;
|
|
||||||
end;
|
|
||||||
|
|
||||||
begin t:=45; pct:=pct+1;
|
|
||||||
zero:=0;
|
|
||||||
#ifndef NOFLOAT
|
|
||||||
l1:=29; xr:=-0.31; xb:=false; xc:='k';
|
|
||||||
#else
|
|
||||||
l1:=29; xb:=false; xc:='k';
|
|
||||||
#endif
|
|
||||||
new(xar[1,1]); xar[1,1]^ := [red,blue];
|
|
||||||
new(xar[2,2]); xar[2,2]^ := [yellow];
|
|
||||||
new(xar[1,2]); xar[1,2]^ := [yellow];
|
|
||||||
new(xnode); xnode^.val :=105;
|
|
||||||
new(xnode^.next); xnode^.next^.val :=106;
|
|
||||||
#ifndef NOFLOAT
|
|
||||||
r1.c1:='w'; r1.x:=20.3;
|
|
||||||
vec1[10] := -996; vec2[zero].x := -300;
|
|
||||||
#else
|
|
||||||
r1.c1:='w';
|
|
||||||
vec1[10] := -996;
|
|
||||||
#endif
|
|
||||||
rec1.k[zero]:=-421; rec1.s :=[];
|
|
||||||
s1:=[]; s2:=[red];
|
|
||||||
|
|
||||||
#ifndef NOFLOAT
|
|
||||||
tst4501(l1, xr, xb, xc, xar, xnode, r1, vec1, vec2, rec1,
|
|
||||||
#else
|
|
||||||
tst4501(l1, xb, xc, xar, xnode, r1, vec1, vec2, rec1,
|
|
||||||
#endif
|
|
||||||
s1, s2, rec1.k, rec1.k[zero], xnode^.next^.val);;
|
|
||||||
t:=45;
|
|
||||||
|
|
||||||
if l1<>0 then e(1);
|
|
||||||
#ifndef NOFLOAT
|
|
||||||
if xr<> 0 then e(2);
|
|
||||||
#endif
|
|
||||||
if xb <> true then e(3);
|
|
||||||
if xc <> ' ' then e(4);
|
|
||||||
if (xar[1,1]^ <> []) or (xar[2,2]^ <> []) then e(5);
|
|
||||||
if xar[1,2]^ <> [yellow] then e(6);
|
|
||||||
if (xnode^.val <> 0) or (xnode^.next^.val <> 445) then e(7);
|
|
||||||
#ifndef NOFLOAT
|
|
||||||
if (r1.c1 <> ' ') or (r1.x <> 0) then e(8);
|
|
||||||
#else
|
|
||||||
if (r1.c1 <> ' ') then e(8);
|
|
||||||
#endif
|
|
||||||
if vec1[10] <> 0 then e(9);
|
|
||||||
#ifndef NOFLOAT
|
|
||||||
if vec2[zero].x <> 0 then e(10);
|
|
||||||
#endif
|
|
||||||
if (rec1.k[zero] <> 223) or (rec1.s <> []) then e(11);
|
|
||||||
if (s1 <> []) or (s2 <> [red]) then e(12);
|
|
||||||
end;
|
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
begin ect:=0; pct:=0;
|
|
||||||
tst40; tst41; tst42; tst43; tst44; tst45;
|
|
||||||
write('Program t4:',pct:3,' tests completed.');
|
|
||||||
writeln('Number of errors = ',ect:0);
|
|
||||||
end.
|
|
||||||
@@ -1,13 +0,0 @@
|
|||||||
{$i1000}
|
|
||||||
program test(output);
|
|
||||||
const rcsversion='$Header$';
|
|
||||||
var b:false..true;
|
|
||||||
i:integer;
|
|
||||||
s:set of 0..999;
|
|
||||||
begin
|
|
||||||
b:=true; if not b then writeln('error 1');
|
|
||||||
s:=[0,100,200,300,400,500,600,700,800,900];
|
|
||||||
for i:=0 to 999 do
|
|
||||||
if (i in s) <> (i mod 100=0) then
|
|
||||||
writeln('error 2');
|
|
||||||
end.
|
|
||||||
@@ -1,66 +0,0 @@
|
|||||||
{
|
|
||||||
(c) copyright 1983 by the Vrije Universiteit, Amsterdam, The Netherlands.
|
|
||||||
|
|
||||||
This product is part of the Amsterdam Compiler Kit.
|
|
||||||
|
|
||||||
Permission to use, sell, duplicate or disclose this software must be
|
|
||||||
obtained in writing. Requests for such permissions may be sent to
|
|
||||||
|
|
||||||
Dr. Andrew S. Tanenbaum
|
|
||||||
Wiskundig Seminarium
|
|
||||||
Vrije Universiteit
|
|
||||||
Postbox 7161
|
|
||||||
1007 MC Amsterdam
|
|
||||||
The Netherlands
|
|
||||||
|
|
||||||
}
|
|
||||||
program tstenc(output);
|
|
||||||
const rcsversion='$Header$';
|
|
||||||
trapno=150;
|
|
||||||
var level:integer;
|
|
||||||
beenhere:boolean;
|
|
||||||
e:integer;
|
|
||||||
procedure trap(erno:integer); extern;
|
|
||||||
procedure encaps(procedure p;procedure q(erno:integer)); extern;
|
|
||||||
procedure p1;
|
|
||||||
label 1;
|
|
||||||
var plevel:integer;
|
|
||||||
procedure p2;
|
|
||||||
var plevel:integer;
|
|
||||||
begin plevel:=3 ; trap(trapno) ;
|
|
||||||
writeln('executing unreachable code in p2') ; e:=e+1 ;
|
|
||||||
end;
|
|
||||||
procedure q2(no:integer);
|
|
||||||
var qlevel:integer;
|
|
||||||
begin qlevel:=-3 ;
|
|
||||||
if no<>trapno then
|
|
||||||
begin writeln('wrong trapno ',no,' in q2'); e:=e+1 end ;
|
|
||||||
if plevel<>2 then
|
|
||||||
begin writeln('wrong level ',plevel,' in q2'); e:=e+1 end ;
|
|
||||||
trap(trapno) ;
|
|
||||||
goto 1;
|
|
||||||
writeln('executing unreachable code in q2') ; e:=e+1 ;
|
|
||||||
end;
|
|
||||||
begin plevel:=2 ; encaps(p2,q2) ;
|
|
||||||
writeln('executing unreachable code in p1'); e:=e+1;
|
|
||||||
1: if plevel<>2 then
|
|
||||||
begin writeln('wrong level ', plevel, 'in p1') ; e:=e+1 end ;
|
|
||||||
beenhere:=true ;
|
|
||||||
end; { body of p1 }
|
|
||||||
procedure q1(no:integer);
|
|
||||||
var qlevel:integer;
|
|
||||||
begin qlevel:=-2 ;
|
|
||||||
if no<>trapno then
|
|
||||||
begin writeln('wrong trapno ',no,' in q1'); e:=e+1 end ;
|
|
||||||
if level<>1 then
|
|
||||||
begin writeln('wrong level ',level,' in q1'); e:=e+1 end ;
|
|
||||||
end;
|
|
||||||
begin
|
|
||||||
level:=1 ;
|
|
||||||
e:=0 ;
|
|
||||||
beenhere:=false ;
|
|
||||||
encaps(p1,q1);
|
|
||||||
if not beenhere then
|
|
||||||
begin writeln('illegaly skipped code in p1') ; e:=e+1 end;
|
|
||||||
if e=0 then writeln('encaps OK')
|
|
||||||
end.
|
|
||||||
@@ -1,75 +0,0 @@
|
|||||||
program tstgto(output);
|
|
||||||
type int=integer;
|
|
||||||
pint=^integer;
|
|
||||||
var ga0,ga1,ga2,ga3,ga4,ga5:int;
|
|
||||||
gp0,gp1,gp2,gp3,gp4,gp5:pint;
|
|
||||||
|
|
||||||
procedure level0(a1,a2:int;p1,p2:pint);
|
|
||||||
label 1;
|
|
||||||
var a3,a4,a5:int;p3,p4,p5:pint;
|
|
||||||
|
|
||||||
procedure level1(a1,a2:int;p1,p2:pint);
|
|
||||||
var a3,a4,a5:int;p3,p4,p5:pint;
|
|
||||||
|
|
||||||
procedure level2(a1,a2:int;p1,p2:pint);
|
|
||||||
var a3,a4,a5:int;p3,p4,p5:pint;
|
|
||||||
begin
|
|
||||||
a1:= -5;a2:=a1;a3:=a2;a4:=a3;a5:=a4;
|
|
||||||
a1:= -4;a2:=a1;a3:=a2;a4:=a3;
|
|
||||||
a1:= -3;a2:=a1;a3:=a2;
|
|
||||||
a1:= -2;a2:=a1;
|
|
||||||
a1:=a5+a5;a1:= -1;
|
|
||||||
p1:=gp0;p2:=p1;p3:=p2;p4:=p3;p5:=p4;
|
|
||||||
p1:=gp1;p2:=p1;p3:=p2;p4:=p3;
|
|
||||||
p1:=gp2;p2:=p1;p3:=p2;
|
|
||||||
p1:=gp3;p2:=p1;
|
|
||||||
p1:=p5;p1:=gp4;
|
|
||||||
goto 1;
|
|
||||||
end; { level 2 }
|
|
||||||
|
|
||||||
begin
|
|
||||||
a1:=ga4;a2:=a1;a3:=a2;a4:=a3;a5:=a4;
|
|
||||||
a1:=ga3;a2:=a1;a3:=a2;a4:=a3;
|
|
||||||
a1:=ga2;a2:=a1;a3:=a2;
|
|
||||||
a1:=ga1;a2:=a1;
|
|
||||||
a1:=ga0;
|
|
||||||
p1:=gp4;p2:=p1;p3:=p2;p4:=p3;p5:=p4;
|
|
||||||
p1:=gp3;p2:=p1;p3:=p2;p4:=p3;
|
|
||||||
p1:=gp2;p2:=p1;p3:=p2;
|
|
||||||
p1:=gp1;p2:=p1;
|
|
||||||
p1:=gp0;
|
|
||||||
level2(a5,a4,p5,p4);
|
|
||||||
writeln('Error, goto failed');
|
|
||||||
end; { level 1 }
|
|
||||||
|
|
||||||
begin
|
|
||||||
a1:=ga5;a2:=a1;a3:=a2;a4:=a3;a5:=a4;
|
|
||||||
a1:=ga4;a2:=a1;a3:=a2;a4:=a3;
|
|
||||||
a1:=ga3;a2:=a1;a3:=a2;
|
|
||||||
a1:=ga2;a2:=a1;
|
|
||||||
a1:=ga1;
|
|
||||||
p1:=gp5;p2:=p1;p3:=p2;p4:=p3;p5:=p4;
|
|
||||||
p1:=gp4;p2:=p1;p3:=p2;p4:=p3;
|
|
||||||
p1:=gp3;p2:=p1;p3:=p2;
|
|
||||||
p1:=gp2;p2:=p1;
|
|
||||||
p1:=gp1;
|
|
||||||
level1(a5,a4,p5,p4);
|
|
||||||
writeln('Error, goto failed');
|
|
||||||
1:
|
|
||||||
if (a1 <> ga1) then writeln('level0:a1 has wrong value');
|
|
||||||
if (a2 <> ga2) then writeln('level0:a2 has wrong value');
|
|
||||||
if (a3 <> ga3) then writeln('level0:a3 has wrong value');
|
|
||||||
if (a4 <> ga4) then writeln('level0:a4 has wrong value');
|
|
||||||
if (a5 <> ga5) then writeln('level0:a5 has wrong value');
|
|
||||||
if (p1 <> gp1) then writeln('level0:p1 has wrong value');
|
|
||||||
if (p2 <> gp2) then writeln('level0:p2 has wrong value');
|
|
||||||
if (p3 <> gp3) then writeln('level0:p3 has wrong value');
|
|
||||||
if (p4 <> gp4) then writeln('level0:p4 has wrong value');
|
|
||||||
if (p5 <> gp5) then writeln('level0:p5 has wrong value');
|
|
||||||
end; { level 0 }
|
|
||||||
|
|
||||||
begin
|
|
||||||
ga0:=0;ga1:=1;ga2:=2;ga3:=3;ga4:=4;ga5:=5;
|
|
||||||
new(gp0);new(gp1);new(gp2);new(gp3);new(gp4);new(gp5);
|
|
||||||
level0(ga5,ga4,gp5,gp4);
|
|
||||||
end.
|
|
||||||
@@ -1,27 +0,0 @@
|
|||||||
var w=2
|
|
||||||
var p=2
|
|
||||||
var s=2
|
|
||||||
var l=4
|
|
||||||
var f=4
|
|
||||||
var d=8
|
|
||||||
var NAME=m6500
|
|
||||||
var M=6500
|
|
||||||
var LIB=mach/6500/lib/tail_
|
|
||||||
var RT=mach/6500/lib/head_
|
|
||||||
var INCLUDES=-I{EM}/include -I/usr/include
|
|
||||||
name be
|
|
||||||
from .m
|
|
||||||
to .s
|
|
||||||
program {EM}/lib/{M}_be
|
|
||||||
args <
|
|
||||||
prop >
|
|
||||||
need .e
|
|
||||||
end
|
|
||||||
name asld
|
|
||||||
from .s.a
|
|
||||||
to a.out
|
|
||||||
program {EM}/lib/{M}_as
|
|
||||||
mapflag -l* LNAME={EM}/{LIB}*
|
|
||||||
args (.e:{HEAD}={EM}/{RT}em) -o > (.e:{TAIL}={EM}/{LIB}em)
|
|
||||||
prop C
|
|
||||||
end
|
|
||||||
@@ -1,31 +0,0 @@
|
|||||||
var w=2
|
|
||||||
var i=2
|
|
||||||
var p=2
|
|
||||||
var s=2
|
|
||||||
var l=4
|
|
||||||
var f=4
|
|
||||||
var d=8
|
|
||||||
var NAME=m6809
|
|
||||||
var M=6809
|
|
||||||
var LIB=mach/6809/lib/tail_
|
|
||||||
var RT=mach/6809/lib/head_
|
|
||||||
var INCLUDES=-I{EM}/include -I/usr/include
|
|
||||||
name be
|
|
||||||
from .m
|
|
||||||
to .s
|
|
||||||
program {EM}/lib/{M}_be
|
|
||||||
args <
|
|
||||||
prop >
|
|
||||||
need .e
|
|
||||||
end
|
|
||||||
name asld
|
|
||||||
from .s.a
|
|
||||||
to a.out
|
|
||||||
program {EM}/lib/{M}_as
|
|
||||||
mapflag -l* LNAME={EM}/{LIB}*
|
|
||||||
args (.e:{HEAD}={EM}/{RT}em) \
|
|
||||||
({RTS}:.c={EM}/{RT}cc) ({RTS}:.p={EM}/{RT}pc) -o > < \
|
|
||||||
(.p:{TAIL}={EM}/{LIB}pc) (.c:{TAIL}={EM}/{LIB}cc.1s {EM}/{LIB}cc.2g) \
|
|
||||||
(.c.p:{TAIL}={EM}/{LIB}mon) (.e:{TAIL}={EM}/{LIB}em)
|
|
||||||
prop C
|
|
||||||
end
|
|
||||||
@@ -1,25 +0,0 @@
|
|||||||
var w=2
|
|
||||||
var p=2
|
|
||||||
var s=2
|
|
||||||
var l=4
|
|
||||||
var f=4
|
|
||||||
var d=4
|
|
||||||
var M=cpm
|
|
||||||
var NAME=CPM
|
|
||||||
var LIB=mach/z80/int/lib/tail_
|
|
||||||
var RT=mach/z80/int/lib/head_
|
|
||||||
var SIZE_F=-sm
|
|
||||||
var INCLUDES=-I{EM}/include -I/usr/include
|
|
||||||
name asld
|
|
||||||
from .k.m.a
|
|
||||||
to e.out
|
|
||||||
program {EM}/lib/em_ass
|
|
||||||
mapflag -l* LNAME={EM}/{LIB}*
|
|
||||||
mapflag -+* ASS_F={ASS_F?} -+*
|
|
||||||
mapflag --* ASS_F={ASS_F?} --*
|
|
||||||
mapflag -s* SIZE_F=-s*
|
|
||||||
args {ASS_F?} ({RTS}:.c={EM}/{RT}cc) ({RTS}:.p={EM}/{RT}pc) -o > < \
|
|
||||||
(.p:{TAIL}={EM}/{LIB}pc) (.c:{TAIL}={EM}/{LIB}cc.1s {EM}/{LIB}cc.2g) \
|
|
||||||
(.c.p:{TAIL}={EM}/{LIB}mon)
|
|
||||||
prop C
|
|
||||||
end
|
|
||||||
@@ -1,60 +0,0 @@
|
|||||||
# (c) copyright 1983 by the Vrije Universiteit, Amsterdam, The Netherlands.
|
|
||||||
name cpp
|
|
||||||
# no from, it's governed by the P property
|
|
||||||
to .i
|
|
||||||
program {EM}/lib/cpp
|
|
||||||
mapflag -I* CPP_F={CPP_F?} -I*
|
|
||||||
mapflag -U* CPP_F={CPP_F?} -U*
|
|
||||||
mapflag -D* CPP_F={CPP_F?} -D*
|
|
||||||
args {CPP_F?} {INCLUDES?} -D{NAME} -DEM_WSIZE={w} -DEM_PSIZE={p} \
|
|
||||||
-DEM_SSIZE={s} -DEM_LSIZE={l} -DEM_FSIZE={f} -DEM_DSIZE={d} <
|
|
||||||
prop >P
|
|
||||||
end
|
|
||||||
name cem
|
|
||||||
from .c
|
|
||||||
to .k
|
|
||||||
program {EM}/lib/em_cem
|
|
||||||
mapflag -p CEM_F={CEM_F?} -Xp
|
|
||||||
mapflag -L CEM_F={CEM_F?} -l
|
|
||||||
args -Vw{w}i{w}p{p}f{f}s{s}l{l}d{d} {CEM_F?}
|
|
||||||
prop <>p
|
|
||||||
rts .c
|
|
||||||
need .c
|
|
||||||
end
|
|
||||||
name pc
|
|
||||||
from .p
|
|
||||||
to .k
|
|
||||||
program {EM}/lib/em_pc
|
|
||||||
mapflag -p PC_F={PC_F?} -p
|
|
||||||
mapflag -w PC_F={PC_F?} -w
|
|
||||||
mapflag -E PC_F={PC_F?} -E
|
|
||||||
mapflag -e PC_F={PC_F?} -e
|
|
||||||
mapflag -{*} PC_F={PC_F?} -\{*}
|
|
||||||
mapflag -L PC_F={PC_F?} -\{l-}
|
|
||||||
args -Vw{w}p{p}f{d}l{l} {PC_F?} < > {SOURCE}
|
|
||||||
prop m
|
|
||||||
rts .p
|
|
||||||
need .p
|
|
||||||
end
|
|
||||||
name encode
|
|
||||||
from .e
|
|
||||||
to .k
|
|
||||||
program {EM}/lib/em_encode
|
|
||||||
args <
|
|
||||||
prop >m
|
|
||||||
end
|
|
||||||
name opt
|
|
||||||
from .k
|
|
||||||
to .m
|
|
||||||
program {EM}/lib/em_opt
|
|
||||||
mapflag -LIB OPT_F={OPT_F?} -L
|
|
||||||
args {OPT_F?} <
|
|
||||||
prop >O
|
|
||||||
end
|
|
||||||
name decode
|
|
||||||
from .k.m
|
|
||||||
to .e
|
|
||||||
program {EM}/lib/em_decode
|
|
||||||
args <
|
|
||||||
prop >
|
|
||||||
end
|
|
||||||
@@ -1,35 +0,0 @@
|
|||||||
var w=2
|
|
||||||
var p=2
|
|
||||||
var s=2
|
|
||||||
var l=4
|
|
||||||
var f=4
|
|
||||||
var d=8
|
|
||||||
var NAME=i8086
|
|
||||||
var M=i86
|
|
||||||
var LIB=mach/i86/lib/tail_
|
|
||||||
var LIBIBM=mach/ibm/lib/tail_
|
|
||||||
var RT=mach/i86/lib/head_
|
|
||||||
var RTIBM=mach/ibm/lib/head_
|
|
||||||
var INCLUDES=-I{EM}/include -I{EM}/mach/ibm/include
|
|
||||||
name be
|
|
||||||
from .m
|
|
||||||
to .s
|
|
||||||
program {EM}/lib/{M}_cg
|
|
||||||
args <
|
|
||||||
prop >
|
|
||||||
need .e
|
|
||||||
end
|
|
||||||
name asld
|
|
||||||
from .s.a
|
|
||||||
to a.out
|
|
||||||
program {EM}/lib/{M}_as
|
|
||||||
mapflag -l* LNAME={EM}/{LIB}*
|
|
||||||
mapflag -i IFILE={EM}/{RT}i
|
|
||||||
args {IFILE?} (.e:{HEAD}={EM}/{RTIBM}em) \
|
|
||||||
({RTS}:.c={EM}/{RT}cc) ({RTS}:.p={EM}/{RT}pc) -o > < \
|
|
||||||
(.p:{TAIL}={EM}/{LIB}pc) (.c:{TAIL}={EM}/{LIB}cc.1s {EM}/{LIB}cc.2g) \
|
|
||||||
(.e:{TAIL}={EM}/{LIBIBM}em) \
|
|
||||||
(.c.p:{TAIL}={EM}/{LIBIBM}mon) \
|
|
||||||
(.e:{TAIL}={EM}/{LIBIBM}em.vend)
|
|
||||||
prop C
|
|
||||||
end
|
|
||||||
@@ -1,34 +0,0 @@
|
|||||||
var w=2
|
|
||||||
var p=4
|
|
||||||
var s=2
|
|
||||||
var l=4
|
|
||||||
var f=4
|
|
||||||
var d=8
|
|
||||||
var NAME=m68k2
|
|
||||||
var M=m68k2
|
|
||||||
var LIBDIR=mach/m68k2/lib
|
|
||||||
var LIB=mach/m68k2/lib/tail_
|
|
||||||
var RT=mach/m68k2/lib/head_
|
|
||||||
var INCLUDES=-I{EM}/include -I/usr/include
|
|
||||||
name be
|
|
||||||
from .m
|
|
||||||
to .s
|
|
||||||
program {EM}/lib/{M}_cg
|
|
||||||
args <
|
|
||||||
prop >
|
|
||||||
need .e
|
|
||||||
end
|
|
||||||
name asld
|
|
||||||
from .s.a
|
|
||||||
to a.out
|
|
||||||
program {EM}/lib/{M}_as
|
|
||||||
mapflag -l* LNAME={EM}/{LIB}*
|
|
||||||
args (.e:{HEAD}={EM}/{RT}em) \
|
|
||||||
({RTS}:.c={EM}/{RT}cc) ({RTS}:.p={EM}/{RT}pc) -o > < \
|
|
||||||
(.p.c:{TAIL}={EM}/{LIBDIR}/sys1.s) (.p:{TAIL}={EM}/{LIBDIR}/sys2.s) \
|
|
||||||
(.c:{TAIL}={EM}/{LIBDIR}/write.s) \
|
|
||||||
(.p:{TAIL}={EM}/{LIB}pc) (.c:{TAIL}={EM}/{LIB}cc.1s {EM}/{LIB}cc.2g) \
|
|
||||||
(.c:{TAIL}={EM}/{LIB}mon {EM}/{LIB}fake) \
|
|
||||||
(.e:{TAIL}={EM}/{LIB}em.rt {EM}/{LIB}em.vend)
|
|
||||||
prop Cm
|
|
||||||
end
|
|
||||||
@@ -1,28 +0,0 @@
|
|||||||
var w=1
|
|
||||||
var p=2
|
|
||||||
var s=1
|
|
||||||
var l=2
|
|
||||||
var f=4
|
|
||||||
var d=8
|
|
||||||
var NAME=nascom
|
|
||||||
var M=z80a
|
|
||||||
var LIB=mach/z80a/lib/tail_
|
|
||||||
var RT=mach/z80a/lib/head_
|
|
||||||
var INCLUDES=-I{EM}/include -I/usr/include
|
|
||||||
name be
|
|
||||||
from .m
|
|
||||||
to .s
|
|
||||||
program {EM}/lib/{M}_be
|
|
||||||
args <
|
|
||||||
prop >
|
|
||||||
need .e
|
|
||||||
end
|
|
||||||
name asld
|
|
||||||
from .s.a
|
|
||||||
to a.out
|
|
||||||
program {EM}/lib/{M}_as
|
|
||||||
mapflag -l* LNAME={EM}/{LIB}*
|
|
||||||
args (.e:{HEAD}={EM}/{RT}em) ({RTS}:.c={EM}/{RT}cc) -o > \
|
|
||||||
(.e:{TAIL}={EM}/{LIB}em.1 {EM}/{LIB}em.2)
|
|
||||||
prop C
|
|
||||||
end
|
|
||||||
@@ -1,32 +0,0 @@
|
|||||||
var w=2
|
|
||||||
var p=2
|
|
||||||
var s=2
|
|
||||||
var l=4
|
|
||||||
var f=4
|
|
||||||
var d=8
|
|
||||||
var NAME=i8086
|
|
||||||
var M=i86
|
|
||||||
var LIB=mach/i86/lib/tail_
|
|
||||||
var RT=mach/i86/lib/head_
|
|
||||||
var INCLUDES=-I{EM}/include -I/usr/include
|
|
||||||
name be
|
|
||||||
from .m
|
|
||||||
to .s
|
|
||||||
program {EM}/lib/{M}_cg
|
|
||||||
args <
|
|
||||||
prop >
|
|
||||||
need .e
|
|
||||||
end
|
|
||||||
name asld
|
|
||||||
from .s.a
|
|
||||||
to a.out
|
|
||||||
program {EM}/lib/{M}_as
|
|
||||||
mapflag -l* LNAME={EM}/{LIB}*
|
|
||||||
mapflag -i IFILE={EM}/{RT}i
|
|
||||||
args {IFILE?} (.e:{HEAD}={EM}/{RT}em) \
|
|
||||||
({RTS}:.c={EM}/{RT}cc) ({RTS}:.p={EM}/{RT}pc) -o > < \
|
|
||||||
(.p:{TAIL}={EM}/{LIB}pc) (.c:{TAIL}={EM}/{LIB}cc.1s {EM}/{LIB}cc.2g) \
|
|
||||||
(.c.p.e:{TAIL}={EM}/{LIB}netio) (.c.p.e:{TAIL}={EM}/{LIB}alo) \
|
|
||||||
(.c.p:{TAIL}={EM}/{LIB}mon) (.e:{TAIL}={EM}/{LIB}em)
|
|
||||||
prop C
|
|
||||||
end
|
|
||||||
@@ -1,33 +0,0 @@
|
|||||||
var w=2
|
|
||||||
var p=2
|
|
||||||
var s=2
|
|
||||||
var l=4
|
|
||||||
var f=4
|
|
||||||
var d=8
|
|
||||||
var NAME=i8086
|
|
||||||
var M=i86
|
|
||||||
var LIB=mach/i86/lib/tail_
|
|
||||||
var ALIB=mach/i86/lib/sat_tail_
|
|
||||||
var RT=mach/i86/lib/head_
|
|
||||||
var ART=mach/i86/lib/sat_head_
|
|
||||||
var INCLUDES=-I{EM}/include -I/usr/include
|
|
||||||
name be
|
|
||||||
from .m
|
|
||||||
to .s
|
|
||||||
program {EM}/lib/{M}_cg
|
|
||||||
args <
|
|
||||||
prop >
|
|
||||||
need .e
|
|
||||||
end
|
|
||||||
name asld
|
|
||||||
from .s.a
|
|
||||||
to a.out
|
|
||||||
program {EM}/lib/{M}_as
|
|
||||||
mapflag -l* LNAME={EM}/{LIB}*
|
|
||||||
args (.e:{HEAD}={EM}/{ART}em) \
|
|
||||||
({RTS}:.c={EM}/{RT}cc) ({RTS}:.p={EM}/{RT}pc) -o > < \
|
|
||||||
(.p:{TAIL}={EM}/{LIB}pc) (.c:{TAIL}={EM}/{LIB}cc.1s {EM}/{LIB}cc.2g) \
|
|
||||||
(.c.p:{TAIL}={EM}/{ALIB}mon) (.c.p.e:{TAIL}={EM}/{LIB}alo) \
|
|
||||||
(.e:{TAIL}={EM}/{LIB}em)
|
|
||||||
prop C
|
|
||||||
end
|
|
||||||
@@ -1,27 +0,0 @@
|
|||||||
var w=2
|
|
||||||
var p=2
|
|
||||||
var s=2
|
|
||||||
var l=4
|
|
||||||
var f=4
|
|
||||||
var d=8
|
|
||||||
var M=int
|
|
||||||
var NAME=int22
|
|
||||||
var LIB=mach/int/lib/tail_
|
|
||||||
var RT=mach/int/lib/head_
|
|
||||||
var SIZE_FLAG=-sm
|
|
||||||
var INCLUDES=-I{EM}/include -I/usr/include
|
|
||||||
name asld
|
|
||||||
from .k.m.a
|
|
||||||
to e.out
|
|
||||||
program {EM}/lib/em_ass
|
|
||||||
mapflag -l* LNAME={EM}/{LIB}*
|
|
||||||
mapflag -+* ASS_F={ASS_F?} -+*
|
|
||||||
mapflag --* ASS_F={ASS_F?} --*
|
|
||||||
mapflag -s* SIZE_FLAG=-s*
|
|
||||||
args {SIZE_FLAG} \
|
|
||||||
({RTS}:.c={EM}/{RT}cc) ({RTS}:.p={EM}/{RT}pc) -o > < \
|
|
||||||
(.p:{TAIL}={EM}/{LIB}pc) \
|
|
||||||
(.c:{TAIL}={EM}/{LIB}cc.1s {EM}/{LIB}cc.2g) \
|
|
||||||
(.c.p:{TAIL}={EM}/{LIB}mon)
|
|
||||||
prop C
|
|
||||||
end
|
|
||||||
@@ -1,27 +0,0 @@
|
|||||||
var w=2
|
|
||||||
var p=2
|
|
||||||
var s=2
|
|
||||||
var l=4
|
|
||||||
var f=4
|
|
||||||
var d=8
|
|
||||||
var NAME=i8080
|
|
||||||
var M=8080
|
|
||||||
var LIB=mach/8080/lib/tail_
|
|
||||||
var RT=mach/8080/lib/head_
|
|
||||||
var INCLUDES=-I{EM}/include -I/usr/include
|
|
||||||
name be
|
|
||||||
from .m
|
|
||||||
to .s
|
|
||||||
program {EM}/lib/{M}_be
|
|
||||||
args <
|
|
||||||
prop >
|
|
||||||
need .e
|
|
||||||
end
|
|
||||||
name asld
|
|
||||||
from .s.a
|
|
||||||
to a.out
|
|
||||||
program {EM}/lib/{M}_as
|
|
||||||
mapflag -l* LNAME={EM}/{LIB}*
|
|
||||||
args ({RTS}:.c={EM}/{RT}cc) -o > <
|
|
||||||
prop C
|
|
||||||
end
|
|
||||||
@@ -1,32 +0,0 @@
|
|||||||
var w=2
|
|
||||||
var p=2
|
|
||||||
var s=2
|
|
||||||
var l=4
|
|
||||||
var f=4
|
|
||||||
var d=8
|
|
||||||
var NAME=i8086
|
|
||||||
var M=i86
|
|
||||||
var LIB=mach/i86/lib/tail_
|
|
||||||
var RT=mach/i86/lib/head_
|
|
||||||
var INCLUDES=-I{EM}/include -I/usr/include
|
|
||||||
name be
|
|
||||||
from .m
|
|
||||||
to .s
|
|
||||||
program {EM}/lib/{M}_cg
|
|
||||||
args <
|
|
||||||
prop >
|
|
||||||
need .e
|
|
||||||
end
|
|
||||||
name asld
|
|
||||||
from .s.a
|
|
||||||
to a.out
|
|
||||||
program {EM}/lib/{M}_as
|
|
||||||
mapflag -l* LNAME={EM}/{LIB}*
|
|
||||||
mapflag -i IFILE={EM}/{RT}i
|
|
||||||
args {IFILE?} (.e:{HEAD}={EM}/{RT}em) \
|
|
||||||
({RTS}:.c={EM}/{RT}cc) ({RTS}:.p={EM}/{RT}pc) -o > < \
|
|
||||||
(.p:{TAIL}={EM}/{LIB}pc) (.c:{TAIL}={EM}/{LIB}cc.1s {EM}/{LIB}cc.2g) \
|
|
||||||
(.c.p.e:{TAIL}={EM}/{LIB}alo) (.c.p:{TAIL}={EM}/{LIB}mon) \
|
|
||||||
(.e:{TAIL}={EM}/{LIB}em)
|
|
||||||
prop C
|
|
||||||
end
|
|
||||||
@@ -1,30 +0,0 @@
|
|||||||
var w=2
|
|
||||||
var p=4
|
|
||||||
var s=2
|
|
||||||
var l=4
|
|
||||||
var f=4
|
|
||||||
var d=8
|
|
||||||
var NAME=m68k2
|
|
||||||
var M=m68k2
|
|
||||||
var LIB=mach/m68k2/lib/tail_
|
|
||||||
var RT=mach/m68k2/lib/head_
|
|
||||||
var INCLUDES=-I{EM}/include -I/usr/include
|
|
||||||
name be
|
|
||||||
from .m
|
|
||||||
to .s
|
|
||||||
program {EM}/lib/{M}_cg
|
|
||||||
args <
|
|
||||||
prop >
|
|
||||||
need .e
|
|
||||||
end
|
|
||||||
name asld
|
|
||||||
from .s.a
|
|
||||||
to a.out
|
|
||||||
program {EM}/lib/{M}_as
|
|
||||||
mapflag -l* LNAME={EM}/{LIB}*
|
|
||||||
args (.e:{HEAD}={EM}/{RT}em) \
|
|
||||||
({RTS}:.c={EM}/{RT}cc) ({RTS}:.p={EM}/{RT}pc) -o > < \
|
|
||||||
(.p:{TAIL}={EM}/{LIB}pc) (.c:{TAIL}={EM}/{LIB}cc.1s {EM}/{LIB}cc.2g) \
|
|
||||||
(.e:{TAIL}={EM}/{LIB}em.rt {EM}/{LIB}mon {EM}/{LIB}em.vend)
|
|
||||||
prop Cm
|
|
||||||
end
|
|
||||||
@@ -1,34 +0,0 @@
|
|||||||
var w=4
|
|
||||||
var p=4
|
|
||||||
var s=2
|
|
||||||
var l=4
|
|
||||||
var f=4
|
|
||||||
var d=8
|
|
||||||
var NAME=m68k4
|
|
||||||
var M=m68k4
|
|
||||||
var LIBDIR=mach/m68k4/lib
|
|
||||||
var LIB=mach/m68k4/lib/tail_
|
|
||||||
var RT=mach/m68k4/lib/head_
|
|
||||||
var INCLUDES=-I{EM}/include -I/usr/include
|
|
||||||
name be
|
|
||||||
from .m
|
|
||||||
to .s
|
|
||||||
program {EM}/lib/{M}_cg
|
|
||||||
args <
|
|
||||||
prop >
|
|
||||||
need .e
|
|
||||||
end
|
|
||||||
name asld
|
|
||||||
from .s.a
|
|
||||||
to a.out
|
|
||||||
program {EM}/lib/{M}_as
|
|
||||||
mapflag -l* LNAME={EM}/{LIB}*
|
|
||||||
args (.e:{HEAD}={EM}/{RT}em) \
|
|
||||||
({RTS}:.c={EM}/{RT}cc) ({RTS}:.p={EM}/{RT}pc) -o > < \
|
|
||||||
(.p.c:{TAIL}={EM}/{LIBDIR}/sys1.s) (.p:{TAIL}={EM}/{LIBDIR}/sys2.s) \
|
|
||||||
(.c:{TAIL}={EM}/{LIBDIR}/write.s) \
|
|
||||||
(.p:{TAIL}={EM}/{LIB}pc) (.c:{TAIL}={EM}/{LIB}cc.1s {EM}/{LIB}cc.2g) \
|
|
||||||
(.c:{TAIL}={EM}/{LIB}mon {EM}/{LIB}fake) \
|
|
||||||
(.e:{TAIL}={EM}/{LIB}em.rt {EM}/{LIB}em.vend)
|
|
||||||
prop Cm
|
|
||||||
end
|
|
||||||
@@ -1,38 +0,0 @@
|
|||||||
var w=2
|
|
||||||
var p=2
|
|
||||||
var s=2
|
|
||||||
var l=4
|
|
||||||
var f=4
|
|
||||||
var d=8
|
|
||||||
var M=pdp
|
|
||||||
var NAME=pdp
|
|
||||||
var LIB=mach/pdp/lib/tail_
|
|
||||||
var RT=mach/pdp/lib/head_
|
|
||||||
var INCLUDES=-I{EM}/include -I/usr/include
|
|
||||||
name be
|
|
||||||
from .m
|
|
||||||
to .s
|
|
||||||
program {EM}/lib/{M}_cg
|
|
||||||
args <
|
|
||||||
prop >
|
|
||||||
need .e
|
|
||||||
end
|
|
||||||
name as
|
|
||||||
from .s
|
|
||||||
to .o
|
|
||||||
program /bin/as
|
|
||||||
args - -o > <
|
|
||||||
prop m
|
|
||||||
end
|
|
||||||
name ld
|
|
||||||
from .o.a
|
|
||||||
to a.out
|
|
||||||
program /bin/ld
|
|
||||||
mapflag -l* LNAME={EM}/{LIB}*
|
|
||||||
args (.e:{HEAD}={EM}/{RT}em) \
|
|
||||||
({RTS}:.c={EM}/{RT}cc) ({RTS}:.p={EM}/{RT}pc) -o > < \
|
|
||||||
(.p:{TAIL}={EM}/{LIB}pc) \
|
|
||||||
(.c:{TAIL}={EM}/{LIB}cc.1s {EM}/{LIB}cc.2g) \
|
|
||||||
(.e:{TAIL}={EM}/{LIB}em) (.c.p:{TAIL}=/lib/libc.a)
|
|
||||||
prop C
|
|
||||||
end
|
|
||||||
@@ -1,32 +0,0 @@
|
|||||||
var w=2
|
|
||||||
var p=4
|
|
||||||
var s=2
|
|
||||||
var l=4
|
|
||||||
var f=4
|
|
||||||
var d=8
|
|
||||||
var NAME=m68k2
|
|
||||||
var M=m68k2
|
|
||||||
var LIB=mach/m68k2/lib/tail_
|
|
||||||
var RT=mach/m68k2/lib/head_
|
|
||||||
var INCLUDES=-I{EM}/include -I/usr/include
|
|
||||||
name be
|
|
||||||
from .m
|
|
||||||
to .o
|
|
||||||
program {EM}/lib/{M}_cg
|
|
||||||
args <
|
|
||||||
prop >
|
|
||||||
need .e
|
|
||||||
end
|
|
||||||
name asld
|
|
||||||
from .o.s.a
|
|
||||||
to a.out
|
|
||||||
program {EM}/lib/{M}_as
|
|
||||||
mapflag -l* LNAME={EM}/{LIB}*
|
|
||||||
mapflag -i
|
|
||||||
mapflag -n
|
|
||||||
args (.e:{HEAD}={EM}/{RT}em.pmds) \
|
|
||||||
({RTS}:.c={EM}/{RT}cc) ({RTS}:.p={EM}/{RT}pc) -o > < \
|
|
||||||
(.p:{TAIL}={EM}/{LIB}pc) (.c:{TAIL}={EM}/{LIB}cc.1s {EM}/{LIB}cc.2g) \
|
|
||||||
(.e:{TAIL}={EM}/{LIB}em.rt {EM}/{LIB}mon.pmds {EM}/{LIB}em.vend)
|
|
||||||
prop Cm
|
|
||||||
end
|
|
||||||
@@ -1,44 +0,0 @@
|
|||||||
var w=4
|
|
||||||
var p=4
|
|
||||||
var s=2
|
|
||||||
var l=4
|
|
||||||
var f=4
|
|
||||||
var d=8
|
|
||||||
var M=vax4
|
|
||||||
var NAME=vax4
|
|
||||||
var LIB=mach/vax4/lib/tail_
|
|
||||||
var RT=mach/vax4/lib/head_
|
|
||||||
var INCLUDES=-I{EM}/include -I/usr/include
|
|
||||||
name be
|
|
||||||
from .m
|
|
||||||
to .s
|
|
||||||
program {EM}/lib/{M}_cg
|
|
||||||
args <
|
|
||||||
prop >
|
|
||||||
need .e
|
|
||||||
end
|
|
||||||
name asopt
|
|
||||||
from .s
|
|
||||||
to .so
|
|
||||||
program /bin/sed
|
|
||||||
args -f {EM}/mach/vax4/cg/sedf
|
|
||||||
prop O<>
|
|
||||||
end
|
|
||||||
name as
|
|
||||||
from .s.so
|
|
||||||
to .o
|
|
||||||
program /bin/as
|
|
||||||
args - -o > <
|
|
||||||
prop m
|
|
||||||
end
|
|
||||||
name ld
|
|
||||||
from .o.a
|
|
||||||
to a.out
|
|
||||||
program /bin/ld
|
|
||||||
mapflag -l* LNAME={EM}/{LIB}*
|
|
||||||
args (.e:{HEAD}={EM}/{RT}em) \
|
|
||||||
({RTS}:.c={EM}/{RT}cc) ({RTS}:.p={EM}/{RT}pc) -o > < \
|
|
||||||
(.p:{TAIL}={EM}/{LIB}pc) (.c:{TAIL}={EM}/{LIB}cc.1s {EM}/{LIB}cc.2g) \
|
|
||||||
(.c.p:{TAIL}={EM}/{LIB}mon) (.e:{TAIL}={EM}/{LIB}em)
|
|
||||||
prop C
|
|
||||||
end
|
|
||||||
@@ -1,31 +0,0 @@
|
|||||||
var w=2
|
|
||||||
var p=2
|
|
||||||
var s=2
|
|
||||||
var l=4
|
|
||||||
var f=4
|
|
||||||
var d=8
|
|
||||||
var NAME=z80
|
|
||||||
var M=z80
|
|
||||||
var LIB=mach/z80/lib/tail_
|
|
||||||
var RT=mach/z80/lib/head_
|
|
||||||
var INCLUDES=-I{EM}/include -I/usr/include
|
|
||||||
name be
|
|
||||||
from .m
|
|
||||||
to .s
|
|
||||||
program {EM}/lib/{M}_cg
|
|
||||||
args <
|
|
||||||
prop >
|
|
||||||
need .e
|
|
||||||
end
|
|
||||||
name asld
|
|
||||||
from .s.a
|
|
||||||
to a.out
|
|
||||||
program {EM}/lib/{M}_as
|
|
||||||
mapflag -l* LNAME={EM}/{LIB}*
|
|
||||||
mapflag -i IFILE={EM}/{RT}i
|
|
||||||
args {IFILE?} (.e:{HEAD}={EM}/{RT}em) \
|
|
||||||
({RTS}:.c={EM}/{RT}cc) ({RTS}:.p={EM}/{RT}pc) -o > < \
|
|
||||||
(.p:{TAIL}={EM}/{LIB}pc) (.c:{TAIL}={EM}/{LIB}cc.1s {EM}/{LIB}cc.2g) \
|
|
||||||
(.p.c:{TAIL}={EM}/{LIB}mon) (.e:{TAIL}={EM}/{LIB}em)
|
|
||||||
prop C
|
|
||||||
end
|
|
||||||
@@ -1,31 +0,0 @@
|
|||||||
var w=2
|
|
||||||
var p=2
|
|
||||||
var s=2
|
|
||||||
var l=4
|
|
||||||
var f=4
|
|
||||||
var d=8
|
|
||||||
var NAME=z8000
|
|
||||||
var M=z8000
|
|
||||||
var LIB=mach/z8000/lib/tail_
|
|
||||||
var RT=mach/z8000/lib/head_
|
|
||||||
var INCLUDES=-I{EM}/include -I/usr/include
|
|
||||||
name be
|
|
||||||
from .m
|
|
||||||
to .s
|
|
||||||
program {EM}/lib/{M}_cg
|
|
||||||
args <
|
|
||||||
prop >
|
|
||||||
need .e
|
|
||||||
end
|
|
||||||
name asld
|
|
||||||
from .s.a
|
|
||||||
to a.out
|
|
||||||
program {EM}/lib/{M}_as
|
|
||||||
mapflag -l* LNAME={EM}/{LIB}*
|
|
||||||
mapflag -i IFILE={EM}/{RT}i
|
|
||||||
args {IFILE?} (.e:{HEAD}={EM}/{RT}em) \
|
|
||||||
({RTS}:.c={EM}/{RT}cc) ({RTS}:.p={EM}/{RT}pc) -o > < \
|
|
||||||
(.p:{TAIL}={EM}/{LIB}pc) (.c:{TAIL}={EM}/{LIB}cc.1s {EM}/{LIB}cc.2g) \
|
|
||||||
(.p.c:{TAIL}={EM}/{LIB}mon) (.e:{TAIL}={EM}/{LIB}em)
|
|
||||||
prop C
|
|
||||||
end
|
|
||||||
@@ -1,178 +0,0 @@
|
|||||||
# $Header$
|
|
||||||
|
|
||||||
PREFLAGS=-I../../../h -I. -DNDEBUG
|
|
||||||
PFLAGS=
|
|
||||||
CFLAGS=$(PREFLAGS) $(PFLAGS) -O
|
|
||||||
LDFLAGS=-i $(PFLAGS)
|
|
||||||
LINTOPTS=-hbxac
|
|
||||||
LIBS=../../../lib/em_data.a
|
|
||||||
CDIR=../../proto/cg
|
|
||||||
CFILES=$(CDIR)/codegen.c $(CDIR)/compute.c $(CDIR)/equiv.c $(CDIR)/fillem.c \
|
|
||||||
$(CDIR)/gencode.c $(CDIR)/glosym.c $(CDIR)/main.c $(CDIR)/move.c \
|
|
||||||
$(CDIR)/nextem.c $(CDIR)/reg.c $(CDIR)/regvar.c $(CDIR)/salloc.c \
|
|
||||||
$(CDIR)/state.c $(CDIR)/subr.c $(CDIR)/var.c
|
|
||||||
OFILES=codegen.o compute.o equiv.o fillem.o gencode.o glosym.o main.o\
|
|
||||||
move.o nextem.o reg.o regvar.o salloc.o state.o subr.o var.o
|
|
||||||
|
|
||||||
all:
|
|
||||||
make tables.c
|
|
||||||
make cg
|
|
||||||
|
|
||||||
cg: tables.o $(OFILES)
|
|
||||||
cc $(LDFLAGS) $(OFILES) tables.o $(LIBS) -o cg
|
|
||||||
|
|
||||||
tables.o: tables.c
|
|
||||||
cc -c $(PREFLAGS) -I$(CDIR) tables.c
|
|
||||||
|
|
||||||
codegen.o: $(CDIR)/codegen.c
|
|
||||||
cc -c $(CFLAGS) $(CDIR)/codegen.c
|
|
||||||
compute.o: $(CDIR)/compute.c
|
|
||||||
cc -c $(CFLAGS) $(CDIR)/compute.c
|
|
||||||
equiv.o: $(CDIR)/equiv.c
|
|
||||||
cc -c $(CFLAGS) $(CDIR)/equiv.c
|
|
||||||
fillem.o: $(CDIR)/fillem.c
|
|
||||||
cc -c $(CFLAGS) $(CDIR)/fillem.c
|
|
||||||
gencode.o: $(CDIR)/gencode.c
|
|
||||||
cc -c $(CFLAGS) $(CDIR)/gencode.c
|
|
||||||
glosym.o: $(CDIR)/glosym.c
|
|
||||||
cc -c $(CFLAGS) $(CDIR)/glosym.c
|
|
||||||
main.o: $(CDIR)/main.c
|
|
||||||
cc -c $(CFLAGS) $(CDIR)/main.c
|
|
||||||
move.o: $(CDIR)/move.c
|
|
||||||
cc -c $(CFLAGS) $(CDIR)/move.c
|
|
||||||
nextem.o: $(CDIR)/nextem.c
|
|
||||||
cc -c $(CFLAGS) $(CDIR)/nextem.c
|
|
||||||
reg.o: $(CDIR)/reg.c
|
|
||||||
cc -c $(CFLAGS) $(CDIR)/reg.c
|
|
||||||
regvar.o: $(CDIR)/regvar.c
|
|
||||||
cc -c $(CFLAGS) $(CDIR)/regvar.c
|
|
||||||
salloc.o: $(CDIR)/salloc.c
|
|
||||||
cc -c $(CFLAGS) $(CDIR)/salloc.c
|
|
||||||
state.o: $(CDIR)/state.c
|
|
||||||
cc -c $(CFLAGS) $(CDIR)/state.c
|
|
||||||
subr.o: $(CDIR)/subr.c
|
|
||||||
cc -c $(CFLAGS) $(CDIR)/subr.c
|
|
||||||
var.o: $(CDIR)/var.c
|
|
||||||
cc -c $(CFLAGS) $(CDIR)/var.c
|
|
||||||
|
|
||||||
install: all
|
|
||||||
../install cg
|
|
||||||
|
|
||||||
cmp: all
|
|
||||||
-../compare cg
|
|
||||||
|
|
||||||
|
|
||||||
tables.c: table
|
|
||||||
-mv tables.h tables.h.save
|
|
||||||
../../../lib/cpp -P table | ../../../lib/cgg > debug.out
|
|
||||||
-if cmp -s tables.h.save tables.h; then mv tables.h.save tables.h; else exit 0; fi
|
|
||||||
-if cmp -s /dev/null tables.h; then mv tables.h.save tables.h; else exit 0; fi
|
|
||||||
|
|
||||||
lint: $(CFILES)
|
|
||||||
lint $(LINTOPTS) $(PREFLAGS) $(CFILES)
|
|
||||||
clean:
|
|
||||||
rm -f *.o tables.c tables.h debug.out cg tables.h.save
|
|
||||||
|
|
||||||
codegen.o: $(CDIR)/assert.h
|
|
||||||
codegen.o: $(CDIR)/data.h
|
|
||||||
codegen.o: $(CDIR)/equiv.h
|
|
||||||
codegen.o: $(CDIR)/extern.h
|
|
||||||
codegen.o: $(CDIR)/param.h
|
|
||||||
codegen.o: $(CDIR)/result.h
|
|
||||||
codegen.o: $(CDIR)/state.h
|
|
||||||
codegen.o: tables.h
|
|
||||||
codegen.o: $(CDIR)/types.h
|
|
||||||
compute.o: $(CDIR)/assert.h
|
|
||||||
compute.o: $(CDIR)/data.h
|
|
||||||
compute.o: $(CDIR)/extern.h
|
|
||||||
compute.o: $(CDIR)/glosym.h
|
|
||||||
compute.o: $(CDIR)/param.h
|
|
||||||
compute.o: $(CDIR)/result.h
|
|
||||||
compute.o: tables.h
|
|
||||||
compute.o: $(CDIR)/types.h
|
|
||||||
equiv.o: $(CDIR)/assert.h
|
|
||||||
equiv.o: $(CDIR)/data.h
|
|
||||||
equiv.o: $(CDIR)/equiv.h
|
|
||||||
equiv.o: $(CDIR)/extern.h
|
|
||||||
equiv.o: $(CDIR)/param.h
|
|
||||||
equiv.o: $(CDIR)/result.h
|
|
||||||
equiv.o: tables.h
|
|
||||||
equiv.o: $(CDIR)/types.h
|
|
||||||
fillem.o: $(CDIR)/assert.h
|
|
||||||
fillem.o: $(CDIR)/data.h
|
|
||||||
fillem.o: $(CDIR)/extern.h
|
|
||||||
fillem.o: mach.c
|
|
||||||
fillem.o: mach.h
|
|
||||||
fillem.o: $(CDIR)/param.h
|
|
||||||
fillem.o: $(CDIR)/regvar.h
|
|
||||||
fillem.o: $(CDIR)/result.h
|
|
||||||
fillem.o: tables.h
|
|
||||||
fillem.o: $(CDIR)/types.h
|
|
||||||
gencode.o: $(CDIR)/assert.h
|
|
||||||
gencode.o: $(CDIR)/data.h
|
|
||||||
gencode.o: $(CDIR)/extern.h
|
|
||||||
gencode.o: $(CDIR)/param.h
|
|
||||||
gencode.o: $(CDIR)/result.h
|
|
||||||
gencode.o: tables.h
|
|
||||||
gencode.o: $(CDIR)/types.h
|
|
||||||
glosym.o: $(CDIR)/glosym.h
|
|
||||||
glosym.o: $(CDIR)/param.h
|
|
||||||
glosym.o: tables.h
|
|
||||||
glosym.o: $(CDIR)/types.h
|
|
||||||
main.o: $(CDIR)/param.h
|
|
||||||
move.o: $(CDIR)/assert.h
|
|
||||||
move.o: $(CDIR)/data.h
|
|
||||||
move.o: $(CDIR)/extern.h
|
|
||||||
move.o: $(CDIR)/param.h
|
|
||||||
move.o: $(CDIR)/result.h
|
|
||||||
move.o: tables.h
|
|
||||||
move.o: $(CDIR)/types.h
|
|
||||||
nextem.o: $(CDIR)/assert.h
|
|
||||||
nextem.o: $(CDIR)/data.h
|
|
||||||
nextem.o: $(CDIR)/extern.h
|
|
||||||
nextem.o: $(CDIR)/param.h
|
|
||||||
nextem.o: $(CDIR)/result.h
|
|
||||||
nextem.o: tables.h
|
|
||||||
nextem.o: $(CDIR)/types.h
|
|
||||||
reg.o: $(CDIR)/assert.h
|
|
||||||
reg.o: $(CDIR)/data.h
|
|
||||||
reg.o: $(CDIR)/extern.h
|
|
||||||
reg.o: $(CDIR)/param.h
|
|
||||||
reg.o: $(CDIR)/result.h
|
|
||||||
reg.o: tables.h
|
|
||||||
reg.o: $(CDIR)/types.h
|
|
||||||
regvar.o: $(CDIR)/assert.h
|
|
||||||
regvar.o: $(CDIR)/data.h
|
|
||||||
regvar.o: $(CDIR)/extern.h
|
|
||||||
regvar.o: $(CDIR)/param.h
|
|
||||||
regvar.o: $(CDIR)/regvar.h
|
|
||||||
regvar.o: $(CDIR)/result.h
|
|
||||||
regvar.o: tables.h
|
|
||||||
regvar.o: $(CDIR)/types.h
|
|
||||||
salloc.o: $(CDIR)/assert.h
|
|
||||||
salloc.o: $(CDIR)/data.h
|
|
||||||
salloc.o: $(CDIR)/extern.h
|
|
||||||
salloc.o: $(CDIR)/param.h
|
|
||||||
salloc.o: $(CDIR)/result.h
|
|
||||||
salloc.o: tables.h
|
|
||||||
salloc.o: $(CDIR)/types.h
|
|
||||||
state.o: $(CDIR)/assert.h
|
|
||||||
state.o: $(CDIR)/data.h
|
|
||||||
state.o: $(CDIR)/extern.h
|
|
||||||
state.o: $(CDIR)/param.h
|
|
||||||
state.o: $(CDIR)/result.h
|
|
||||||
state.o: $(CDIR)/state.h
|
|
||||||
state.o: tables.h
|
|
||||||
state.o: $(CDIR)/types.h
|
|
||||||
subr.o: $(CDIR)/assert.h
|
|
||||||
subr.o: $(CDIR)/data.h
|
|
||||||
subr.o: $(CDIR)/extern.h
|
|
||||||
subr.o: $(CDIR)/param.h
|
|
||||||
subr.o: $(CDIR)/result.h
|
|
||||||
subr.o: tables.h
|
|
||||||
subr.o: $(CDIR)/types.h
|
|
||||||
var.o: $(CDIR)/data.h
|
|
||||||
var.o: $(CDIR)/param.h
|
|
||||||
var.o: $(CDIR)/result.h
|
|
||||||
var.o: tables.h
|
|
||||||
var.o: $(CDIR)/types.h
|
|
||||||
@@ -1,72 +0,0 @@
|
|||||||
con_part(sz,w) register sz; word w; {
|
|
||||||
|
|
||||||
while (part_size % sz)
|
|
||||||
part_size++;
|
|
||||||
if (part_size == EM_WSIZE)
|
|
||||||
part_flush();
|
|
||||||
if (sz == 1) {
|
|
||||||
w &= 0xFF;
|
|
||||||
if (part_size)
|
|
||||||
w <<= 8;
|
|
||||||
part_word |= w;
|
|
||||||
} else {
|
|
||||||
assert(sz == 2);
|
|
||||||
part_word = w;
|
|
||||||
}
|
|
||||||
part_size += sz;
|
|
||||||
}
|
|
||||||
|
|
||||||
con_mult(sz) word sz; {
|
|
||||||
long l;
|
|
||||||
|
|
||||||
if (sz != 4)
|
|
||||||
fatal("bad icon/ucon size");
|
|
||||||
l = atol(str);
|
|
||||||
fprintf(codefile,".short\t%d\n",(int) l);
|
|
||||||
fprintf(codefile,".short\t%d\n",(int) (l >> 16));
|
|
||||||
}
|
|
||||||
|
|
||||||
con_float() {
|
|
||||||
fatal("no reals");
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
prolog(nlocals) full nlocals; {
|
|
||||||
|
|
||||||
fprintf(codefile,"\tjsr Pro\n");
|
|
||||||
if (nlocals == 0)
|
|
||||||
return;
|
|
||||||
else
|
|
||||||
fprintf(codefile,
|
|
||||||
"\tldx #[%d].h\n\tlda #[%d].l\n\tjsr Lcs\n",
|
|
||||||
nlocals, nlocals);
|
|
||||||
}
|
|
||||||
|
|
||||||
mes(type) word type; {
|
|
||||||
int argt ;
|
|
||||||
|
|
||||||
switch ( (int)type ) {
|
|
||||||
case ms_ext :
|
|
||||||
for (;;) {
|
|
||||||
switch ( argt=getarg(
|
|
||||||
ptyp(sp_cend)|ptyp(sp_pnam)|sym_ptyp) ) {
|
|
||||||
case sp_cend :
|
|
||||||
return ;
|
|
||||||
default:
|
|
||||||
strarg(argt) ;
|
|
||||||
fprintf(codefile,".define %s\n",argstr) ;
|
|
||||||
break ;
|
|
||||||
}
|
|
||||||
}
|
|
||||||
default :
|
|
||||||
while ( getarg(any_ptyp) != sp_cend ) ;
|
|
||||||
break ;
|
|
||||||
}
|
|
||||||
}
|
|
||||||
|
|
||||||
char *segname[] = {
|
|
||||||
".text", /* SEGTXT */
|
|
||||||
".data", /* SEGCON */
|
|
||||||
".data", /* SEGROM */
|
|
||||||
".bss" /* SEGBSS */
|
|
||||||
};
|
|
||||||
@@ -1,24 +0,0 @@
|
|||||||
#define ex_ap(y) fprintf(codefile,".extern %s\n",y)
|
|
||||||
#define in_ap(y) /* nothing */
|
|
||||||
|
|
||||||
#define newilb(x) fprintf(codefile,"%s:\n",x)
|
|
||||||
#define newdlb(x) fprintf(codefile,"%s:\n",x)
|
|
||||||
#define dlbdlb(x,y) fprintf(codefile,"%s = %s\n",x,y)
|
|
||||||
#define newlbss(l,x) fprintf(codefile,"%s: .space\t%d\n",l,x);
|
|
||||||
|
|
||||||
#define cst_fmt "%d"
|
|
||||||
#define off_fmt "%d"
|
|
||||||
#define ilb_fmt "I%02x%x"
|
|
||||||
#define dlb_fmt "_%d"
|
|
||||||
#define hol_fmt "hol%d"
|
|
||||||
|
|
||||||
#define hol_off "%d+hol%d"
|
|
||||||
|
|
||||||
#define con_cst(x) fprintf(codefile,".word\t%d\n",x)
|
|
||||||
#define con_ilb(x) fprintf(codefile,".word\t%s\n",x)
|
|
||||||
#define con_dlb(x) fprintf(codefile,".word\t%s\n",x)
|
|
||||||
|
|
||||||
#define modhead ""
|
|
||||||
|
|
||||||
#define id_first '_'
|
|
||||||
#define BSS_INIT 0
|
|
||||||
2212
mach/6500/cg/table
2212
mach/6500/cg/table
File diff suppressed because it is too large
Load Diff
@@ -1,178 +0,0 @@
|
|||||||
# $Header$
|
|
||||||
|
|
||||||
PREFLAGS=-I../../../h -I. -DNDEBUG
|
|
||||||
PFLAGS=
|
|
||||||
CFLAGS=$(PREFLAGS) $(PFLAGS) -O
|
|
||||||
LDFLAGS=-i $(PFLAGS)
|
|
||||||
LINTOPTS=-hbxac
|
|
||||||
LIBS=../../../lib/em_data.a
|
|
||||||
CDIR=../../proto/cg
|
|
||||||
CFILES=$(CDIR)/codegen.c $(CDIR)/compute.c $(CDIR)/equiv.c $(CDIR)/fillem.c \
|
|
||||||
$(CDIR)/gencode.c $(CDIR)/glosym.c $(CDIR)/main.c $(CDIR)/move.c \
|
|
||||||
$(CDIR)/nextem.c $(CDIR)/reg.c $(CDIR)/regvar.c $(CDIR)/salloc.c \
|
|
||||||
$(CDIR)/state.c $(CDIR)/subr.c $(CDIR)/var.c
|
|
||||||
OFILES=codegen.o compute.o equiv.o fillem.o gencode.o glosym.o main.o\
|
|
||||||
move.o nextem.o reg.o regvar.o salloc.o state.o subr.o var.o
|
|
||||||
|
|
||||||
all:
|
|
||||||
make tables.c
|
|
||||||
make cg
|
|
||||||
|
|
||||||
cg: tables.o $(OFILES)
|
|
||||||
cc $(LDFLAGS) $(OFILES) tables.o $(LIBS) -o cg
|
|
||||||
|
|
||||||
tables.o: tables.c
|
|
||||||
cc -c $(PREFLAGS) -I$(CDIR) tables.c
|
|
||||||
|
|
||||||
codegen.o: $(CDIR)/codegen.c
|
|
||||||
cc -c $(CFLAGS) $(CDIR)/codegen.c
|
|
||||||
compute.o: $(CDIR)/compute.c
|
|
||||||
cc -c $(CFLAGS) $(CDIR)/compute.c
|
|
||||||
equiv.o: $(CDIR)/equiv.c
|
|
||||||
cc -c $(CFLAGS) $(CDIR)/equiv.c
|
|
||||||
fillem.o: $(CDIR)/fillem.c
|
|
||||||
cc -c $(CFLAGS) $(CDIR)/fillem.c
|
|
||||||
gencode.o: $(CDIR)/gencode.c
|
|
||||||
cc -c $(CFLAGS) $(CDIR)/gencode.c
|
|
||||||
glosym.o: $(CDIR)/glosym.c
|
|
||||||
cc -c $(CFLAGS) $(CDIR)/glosym.c
|
|
||||||
main.o: $(CDIR)/main.c
|
|
||||||
cc -c $(CFLAGS) $(CDIR)/main.c
|
|
||||||
move.o: $(CDIR)/move.c
|
|
||||||
cc -c $(CFLAGS) $(CDIR)/move.c
|
|
||||||
nextem.o: $(CDIR)/nextem.c
|
|
||||||
cc -c $(CFLAGS) $(CDIR)/nextem.c
|
|
||||||
reg.o: $(CDIR)/reg.c
|
|
||||||
cc -c $(CFLAGS) $(CDIR)/reg.c
|
|
||||||
regvar.o: $(CDIR)/regvar.c
|
|
||||||
cc -c $(CFLAGS) $(CDIR)/regvar.c
|
|
||||||
salloc.o: $(CDIR)/salloc.c
|
|
||||||
cc -c $(CFLAGS) $(CDIR)/salloc.c
|
|
||||||
state.o: $(CDIR)/state.c
|
|
||||||
cc -c $(CFLAGS) $(CDIR)/state.c
|
|
||||||
subr.o: $(CDIR)/subr.c
|
|
||||||
cc -c $(CFLAGS) $(CDIR)/subr.c
|
|
||||||
var.o: $(CDIR)/var.c
|
|
||||||
cc -c $(CFLAGS) $(CDIR)/var.c
|
|
||||||
|
|
||||||
install: all
|
|
||||||
../install cg
|
|
||||||
|
|
||||||
cmp: all
|
|
||||||
-../compare cg
|
|
||||||
|
|
||||||
|
|
||||||
tables.c: table
|
|
||||||
-mv tables.h tables.h.save
|
|
||||||
../../../lib/cpp -P table | ../../../lib/cgg > debug.out
|
|
||||||
-if cmp -s tables.h.save tables.h; then mv tables.h.save tables.h; else exit 0; fi
|
|
||||||
-if cmp -s /dev/null tables.h; then mv tables.h.save tables.h; else exit 0; fi
|
|
||||||
|
|
||||||
lint: $(CFILES)
|
|
||||||
lint $(LINTOPTS) $(PREFLAGS) $(CFILES)
|
|
||||||
clean:
|
|
||||||
rm -f *.o tables.c tables.h debug.out cg tables.h.save
|
|
||||||
|
|
||||||
codegen.o: $(CDIR)/assert.h
|
|
||||||
codegen.o: $(CDIR)/data.h
|
|
||||||
codegen.o: $(CDIR)/equiv.h
|
|
||||||
codegen.o: $(CDIR)/extern.h
|
|
||||||
codegen.o: $(CDIR)/param.h
|
|
||||||
codegen.o: $(CDIR)/result.h
|
|
||||||
codegen.o: $(CDIR)/state.h
|
|
||||||
codegen.o: tables.h
|
|
||||||
codegen.o: $(CDIR)/types.h
|
|
||||||
compute.o: $(CDIR)/assert.h
|
|
||||||
compute.o: $(CDIR)/data.h
|
|
||||||
compute.o: $(CDIR)/extern.h
|
|
||||||
compute.o: $(CDIR)/glosym.h
|
|
||||||
compute.o: $(CDIR)/param.h
|
|
||||||
compute.o: $(CDIR)/result.h
|
|
||||||
compute.o: tables.h
|
|
||||||
compute.o: $(CDIR)/types.h
|
|
||||||
equiv.o: $(CDIR)/assert.h
|
|
||||||
equiv.o: $(CDIR)/data.h
|
|
||||||
equiv.o: $(CDIR)/equiv.h
|
|
||||||
equiv.o: $(CDIR)/extern.h
|
|
||||||
equiv.o: $(CDIR)/param.h
|
|
||||||
equiv.o: $(CDIR)/result.h
|
|
||||||
equiv.o: tables.h
|
|
||||||
equiv.o: $(CDIR)/types.h
|
|
||||||
fillem.o: $(CDIR)/assert.h
|
|
||||||
fillem.o: $(CDIR)/data.h
|
|
||||||
fillem.o: $(CDIR)/extern.h
|
|
||||||
fillem.o: mach.c
|
|
||||||
fillem.o: mach.h
|
|
||||||
fillem.o: $(CDIR)/param.h
|
|
||||||
fillem.o: $(CDIR)/regvar.h
|
|
||||||
fillem.o: $(CDIR)/result.h
|
|
||||||
fillem.o: tables.h
|
|
||||||
fillem.o: $(CDIR)/types.h
|
|
||||||
gencode.o: $(CDIR)/assert.h
|
|
||||||
gencode.o: $(CDIR)/data.h
|
|
||||||
gencode.o: $(CDIR)/extern.h
|
|
||||||
gencode.o: $(CDIR)/param.h
|
|
||||||
gencode.o: $(CDIR)/result.h
|
|
||||||
gencode.o: tables.h
|
|
||||||
gencode.o: $(CDIR)/types.h
|
|
||||||
glosym.o: $(CDIR)/glosym.h
|
|
||||||
glosym.o: $(CDIR)/param.h
|
|
||||||
glosym.o: tables.h
|
|
||||||
glosym.o: $(CDIR)/types.h
|
|
||||||
main.o: $(CDIR)/param.h
|
|
||||||
move.o: $(CDIR)/assert.h
|
|
||||||
move.o: $(CDIR)/data.h
|
|
||||||
move.o: $(CDIR)/extern.h
|
|
||||||
move.o: $(CDIR)/param.h
|
|
||||||
move.o: $(CDIR)/result.h
|
|
||||||
move.o: tables.h
|
|
||||||
move.o: $(CDIR)/types.h
|
|
||||||
nextem.o: $(CDIR)/assert.h
|
|
||||||
nextem.o: $(CDIR)/data.h
|
|
||||||
nextem.o: $(CDIR)/extern.h
|
|
||||||
nextem.o: $(CDIR)/param.h
|
|
||||||
nextem.o: $(CDIR)/result.h
|
|
||||||
nextem.o: tables.h
|
|
||||||
nextem.o: $(CDIR)/types.h
|
|
||||||
reg.o: $(CDIR)/assert.h
|
|
||||||
reg.o: $(CDIR)/data.h
|
|
||||||
reg.o: $(CDIR)/extern.h
|
|
||||||
reg.o: $(CDIR)/param.h
|
|
||||||
reg.o: $(CDIR)/result.h
|
|
||||||
reg.o: tables.h
|
|
||||||
reg.o: $(CDIR)/types.h
|
|
||||||
regvar.o: $(CDIR)/assert.h
|
|
||||||
regvar.o: $(CDIR)/data.h
|
|
||||||
regvar.o: $(CDIR)/extern.h
|
|
||||||
regvar.o: $(CDIR)/param.h
|
|
||||||
regvar.o: $(CDIR)/regvar.h
|
|
||||||
regvar.o: $(CDIR)/result.h
|
|
||||||
regvar.o: tables.h
|
|
||||||
regvar.o: $(CDIR)/types.h
|
|
||||||
salloc.o: $(CDIR)/assert.h
|
|
||||||
salloc.o: $(CDIR)/data.h
|
|
||||||
salloc.o: $(CDIR)/extern.h
|
|
||||||
salloc.o: $(CDIR)/param.h
|
|
||||||
salloc.o: $(CDIR)/result.h
|
|
||||||
salloc.o: tables.h
|
|
||||||
salloc.o: $(CDIR)/types.h
|
|
||||||
state.o: $(CDIR)/assert.h
|
|
||||||
state.o: $(CDIR)/data.h
|
|
||||||
state.o: $(CDIR)/extern.h
|
|
||||||
state.o: $(CDIR)/param.h
|
|
||||||
state.o: $(CDIR)/result.h
|
|
||||||
state.o: $(CDIR)/state.h
|
|
||||||
state.o: tables.h
|
|
||||||
state.o: $(CDIR)/types.h
|
|
||||||
subr.o: $(CDIR)/assert.h
|
|
||||||
subr.o: $(CDIR)/data.h
|
|
||||||
subr.o: $(CDIR)/extern.h
|
|
||||||
subr.o: $(CDIR)/param.h
|
|
||||||
subr.o: $(CDIR)/result.h
|
|
||||||
subr.o: tables.h
|
|
||||||
subr.o: $(CDIR)/types.h
|
|
||||||
var.o: $(CDIR)/data.h
|
|
||||||
var.o: $(CDIR)/param.h
|
|
||||||
var.o: $(CDIR)/result.h
|
|
||||||
var.o: tables.h
|
|
||||||
var.o: $(CDIR)/types.h
|
|
||||||
@@ -1,171 +0,0 @@
|
|||||||
#ifndef NORCSID
|
|
||||||
static char rcsid[] = "$Header$";
|
|
||||||
#endif
|
|
||||||
|
|
||||||
/*
|
|
||||||
* (c) copyright 1983 by the Vrije Universiteit, Amsterdam, The Netherlands.
|
|
||||||
*
|
|
||||||
* This product is part of the Amsterdam Compiler Kit.
|
|
||||||
*
|
|
||||||
* Permission to use, sell, duplicate or disclose this software must be
|
|
||||||
* obtained in writing. Requests for such permissions may be sent to
|
|
||||||
*
|
|
||||||
* Dr. Andrew S. Tanenbaum
|
|
||||||
* Wiskundig Seminarium
|
|
||||||
* Vrije Universiteit
|
|
||||||
* Postbox 7161
|
|
||||||
* 1007 MC Amsterdam
|
|
||||||
* The Netherlands
|
|
||||||
*
|
|
||||||
* Author: Hans van Staveren
|
|
||||||
*/
|
|
||||||
|
|
||||||
/*
|
|
||||||
* machine dependent back end routines for the PDP-11
|
|
||||||
*/
|
|
||||||
|
|
||||||
/* #define REGPATCH /* save all registers in markblock */
|
|
||||||
|
|
||||||
con_part(sz,w) register sz; word w; {
|
|
||||||
|
|
||||||
while (part_size % sz)
|
|
||||||
part_size++;
|
|
||||||
if (part_size == EM_WSIZE)
|
|
||||||
part_flush();
|
|
||||||
if (sz == 1) {
|
|
||||||
w &= 0xFF;
|
|
||||||
if (part_size)
|
|
||||||
w <<= 8;
|
|
||||||
part_word |= w;
|
|
||||||
} else {
|
|
||||||
assert(sz == 2);
|
|
||||||
part_word = w;
|
|
||||||
}
|
|
||||||
part_size += sz;
|
|
||||||
}
|
|
||||||
|
|
||||||
con_mult(sz) word sz; {
|
|
||||||
long l;
|
|
||||||
|
|
||||||
if (sz != 4)
|
|
||||||
fatal("bad icon/ucon size");
|
|
||||||
l = atol(str);
|
|
||||||
fprintf(codefile,"\t%o;%o\n",(int)(l>>16),(int)l);
|
|
||||||
}
|
|
||||||
|
|
||||||
con_float() {
|
|
||||||
double f;
|
|
||||||
register short *p,i;
|
|
||||||
|
|
||||||
if (argval != 4 && argval != 8)
|
|
||||||
fatal("bad fcon size");
|
|
||||||
f = atof(str);
|
|
||||||
p = (short *) &f;
|
|
||||||
i = *p++;
|
|
||||||
if (argval == 8) {
|
|
||||||
fprintf(codefile,"\t%o;%o;",i,*p++);
|
|
||||||
i = *p++;
|
|
||||||
}
|
|
||||||
fprintf(codefile,"\t%o;%o\n",i,*p++);
|
|
||||||
}
|
|
||||||
|
|
||||||
#ifdef REGVARS
|
|
||||||
|
|
||||||
char Rstring[10] = "RT";
|
|
||||||
|
|
||||||
regscore(off,size,typ,score,totyp) long off; {
|
|
||||||
|
|
||||||
if (size != 2)
|
|
||||||
return(-1);
|
|
||||||
score -= 1; /* allow for save/restore */
|
|
||||||
if (off>=0)
|
|
||||||
score -= 2;
|
|
||||||
if (typ==reg_pointer)
|
|
||||||
score *= 17;
|
|
||||||
else if (typ==reg_loop)
|
|
||||||
score = 10*score+50; /* Guestimate */
|
|
||||||
else
|
|
||||||
score *= 10;
|
|
||||||
return(score); /* estimated # of words of profit */
|
|
||||||
}
|
|
||||||
|
|
||||||
i_regsave() {
|
|
||||||
|
|
||||||
Rstring[2] = 0;
|
|
||||||
}
|
|
||||||
|
|
||||||
f_regsave() {}
|
|
||||||
|
|
||||||
regsave(regstr,off,size) char *regstr; long off; {
|
|
||||||
|
|
||||||
fprintf(codefile,"/ Local %ld into %s\n",off,regstr);
|
|
||||||
#ifndef REGPATCH
|
|
||||||
fprintf(codefile,"mov %s,-(sp)\n",regstr);
|
|
||||||
#endif
|
|
||||||
strcat(Rstring,regstr);
|
|
||||||
if (off>=0)
|
|
||||||
fprintf(codefile,"mov 0%lo(r5),%s\n",off,regstr);
|
|
||||||
}
|
|
||||||
|
|
||||||
regreturn() {
|
|
||||||
|
|
||||||
#ifdef REGPATCH
|
|
||||||
fprintf(codefile,"jmp eret\n");
|
|
||||||
#else
|
|
||||||
fprintf(codefile,"jmp %s\n",Rstring);
|
|
||||||
#endif
|
|
||||||
}
|
|
||||||
|
|
||||||
#endif
|
|
||||||
|
|
||||||
prolog(nlocals) full nlocals; {
|
|
||||||
|
|
||||||
#ifdef REGPATCH
|
|
||||||
fprintf(codefile,"mov r2,-(sp)\nmov r4,-(sp)\n");
|
|
||||||
#endif
|
|
||||||
fprintf(codefile,"mov r5,-(sp)\nmov sp,r5\n");
|
|
||||||
if (nlocals == 0)
|
|
||||||
return;
|
|
||||||
if (nlocals == 2)
|
|
||||||
fprintf(codefile,"tst -(sp)\n");
|
|
||||||
else
|
|
||||||
fprintf(codefile,"sub $0%o,sp\n",nlocals);
|
|
||||||
}
|
|
||||||
|
|
||||||
dlbdlb(as,ls) string as,ls; {
|
|
||||||
|
|
||||||
if (strlen(as)+strlen(ls)+2<sizeof(labstr)) {
|
|
||||||
strcat(ls,":");
|
|
||||||
strcat(ls,as);
|
|
||||||
} else
|
|
||||||
fatal("too many consecutive labels");
|
|
||||||
}
|
|
||||||
|
|
||||||
mes(type) word type; {
|
|
||||||
int argt ;
|
|
||||||
|
|
||||||
switch ( (int)type ) {
|
|
||||||
case ms_ext :
|
|
||||||
for (;;) {
|
|
||||||
switch ( argt=getarg(
|
|
||||||
ptyp(sp_cend)|ptyp(sp_pnam)|sym_ptyp) ) {
|
|
||||||
case sp_cend :
|
|
||||||
return ;
|
|
||||||
default:
|
|
||||||
strarg(argt) ;
|
|
||||||
fprintf(codefile,".globl %s\n",argstr) ;
|
|
||||||
break ;
|
|
||||||
}
|
|
||||||
}
|
|
||||||
default :
|
|
||||||
while ( getarg(any_ptyp) != sp_cend ) ;
|
|
||||||
break ;
|
|
||||||
}
|
|
||||||
}
|
|
||||||
|
|
||||||
char *segname[] = {
|
|
||||||
".text", /* SEGTXT */
|
|
||||||
".data", /* SEGCON */
|
|
||||||
".data", /* SEGROM */
|
|
||||||
".bss" /* SEGBSS */
|
|
||||||
};
|
|
||||||
@@ -1,24 +0,0 @@
|
|||||||
/* $Header$ */
|
|
||||||
|
|
||||||
#define ex_ap(y) fprintf(codefile,".globl %s\n",y)
|
|
||||||
#define in_ap(y) /* nothing */
|
|
||||||
|
|
||||||
#define newplb(x) fprintf(codefile,"%s:\n",x)
|
|
||||||
#define newilb(x) fprintf(codefile,"%s:\n",x)
|
|
||||||
#define newdlb(x) fprintf(codefile,"%s:\n",x)
|
|
||||||
#define newlbss(l,x) fprintf(codefile,"%s:.=.+0%o\n",l,x);
|
|
||||||
|
|
||||||
#define cst_fmt "$0%o"
|
|
||||||
#define off_fmt "0%o"
|
|
||||||
#define ilb_fmt "I%02x%x"
|
|
||||||
#define dlb_fmt "_%d"
|
|
||||||
#define hol_fmt "hol%d"
|
|
||||||
|
|
||||||
#define hol_off "0%o+hol%d"
|
|
||||||
|
|
||||||
#define con_cst(x) fprintf(codefile,"0%o\n",x)
|
|
||||||
#define con_ilb(x) fprintf(codefile,"%s\n",x)
|
|
||||||
#define con_dlb(x) fprintf(codefile,"%s\n",x)
|
|
||||||
|
|
||||||
#define id_first '_'
|
|
||||||
#define BSS_INIT 0
|
|
||||||
@@ -1,130 +0,0 @@
|
|||||||
#include <stdio.h>
|
|
||||||
|
|
||||||
/*
|
|
||||||
* (c) copyright 1983 by the Vrije Universiteit, Amsterdam, The Netherlands.
|
|
||||||
*
|
|
||||||
* This product is part of the Amsterdam Compiler Kit.
|
|
||||||
*
|
|
||||||
* Permission to use, sell, duplicate or disclose this software must be
|
|
||||||
* obtained in writing. Requests for such permissions may be sent to
|
|
||||||
*
|
|
||||||
* Dr. Andrew S. Tanenbaum
|
|
||||||
* Wiskundig Seminarium
|
|
||||||
* Vrije Universiteit
|
|
||||||
* Postbox 7161
|
|
||||||
* 1007 MC Amsterdam
|
|
||||||
* The Netherlands
|
|
||||||
*
|
|
||||||
* Author: Hans van Staveren
|
|
||||||
*/
|
|
||||||
|
|
||||||
char buf[512];
|
|
||||||
|
|
||||||
main() {
|
|
||||||
register n,sa;
|
|
||||||
register char *p;
|
|
||||||
|
|
||||||
sa=0;
|
|
||||||
for (;;) {
|
|
||||||
getline(buf);
|
|
||||||
if (n=stackadjust()) {
|
|
||||||
sa += n;
|
|
||||||
continue;
|
|
||||||
}
|
|
||||||
if (nullinstruction())
|
|
||||||
continue;
|
|
||||||
if (sa) {
|
|
||||||
if (buf[0]=='t' && buf[1]=='s' && buf[2]=='t' && buf[3]==' ') {
|
|
||||||
sa -= 2;
|
|
||||||
buf[0]='m';
|
|
||||||
buf[1]='o';
|
|
||||||
buf[2]='v';
|
|
||||||
strcat(buf,",(sp)+");
|
|
||||||
} else if (buf[0]=='m' && buf[1]=='o' && buf[2]=='v' &&
|
|
||||||
buf[3]==' ' && (p=index(&buf[5],','))!=0 &&
|
|
||||||
p[1]=='-' && p[2]=='(' && p[3]=='s') {
|
|
||||||
sa -= 2;
|
|
||||||
p[1]=' ';
|
|
||||||
}
|
|
||||||
}
|
|
||||||
switch(sa) {
|
|
||||||
case 0:break;
|
|
||||||
case 2:puts("tst (sp)+");sa=0;break;
|
|
||||||
case 4:puts("cmp (sp)+,(sp)+");sa=0;break;
|
|
||||||
case 6:puts("add $6.,sp");sa=0;break;
|
|
||||||
}
|
|
||||||
puts(buf);
|
|
||||||
}
|
|
||||||
}
|
|
||||||
|
|
||||||
getline(buf) register char *buf; {
|
|
||||||
register c;
|
|
||||||
|
|
||||||
while ((c=getchar())==' ' || c=='\t')
|
|
||||||
;
|
|
||||||
if (c==EOF)
|
|
||||||
exit(0);
|
|
||||||
do *buf++=c;
|
|
||||||
while ((c=getchar())!='\n');
|
|
||||||
*buf=0;
|
|
||||||
}
|
|
||||||
|
|
||||||
stackadjust() {
|
|
||||||
|
|
||||||
if (buf[0]=='t' &&
|
|
||||||
buf[1]=='s' &&
|
|
||||||
buf[2]=='t' &&
|
|
||||||
buf[3]==' ' &&
|
|
||||||
buf[4]=='(' &&
|
|
||||||
buf[5]=='s' &&
|
|
||||||
buf[6]=='p' &&
|
|
||||||
buf[7]==')' &&
|
|
||||||
buf[8]=='+') return(2);
|
|
||||||
if (buf[0]=='c' &&
|
|
||||||
buf[1]=='m' &&
|
|
||||||
buf[2]=='p' &&
|
|
||||||
buf[3]==' ' &&
|
|
||||||
buf[4]=='(' &&
|
|
||||||
buf[5]=='s' &&
|
|
||||||
buf[6]=='p' &&
|
|
||||||
buf[7]==')' &&
|
|
||||||
buf[8]=='+' &&
|
|
||||||
buf[9]==',' &&
|
|
||||||
buf[10]=='(' &&
|
|
||||||
buf[11]=='s' &&
|
|
||||||
buf[12]=='p' &&
|
|
||||||
buf[13]==')' &&
|
|
||||||
buf[14]=='+') return(4);
|
|
||||||
if (buf[0]=='a' &&
|
|
||||||
buf[1]=='d' &&
|
|
||||||
buf[2]=='d' &&
|
|
||||||
buf[3]==' ' &&
|
|
||||||
buf[4]=='$' &&
|
|
||||||
buf[5]=='6' &&
|
|
||||||
buf[6]=='.' &&
|
|
||||||
buf[7]==',' &&
|
|
||||||
buf[8]=='s' &&
|
|
||||||
buf[9]=='p' &&
|
|
||||||
buf[10]==0) return(6);
|
|
||||||
return(0);
|
|
||||||
}
|
|
||||||
|
|
||||||
nullinstruction() {
|
|
||||||
register char *p;
|
|
||||||
|
|
||||||
if (buf[4]=='$' && buf[5]=='0' && buf[6]=='.' && buf[7]==',') {
|
|
||||||
p=index(buf,'-');
|
|
||||||
if (p!=0 && p[1]=='(')
|
|
||||||
return(0);
|
|
||||||
p=index(buf,'+');
|
|
||||||
if (p!=0 && p[-1]==')')
|
|
||||||
return(0);
|
|
||||||
if (buf[0]=='b' && buf[1]=='i' && (buf[2]=='s' || buf[2]=='c'))
|
|
||||||
return(1);
|
|
||||||
if (buf[0]=='a' && buf[1]=='d' && buf[2]=='d')
|
|
||||||
return(1);
|
|
||||||
if (buf[0]=='s' && buf[1]=='u' && buf[2]=='b')
|
|
||||||
return(1);
|
|
||||||
}
|
|
||||||
return(0);
|
|
||||||
}
|
|
||||||
2598
mach/pdp/cg/table
2598
mach/pdp/cg/table
File diff suppressed because it is too large
Load Diff
363
mach/proto/as/comm6.c
Normal file
363
mach/proto/as/comm6.c
Normal file
@@ -0,0 +1,363 @@
|
|||||||
|
/* @(#)comm6.c 1.7 */
|
||||||
|
/*
|
||||||
|
* implement pseudo instructions
|
||||||
|
*/
|
||||||
|
|
||||||
|
#include "comm0.h"
|
||||||
|
#include "comm1.h"
|
||||||
|
#include "y.tab.h"
|
||||||
|
|
||||||
|
newequate(ip, typ)
|
||||||
|
register item_t *ip;
|
||||||
|
register short typ;
|
||||||
|
{
|
||||||
|
typ &= ~S_EXT;
|
||||||
|
if (typ & S_COM)
|
||||||
|
typ = S_UND;
|
||||||
|
else if ((typ & S_VAR) && (typ & S_TYP) != S_ABS)
|
||||||
|
typ = S_UND;
|
||||||
|
#ifdef THREE_PASS
|
||||||
|
else if (pass == PASS_1 && typ == S_UND)
|
||||||
|
typ = S_VAR;
|
||||||
|
else if (pass == PASS_2 && (ip->i_type & S_TYP) == S_UND)
|
||||||
|
ip->i_type |= typ;
|
||||||
|
#endif THREE_PASS
|
||||||
|
if (typ == S_UND)
|
||||||
|
serror("illegal equate");
|
||||||
|
if (pass == PASS_3)
|
||||||
|
assert((ip->i_type & S_TYP) == (typ & S_TYP));
|
||||||
|
newident(ip, typ);
|
||||||
|
}
|
||||||
|
|
||||||
|
newident(ip, typ)
|
||||||
|
register item_t *ip;
|
||||||
|
{
|
||||||
|
register flag;
|
||||||
|
#ifdef GENLAB
|
||||||
|
static char genlab[] = GENLAB;
|
||||||
|
#endif GENLAB
|
||||||
|
|
||||||
|
if (pass == PASS_1) {
|
||||||
|
/* printf("declare %s: %o\n", ip->i_name, typ); */
|
||||||
|
if (ip->i_type & ~S_EXT)
|
||||||
|
serror("multiple declared");
|
||||||
|
else
|
||||||
|
--unresolved;
|
||||||
|
ip->i_type |= typ;
|
||||||
|
}
|
||||||
|
if (PASS_SYMB == 0)
|
||||||
|
return;
|
||||||
|
#ifdef THREE_PASS
|
||||||
|
if (ip->i_type & S_EXT)
|
||||||
|
flag = SYM_EXT;
|
||||||
|
else
|
||||||
|
flag = SYM_LOC;
|
||||||
|
#else
|
||||||
|
flag = SYM_EXT|SYM_LOC; /* S_EXT not stable in PASS_1 */
|
||||||
|
#endif THREE_PASS
|
||||||
|
#ifdef GENLAB
|
||||||
|
if (strncmp(ip->i_name, genlab, sizeof(genlab)-1) == 0)
|
||||||
|
flag = SYM_LAB;
|
||||||
|
#endif GENLAB
|
||||||
|
if (sflag & flag)
|
||||||
|
newsymb(
|
||||||
|
ip->i_name,
|
||||||
|
ip->i_type & (S_EXT|S_TYP),
|
||||||
|
(short)0,
|
||||||
|
load(ip)
|
||||||
|
);
|
||||||
|
}
|
||||||
|
|
||||||
|
newlabel(ip)
|
||||||
|
register item_t *ip;
|
||||||
|
{
|
||||||
|
#ifdef THREE_PASS
|
||||||
|
register addr_t oldval = ip->i_valu;
|
||||||
|
#endif
|
||||||
|
|
||||||
|
if (DOTSCT == NULL)
|
||||||
|
nosect();
|
||||||
|
ip->i_type &= ~S_TYP;
|
||||||
|
ip->i_type |= DOTTYP;
|
||||||
|
if (store(ip, (valu_t) DOTVAL) == 0)
|
||||||
|
return;
|
||||||
|
#ifdef THREE_PASS
|
||||||
|
assert(pass != PASS_2 || oldval - ip->i_valu == DOTGAIN);
|
||||||
|
#endif
|
||||||
|
}
|
||||||
|
|
||||||
|
newsect(ip)
|
||||||
|
register item_t *ip;
|
||||||
|
{
|
||||||
|
register ushort typ;
|
||||||
|
register sect_t *sp = NULL;
|
||||||
|
|
||||||
|
typ = ip->i_type & S_TYP;
|
||||||
|
if (typ == S_UND) {
|
||||||
|
/*
|
||||||
|
* new section
|
||||||
|
*/
|
||||||
|
assert(pass == PASS_1);
|
||||||
|
--unresolved;
|
||||||
|
typ = outhead.oh_nsect + S_MIN;
|
||||||
|
outhead.oh_nsect++;
|
||||||
|
if (outhead.oh_nsect > SECTMAX || typ > S_MAX)
|
||||||
|
fatal("too many sections");
|
||||||
|
sp = §[typ - S_MIN];
|
||||||
|
sp->s_item = ip;
|
||||||
|
sp->s_lign = ALIGNSECT;
|
||||||
|
#ifdef DUK
|
||||||
|
ip->i_type = typ;
|
||||||
|
#else DUK
|
||||||
|
ip->i_type = typ | S_EXT;
|
||||||
|
#endif DUK
|
||||||
|
ip->i_valu = 0;
|
||||||
|
} else if (typ >= S_MIN) {
|
||||||
|
sp = §[typ - S_MIN];
|
||||||
|
if (sp->s_item != ip)
|
||||||
|
sp = NULL;
|
||||||
|
}
|
||||||
|
if (sp == NULL)
|
||||||
|
serror("multiple declared");
|
||||||
|
else
|
||||||
|
switchsect(typ);
|
||||||
|
}
|
||||||
|
|
||||||
|
newbase(base)
|
||||||
|
valu_t base;
|
||||||
|
{
|
||||||
|
#ifdef ASLD
|
||||||
|
register sect_t *sp;
|
||||||
|
|
||||||
|
if ((sp = DOTSCT) == NULL)
|
||||||
|
nosect();
|
||||||
|
if (sp->s_flag & BASED)
|
||||||
|
serror("already based");
|
||||||
|
sp->s_base = base;
|
||||||
|
sp->s_flag |= BASED;
|
||||||
|
DOTVAL += base;
|
||||||
|
#else
|
||||||
|
warning(".base ignored");
|
||||||
|
#endif
|
||||||
|
}
|
||||||
|
|
||||||
|
/*
|
||||||
|
* NOTE: A rather different solution is used for ASLD and NOLD:
|
||||||
|
* ASLD:
|
||||||
|
* - maximum length of .comm is recorded in i_valu during PASS_1
|
||||||
|
* - address of .comm is recorded in i_valu in later passes:
|
||||||
|
* assigned at end of PASS_1, corrected for s_gain at end of PASS_2
|
||||||
|
* - symbol table entries are produced in commfinish()
|
||||||
|
* NOLD:
|
||||||
|
* - i_valu cannot be used since it is needed for relocation info
|
||||||
|
* - only one .comm with a particular symbol is allowed per module
|
||||||
|
* - symbol table entries are produced in newcomm()
|
||||||
|
*/
|
||||||
|
newcomm(ip, val)
|
||||||
|
register item_t *ip;
|
||||||
|
valu_t val;
|
||||||
|
{
|
||||||
|
if (pass == PASS_1) {
|
||||||
|
if (DOTSCT == NULL)
|
||||||
|
nosect();
|
||||||
|
if (val == 0)
|
||||||
|
serror("bad size");
|
||||||
|
/* printf("declare %s: %o\n", ip->i_name, DOTTYP); */
|
||||||
|
if ((ip->i_type & ~S_EXT) == S_UND) {
|
||||||
|
--unresolved;
|
||||||
|
ip->i_type = S_COM|DOTTYP|(ip->i_type&S_EXT);
|
||||||
|
#ifdef ASLD
|
||||||
|
ip->i_valu = val;
|
||||||
|
} else if (ip->i_type == (S_COM|S_EXT|DOTTYP)) {
|
||||||
|
if (ip->i_valu < val)
|
||||||
|
ip->i_valu = val;
|
||||||
|
#endif
|
||||||
|
} else
|
||||||
|
serror("multiple declared");
|
||||||
|
}
|
||||||
|
#ifndef ASLD
|
||||||
|
if (PASS_SYMB == 0)
|
||||||
|
return;
|
||||||
|
if (pass != PASS_3)
|
||||||
|
/*
|
||||||
|
* save symbol table index
|
||||||
|
* for possible relocation
|
||||||
|
*/
|
||||||
|
ip->i_valu = outhead.oh_nname;
|
||||||
|
#ifdef DUK
|
||||||
|
newsymb(ip->i_name, S_COM|DOTTYP|(ip->i_type&S_EXT), (short)0, val);
|
||||||
|
#else DUK
|
||||||
|
newsymb(ip->i_name, S_EXT|DOTTYP, (short)0, val);
|
||||||
|
#endif DUK
|
||||||
|
#endif
|
||||||
|
}
|
||||||
|
|
||||||
|
switchsect(newtyp)
|
||||||
|
short newtyp;
|
||||||
|
{
|
||||||
|
register sect_t *sp;
|
||||||
|
|
||||||
|
if (sp = DOTSCT)
|
||||||
|
sp->s_size = DOTVAL - sp->s_base;
|
||||||
|
if (newtyp == S_UND) {
|
||||||
|
DOTSCT = NULL;
|
||||||
|
DOTTYP = newtyp;
|
||||||
|
return;
|
||||||
|
}
|
||||||
|
assert(newtyp >= S_MIN);
|
||||||
|
sp = §[newtyp - S_MIN];
|
||||||
|
if (pass == PASS_3) {
|
||||||
|
#ifdef AOUTSEEK
|
||||||
|
aoutpart = -1;
|
||||||
|
aoutseek[PARTEMIT] = sp->s_foff + sp->s_size - sp->s_zero;
|
||||||
|
#else
|
||||||
|
fseek(aoutfile[PARTEMIT], sp->s_foff + sp->s_size - sp->s_zero, 0);
|
||||||
|
#endif
|
||||||
|
}
|
||||||
|
DOTVAL = sp->s_size + sp->s_base;
|
||||||
|
DOTSCT = sp;
|
||||||
|
DOTTYP = newtyp;
|
||||||
|
}
|
||||||
|
|
||||||
|
align(bytes)
|
||||||
|
valu_t bytes;
|
||||||
|
{
|
||||||
|
register valu_t gap;
|
||||||
|
register sect_t *sp;
|
||||||
|
|
||||||
|
if ((sp = DOTSCT) == NULL)
|
||||||
|
nosect();
|
||||||
|
if (bytes == 0)
|
||||||
|
bytes = ALIGNWORD;
|
||||||
|
if (sp->s_lign % bytes)
|
||||||
|
if (bytes % sp->s_lign)
|
||||||
|
serror("illegal alignment");
|
||||||
|
else
|
||||||
|
sp->s_lign = bytes;
|
||||||
|
if (pass == PASS_1)
|
||||||
|
/*
|
||||||
|
* be pessimistic: biggest gap possible
|
||||||
|
*/
|
||||||
|
gap = bytes - 1;
|
||||||
|
else {
|
||||||
|
/*
|
||||||
|
* calculate gap correctly;
|
||||||
|
* will be the same in PASS_2 and PASS_3
|
||||||
|
*/
|
||||||
|
if ((gap = DOTVAL % bytes) != 0)
|
||||||
|
gap = bytes - gap;
|
||||||
|
#ifdef THREE_PASS
|
||||||
|
if (pass == PASS_2)
|
||||||
|
/*
|
||||||
|
* keep track of gain with respect to PASS_1
|
||||||
|
*/
|
||||||
|
DOTGAIN += (bytes - 1) - gap;
|
||||||
|
#endif
|
||||||
|
}
|
||||||
|
/* I don't play the os_zero game here, but plainly write out zero's */
|
||||||
|
/* Led abuses trailing zero parts */
|
||||||
|
while (gap--) emit1(0) ;
|
||||||
|
}
|
||||||
|
|
||||||
|
#ifdef RELOCATION
|
||||||
|
newrelo(s, n)
|
||||||
|
short s;
|
||||||
|
{
|
||||||
|
struct outrelo outrelo;
|
||||||
|
#ifdef DUK
|
||||||
|
int iscomm;
|
||||||
|
#endif DUK
|
||||||
|
|
||||||
|
if (rflag == 0)
|
||||||
|
return;
|
||||||
|
if (PASS_RELO == 0)
|
||||||
|
return;
|
||||||
|
s &= ~S_DOT;
|
||||||
|
assert((s & ~(S_COM|S_VAR|S_TYP)) == 0);
|
||||||
|
#ifndef THREE_PASS
|
||||||
|
if (s == S_UND)
|
||||||
|
serror("bad relocation");
|
||||||
|
#endif
|
||||||
|
/*
|
||||||
|
* always relocation info if S_VAR to solve problems with:
|
||||||
|
* move b,d0
|
||||||
|
* b=a
|
||||||
|
* a: .data2 0
|
||||||
|
*/
|
||||||
|
#ifdef DUK
|
||||||
|
iscomm = s & S_COM;
|
||||||
|
#endif DUK
|
||||||
|
s &= ~S_COM;
|
||||||
|
if ((n & RELPC) == 0 && s == S_ABS)
|
||||||
|
return;
|
||||||
|
if ((n & RELPC) != 0 && s == DOTTYP)
|
||||||
|
return;
|
||||||
|
if (pass != PASS_3) {
|
||||||
|
outhead.oh_nrelo++;
|
||||||
|
return;
|
||||||
|
}
|
||||||
|
s &= ~S_VAR;
|
||||||
|
outrelo.or_type = (char)n;
|
||||||
|
outrelo.or_sect = (char)DOTTYP;
|
||||||
|
#ifndef ASLD
|
||||||
|
#ifdef DUK
|
||||||
|
if (s == S_UND || iscomm) {
|
||||||
|
#else DUK
|
||||||
|
if (s == S_UND) {
|
||||||
|
#endif DUK
|
||||||
|
assert(relonami != 0);
|
||||||
|
outrelo.or_nami = relonami-1;
|
||||||
|
relonami = 0;
|
||||||
|
} else
|
||||||
|
#endif
|
||||||
|
if (s < S_MIN) {
|
||||||
|
assert(s == S_ABS);
|
||||||
|
/*
|
||||||
|
* use first non existing entry (argh)
|
||||||
|
*/
|
||||||
|
outrelo.or_nami = outhead.oh_nname;
|
||||||
|
} else {
|
||||||
|
/*
|
||||||
|
* section symbols are at the end
|
||||||
|
*/
|
||||||
|
outrelo.or_nami = outhead.oh_nname
|
||||||
|
- outhead.oh_nsect
|
||||||
|
+ (s - S_MIN)
|
||||||
|
;
|
||||||
|
}
|
||||||
|
outrelo.or_addr = (long)DOTVAL;
|
||||||
|
putofmt((char *)&outrelo, SF_RELO, PARTRELO);
|
||||||
|
}
|
||||||
|
#endif
|
||||||
|
|
||||||
|
newsymb(name, type, desc, valu)
|
||||||
|
register char *name;
|
||||||
|
short type;
|
||||||
|
short desc;
|
||||||
|
valu_t valu;
|
||||||
|
{
|
||||||
|
struct outname outname;
|
||||||
|
|
||||||
|
if (name && *name == 0)
|
||||||
|
name = 0;
|
||||||
|
assert(PASS_SYMB);
|
||||||
|
if (pass != PASS_3) {
|
||||||
|
if (name)
|
||||||
|
outhead.oh_nchar += strlen(name)+1;
|
||||||
|
outhead.oh_nname++;
|
||||||
|
return;
|
||||||
|
}
|
||||||
|
if (name) {
|
||||||
|
AOUTPART(PARTCHAR);
|
||||||
|
outname.on_foff = outhead.oh_nchar;
|
||||||
|
do {
|
||||||
|
AOUTPUTC(*name, PARTCHAR);
|
||||||
|
outhead.oh_nchar++;
|
||||||
|
} while (*name++);
|
||||||
|
} else
|
||||||
|
outname.on_foff = 0;
|
||||||
|
outname.on_type = type;
|
||||||
|
outname.on_desc = desc;
|
||||||
|
outname.on_valu = valu & ~((0xFFFFFFFF)<<(8*sizeof(valu_t)));
|
||||||
|
putofmt((char *)&outname, SF_NAME, PARTNAME);
|
||||||
|
}
|
||||||
@@ -1,178 +0,0 @@
|
|||||||
# $Header$
|
|
||||||
|
|
||||||
PREFLAGS=-I../../../h -I. -DNDEBUG
|
|
||||||
PFLAGS=
|
|
||||||
CFLAGS=$(PREFLAGS) $(PFLAGS) -O
|
|
||||||
LDFLAGS=-i $(PFLAGS)
|
|
||||||
LINTOPTS=-hbxac
|
|
||||||
LIBS=../../../lib/em_data.a
|
|
||||||
CDIR=../../proto/cg
|
|
||||||
CFILES=$(CDIR)/codegen.c $(CDIR)/compute.c $(CDIR)/equiv.c $(CDIR)/fillem.c \
|
|
||||||
$(CDIR)/gencode.c $(CDIR)/glosym.c $(CDIR)/main.c $(CDIR)/move.c \
|
|
||||||
$(CDIR)/nextem.c $(CDIR)/reg.c $(CDIR)/regvar.c $(CDIR)/salloc.c \
|
|
||||||
$(CDIR)/state.c $(CDIR)/subr.c $(CDIR)/var.c
|
|
||||||
OFILES=codegen.o compute.o equiv.o fillem.o gencode.o glosym.o main.o\
|
|
||||||
move.o nextem.o reg.o regvar.o salloc.o state.o subr.o var.o
|
|
||||||
|
|
||||||
all:
|
|
||||||
make tables.c
|
|
||||||
make cg
|
|
||||||
|
|
||||||
cg: tables.o $(OFILES)
|
|
||||||
cc $(LDFLAGS) $(OFILES) tables.o $(LIBS) -o cg
|
|
||||||
|
|
||||||
tables.o: tables.c
|
|
||||||
cc -c $(PREFLAGS) -I$(CDIR) tables.c
|
|
||||||
|
|
||||||
codegen.o: $(CDIR)/codegen.c
|
|
||||||
cc -c $(CFLAGS) $(CDIR)/codegen.c
|
|
||||||
compute.o: $(CDIR)/compute.c
|
|
||||||
cc -c $(CFLAGS) $(CDIR)/compute.c
|
|
||||||
equiv.o: $(CDIR)/equiv.c
|
|
||||||
cc -c $(CFLAGS) $(CDIR)/equiv.c
|
|
||||||
fillem.o: $(CDIR)/fillem.c
|
|
||||||
cc -c $(CFLAGS) $(CDIR)/fillem.c
|
|
||||||
gencode.o: $(CDIR)/gencode.c
|
|
||||||
cc -c $(CFLAGS) $(CDIR)/gencode.c
|
|
||||||
glosym.o: $(CDIR)/glosym.c
|
|
||||||
cc -c $(CFLAGS) $(CDIR)/glosym.c
|
|
||||||
main.o: $(CDIR)/main.c
|
|
||||||
cc -c $(CFLAGS) $(CDIR)/main.c
|
|
||||||
move.o: $(CDIR)/move.c
|
|
||||||
cc -c $(CFLAGS) $(CDIR)/move.c
|
|
||||||
nextem.o: $(CDIR)/nextem.c
|
|
||||||
cc -c $(CFLAGS) $(CDIR)/nextem.c
|
|
||||||
reg.o: $(CDIR)/reg.c
|
|
||||||
cc -c $(CFLAGS) $(CDIR)/reg.c
|
|
||||||
regvar.o: $(CDIR)/regvar.c
|
|
||||||
cc -c $(CFLAGS) $(CDIR)/regvar.c
|
|
||||||
salloc.o: $(CDIR)/salloc.c
|
|
||||||
cc -c $(CFLAGS) $(CDIR)/salloc.c
|
|
||||||
state.o: $(CDIR)/state.c
|
|
||||||
cc -c $(CFLAGS) $(CDIR)/state.c
|
|
||||||
subr.o: $(CDIR)/subr.c
|
|
||||||
cc -c $(CFLAGS) $(CDIR)/subr.c
|
|
||||||
var.o: $(CDIR)/var.c
|
|
||||||
cc -c $(CFLAGS) $(CDIR)/var.c
|
|
||||||
|
|
||||||
install: all
|
|
||||||
../install cg
|
|
||||||
|
|
||||||
cmp: all
|
|
||||||
-../compare cg
|
|
||||||
|
|
||||||
|
|
||||||
tables.c: table
|
|
||||||
-mv tables.h tables.h.save
|
|
||||||
../../../lib/cpp -P table | ../../../lib/cgg > debug.out
|
|
||||||
-if cmp -s tables.h.save tables.h; then mv tables.h.save tables.h; else exit 0; fi
|
|
||||||
-if cmp -s /dev/null tables.h; then mv tables.h.save tables.h; else exit 0; fi
|
|
||||||
|
|
||||||
lint: $(CFILES)
|
|
||||||
lint $(LINTOPTS) $(PREFLAGS) $(CFILES)
|
|
||||||
clean:
|
|
||||||
rm -f *.o tables.c tables.h debug.out cg tables.h.save
|
|
||||||
|
|
||||||
codegen.o: $(CDIR)/assert.h
|
|
||||||
codegen.o: $(CDIR)/data.h
|
|
||||||
codegen.o: $(CDIR)/equiv.h
|
|
||||||
codegen.o: $(CDIR)/extern.h
|
|
||||||
codegen.o: $(CDIR)/param.h
|
|
||||||
codegen.o: $(CDIR)/result.h
|
|
||||||
codegen.o: $(CDIR)/state.h
|
|
||||||
codegen.o: tables.h
|
|
||||||
codegen.o: $(CDIR)/types.h
|
|
||||||
compute.o: $(CDIR)/assert.h
|
|
||||||
compute.o: $(CDIR)/data.h
|
|
||||||
compute.o: $(CDIR)/extern.h
|
|
||||||
compute.o: $(CDIR)/glosym.h
|
|
||||||
compute.o: $(CDIR)/param.h
|
|
||||||
compute.o: $(CDIR)/result.h
|
|
||||||
compute.o: tables.h
|
|
||||||
compute.o: $(CDIR)/types.h
|
|
||||||
equiv.o: $(CDIR)/assert.h
|
|
||||||
equiv.o: $(CDIR)/data.h
|
|
||||||
equiv.o: $(CDIR)/equiv.h
|
|
||||||
equiv.o: $(CDIR)/extern.h
|
|
||||||
equiv.o: $(CDIR)/param.h
|
|
||||||
equiv.o: $(CDIR)/result.h
|
|
||||||
equiv.o: tables.h
|
|
||||||
equiv.o: $(CDIR)/types.h
|
|
||||||
fillem.o: $(CDIR)/assert.h
|
|
||||||
fillem.o: $(CDIR)/data.h
|
|
||||||
fillem.o: $(CDIR)/extern.h
|
|
||||||
fillem.o: mach.c
|
|
||||||
fillem.o: mach.h
|
|
||||||
fillem.o: $(CDIR)/param.h
|
|
||||||
fillem.o: $(CDIR)/regvar.h
|
|
||||||
fillem.o: $(CDIR)/result.h
|
|
||||||
fillem.o: tables.h
|
|
||||||
fillem.o: $(CDIR)/types.h
|
|
||||||
gencode.o: $(CDIR)/assert.h
|
|
||||||
gencode.o: $(CDIR)/data.h
|
|
||||||
gencode.o: $(CDIR)/extern.h
|
|
||||||
gencode.o: $(CDIR)/param.h
|
|
||||||
gencode.o: $(CDIR)/result.h
|
|
||||||
gencode.o: tables.h
|
|
||||||
gencode.o: $(CDIR)/types.h
|
|
||||||
glosym.o: $(CDIR)/glosym.h
|
|
||||||
glosym.o: $(CDIR)/param.h
|
|
||||||
glosym.o: tables.h
|
|
||||||
glosym.o: $(CDIR)/types.h
|
|
||||||
main.o: $(CDIR)/param.h
|
|
||||||
move.o: $(CDIR)/assert.h
|
|
||||||
move.o: $(CDIR)/data.h
|
|
||||||
move.o: $(CDIR)/extern.h
|
|
||||||
move.o: $(CDIR)/param.h
|
|
||||||
move.o: $(CDIR)/result.h
|
|
||||||
move.o: tables.h
|
|
||||||
move.o: $(CDIR)/types.h
|
|
||||||
nextem.o: $(CDIR)/assert.h
|
|
||||||
nextem.o: $(CDIR)/data.h
|
|
||||||
nextem.o: $(CDIR)/extern.h
|
|
||||||
nextem.o: $(CDIR)/param.h
|
|
||||||
nextem.o: $(CDIR)/result.h
|
|
||||||
nextem.o: tables.h
|
|
||||||
nextem.o: $(CDIR)/types.h
|
|
||||||
reg.o: $(CDIR)/assert.h
|
|
||||||
reg.o: $(CDIR)/data.h
|
|
||||||
reg.o: $(CDIR)/extern.h
|
|
||||||
reg.o: $(CDIR)/param.h
|
|
||||||
reg.o: $(CDIR)/result.h
|
|
||||||
reg.o: tables.h
|
|
||||||
reg.o: $(CDIR)/types.h
|
|
||||||
regvar.o: $(CDIR)/assert.h
|
|
||||||
regvar.o: $(CDIR)/data.h
|
|
||||||
regvar.o: $(CDIR)/extern.h
|
|
||||||
regvar.o: $(CDIR)/param.h
|
|
||||||
regvar.o: $(CDIR)/regvar.h
|
|
||||||
regvar.o: $(CDIR)/result.h
|
|
||||||
regvar.o: tables.h
|
|
||||||
regvar.o: $(CDIR)/types.h
|
|
||||||
salloc.o: $(CDIR)/assert.h
|
|
||||||
salloc.o: $(CDIR)/data.h
|
|
||||||
salloc.o: $(CDIR)/extern.h
|
|
||||||
salloc.o: $(CDIR)/param.h
|
|
||||||
salloc.o: $(CDIR)/result.h
|
|
||||||
salloc.o: tables.h
|
|
||||||
salloc.o: $(CDIR)/types.h
|
|
||||||
state.o: $(CDIR)/assert.h
|
|
||||||
state.o: $(CDIR)/data.h
|
|
||||||
state.o: $(CDIR)/extern.h
|
|
||||||
state.o: $(CDIR)/param.h
|
|
||||||
state.o: $(CDIR)/result.h
|
|
||||||
state.o: $(CDIR)/state.h
|
|
||||||
state.o: tables.h
|
|
||||||
state.o: $(CDIR)/types.h
|
|
||||||
subr.o: $(CDIR)/assert.h
|
|
||||||
subr.o: $(CDIR)/data.h
|
|
||||||
subr.o: $(CDIR)/extern.h
|
|
||||||
subr.o: $(CDIR)/param.h
|
|
||||||
subr.o: $(CDIR)/result.h
|
|
||||||
subr.o: tables.h
|
|
||||||
subr.o: $(CDIR)/types.h
|
|
||||||
var.o: $(CDIR)/data.h
|
|
||||||
var.o: $(CDIR)/param.h
|
|
||||||
var.o: $(CDIR)/result.h
|
|
||||||
var.o: tables.h
|
|
||||||
var.o: $(CDIR)/types.h
|
|
||||||
@@ -1,7 +0,0 @@
|
|||||||
/* $Header$ */
|
|
||||||
|
|
||||||
#ifndef NDEBUG
|
|
||||||
#define assert(x) if(!(x)) badassertion("x",__FILE__,__LINE__)
|
|
||||||
#else
|
|
||||||
#define assert(x) /* nothing */
|
|
||||||
#endif
|
|
||||||
@@ -1,672 +0,0 @@
|
|||||||
#ifndef NORCSID
|
|
||||||
static char rcsid[] = "$Header$";
|
|
||||||
#endif
|
|
||||||
|
|
||||||
#include "assert.h"
|
|
||||||
#include "param.h"
|
|
||||||
#include "tables.h"
|
|
||||||
#include "types.h"
|
|
||||||
#include <cg_pattern.h>
|
|
||||||
#include "data.h"
|
|
||||||
#include "result.h"
|
|
||||||
#include "state.h"
|
|
||||||
#include "equiv.h"
|
|
||||||
#include "extern.h"
|
|
||||||
|
|
||||||
/*
|
|
||||||
* (c) copyright 1983 by the Vrije Universiteit, Amsterdam, The Netherlands.
|
|
||||||
*
|
|
||||||
* This product is part of the Amsterdam Compiler Kit.
|
|
||||||
*
|
|
||||||
* Permission to use, sell, duplicate or disclose this software must be
|
|
||||||
* obtained in writing. Requests for such permissions may be sent to
|
|
||||||
*
|
|
||||||
* Dr. Andrew S. Tanenbaum
|
|
||||||
* Wiskundig Seminarium
|
|
||||||
* Vrije Universiteit
|
|
||||||
* Postbox 7161
|
|
||||||
* 1007 MC Amsterdam
|
|
||||||
* The Netherlands
|
|
||||||
*
|
|
||||||
* Author: Hans van Staveren
|
|
||||||
*/
|
|
||||||
|
|
||||||
#define SHORTCUT /* Stop searching at distance 0 */
|
|
||||||
|
|
||||||
#if NREGS >= MAXRULE
|
|
||||||
#define MAXPOS NREGS
|
|
||||||
#else
|
|
||||||
#define MAXPOS MAXRULE
|
|
||||||
#endif
|
|
||||||
|
|
||||||
#define MAXPATTERN 5
|
|
||||||
#define MAXREPLLEN 5 /* Max length of EM-replacement, should come from boot */
|
|
||||||
|
|
||||||
byte startupcode[] = { DO_NEXTEM };
|
|
||||||
|
|
||||||
byte *nextem();
|
|
||||||
unsigned costcalc();
|
|
||||||
unsigned docoerc();
|
|
||||||
unsigned stackupto();
|
|
||||||
string tostring();
|
|
||||||
|
|
||||||
#ifdef NDEBUG
|
|
||||||
#define DEBUG()
|
|
||||||
#else
|
|
||||||
#include <stdio.h>
|
|
||||||
#define DEBUG(string) {if(Debug) fprintf(stderr,"%-*d%s\n",4*level,level,string);}
|
|
||||||
#endif
|
|
||||||
|
|
||||||
#define BROKE() {assert(origcp!=startupcode);DEBUG("BROKE");goto doreturn;}
|
|
||||||
#define CHKCOST() {if (totalcost>=costlimit) BROKE();}
|
|
||||||
|
|
||||||
unsigned codegen(codep,ply,toplevel,costlimit,forced) byte *codep; unsigned costlimit; {
|
|
||||||
#ifndef NDEBUG
|
|
||||||
byte *origcp=codep;
|
|
||||||
static int level=0;
|
|
||||||
#endif
|
|
||||||
unsigned totalcost = 0;
|
|
||||||
byte *bp;
|
|
||||||
int n;
|
|
||||||
unsigned mindistance,dist;
|
|
||||||
register i;
|
|
||||||
int cindex;
|
|
||||||
int npos,npos2,pos[MAXPOS],pos2[MAXPOS];
|
|
||||||
#ifdef STONSTACK
|
|
||||||
state_t state;
|
|
||||||
#define SAVEST savestatus(&state)
|
|
||||||
#define RESTST restorestatus(&state)
|
|
||||||
#define FREEST /* nothing */
|
|
||||||
#else
|
|
||||||
state_p state;
|
|
||||||
#define SAVEST state=savestatus()
|
|
||||||
#define RESTST restorestatus(state)
|
|
||||||
#define FREEST freestatus(state)
|
|
||||||
#endif
|
|
||||||
unsigned mincost,t;
|
|
||||||
int texpno,nodeno;
|
|
||||||
token_p tp;
|
|
||||||
tkdef_p tdp;
|
|
||||||
int tinstno;
|
|
||||||
struct reginfo *rp,**rpp;
|
|
||||||
token_t token,mtoken,token2;
|
|
||||||
int propno;
|
|
||||||
int exactmatch;
|
|
||||||
int j;
|
|
||||||
int decision;
|
|
||||||
int stringno;
|
|
||||||
result_t result;
|
|
||||||
cost_t cost;
|
|
||||||
int size,lsize,repllen;
|
|
||||||
int tokexp[MAXPATTERN];
|
|
||||||
int nregneeded;
|
|
||||||
token_p regtp[MAXCREG];
|
|
||||||
c3_p regcp[MAXCREG];
|
|
||||||
rl_p regls[MAXCREG];
|
|
||||||
c3_p cp,findcoerc();
|
|
||||||
int sret;
|
|
||||||
token_t reptoken[MAXREPLLEN];
|
|
||||||
int emrepllen,eminstr;
|
|
||||||
int inscoerc=0;
|
|
||||||
int stackpad;
|
|
||||||
struct perm *tup,*ntup,*besttup,*tuples();
|
|
||||||
|
|
||||||
#ifndef NDEBUG
|
|
||||||
level++;
|
|
||||||
DEBUG("Entering codegen");
|
|
||||||
#endif
|
|
||||||
for (;;) {
|
|
||||||
switch( (*codep++)&037 ) {
|
|
||||||
default:
|
|
||||||
assert(FALSE);
|
|
||||||
/* NOTREACHED */
|
|
||||||
case DO_NEXTEM:
|
|
||||||
DEBUG("NEXTEM");
|
|
||||||
tokpatlen = 0;
|
|
||||||
nallreg=0;
|
|
||||||
if (toplevel) {
|
|
||||||
garbage_collect();
|
|
||||||
totalcost=0;
|
|
||||||
} else {
|
|
||||||
if (--ply <= 0)
|
|
||||||
goto doreturn;
|
|
||||||
}
|
|
||||||
if (stackheight>MAXFSTACK-7)
|
|
||||||
totalcost += stackupto(&fakestack[6],ply,toplevel);
|
|
||||||
bp = nextem(toplevel);
|
|
||||||
if (bp == 0) {
|
|
||||||
/*
|
|
||||||
* No pattern found, can be pseudo or error
|
|
||||||
* in table.
|
|
||||||
*/
|
|
||||||
if (toplevel) {
|
|
||||||
codep--;
|
|
||||||
DEBUG("pseudo");
|
|
||||||
dopseudo();
|
|
||||||
} else
|
|
||||||
goto doreturn;
|
|
||||||
} else {
|
|
||||||
#ifndef NDEBUG
|
|
||||||
chkregs();
|
|
||||||
#endif
|
|
||||||
n = *bp++;
|
|
||||||
assert(n>0 && n<=MAXRULE);
|
|
||||||
if (n>1) {
|
|
||||||
mindistance = MAXINT; npos=0;
|
|
||||||
for(i=0;i<n;i++) {
|
|
||||||
getint(cindex,bp);
|
|
||||||
dist=distance(cindex);
|
|
||||||
#ifndef NDEBUG
|
|
||||||
if (Debug)
|
|
||||||
fprintf(stderr,"distance of pos %d is %u\n",i,dist);
|
|
||||||
#endif
|
|
||||||
if (dist<=mindistance) {
|
|
||||||
if (dist<mindistance) {
|
|
||||||
#ifdef SHORTCUT
|
|
||||||
if(dist==0)
|
|
||||||
goto gotit;
|
|
||||||
#endif
|
|
||||||
npos=0;
|
|
||||||
mindistance = dist;
|
|
||||||
}
|
|
||||||
pos[npos++] = cindex;
|
|
||||||
}
|
|
||||||
}
|
|
||||||
assert(mindistance<MAXINT);
|
|
||||||
if (npos>1) {
|
|
||||||
/*
|
|
||||||
* More than 1 tokenpattern is a candidate.
|
|
||||||
* Decision has to be made by lookahead.
|
|
||||||
*/
|
|
||||||
SAVEST;
|
|
||||||
mincost = costlimit-totalcost+1;
|
|
||||||
for(i=0;i<npos;i++) {
|
|
||||||
t=codegen(&coderules[pos[i]],ply,FALSE,mincost,0);
|
|
||||||
#ifndef NDEBUG
|
|
||||||
if (Debug)
|
|
||||||
fprintf(stderr,"mincost %u,cost %u,pos %d\n",mincost,t,i);
|
|
||||||
#endif
|
|
||||||
if (t<mincost) {
|
|
||||||
mincost = t;
|
|
||||||
cindex = pos[i];
|
|
||||||
}
|
|
||||||
RESTST;
|
|
||||||
}
|
|
||||||
FREEST;
|
|
||||||
if (totalcost+mincost>costlimit) {
|
|
||||||
totalcost += mincost;
|
|
||||||
BROKE();
|
|
||||||
}
|
|
||||||
} else {
|
|
||||||
cindex = pos[0];
|
|
||||||
}
|
|
||||||
} else {
|
|
||||||
getint(cindex,bp);
|
|
||||||
}
|
|
||||||
|
|
||||||
gotit:
|
|
||||||
/*
|
|
||||||
* Now cindex contains the code-index of the best candidate
|
|
||||||
* so proceed to use it.
|
|
||||||
*/
|
|
||||||
codep = &coderules[cindex];
|
|
||||||
}
|
|
||||||
break;
|
|
||||||
case DO_COERC:
|
|
||||||
DEBUG("COERC");
|
|
||||||
tokpatlen=1;
|
|
||||||
inscoerc=1;
|
|
||||||
break;
|
|
||||||
case DO_XXMATCH:
|
|
||||||
DEBUG("XXMATCH");
|
|
||||||
case DO_XMATCH:
|
|
||||||
DEBUG("XMATCH");
|
|
||||||
tokpatlen=(codep[-1]>>5)&07;
|
|
||||||
for (i=0;i<tokpatlen;i++)
|
|
||||||
getint(tokexp[i],codep);
|
|
||||||
tokexp[i]=0;
|
|
||||||
break; /* match already checked by distance() */
|
|
||||||
case DO_MATCH:
|
|
||||||
DEBUG("MATCH");
|
|
||||||
tokpatlen=(codep[-1]>>5)&07;
|
|
||||||
for(i=0;i<tokpatlen;i++)
|
|
||||||
getint(tokexp[i],codep);
|
|
||||||
tokexp[i] = 0;
|
|
||||||
tp = &fakestack[stackheight-1];
|
|
||||||
i=0;
|
|
||||||
while (i<tokpatlen && tp>=fakestack) {
|
|
||||||
size=tsize(tp);
|
|
||||||
while (i<tokpatlen && (lsize=ssize(tokexp[i]))<=size) {
|
|
||||||
size -= lsize;
|
|
||||||
i++;
|
|
||||||
}
|
|
||||||
if (i<tokpatlen && size!=0) {
|
|
||||||
totalcost += stackupto(tp,ply,toplevel);
|
|
||||||
CHKCOST();
|
|
||||||
break;
|
|
||||||
}
|
|
||||||
tp--;
|
|
||||||
}
|
|
||||||
tp = &fakestack[stackheight-1];
|
|
||||||
i=0;
|
|
||||||
while (i<tokpatlen && tp >= fakestack) {
|
|
||||||
size = tsize(tp);
|
|
||||||
lsize= ssize(tokexp[i]);
|
|
||||||
if (size != lsize) { /* find coercion */
|
|
||||||
#ifdef MAXSPLIT
|
|
||||||
sret = split(tp,&tokexp[i],ply,toplevel);
|
|
||||||
if (sret==0) {
|
|
||||||
#endif MAXSPLIT
|
|
||||||
totalcost += stackupto(tp,ply,toplevel);
|
|
||||||
CHKCOST();
|
|
||||||
break;
|
|
||||||
#ifdef MAXSPLIT
|
|
||||||
}
|
|
||||||
i += sret;
|
|
||||||
#endif MAXSPLIT
|
|
||||||
} else
|
|
||||||
i += 1;
|
|
||||||
tp--;
|
|
||||||
}
|
|
||||||
nextmatch:
|
|
||||||
tp = &fakestack[stackheight-1];
|
|
||||||
i=0; nregneeded = 0;
|
|
||||||
while (i<tokpatlen && tp>=fakestack) {
|
|
||||||
if (!match(tp,&machsets[tokexp[i]],0)) {
|
|
||||||
cp = findcoerc(tp, &machsets[tokexp[i]]);
|
|
||||||
if (cp==0) {
|
|
||||||
for (j=0;j<nregneeded;j++)
|
|
||||||
regtp[j] -= (tp-fakestack+1);
|
|
||||||
totalcost += stackupto(tp,ply,toplevel);
|
|
||||||
CHKCOST();
|
|
||||||
break;
|
|
||||||
} else {
|
|
||||||
if (cp->c3_prop==0) {
|
|
||||||
totalcost+=docoerc(tp,cp,ply,toplevel,0);
|
|
||||||
CHKCOST();
|
|
||||||
} else {
|
|
||||||
assert(nregneeded<MAXCREG);
|
|
||||||
regtp[nregneeded] = tp;
|
|
||||||
regcp[nregneeded] = cp;
|
|
||||||
regls[nregneeded] = curreglist;
|
|
||||||
nregneeded++;
|
|
||||||
}
|
|
||||||
}
|
|
||||||
}
|
|
||||||
i++; tp--;
|
|
||||||
}
|
|
||||||
if (tokpatlen>stackheight) {
|
|
||||||
stackpad = tokpatlen-stackheight;
|
|
||||||
for (j=stackheight-1;j>=0;j--)
|
|
||||||
fakestack[j+stackpad] = fakestack[j];
|
|
||||||
for (j=0;j<stackpad;j++)
|
|
||||||
fakestack[j].t_token=0;
|
|
||||||
stackheight += stackpad;
|
|
||||||
for (j=0;j<nregneeded;j++)
|
|
||||||
regtp[j] += stackpad;
|
|
||||||
tp = &fakestack[stackpad-1];
|
|
||||||
while (i<tokpatlen && tp>=fakestack) {
|
|
||||||
cp = findcoerc((token_p) 0, &machsets[tokexp[i]]);
|
|
||||||
if (cp==0) {
|
|
||||||
assert(!toplevel);
|
|
||||||
for (j=0;j<nregneeded;j++)
|
|
||||||
myfree(regls[j]);
|
|
||||||
totalcost=INFINITY;
|
|
||||||
BROKE();
|
|
||||||
}
|
|
||||||
if (cp->c3_prop==0) {
|
|
||||||
totalcost+=docoerc(tp,cp,ply,toplevel,0);
|
|
||||||
CHKCOST();
|
|
||||||
} else {
|
|
||||||
assert(nregneeded<MAXCREG);
|
|
||||||
regtp[nregneeded] = tp;
|
|
||||||
regcp[nregneeded] = cp;
|
|
||||||
regls[nregneeded] = curreglist;
|
|
||||||
nregneeded++;
|
|
||||||
}
|
|
||||||
i++; tp--;
|
|
||||||
}
|
|
||||||
} else
|
|
||||||
stackpad=0;
|
|
||||||
assert(i==tokpatlen);
|
|
||||||
if (nregneeded==0)
|
|
||||||
break;
|
|
||||||
SAVEST;
|
|
||||||
mincost=costlimit-totalcost+1;
|
|
||||||
tup = tuples(regls,nregneeded);
|
|
||||||
besttup=0;
|
|
||||||
for (; tup != 0; tup = ntup) {
|
|
||||||
ntup = tup->p_next;
|
|
||||||
for (i=0,t=0;i<nregneeded && t<mincost; i++)
|
|
||||||
t += docoerc(regtp[i],regcp[i],ply,FALSE,tup->p_rar[i]);
|
|
||||||
if (t<mincost)
|
|
||||||
t += codegen(codep,ply,FALSE,mincost-t,0);
|
|
||||||
if (t<mincost) {
|
|
||||||
mincost = t;
|
|
||||||
besttup = tup;
|
|
||||||
} else
|
|
||||||
myfree(tup);
|
|
||||||
RESTST;
|
|
||||||
}
|
|
||||||
FREEST;
|
|
||||||
for (i=0;i<nregneeded;i++)
|
|
||||||
myfree(regls[i]);
|
|
||||||
if (totalcost+mincost>costlimit) {
|
|
||||||
if (besttup)
|
|
||||||
myfree(besttup);
|
|
||||||
if (stackpad!=tokpatlen) {
|
|
||||||
if (stackpad) {
|
|
||||||
if (costlimit<MAXINT) {
|
|
||||||
totalcost = costlimit+1;
|
|
||||||
BROKE();
|
|
||||||
}
|
|
||||||
for (i=0;i<stackheight-stackpad;i++)
|
|
||||||
fakestack[i] = fakestack[i+stackpad];
|
|
||||||
stackheight -= stackpad;
|
|
||||||
totalcost += stackupto(&fakestack[stackheight-1],ply,toplevel);
|
|
||||||
} else
|
|
||||||
totalcost += stackupto(fakestack,ply,toplevel);
|
|
||||||
CHKCOST();
|
|
||||||
goto nextmatch;
|
|
||||||
}
|
|
||||||
totalcost += mincost;
|
|
||||||
BROKE();
|
|
||||||
}
|
|
||||||
for (i=0;i<nregneeded;i++)
|
|
||||||
totalcost += docoerc(regtp[i],regcp[i],ply,toplevel,besttup->p_rar[i]);
|
|
||||||
myfree(besttup);
|
|
||||||
break;
|
|
||||||
case DO_REMOVE:
|
|
||||||
DEBUG("REMOVE");
|
|
||||||
if (codep[-1]&32) {
|
|
||||||
getint(texpno,codep);
|
|
||||||
getint(nodeno,codep);
|
|
||||||
} else {
|
|
||||||
getint(texpno,codep);
|
|
||||||
nodeno=0;
|
|
||||||
}
|
|
||||||
for (tp= &fakestack[stackheight-tokpatlen-1];tp>=&fakestack[0];tp--)
|
|
||||||
if (match(tp,&machsets[texpno],nodeno)) {
|
|
||||||
/* investigate possible coercion to register */
|
|
||||||
totalcost += stackupto(tp,ply,toplevel);
|
|
||||||
CHKCOST();
|
|
||||||
break;
|
|
||||||
}
|
|
||||||
for (rp=machregs+2;rp<machregs+NREGS;rp++)
|
|
||||||
if (match(&rp->r_contents,&machsets[texpno],nodeno))
|
|
||||||
rp->r_contents.t_token=0;
|
|
||||||
break;
|
|
||||||
case DO_RREMOVE: /* register remove */
|
|
||||||
getint(nodeno,codep);
|
|
||||||
result=compute(&enodes[nodeno]);
|
|
||||||
assert(result.e_typ==EV_REG);
|
|
||||||
for (tp= &fakestack[stackheight-tokpatlen-1];tp>=&fakestack[0];tp--)
|
|
||||||
if (tp->t_token==-1) {
|
|
||||||
if(tp->t_att[0].ar==result.e_v.e_con)
|
|
||||||
goto gotone;
|
|
||||||
} else {
|
|
||||||
tdp = &tokens[tp->t_token];
|
|
||||||
for(i=0;i<TOKENSIZE;i++)
|
|
||||||
if (tdp->t_type[i]==EV_REG &&
|
|
||||||
tp->t_att[i].ar==result.e_v.e_con)
|
|
||||||
goto gotone;
|
|
||||||
}
|
|
||||||
break;
|
|
||||||
gotone:
|
|
||||||
/* investigate possible coercion to register */
|
|
||||||
totalcost += stackupto(tp,ply,toplevel);
|
|
||||||
CHKCOST();
|
|
||||||
break;
|
|
||||||
case DO_DEALLOCATE:
|
|
||||||
DEBUG("DEALLOCATE");
|
|
||||||
getint(tinstno,codep);
|
|
||||||
instance(tinstno,&token);
|
|
||||||
if (token.t_token==-1)
|
|
||||||
chrefcount(token.t_att[0].ar,-1,TRUE);
|
|
||||||
else {
|
|
||||||
tdp= &tokens[token.t_token];
|
|
||||||
for (i=0;i<TOKENSIZE;i++)
|
|
||||||
if (tdp->t_type[i]==EV_REG)
|
|
||||||
chrefcount(token.t_att[i].ar,-1,TRUE);
|
|
||||||
}
|
|
||||||
break;
|
|
||||||
case DO_REALLOCATE:
|
|
||||||
DEBUG("REALLOCATE");
|
|
||||||
for(rp=machregs;rp<machregs+NREGS;rp++)
|
|
||||||
if(rp->r_tcount) {
|
|
||||||
rp->r_refcount -= rp->r_tcount;
|
|
||||||
rp->r_tcount = 0;
|
|
||||||
}
|
|
||||||
break;
|
|
||||||
case DO_ALLOCATE:
|
|
||||||
DEBUG("ALLOCATE");
|
|
||||||
if (codep[-1]&32) {
|
|
||||||
getint(propno,codep);
|
|
||||||
getint(tinstno,codep);
|
|
||||||
} else {
|
|
||||||
getint(propno,codep);
|
|
||||||
tinstno=0;
|
|
||||||
}
|
|
||||||
instance(tinstno,&token);
|
|
||||||
if (!forced) {
|
|
||||||
do {
|
|
||||||
npos=exactmatch=0;
|
|
||||||
for(rpp=reglist[propno];rp= *rpp; rpp++)
|
|
||||||
if (getrefcount(rp-machregs)==0) {
|
|
||||||
pos[npos++] = rp-machregs;
|
|
||||||
if (eqtoken(&rp->r_contents,&token))
|
|
||||||
exactmatch++;
|
|
||||||
}
|
|
||||||
/*
|
|
||||||
* Now pos[] contains all free registers with desired
|
|
||||||
* property. If none then some stacking has to take place.
|
|
||||||
*/
|
|
||||||
if (npos==0) {
|
|
||||||
if (stackheight<=tokpatlen) {
|
|
||||||
if (!toplevel) {
|
|
||||||
totalcost = INFINITY;
|
|
||||||
BROKE();
|
|
||||||
} else {
|
|
||||||
fatal("No regs available");
|
|
||||||
}
|
|
||||||
}
|
|
||||||
totalcost += stackupto( &fakestack[0],ply,toplevel);
|
|
||||||
CHKCOST();
|
|
||||||
}
|
|
||||||
} while (npos==0);
|
|
||||||
if (!exactmatch) {
|
|
||||||
npos2=npos;
|
|
||||||
for(i=0;i<npos;i++)
|
|
||||||
pos2[i]=pos[i];
|
|
||||||
} else {
|
|
||||||
/*
|
|
||||||
* Now we are reducing the number of possible registers.
|
|
||||||
* We take only one equally likely register out of every
|
|
||||||
* equivalence class as given by set of properties.
|
|
||||||
*/
|
|
||||||
mtoken = token;
|
|
||||||
npos2=0;
|
|
||||||
for(i=0;i<npos;i++)
|
|
||||||
if (eqtoken(&machregs[pos[i]].r_contents,&mtoken)) {
|
|
||||||
pos2[npos2++] = pos[i];
|
|
||||||
for(j=0;j<npos2-1;j++)
|
|
||||||
if (eqregclass(pos2[j],pos[i])) {
|
|
||||||
npos2--;
|
|
||||||
break;
|
|
||||||
}
|
|
||||||
}
|
|
||||||
}
|
|
||||||
/*
|
|
||||||
* Now pos2[] contains all possibilities to try, if more than
|
|
||||||
* one, lookahead is necessary.
|
|
||||||
*/
|
|
||||||
token2.t_token= -1;
|
|
||||||
for (i=1;i<TOKENSIZE;i++)
|
|
||||||
token2.t_att[i].aw=0;
|
|
||||||
if (npos2==1)
|
|
||||||
decision=pos2[0];
|
|
||||||
else {
|
|
||||||
SAVEST;
|
|
||||||
mincost=costlimit-totalcost+1;
|
|
||||||
for(j=0;j<npos2;j++) {
|
|
||||||
chrefcount(pos2[j],1,FALSE);
|
|
||||||
token2.t_att[0].ar=pos2[j];
|
|
||||||
allreg[nallreg++] = pos2[j];
|
|
||||||
if (token.t_token != 0)
|
|
||||||
t=move(&token,&token2,ply,FALSE,mincost);
|
|
||||||
else {
|
|
||||||
t = 0;
|
|
||||||
erasereg(pos2[j]);
|
|
||||||
}
|
|
||||||
if (t<mincost)
|
|
||||||
t += codegen(codep,ply,FALSE,mincost-t,0);
|
|
||||||
if (t<mincost) {
|
|
||||||
mincost=t;
|
|
||||||
decision=pos2[j];
|
|
||||||
}
|
|
||||||
RESTST;
|
|
||||||
}
|
|
||||||
FREEST;
|
|
||||||
if (totalcost+mincost>costlimit) {
|
|
||||||
totalcost = INFINITY;
|
|
||||||
BROKE();
|
|
||||||
}
|
|
||||||
}
|
|
||||||
} else {
|
|
||||||
decision = forced;
|
|
||||||
if (getrefcount(decision)!=0) {
|
|
||||||
totalcost = INFINITY;
|
|
||||||
BROKE();
|
|
||||||
}
|
|
||||||
token2.t_token = -1;
|
|
||||||
}
|
|
||||||
chrefcount(decision,1,FALSE);
|
|
||||||
token2.t_att[0].ar=decision;
|
|
||||||
if (token.t_token != 0) {
|
|
||||||
totalcost+=move(&token,&token2,ply,toplevel,MAXINT);
|
|
||||||
CHKCOST();
|
|
||||||
} else
|
|
||||||
erasereg(decision);
|
|
||||||
allreg[nallreg++]=decision;
|
|
||||||
break;
|
|
||||||
case DO_LOUTPUT:
|
|
||||||
DEBUG("LOUTPUT");
|
|
||||||
getint(stringno,codep);
|
|
||||||
getint(nodeno,codep);
|
|
||||||
if (toplevel) {
|
|
||||||
gencode(codestrings[stringno]);
|
|
||||||
genexpr(nodeno);
|
|
||||||
}
|
|
||||||
break;
|
|
||||||
case DO_ROUTPUT:
|
|
||||||
DEBUG("ROUTPUT");
|
|
||||||
i=((codep[-1]>>5)&07);
|
|
||||||
do {
|
|
||||||
getint(stringno,codep);
|
|
||||||
if (toplevel) {
|
|
||||||
gencode(codestrings[stringno]);
|
|
||||||
gennl();
|
|
||||||
}
|
|
||||||
} while (i--);
|
|
||||||
break;
|
|
||||||
case DO_MOVE:
|
|
||||||
DEBUG("MOVE");
|
|
||||||
getint(tinstno,codep);
|
|
||||||
instance(tinstno,&token);
|
|
||||||
getint(tinstno,codep);
|
|
||||||
instance(tinstno,&token2);
|
|
||||||
totalcost += move(&token,&token2,ply,toplevel,costlimit-totalcost+1);
|
|
||||||
CHKCOST();
|
|
||||||
break;
|
|
||||||
case DO_ERASE:
|
|
||||||
DEBUG("ERASE");
|
|
||||||
getint(nodeno,codep);
|
|
||||||
result=compute(&enodes[nodeno]);
|
|
||||||
assert(result.e_typ==EV_REG);
|
|
||||||
erasereg(result.e_v.e_reg);
|
|
||||||
break;
|
|
||||||
case DO_TOKREPLACE:
|
|
||||||
DEBUG("TOKREPLACE");
|
|
||||||
assert(stackheight>=tokpatlen);
|
|
||||||
repllen=(codep[-1]>>5)&07;
|
|
||||||
for(i=0;i<repllen;i++) {
|
|
||||||
getint(tinstno,codep);
|
|
||||||
instance(tinstno,&reptoken[i]);
|
|
||||||
tref(&reptoken[i],1);
|
|
||||||
}
|
|
||||||
for(i=0;i<tokpatlen;i++) {
|
|
||||||
if (!inscoerc)
|
|
||||||
tref(&fakestack[stackheight-1],-1);
|
|
||||||
stackheight--;
|
|
||||||
}
|
|
||||||
for (i=0;i<repllen;i++) {
|
|
||||||
assert(stackheight<MAXFSTACK);
|
|
||||||
fakestack[stackheight++] = reptoken[i];
|
|
||||||
}
|
|
||||||
for(i=0;i<nallreg;i++)
|
|
||||||
chrefcount(allreg[i],-1,FALSE);
|
|
||||||
break;
|
|
||||||
case DO_EMREPLACE:
|
|
||||||
DEBUG("EMREPLACE");
|
|
||||||
emrepllen=(codep[-1]>>5)&07;
|
|
||||||
j=emp-emlines;
|
|
||||||
if (emrepllen>j) {
|
|
||||||
assert(nemlines+emrepllen-j<MAXEMLINES);
|
|
||||||
for (i=nemlines;i>=0;i--)
|
|
||||||
emlines[i+emrepllen-j] = emlines[i];
|
|
||||||
nemlines += emrepllen-j;
|
|
||||||
emp += emrepllen-j;
|
|
||||||
}
|
|
||||||
emp -= emrepllen;
|
|
||||||
for (i=0;i<emrepllen;i++) {
|
|
||||||
getint(eminstr,codep);
|
|
||||||
getint(nodeno,codep);
|
|
||||||
emp[i].em_instr = eminstr;
|
|
||||||
result = compute(&enodes[nodeno]);
|
|
||||||
switch(result.e_typ) {
|
|
||||||
default:
|
|
||||||
assert(FALSE);
|
|
||||||
case 0:
|
|
||||||
emp[i].em_optyp = OPNO;
|
|
||||||
emp[i].em_soper = 0;
|
|
||||||
break;
|
|
||||||
case EV_INT:
|
|
||||||
emp[i].em_optyp = OPINT;
|
|
||||||
emp[i].em_soper = tostring(result.e_v.e_con);
|
|
||||||
emp[i].em_u.em_ioper = result.e_v.e_con;
|
|
||||||
break;
|
|
||||||
case EV_STR:
|
|
||||||
emp[i].em_optyp = OPSYMBOL;
|
|
||||||
emp[i].em_soper = result.e_v.e_str;
|
|
||||||
break;
|
|
||||||
}
|
|
||||||
}
|
|
||||||
if (!toplevel)
|
|
||||||
ply += emrepllen;
|
|
||||||
break;
|
|
||||||
case DO_COST:
|
|
||||||
DEBUG("COST");
|
|
||||||
getint(cost.c_size,codep);
|
|
||||||
getint(cost.c_time,codep);
|
|
||||||
totalcost += costcalc(cost);
|
|
||||||
CHKCOST();
|
|
||||||
break;
|
|
||||||
#ifdef REGVARS
|
|
||||||
case DO_PRETURN:
|
|
||||||
if (toplevel) {
|
|
||||||
swtxt();
|
|
||||||
regreturn(); /* in mach.c */
|
|
||||||
}
|
|
||||||
break;
|
|
||||||
#endif
|
|
||||||
case DO_RETURN:
|
|
||||||
DEBUG("RETURN");
|
|
||||||
assert(origcp!=startupcode);
|
|
||||||
doreturn:
|
|
||||||
#ifndef NDEBUG
|
|
||||||
level--;
|
|
||||||
#endif
|
|
||||||
return(totalcost);
|
|
||||||
}
|
|
||||||
}
|
|
||||||
}
|
|
||||||
@@ -1,364 +0,0 @@
|
|||||||
#ifndef NORCSID
|
|
||||||
static char rcsid[] = "$Header$";
|
|
||||||
#endif
|
|
||||||
|
|
||||||
#include "assert.h"
|
|
||||||
#include "param.h"
|
|
||||||
#include "tables.h"
|
|
||||||
#include "types.h"
|
|
||||||
#include <cg_pattern.h>
|
|
||||||
#include "data.h"
|
|
||||||
#include "result.h"
|
|
||||||
#include "glosym.h"
|
|
||||||
#include "extern.h"
|
|
||||||
|
|
||||||
/*
|
|
||||||
* (c) copyright 1983 by the Vrije Universiteit, Amsterdam, The Netherlands.
|
|
||||||
*
|
|
||||||
* This product is part of the Amsterdam Compiler Kit.
|
|
||||||
*
|
|
||||||
* Permission to use, sell, duplicate or disclose this software must be
|
|
||||||
* obtained in writing. Requests for such permissions may be sent to
|
|
||||||
*
|
|
||||||
* Dr. Andrew S. Tanenbaum
|
|
||||||
* Wiskundig Seminarium
|
|
||||||
* Vrije Universiteit
|
|
||||||
* Postbox 7161
|
|
||||||
* 1007 MC Amsterdam
|
|
||||||
* The Netherlands
|
|
||||||
*
|
|
||||||
* Author: Hans van Staveren
|
|
||||||
*/
|
|
||||||
|
|
||||||
#define LLEAF 01
|
|
||||||
#define LDEF 02
|
|
||||||
#define RLEAF 04
|
|
||||||
#define RDEF 010
|
|
||||||
#define LLDEF LLEAF|LDEF
|
|
||||||
#define RLDEF RLEAF|RDEF
|
|
||||||
|
|
||||||
char opdesc[] = {
|
|
||||||
0, /* EX_TOKFIELD */
|
|
||||||
0, /* EX_ARG */
|
|
||||||
0, /* EX_CON */
|
|
||||||
0, /* EX_ALLREG */
|
|
||||||
LLDEF|RLDEF, /* EX_SAMESIGN */
|
|
||||||
LLDEF|RLDEF, /* EX_SFIT */
|
|
||||||
LLDEF|RLDEF, /* EX_UFIT */
|
|
||||||
0, /* EX_ROM */
|
|
||||||
LLDEF|RLDEF, /* EX_NCPEQ */
|
|
||||||
LLDEF|RLDEF, /* EX_SCPEQ */
|
|
||||||
LLDEF|RLDEF, /* EX_RCPEQ */
|
|
||||||
LLDEF|RLDEF, /* EX_NCPNE */
|
|
||||||
LLDEF|RLDEF, /* EX_SCPNE */
|
|
||||||
LLDEF|RLDEF, /* EX_RCPNE */
|
|
||||||
LLDEF|RLDEF, /* EX_NCPGT */
|
|
||||||
LLDEF|RLDEF, /* EX_NCPGE */
|
|
||||||
LLDEF|RLDEF, /* EX_NCPLT */
|
|
||||||
LLDEF|RLDEF, /* EX_NCPLE */
|
|
||||||
LLDEF, /* EX_OR2 */
|
|
||||||
LLDEF, /* EX_AND2 */
|
|
||||||
LLDEF|RLDEF, /* EX_PLUS */
|
|
||||||
LLDEF|RLDEF, /* EX_CAT */
|
|
||||||
LLDEF|RLDEF, /* EX_MINUS */
|
|
||||||
LLDEF|RLDEF, /* EX_TIMES */
|
|
||||||
LLDEF|RLDEF, /* EX_DIVIDE */
|
|
||||||
LLDEF|RLDEF, /* EX_MOD */
|
|
||||||
LLDEF|RLDEF, /* EX_LSHIFT */
|
|
||||||
LLDEF|RLDEF, /* EX_RSHIFT */
|
|
||||||
LLDEF, /* EX_NOT */
|
|
||||||
LLDEF, /* EX_COMP */
|
|
||||||
0, /* EX_COST */
|
|
||||||
0, /* EX_STRING */
|
|
||||||
LLEAF, /* EX_DEFINED */
|
|
||||||
0, /* EX_SUBREG */
|
|
||||||
LLDEF, /* EX_TOSTRING */
|
|
||||||
LLDEF, /* EX_UMINUS */
|
|
||||||
0, /* EX_REG */
|
|
||||||
0, /* EX_LOWW */
|
|
||||||
0, /* EX_HIGHW */
|
|
||||||
LLDEF, /* EX_INREG */
|
|
||||||
LLDEF, /* EX_REGVAR */
|
|
||||||
};
|
|
||||||
|
|
||||||
string salloc(),strcpy(),strcat();
|
|
||||||
|
|
||||||
string mycat(s1,s2) string s1,s2; {
|
|
||||||
register string s;
|
|
||||||
|
|
||||||
s=salloc(strlen(s1)+strlen(s2));
|
|
||||||
strcpy(s,s1);
|
|
||||||
strcat(s,s2);
|
|
||||||
return(s);
|
|
||||||
}
|
|
||||||
|
|
||||||
string mystrcpy(s) string s; {
|
|
||||||
register string r;
|
|
||||||
|
|
||||||
r=salloc(strlen(s));
|
|
||||||
strcpy(r,s);
|
|
||||||
return(r);
|
|
||||||
}
|
|
||||||
|
|
||||||
char digstr[21][15];
|
|
||||||
|
|
||||||
string tostring(n) word n; {
|
|
||||||
char buf[25];
|
|
||||||
|
|
||||||
if (n>=-20 && n<=20 && (n&1)==0) {
|
|
||||||
if (digstr[(n>>1)+10][0]==0)
|
|
||||||
sprintf(digstr[(n>>1)+10],WRD_FMT,n);
|
|
||||||
return(digstr[(n>>1)+10]);
|
|
||||||
}
|
|
||||||
sprintf(buf,WRD_FMT,n);
|
|
||||||
return(mystrcpy(buf));
|
|
||||||
}
|
|
||||||
|
|
||||||
result_t undefres= {EV_UNDEF};
|
|
||||||
|
|
||||||
result_t compute(node) node_p node; {
|
|
||||||
result_t leaf1,leaf2,result;
|
|
||||||
token_p tp;
|
|
||||||
int desc;
|
|
||||||
long mask,tmp;
|
|
||||||
int i,tmpreg;
|
|
||||||
glosym_p gp;
|
|
||||||
|
|
||||||
desc=opdesc[node->ex_operator];
|
|
||||||
if (desc&LLEAF) {
|
|
||||||
leaf1 = compute(&enodes[node->ex_lnode]);
|
|
||||||
if (desc&LDEF && leaf1.e_typ==EV_UNDEF)
|
|
||||||
return(undefres);
|
|
||||||
}
|
|
||||||
if (desc&RLEAF) {
|
|
||||||
leaf2 = compute(&enodes[node->ex_rnode]);
|
|
||||||
if (desc&RDEF && leaf2.e_typ==EV_UNDEF)
|
|
||||||
return(undefres);
|
|
||||||
}
|
|
||||||
result.e_typ=EV_INT;
|
|
||||||
switch(node->ex_operator) {
|
|
||||||
default: assert(FALSE);
|
|
||||||
case EX_TOKFIELD:
|
|
||||||
if (node->ex_lnode!=0)
|
|
||||||
tp = &fakestack[stackheight-node->ex_lnode];
|
|
||||||
else
|
|
||||||
tp = curtoken;
|
|
||||||
switch(result.e_typ = tokens[tp->t_token].t_type[node->ex_rnode-1]) {
|
|
||||||
default:
|
|
||||||
assert(FALSE);
|
|
||||||
case EV_INT:
|
|
||||||
result.e_v.e_con = tp->t_att[node->ex_rnode-1].aw;
|
|
||||||
break;
|
|
||||||
case EV_STR:
|
|
||||||
result.e_v.e_str = tp->t_att[node->ex_rnode-1].as;
|
|
||||||
break;
|
|
||||||
case EV_REG:
|
|
||||||
result.e_v.e_reg = tp->t_att[node->ex_rnode-1].ar;
|
|
||||||
break;
|
|
||||||
}
|
|
||||||
return(result);
|
|
||||||
case EX_ARG:
|
|
||||||
return(dollar[node->ex_lnode-1]);
|
|
||||||
case EX_CON:
|
|
||||||
result.e_typ = EV_INT;
|
|
||||||
result.e_v.e_con = ((long) node->ex_rnode << 16) | ((long)node->ex_lnode&0xffff);
|
|
||||||
return(result);
|
|
||||||
case EX_REG:
|
|
||||||
result.e_typ = EV_REG;
|
|
||||||
result.e_v.e_reg = node->ex_lnode;
|
|
||||||
return(result);
|
|
||||||
case EX_ALLREG:
|
|
||||||
result.e_typ = EV_REG;
|
|
||||||
result.e_v.e_reg = allreg[node->ex_lnode-1];
|
|
||||||
#if MAXMEMBERS!=0
|
|
||||||
if (node->ex_rnode!=0)
|
|
||||||
result.e_v.e_reg = machregs[result.e_v.e_reg].
|
|
||||||
r_members[node->ex_rnode-1];
|
|
||||||
#endif
|
|
||||||
return(result);
|
|
||||||
case EX_SAMESIGN:
|
|
||||||
assert(leaf1.e_typ == EV_INT && leaf2.e_typ == EV_INT);
|
|
||||||
result.e_typ = EV_INT;
|
|
||||||
if (leaf1.e_v.e_con>=0)
|
|
||||||
result.e_v.e_con= leaf2.e_v.e_con>=0;
|
|
||||||
else
|
|
||||||
result.e_v.e_con= leaf2.e_v.e_con<0;
|
|
||||||
return(result);
|
|
||||||
case EX_SFIT:
|
|
||||||
assert(leaf1.e_typ == EV_INT && leaf2.e_typ == EV_INT);
|
|
||||||
mask = 0xFFFFFFFFL;
|
|
||||||
for (i=0;i<leaf2.e_v.e_con-1;i++)
|
|
||||||
mask &= ~(1<<i);
|
|
||||||
tmp = leaf1.e_v.e_con&mask;
|
|
||||||
result.e_v.e_con = tmp==0||tmp==mask;
|
|
||||||
return(result);
|
|
||||||
case EX_UFIT:
|
|
||||||
assert(leaf1.e_typ == EV_INT && leaf2.e_typ == EV_INT);
|
|
||||||
mask = 0xFFFFFFFFL;
|
|
||||||
for (i=0;i<leaf2.e_v.e_con;i++)
|
|
||||||
mask &= ~(1<<i);
|
|
||||||
result.e_v.e_con = (leaf1.e_v.e_con&mask)==0;
|
|
||||||
return(result);
|
|
||||||
case EX_ROM:
|
|
||||||
assert(node->ex_rnode>=0 &&node->ex_rnode<MAXROM);
|
|
||||||
leaf2=dollar[node->ex_lnode];
|
|
||||||
if (leaf2.e_typ != EV_STR)
|
|
||||||
return(undefres);
|
|
||||||
gp = lookglo(leaf2.e_v.e_str);
|
|
||||||
if (gp == (glosym_p) 0)
|
|
||||||
return(undefres);
|
|
||||||
if ((gp->gl_rom[MAXROM]&(1<<node->ex_rnode))==0)
|
|
||||||
return(undefres);
|
|
||||||
result.e_v.e_con = gp->gl_rom[node->ex_rnode];
|
|
||||||
return(result);
|
|
||||||
case EX_LOWW:
|
|
||||||
result.e_v.e_con = saveemp[node->ex_lnode].em_u.em_loper&0xFFFF;
|
|
||||||
return(result);
|
|
||||||
case EX_HIGHW:
|
|
||||||
result.e_v.e_con = saveemp[node->ex_lnode].em_u.em_loper>>16;
|
|
||||||
return(result);
|
|
||||||
case EX_NCPEQ:
|
|
||||||
assert(leaf1.e_typ == EV_INT && leaf2.e_typ == EV_INT);
|
|
||||||
result.e_v.e_con = leaf1.e_v.e_con==leaf2.e_v.e_con;
|
|
||||||
return(result);
|
|
||||||
case EX_SCPEQ:
|
|
||||||
assert(leaf1.e_typ == EV_STR && leaf2.e_typ == EV_STR);
|
|
||||||
result.e_v.e_con = !strcmp(leaf1.e_v.e_str,leaf2.e_v.e_str);
|
|
||||||
return(result);
|
|
||||||
case EX_RCPEQ:
|
|
||||||
assert(leaf1.e_typ == EV_REG && leaf2.e_typ == EV_REG);
|
|
||||||
result.e_v.e_con = leaf1.e_v.e_reg==leaf2.e_v.e_reg;
|
|
||||||
return(result);
|
|
||||||
case EX_NCPNE:
|
|
||||||
assert(leaf1.e_typ == EV_INT && leaf2.e_typ == EV_INT);
|
|
||||||
result.e_v.e_con = leaf1.e_v.e_con!=leaf2.e_v.e_con;
|
|
||||||
return(result);
|
|
||||||
case EX_SCPNE:
|
|
||||||
assert(leaf1.e_typ == EV_STR && leaf2.e_typ == EV_STR);
|
|
||||||
result.e_v.e_con = strcmp(leaf1.e_v.e_str,leaf2.e_v.e_str);
|
|
||||||
return(result);
|
|
||||||
case EX_RCPNE:
|
|
||||||
assert(leaf1.e_typ == EV_REG && leaf2.e_typ == EV_REG);
|
|
||||||
result.e_v.e_con = leaf1.e_v.e_reg!=leaf2.e_v.e_reg;
|
|
||||||
return(result);
|
|
||||||
case EX_NCPGT:
|
|
||||||
assert(leaf1.e_typ == EV_INT && leaf2.e_typ == EV_INT);
|
|
||||||
result.e_v.e_con = leaf1.e_v.e_con>leaf2.e_v.e_con;
|
|
||||||
return(result);
|
|
||||||
case EX_NCPGE:
|
|
||||||
assert(leaf1.e_typ == EV_INT && leaf2.e_typ == EV_INT);
|
|
||||||
result.e_v.e_con = leaf1.e_v.e_con>=leaf2.e_v.e_con;
|
|
||||||
return(result);
|
|
||||||
case EX_NCPLT:
|
|
||||||
assert(leaf1.e_typ == EV_INT && leaf2.e_typ == EV_INT);
|
|
||||||
result.e_v.e_con = leaf1.e_v.e_con<leaf2.e_v.e_con;
|
|
||||||
return(result);
|
|
||||||
case EX_NCPLE:
|
|
||||||
assert(leaf1.e_typ == EV_INT && leaf2.e_typ == EV_INT);
|
|
||||||
result.e_v.e_con = leaf1.e_v.e_con<=leaf2.e_v.e_con;
|
|
||||||
return(result);
|
|
||||||
case EX_OR2:
|
|
||||||
assert(leaf1.e_typ == EV_INT);
|
|
||||||
if (leaf1.e_v.e_con==0)
|
|
||||||
return(compute(&enodes[node->ex_rnode]));
|
|
||||||
return(leaf1);
|
|
||||||
case EX_AND2:
|
|
||||||
assert(leaf1.e_typ == EV_INT);
|
|
||||||
if (leaf1.e_v.e_con!=0)
|
|
||||||
return(compute(&enodes[node->ex_rnode]));
|
|
||||||
return(leaf1);
|
|
||||||
case EX_PLUS:
|
|
||||||
assert(leaf1.e_typ == EV_INT && leaf2.e_typ == EV_INT);
|
|
||||||
result.e_v.e_con=leaf1.e_v.e_con+leaf2.e_v.e_con;
|
|
||||||
return(result);
|
|
||||||
case EX_CAT:
|
|
||||||
assert(leaf1.e_typ == EV_STR && leaf2.e_typ == EV_STR);
|
|
||||||
result.e_typ = EV_STR;
|
|
||||||
result.e_v.e_str = mycat(leaf1.e_v.e_str,leaf2.e_v.e_str);
|
|
||||||
return(result);
|
|
||||||
case EX_MINUS:
|
|
||||||
assert(leaf1.e_typ == EV_INT && leaf2.e_typ == EV_INT);
|
|
||||||
result.e_v.e_con = leaf1.e_v.e_con - leaf2.e_v.e_con;
|
|
||||||
return(result);
|
|
||||||
case EX_TIMES:
|
|
||||||
assert(leaf1.e_typ == EV_INT && leaf2.e_typ == EV_INT);
|
|
||||||
result.e_v.e_con = leaf1.e_v.e_con * leaf2.e_v.e_con;
|
|
||||||
return(result);
|
|
||||||
case EX_DIVIDE:
|
|
||||||
assert(leaf1.e_typ == EV_INT && leaf2.e_typ == EV_INT);
|
|
||||||
result.e_v.e_con = leaf1.e_v.e_con / leaf2.e_v.e_con;
|
|
||||||
return(result);
|
|
||||||
case EX_MOD:
|
|
||||||
assert(leaf1.e_typ == EV_INT && leaf2.e_typ == EV_INT);
|
|
||||||
result.e_v.e_con = leaf1.e_v.e_con % leaf2.e_v.e_con;
|
|
||||||
return(result);
|
|
||||||
case EX_LSHIFT:
|
|
||||||
assert(leaf1.e_typ == EV_INT && leaf2.e_typ == EV_INT);
|
|
||||||
result.e_v.e_con = leaf1.e_v.e_con << leaf2.e_v.e_con;
|
|
||||||
return(result);
|
|
||||||
case EX_RSHIFT:
|
|
||||||
assert(leaf1.e_typ == EV_INT && leaf2.e_typ == EV_INT);
|
|
||||||
result.e_v.e_con = leaf1.e_v.e_con >> leaf2.e_v.e_con;
|
|
||||||
return(result);
|
|
||||||
case EX_NOT:
|
|
||||||
assert(leaf1.e_typ == EV_INT);
|
|
||||||
result.e_v.e_con = !leaf1.e_v.e_con;
|
|
||||||
return(result);
|
|
||||||
case EX_COMP:
|
|
||||||
assert(leaf1.e_typ == EV_INT);
|
|
||||||
result.e_v.e_con = ~leaf1.e_v.e_con;
|
|
||||||
return(result);
|
|
||||||
case EX_COST:
|
|
||||||
if (node->ex_rnode==0)
|
|
||||||
return(compute(&enodes[tokens[node->ex_lnode].t_cost.c_size]));
|
|
||||||
else
|
|
||||||
return(compute(&enodes[tokens[node->ex_lnode].t_cost.c_time]));
|
|
||||||
case EX_STRING:
|
|
||||||
result.e_typ = EV_STR;
|
|
||||||
result.e_v.e_str = codestrings[node->ex_lnode];
|
|
||||||
return(result);
|
|
||||||
case EX_DEFINED:
|
|
||||||
result.e_v.e_con=leaf1.e_typ!=EV_UNDEF;
|
|
||||||
return(result);
|
|
||||||
case EX_SUBREG:
|
|
||||||
result.e_typ = EV_REG;
|
|
||||||
tp= &fakestack[stackheight-node->ex_lnode];
|
|
||||||
assert(tp->t_token == -1);
|
|
||||||
tmpreg= tp->t_att[0].ar;
|
|
||||||
#if MAXMEMBERS!=0
|
|
||||||
if (node->ex_rnode)
|
|
||||||
tmpreg=machregs[tmpreg].r_members[node->ex_rnode-1];
|
|
||||||
#endif
|
|
||||||
result.e_v.e_reg=tmpreg;
|
|
||||||
return(result);
|
|
||||||
case EX_TOSTRING:
|
|
||||||
assert(leaf1.e_typ == EV_INT);
|
|
||||||
result.e_typ = EV_STR;
|
|
||||||
result.e_v.e_str = tostring(leaf1.e_v.e_con);
|
|
||||||
return(result);
|
|
||||||
#ifdef REGVARS
|
|
||||||
case EX_INREG:
|
|
||||||
assert(leaf1.e_typ == EV_INT);
|
|
||||||
i = isregvar((long) leaf1.e_v.e_con);
|
|
||||||
if (i<0)
|
|
||||||
result.e_v.e_con = 0;
|
|
||||||
else if (i==0)
|
|
||||||
result.e_v.e_con = 1;
|
|
||||||
else
|
|
||||||
result.e_v.e_con = 2;
|
|
||||||
return(result);
|
|
||||||
case EX_REGVAR:
|
|
||||||
assert(leaf1.e_typ == EV_INT);
|
|
||||||
i = isregvar((long) leaf1.e_v.e_con);
|
|
||||||
if (i<=0)
|
|
||||||
return(undefres);
|
|
||||||
result.e_typ = EV_REG;
|
|
||||||
result.e_v.e_reg=i;
|
|
||||||
return(result);
|
|
||||||
#endif
|
|
||||||
case EX_UMINUS:
|
|
||||||
assert(leaf1.e_typ == EV_INT);
|
|
||||||
result.e_v.e_con = -leaf1.e_v.e_con;
|
|
||||||
return(result);
|
|
||||||
}
|
|
||||||
}
|
|
||||||
@@ -1,54 +0,0 @@
|
|||||||
/* $Header$ */
|
|
||||||
|
|
||||||
typedef struct {
|
|
||||||
int t_token; /* kind of token, -1 for register */
|
|
||||||
union {
|
|
||||||
word aw; /* integer type */
|
|
||||||
string as; /* string type */
|
|
||||||
int ar; /* register type */
|
|
||||||
} t_att[TOKENSIZE];
|
|
||||||
} token_t,*token_p;
|
|
||||||
|
|
||||||
struct reginfo {
|
|
||||||
int r_repr; /* index in string table */
|
|
||||||
int r_size; /* size in bytes */
|
|
||||||
#if MAXMEMBERS!=0
|
|
||||||
int r_members[MAXMEMBERS]; /* register contained within this reg */
|
|
||||||
short r_clash[REGSETSIZE]; /* set of clashing registers */
|
|
||||||
#endif
|
|
||||||
int r_refcount; /* Times in use */
|
|
||||||
token_t r_contents; /* Current contents */
|
|
||||||
int r_tcount; /* Temporary count difference */
|
|
||||||
};
|
|
||||||
|
|
||||||
#if MAXMEMBERS!=0
|
|
||||||
#define clash(a,b) ((machregs[a].r_clash[(b)>>4]&(1<<((b)&017)))!=0)
|
|
||||||
#else
|
|
||||||
#define clash(a,b) ((a)==(b))
|
|
||||||
#endif
|
|
||||||
|
|
||||||
typedef struct {
|
|
||||||
int t_size; /* size in bytes */
|
|
||||||
cost_t t_cost; /* cost in bytes and time */
|
|
||||||
byte t_type[TOKENSIZE]; /* types of attributes, TT_??? */
|
|
||||||
int t_format; /* index of formatstring */
|
|
||||||
} tkdef_t,*tkdef_p;
|
|
||||||
|
|
||||||
struct emline {
|
|
||||||
int em_instr;
|
|
||||||
int em_optyp;
|
|
||||||
string em_soper;
|
|
||||||
union {
|
|
||||||
word em_ioper;
|
|
||||||
long em_loper;
|
|
||||||
} em_u;
|
|
||||||
};
|
|
||||||
|
|
||||||
#define OPNO 0
|
|
||||||
#define OPINT 1
|
|
||||||
#define OPSYMBOL 2
|
|
||||||
|
|
||||||
typedef struct {
|
|
||||||
int rl_n; /* number in list */
|
|
||||||
int rl_list[NREGS];
|
|
||||||
} rl_t,*rl_p;
|
|
||||||
@@ -1,105 +0,0 @@
|
|||||||
#ifndef NORCSID
|
|
||||||
static char rcsid[] = "$Header$";
|
|
||||||
#endif
|
|
||||||
|
|
||||||
#include "assert.h"
|
|
||||||
#include "equiv.h"
|
|
||||||
#include "param.h"
|
|
||||||
#include "tables.h"
|
|
||||||
#include "types.h"
|
|
||||||
#include <cg_pattern.h>
|
|
||||||
#include "data.h"
|
|
||||||
#include "result.h"
|
|
||||||
#include "extern.h"
|
|
||||||
|
|
||||||
/*
|
|
||||||
* (c) copyright 1983 by the Vrije Universiteit, Amsterdam, The Netherlands.
|
|
||||||
*
|
|
||||||
* This product is part of the Amsterdam Compiler Kit.
|
|
||||||
*
|
|
||||||
* Permission to use, sell, duplicate or disclose this software must be
|
|
||||||
* obtained in writing. Requests for such permissions may be sent to
|
|
||||||
*
|
|
||||||
* Dr. Andrew S. Tanenbaum
|
|
||||||
* Wiskundig Seminarium
|
|
||||||
* Vrije Universiteit
|
|
||||||
* Postbox 7161
|
|
||||||
* 1007 MC Amsterdam
|
|
||||||
* The Netherlands
|
|
||||||
*
|
|
||||||
* Author: Hans van Staveren
|
|
||||||
*/
|
|
||||||
|
|
||||||
extern string myalloc();
|
|
||||||
|
|
||||||
int rar[MAXCREG];
|
|
||||||
rl_p *lar;
|
|
||||||
int maxindex;
|
|
||||||
int regclass[NREGS];
|
|
||||||
struct perm *perms;
|
|
||||||
|
|
||||||
struct perm *
|
|
||||||
tuples(regls,nregneeded) rl_p *regls; {
|
|
||||||
int class=0;
|
|
||||||
register i,j;
|
|
||||||
|
|
||||||
/*
|
|
||||||
* First compute equivalence classes of registers.
|
|
||||||
*/
|
|
||||||
|
|
||||||
for (i=0;i<NREGS;i++) {
|
|
||||||
regclass[i] = class++;
|
|
||||||
if (getrefcount(i) == 0) {
|
|
||||||
for (j=0;j<i;j++) {
|
|
||||||
if (eqregclass(i,j) &&
|
|
||||||
eqtoken(&machregs[i].r_contents,
|
|
||||||
&machregs[j].r_contents)) {
|
|
||||||
regclass[i] = regclass[j];
|
|
||||||
break;
|
|
||||||
}
|
|
||||||
}
|
|
||||||
}
|
|
||||||
}
|
|
||||||
|
|
||||||
/*
|
|
||||||
* Now create tuples through a recursive function
|
|
||||||
*/
|
|
||||||
|
|
||||||
maxindex = nregneeded;
|
|
||||||
lar = regls;
|
|
||||||
perms = 0;
|
|
||||||
permute(0);
|
|
||||||
return(perms);
|
|
||||||
}
|
|
||||||
|
|
||||||
permute(index) {
|
|
||||||
register struct perm *pp;
|
|
||||||
register rl_p rlp;
|
|
||||||
register i,j;
|
|
||||||
|
|
||||||
if (index == maxindex) {
|
|
||||||
for (pp=perms; pp != 0; pp=pp->p_next) {
|
|
||||||
for (i=0; i<maxindex; i++)
|
|
||||||
if (regclass[rar[i]] != regclass[pp->p_rar[i]])
|
|
||||||
goto diff;
|
|
||||||
for (i=0; i<maxindex; i++)
|
|
||||||
for (j=0; j<i; j++)
|
|
||||||
if (clash(rar[i],rar[j]) !=
|
|
||||||
clash(pp->p_rar[i],pp->p_rar[j]))
|
|
||||||
goto diff;
|
|
||||||
return;
|
|
||||||
diff: ;
|
|
||||||
}
|
|
||||||
pp = (struct perm *) myalloc(sizeof ( *pp ));
|
|
||||||
pp->p_next = perms;
|
|
||||||
for (i=0; i<maxindex; i++)
|
|
||||||
pp->p_rar[i] = rar[i];
|
|
||||||
perms = pp;
|
|
||||||
} else {
|
|
||||||
rlp=lar[index];
|
|
||||||
for (i=rlp->rl_n-1; i>=0; i--) {
|
|
||||||
rar[index] = rlp->rl_list[i];
|
|
||||||
permute(index+1);
|
|
||||||
}
|
|
||||||
}
|
|
||||||
}
|
|
||||||
@@ -1,8 +0,0 @@
|
|||||||
/* $Header$ */
|
|
||||||
|
|
||||||
#define MAXCREG 4
|
|
||||||
|
|
||||||
struct perm {
|
|
||||||
struct perm *p_next;
|
|
||||||
int p_rar[MAXCREG];
|
|
||||||
};
|
|
||||||
@@ -1,49 +0,0 @@
|
|||||||
/* $Header$ */
|
|
||||||
|
|
||||||
extern int maxply; /* amount of lookahead allowed */
|
|
||||||
extern int stackheight; /* # of tokens on fakestack */
|
|
||||||
extern token_t fakestack[]; /* fakestack itself */
|
|
||||||
extern int nallreg; /* number of allocated registers */
|
|
||||||
extern int allreg[]; /* array of allocated registers */
|
|
||||||
extern token_p curtoken; /* pointer to current token */
|
|
||||||
extern result_t dollar[]; /* Values of $1,$2 etc.. */
|
|
||||||
extern int nemlines; /* # of EM instructions in core */
|
|
||||||
extern struct emline emlines[]; /* EM instructions itself */
|
|
||||||
extern struct emline *emp; /* pointer to current instr */
|
|
||||||
extern struct emline *saveemp; /* pointer to start of pattern */
|
|
||||||
extern int tokpatlen; /* length of current stackpattern */
|
|
||||||
extern rl_p curreglist; /* side effect of findcoerc() */
|
|
||||||
#ifndef NDEBUG
|
|
||||||
extern int Debug; /* on/off debug printout */
|
|
||||||
#endif
|
|
||||||
|
|
||||||
/*
|
|
||||||
* Next descriptions are external declarations for tables created
|
|
||||||
* by bootgram.
|
|
||||||
* All definitions are to be found in tables.c (Not for humans)
|
|
||||||
*/
|
|
||||||
|
|
||||||
extern byte coderules[]; /* pseudo code for cg itself */
|
|
||||||
extern char stregclass[]; /* static register class */
|
|
||||||
extern struct reginfo machregs[]; /* register info */
|
|
||||||
extern tkdef_t tokens[]; /* token info */
|
|
||||||
extern node_t enodes[]; /* expression nodes */
|
|
||||||
extern string codestrings[]; /* table of strings */
|
|
||||||
extern set_t machsets[]; /* token expression table */
|
|
||||||
extern inst_t tokeninstances[]; /* token instance description table */
|
|
||||||
extern move_t moves[]; /* move descriptors */
|
|
||||||
extern byte pattern[]; /* EM patterns */
|
|
||||||
extern int pathash[256]; /* Indices into previous */
|
|
||||||
extern c1_t c1coercs[]; /* coercions type 1 */
|
|
||||||
#ifdef MAXSPLIT
|
|
||||||
extern c2_t c2coercs[]; /* coercions type 2 */
|
|
||||||
#endif MAXSPLIT
|
|
||||||
extern c3_t c3coercs[]; /* coercions type 3 */
|
|
||||||
extern struct reginfo **reglist[]; /* lists of registers per property */
|
|
||||||
|
|
||||||
#define eqregclass(r1,r2) (stregclass[r1]==stregclass[r2])
|
|
||||||
|
|
||||||
#ifdef REGVARS
|
|
||||||
extern int nregvar[]; /* # of register variables per type */
|
|
||||||
extern int *rvnumbers[]; /* lists of numbers */
|
|
||||||
#endif
|
|
||||||
@@ -1,648 +0,0 @@
|
|||||||
#ifndef NORCSID
|
|
||||||
static char rcsid2[] = "$Header$";
|
|
||||||
#endif
|
|
||||||
|
|
||||||
#include <stdio.h>
|
|
||||||
#include "assert.h"
|
|
||||||
#include <em_spec.h>
|
|
||||||
#include <em_pseu.h>
|
|
||||||
#include <em_flag.h>
|
|
||||||
#include <em_ptyp.h>
|
|
||||||
#include <em_mes.h>
|
|
||||||
#include "mach.h"
|
|
||||||
#include "param.h"
|
|
||||||
#include "tables.h"
|
|
||||||
#include "types.h"
|
|
||||||
#include <cg_pattern.h>
|
|
||||||
#include "data.h"
|
|
||||||
#include "result.h"
|
|
||||||
#ifdef REGVARS
|
|
||||||
#include "regvar.h"
|
|
||||||
#include <em_reg.h>
|
|
||||||
#endif
|
|
||||||
#include "extern.h"
|
|
||||||
|
|
||||||
/*
|
|
||||||
* (c) copyright 1983 by the Vrije Universiteit, Amsterdam, The Netherlands.
|
|
||||||
*
|
|
||||||
* This product is part of the Amsterdam Compiler Kit.
|
|
||||||
*
|
|
||||||
* Permission to use, sell, duplicate or disclose this software must be
|
|
||||||
* obtained in writing. Requests for such permissions may be sent to
|
|
||||||
*
|
|
||||||
* Dr. Andrew S. Tanenbaum
|
|
||||||
* Wiskundig Seminarium
|
|
||||||
* Vrije Universiteit
|
|
||||||
* Postbox 7161
|
|
||||||
* 1007 MC Amsterdam
|
|
||||||
* The Netherlands
|
|
||||||
*
|
|
||||||
* Author: Hans van Staveren
|
|
||||||
*/
|
|
||||||
|
|
||||||
#ifndef newplb /* retrofit for older mach.h */
|
|
||||||
#define newplb newilb
|
|
||||||
#endif
|
|
||||||
|
|
||||||
/* segment types for switchseg() */
|
|
||||||
#define SEGTXT 0
|
|
||||||
#define SEGCON 1
|
|
||||||
#define SEGROM 2
|
|
||||||
#define SEGBSS 3
|
|
||||||
|
|
||||||
long con();
|
|
||||||
|
|
||||||
#define get8() getc(emfile)
|
|
||||||
|
|
||||||
#define MAXSTR 256
|
|
||||||
|
|
||||||
FILE *emfile;
|
|
||||||
extern FILE *codefile;
|
|
||||||
|
|
||||||
int nextispseu,savetab1;
|
|
||||||
int opcode;
|
|
||||||
int offtyp;
|
|
||||||
long argval;
|
|
||||||
int dlbval;
|
|
||||||
char str[MAXSTR],argstr[32],labstr[32];
|
|
||||||
int strsiz;
|
|
||||||
int holno=0;
|
|
||||||
int procno=0;
|
|
||||||
int curseg= -1;
|
|
||||||
int part_size=0;
|
|
||||||
word part_word=0;
|
|
||||||
int endofprog=0;
|
|
||||||
#ifdef REGVARS
|
|
||||||
int regallowed=0;
|
|
||||||
#endif
|
|
||||||
|
|
||||||
extern char em_flag[];
|
|
||||||
extern short em_ptyp[];
|
|
||||||
extern long atol();
|
|
||||||
extern double atof();
|
|
||||||
|
|
||||||
#define sp_cstx sp_cst2
|
|
||||||
|
|
||||||
string tostring();
|
|
||||||
string holstr();
|
|
||||||
string strarg();
|
|
||||||
string mystrcpy();
|
|
||||||
long get32();
|
|
||||||
|
|
||||||
in_init(filename) char *filename; {
|
|
||||||
|
|
||||||
if ((emfile=freopen(filename,"r",stdin))==NULL)
|
|
||||||
error("Can't open %s",filename);
|
|
||||||
if (get16()!=sp_magic)
|
|
||||||
error("Bad format %s",filename);
|
|
||||||
}
|
|
||||||
|
|
||||||
in_finish() {
|
|
||||||
}
|
|
||||||
|
|
||||||
fillemlines() {
|
|
||||||
int t,i;
|
|
||||||
register struct emline *lp;
|
|
||||||
|
|
||||||
while ((emlines+nemlines)-emp<MAXEMLINES-5) {
|
|
||||||
assert(nemlines<MAXEMLINES);
|
|
||||||
if (nextispseu) {
|
|
||||||
emlines[nemlines].em_instr=0;
|
|
||||||
return;
|
|
||||||
}
|
|
||||||
lp = &emlines[nemlines++];
|
|
||||||
|
|
||||||
switch(t=table1()) {
|
|
||||||
default:
|
|
||||||
error("unknown instruction byte");
|
|
||||||
case sp_ilb1:
|
|
||||||
case sp_ilb2:
|
|
||||||
case sp_fpseu:
|
|
||||||
case sp_dlb1:
|
|
||||||
case sp_dlb2:
|
|
||||||
case sp_dnam:
|
|
||||||
nextispseu=1; savetab1=t;
|
|
||||||
nemlines--;
|
|
||||||
lp->em_instr = 0;
|
|
||||||
return;
|
|
||||||
case EOF:
|
|
||||||
nextispseu=1; savetab1=t;
|
|
||||||
endofprog=1;
|
|
||||||
nemlines--;
|
|
||||||
lp->em_instr = 0;
|
|
||||||
return;
|
|
||||||
case sp_fmnem:
|
|
||||||
lp->em_instr = opcode;
|
|
||||||
break;
|
|
||||||
}
|
|
||||||
i=em_flag[lp->em_instr-sp_fmnem] & EM_PAR;
|
|
||||||
if ( i == PAR_NO ) {
|
|
||||||
lp->em_optyp = OPNO;
|
|
||||||
lp->em_soper = 0;
|
|
||||||
continue;
|
|
||||||
}
|
|
||||||
t= em_ptyp[i];
|
|
||||||
t= getarg(t);
|
|
||||||
switch(i) {
|
|
||||||
case PAR_L:
|
|
||||||
assert(t == sp_cstx);
|
|
||||||
if (argval >= 0)
|
|
||||||
argval += EM_BSIZE;
|
|
||||||
lp->em_optyp = OPINT;
|
|
||||||
lp->em_u.em_ioper = argval;
|
|
||||||
lp->em_soper = tostring((word) argval);
|
|
||||||
continue;
|
|
||||||
case PAR_G:
|
|
||||||
if (t != sp_cstx)
|
|
||||||
break;
|
|
||||||
lp->em_optyp = OPSYMBOL;
|
|
||||||
lp->em_soper = holstr((word) argval);
|
|
||||||
continue;
|
|
||||||
case PAR_B:
|
|
||||||
t = sp_ilb2;
|
|
||||||
break;
|
|
||||||
case PAR_D:
|
|
||||||
assert(t == sp_cstx);
|
|
||||||
lp->em_optyp = OPSYMBOL;
|
|
||||||
lp->em_soper = strarg(t);
|
|
||||||
lp->em_u.em_loper = argval;
|
|
||||||
continue;
|
|
||||||
}
|
|
||||||
lp->em_soper = strarg(t);
|
|
||||||
if (t==sp_cend)
|
|
||||||
lp->em_optyp = OPNO;
|
|
||||||
else if (t==sp_cstx) {
|
|
||||||
lp->em_optyp = OPINT;
|
|
||||||
lp->em_u.em_ioper = argval;
|
|
||||||
} else
|
|
||||||
lp->em_optyp = OPSYMBOL;
|
|
||||||
}
|
|
||||||
}
|
|
||||||
|
|
||||||
dopseudo() {
|
|
||||||
register b,t;
|
|
||||||
register full n;
|
|
||||||
register long save;
|
|
||||||
word romcont[MAXROM+1];
|
|
||||||
int nromwords;
|
|
||||||
int rombit,rommask;
|
|
||||||
unsigned dummy,stackupto();
|
|
||||||
|
|
||||||
if (nextispseu==0 || nemlines>0)
|
|
||||||
error("No table entry for %d",emlines[0].em_instr);
|
|
||||||
nextispseu=0;
|
|
||||||
switch(savetab1) {
|
|
||||||
case sp_ilb1:
|
|
||||||
case sp_ilb2:
|
|
||||||
swtxt();
|
|
||||||
dummy = stackupto(&fakestack[stackheight-1],maxply,TRUE);
|
|
||||||
cleanregs();
|
|
||||||
strarg(savetab1);
|
|
||||||
newilb(argstr);
|
|
||||||
return;
|
|
||||||
case sp_dlb1:
|
|
||||||
case sp_dlb2:
|
|
||||||
case sp_dnam:
|
|
||||||
strarg(savetab1);
|
|
||||||
savelab();
|
|
||||||
return;
|
|
||||||
case sp_fpseu:
|
|
||||||
break;
|
|
||||||
case EOF:
|
|
||||||
swtxt();
|
|
||||||
popstr(0);
|
|
||||||
tstoutput();
|
|
||||||
exit(0);
|
|
||||||
default:
|
|
||||||
error("Unknown opcode %d",savetab1);
|
|
||||||
}
|
|
||||||
switch (opcode) {
|
|
||||||
case ps_hol:
|
|
||||||
sprintf(labstr,hol_fmt,++holno);
|
|
||||||
case ps_bss:
|
|
||||||
getarg(cst_ptyp);
|
|
||||||
n = (full) argval;
|
|
||||||
t = getarg(val_ptyp);
|
|
||||||
save = argval;
|
|
||||||
getarg(cst_ptyp);
|
|
||||||
b = (int) argval;
|
|
||||||
argval = save;
|
|
||||||
bss(n,t,b);
|
|
||||||
break;
|
|
||||||
case ps_con:
|
|
||||||
switchseg(SEGCON);
|
|
||||||
dumplab();
|
|
||||||
con(getarg(val_ptyp));
|
|
||||||
while ((t = getarg(any_ptyp)) != sp_cend)
|
|
||||||
con(t);
|
|
||||||
break;
|
|
||||||
case ps_rom:
|
|
||||||
switchseg(SEGROM);
|
|
||||||
xdumplab();
|
|
||||||
nromwords=0;
|
|
||||||
rommask=0;
|
|
||||||
rombit=1;
|
|
||||||
t=getarg(val_ptyp);
|
|
||||||
while (t!=sp_cend) {
|
|
||||||
if (t==sp_cstx && nromwords<MAXROM) {
|
|
||||||
romcont[nromwords] = (word) argval;
|
|
||||||
rommask |= rombit;
|
|
||||||
}
|
|
||||||
nromwords++;
|
|
||||||
rombit <<= 1;
|
|
||||||
con(t);
|
|
||||||
t=getarg(any_ptyp);
|
|
||||||
}
|
|
||||||
if (rommask != 0) {
|
|
||||||
romcont[MAXROM]=rommask;
|
|
||||||
enterglo(labstr,romcont);
|
|
||||||
}
|
|
||||||
labstr[0]=0;
|
|
||||||
break;
|
|
||||||
case ps_mes:
|
|
||||||
getarg(ptyp(sp_cst2));
|
|
||||||
if (argval == ms_emx) {
|
|
||||||
getarg(ptyp(sp_cst2));
|
|
||||||
if (argval != EM_WSIZE)
|
|
||||||
fatal("bad word size");
|
|
||||||
getarg(ptyp(sp_cst2));
|
|
||||||
if (argval != EM_PSIZE)
|
|
||||||
fatal("bad pointer size");
|
|
||||||
if ( getarg(any_ptyp)!=sp_cend )
|
|
||||||
fatal("too many parameters");
|
|
||||||
#ifdef REGVARS
|
|
||||||
} else if (argval == ms_gto) {
|
|
||||||
getarg(ptyp(sp_cend));
|
|
||||||
if (!regallowed)
|
|
||||||
error("mes 3 not allowed here");
|
|
||||||
fixregvars(TRUE);
|
|
||||||
regallowed=0;
|
|
||||||
} else if (argval == ms_reg) {
|
|
||||||
long r_off;
|
|
||||||
int r_size,r_type,r_score;
|
|
||||||
struct regvar *linkreg();
|
|
||||||
|
|
||||||
if (!regallowed)
|
|
||||||
error("mes 3 not allowed here");
|
|
||||||
if(getarg(ptyp(sp_cst2)|ptyp(sp_cend)) == sp_cend) {
|
|
||||||
fixregvars(FALSE);
|
|
||||||
regallowed=0;
|
|
||||||
} else {
|
|
||||||
r_off = argval;
|
|
||||||
#ifdef EM_BSIZE
|
|
||||||
if (r_off >= 0)
|
|
||||||
r_off += EM_BSIZE;
|
|
||||||
#endif
|
|
||||||
getarg(ptyp(sp_cst2));
|
|
||||||
r_size = argval;
|
|
||||||
getarg(ptyp(sp_cst2));
|
|
||||||
r_type = argval;
|
|
||||||
if (r_type<reg_any || r_type>reg_float)
|
|
||||||
fatal("Bad type in register message");
|
|
||||||
if(getarg(ptyp(sp_cst2)|ptyp(sp_cend)) == sp_cend)
|
|
||||||
r_score = 0;
|
|
||||||
else {
|
|
||||||
r_score = argval;
|
|
||||||
if ( getarg(any_ptyp)!=sp_cend )
|
|
||||||
fatal("too many parameters");
|
|
||||||
}
|
|
||||||
tryreg(linkreg(r_off,r_size,r_type,r_score),r_type);
|
|
||||||
}
|
|
||||||
#endif
|
|
||||||
} else
|
|
||||||
mes((word)argval);
|
|
||||||
break;
|
|
||||||
case ps_exa:
|
|
||||||
strarg(getarg(sym_ptyp));
|
|
||||||
ex_ap(argstr);
|
|
||||||
break;
|
|
||||||
case ps_ina:
|
|
||||||
strarg(getarg(sym_ptyp));
|
|
||||||
in_ap(argstr);
|
|
||||||
break;
|
|
||||||
case ps_exp:
|
|
||||||
strarg(getarg(ptyp(sp_pnam)));
|
|
||||||
ex_ap(argstr);
|
|
||||||
break;
|
|
||||||
case ps_inp:
|
|
||||||
strarg(getarg(ptyp(sp_pnam)));
|
|
||||||
in_ap(argstr);
|
|
||||||
break;
|
|
||||||
case ps_pro:
|
|
||||||
switchseg(SEGTXT);
|
|
||||||
procno++;
|
|
||||||
strarg(getarg(ptyp(sp_pnam)));
|
|
||||||
newplb(argstr);
|
|
||||||
getarg(cst_ptyp);
|
|
||||||
prolog((full)argval);
|
|
||||||
#ifdef REGVARS
|
|
||||||
regallowed++;
|
|
||||||
#endif
|
|
||||||
break;
|
|
||||||
case ps_end:
|
|
||||||
getarg(cst_ptyp | ptyp(sp_cend));
|
|
||||||
cleanregs();
|
|
||||||
#ifdef REGVARS
|
|
||||||
unlinkregs();
|
|
||||||
#endif
|
|
||||||
tstoutput();
|
|
||||||
break;
|
|
||||||
default:
|
|
||||||
error("No table entry for %d",savetab1);
|
|
||||||
}
|
|
||||||
}
|
|
||||||
|
|
||||||
/* ----- input ----- */
|
|
||||||
|
|
||||||
int getarg(typset) {
|
|
||||||
register t,argtyp;
|
|
||||||
|
|
||||||
argtyp = t = table2();
|
|
||||||
if (t == EOF)
|
|
||||||
fatal("unexpected EOF");
|
|
||||||
t -= sp_fspec;
|
|
||||||
t = 1 << t;
|
|
||||||
if ((typset & t) == 0)
|
|
||||||
error("bad argument type %d",argtyp);
|
|
||||||
return(argtyp);
|
|
||||||
}
|
|
||||||
|
|
||||||
int table1() {
|
|
||||||
register i;
|
|
||||||
|
|
||||||
i = get8();
|
|
||||||
if (i < sp_fmnem+sp_nmnem && i >= sp_fmnem) {
|
|
||||||
opcode = i;
|
|
||||||
return(sp_fmnem);
|
|
||||||
}
|
|
||||||
if (i < sp_fpseu+sp_npseu && i >= sp_fpseu) {
|
|
||||||
opcode = i;
|
|
||||||
return(sp_fpseu);
|
|
||||||
}
|
|
||||||
if (i < sp_filb0+sp_nilb0 && i >= sp_filb0) {
|
|
||||||
argval = i - sp_filb0;
|
|
||||||
return(sp_ilb2);
|
|
||||||
}
|
|
||||||
return(table3(i));
|
|
||||||
}
|
|
||||||
|
|
||||||
int table2() {
|
|
||||||
register i;
|
|
||||||
|
|
||||||
i = get8();
|
|
||||||
if (i < sp_fcst0+sp_ncst0 && i >= sp_fcst0) {
|
|
||||||
argval = i - sp_zcst0;
|
|
||||||
return(sp_cstx);
|
|
||||||
}
|
|
||||||
return(table3(i));
|
|
||||||
}
|
|
||||||
|
|
||||||
int table3(i) {
|
|
||||||
word consiz;
|
|
||||||
|
|
||||||
switch(i) {
|
|
||||||
case sp_ilb1:
|
|
||||||
argval = get8();
|
|
||||||
break;
|
|
||||||
case sp_dlb1:
|
|
||||||
dlbval = get8();
|
|
||||||
break;
|
|
||||||
case sp_dlb2:
|
|
||||||
dlbval = get16();
|
|
||||||
break;
|
|
||||||
case sp_cst2:
|
|
||||||
i = sp_cstx;
|
|
||||||
case sp_ilb2:
|
|
||||||
argval = get16();
|
|
||||||
break;
|
|
||||||
case sp_cst4:
|
|
||||||
i = sp_cstx;
|
|
||||||
argval = get32();
|
|
||||||
break;
|
|
||||||
case sp_dnam:
|
|
||||||
case sp_pnam:
|
|
||||||
case sp_scon:
|
|
||||||
getstring();
|
|
||||||
break;
|
|
||||||
case sp_doff:
|
|
||||||
offtyp = getarg(sym_ptyp);
|
|
||||||
getarg(cst_ptyp);
|
|
||||||
break;
|
|
||||||
case sp_icon:
|
|
||||||
case sp_ucon:
|
|
||||||
case sp_fcon:
|
|
||||||
getarg(cst_ptyp);
|
|
||||||
consiz = (word) argval;
|
|
||||||
getstring();
|
|
||||||
argval = consiz;
|
|
||||||
break;
|
|
||||||
}
|
|
||||||
return(i);
|
|
||||||
}
|
|
||||||
|
|
||||||
int get16() {
|
|
||||||
register int l_byte, h_byte;
|
|
||||||
|
|
||||||
l_byte = get8();
|
|
||||||
h_byte = get8();
|
|
||||||
if ( h_byte>=128 ) h_byte -= 256 ;
|
|
||||||
return l_byte | (h_byte*256) ;
|
|
||||||
}
|
|
||||||
|
|
||||||
long get32() {
|
|
||||||
register long l;
|
|
||||||
register int h_byte;
|
|
||||||
|
|
||||||
l = get8();
|
|
||||||
l |= ((unsigned) get8())*256 ;
|
|
||||||
l |= get8()*256L*256L ;
|
|
||||||
h_byte = get8() ;
|
|
||||||
if ( h_byte>=128 ) h_byte -= 256 ;
|
|
||||||
return l | (h_byte*256L*256*256L) ;
|
|
||||||
}
|
|
||||||
|
|
||||||
getstring() {
|
|
||||||
register char *p;
|
|
||||||
register n;
|
|
||||||
|
|
||||||
getarg(cst_ptyp);
|
|
||||||
if (argval < 0 || argval > MAXSTR-1)
|
|
||||||
fatal("string/identifier too long");
|
|
||||||
strsiz = n = (int) argval;
|
|
||||||
p = str;
|
|
||||||
while (--n >= 0)
|
|
||||||
*p++ = get8();
|
|
||||||
*p++ = '\0';
|
|
||||||
}
|
|
||||||
|
|
||||||
char *strarg(t) {
|
|
||||||
register char *p;
|
|
||||||
|
|
||||||
switch (t) {
|
|
||||||
case sp_ilb1:
|
|
||||||
case sp_ilb2:
|
|
||||||
sprintf(argstr,ilb_fmt,procno,(int)argval);
|
|
||||||
break;
|
|
||||||
case sp_dlb1:
|
|
||||||
case sp_dlb2:
|
|
||||||
sprintf(argstr,dlb_fmt,dlbval);
|
|
||||||
break;
|
|
||||||
case sp_cstx:
|
|
||||||
sprintf(argstr,cst_fmt,(full)argval);
|
|
||||||
break;
|
|
||||||
case sp_dnam:
|
|
||||||
case sp_pnam:
|
|
||||||
p = argstr;
|
|
||||||
if (strsiz < 8 || str[0] == id_first)
|
|
||||||
*p++ = id_first;
|
|
||||||
sprintf(p,"%.*s",strsiz,str);
|
|
||||||
break;
|
|
||||||
case sp_doff:
|
|
||||||
strarg(offtyp);
|
|
||||||
for (p = argstr; *p; p++)
|
|
||||||
;
|
|
||||||
if (argval >= 0)
|
|
||||||
*p++ = '+';
|
|
||||||
sprintf(p,off_fmt,(full)argval);
|
|
||||||
break;
|
|
||||||
case sp_cend:
|
|
||||||
return("");
|
|
||||||
}
|
|
||||||
return(mystrcpy(argstr));
|
|
||||||
}
|
|
||||||
|
|
||||||
bss(n,t,b) full n; {
|
|
||||||
register long s;
|
|
||||||
|
|
||||||
if (n % EM_WSIZE)
|
|
||||||
fatal("bad BSS size");
|
|
||||||
if (b==0
|
|
||||||
#ifdef BSS_INIT
|
|
||||||
|| (t==sp_cstx && argval==BSS_INIT)
|
|
||||||
#endif BSS_INIT
|
|
||||||
) {
|
|
||||||
switchseg(SEGBSS);
|
|
||||||
newlbss(labstr,n);
|
|
||||||
labstr[0]=0;
|
|
||||||
return;
|
|
||||||
}
|
|
||||||
switchseg(SEGCON);
|
|
||||||
dumplab();
|
|
||||||
while (n > 0)
|
|
||||||
n -= (s = con(t));
|
|
||||||
if (s % EM_WSIZE)
|
|
||||||
fatal("bad BSS initializer");
|
|
||||||
}
|
|
||||||
|
|
||||||
long con(t) {
|
|
||||||
register i;
|
|
||||||
|
|
||||||
strarg(t);
|
|
||||||
switch (t) {
|
|
||||||
case sp_ilb1:
|
|
||||||
case sp_ilb2:
|
|
||||||
case sp_pnam:
|
|
||||||
part_flush();
|
|
||||||
con_ilb(argstr);
|
|
||||||
return((long)EM_PSIZE);
|
|
||||||
case sp_dlb1:
|
|
||||||
case sp_dlb2:
|
|
||||||
case sp_dnam:
|
|
||||||
case sp_doff:
|
|
||||||
part_flush();
|
|
||||||
con_dlb(argstr);
|
|
||||||
return((long)EM_PSIZE);
|
|
||||||
case sp_cstx:
|
|
||||||
con_part(EM_WSIZE,(word)argval);
|
|
||||||
return((long)EM_WSIZE);
|
|
||||||
case sp_scon:
|
|
||||||
for (i = 0; i < strsiz; i++)
|
|
||||||
con_part(1,(word) str[i]);
|
|
||||||
return((long)strsiz);
|
|
||||||
case sp_icon:
|
|
||||||
case sp_ucon:
|
|
||||||
if (argval > EM_WSIZE) {
|
|
||||||
part_flush();
|
|
||||||
con_mult((word)argval);
|
|
||||||
} else {
|
|
||||||
con_part((int)argval,(word)atol(str));
|
|
||||||
}
|
|
||||||
return(argval);
|
|
||||||
case sp_fcon:
|
|
||||||
part_flush();
|
|
||||||
con_float();
|
|
||||||
return(argval);
|
|
||||||
}
|
|
||||||
assert(FALSE);
|
|
||||||
/* NOTREACHED */
|
|
||||||
}
|
|
||||||
|
|
||||||
extern char *segname[];
|
|
||||||
|
|
||||||
swtxt() {
|
|
||||||
switchseg(SEGTXT);
|
|
||||||
}
|
|
||||||
|
|
||||||
switchseg(s) {
|
|
||||||
|
|
||||||
if (s == curseg)
|
|
||||||
return;
|
|
||||||
part_flush();
|
|
||||||
if ((curseg = s) >= 0)
|
|
||||||
fprintf(codefile,"%s\n",segname[s]);
|
|
||||||
}
|
|
||||||
|
|
||||||
savelab() {
|
|
||||||
register char *p,*q;
|
|
||||||
|
|
||||||
part_flush();
|
|
||||||
if (labstr[0]) {
|
|
||||||
dlbdlb(argstr,labstr);
|
|
||||||
return;
|
|
||||||
}
|
|
||||||
p = argstr;
|
|
||||||
q = labstr;
|
|
||||||
while (*q++ = *p++)
|
|
||||||
;
|
|
||||||
}
|
|
||||||
|
|
||||||
dumplab() {
|
|
||||||
|
|
||||||
if (labstr[0] == 0)
|
|
||||||
return;
|
|
||||||
assert(part_size == 0);
|
|
||||||
newdlb(labstr);
|
|
||||||
labstr[0] = 0;
|
|
||||||
}
|
|
||||||
|
|
||||||
xdumplab() {
|
|
||||||
|
|
||||||
if (labstr[0] == 0)
|
|
||||||
return;
|
|
||||||
assert(part_size == 0);
|
|
||||||
newdlb(labstr);
|
|
||||||
}
|
|
||||||
|
|
||||||
part_flush() {
|
|
||||||
|
|
||||||
/*
|
|
||||||
* Each new data fragment and each data label starts at
|
|
||||||
* a new target machine word
|
|
||||||
*/
|
|
||||||
if (part_size == 0)
|
|
||||||
return;
|
|
||||||
con_cst(part_word);
|
|
||||||
part_size = 0;
|
|
||||||
part_word = 0;
|
|
||||||
}
|
|
||||||
|
|
||||||
string holstr(n) word n; {
|
|
||||||
|
|
||||||
sprintf(str,hol_off,n,holno);
|
|
||||||
return(mystrcpy(str));
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
/* ----- machine dependent routines ----- */
|
|
||||||
|
|
||||||
#include "mach.c"
|
|
||||||
@@ -1,194 +0,0 @@
|
|||||||
#ifndef NORCSID
|
|
||||||
static char rcsid[] = "$Header$";
|
|
||||||
#endif
|
|
||||||
|
|
||||||
#include "assert.h"
|
|
||||||
#include <stdio.h>
|
|
||||||
#include "param.h"
|
|
||||||
#include "tables.h"
|
|
||||||
#include "types.h"
|
|
||||||
#include <cg_pattern.h>
|
|
||||||
#include "data.h"
|
|
||||||
#include "result.h"
|
|
||||||
#include "extern.h"
|
|
||||||
|
|
||||||
/*
|
|
||||||
* (c) copyright 1983 by the Vrije Universiteit, Amsterdam, The Netherlands.
|
|
||||||
*
|
|
||||||
* This product is part of the Amsterdam Compiler Kit.
|
|
||||||
*
|
|
||||||
* Permission to use, sell, duplicate or disclose this software must be
|
|
||||||
* obtained in writing. Requests for such permissions may be sent to
|
|
||||||
*
|
|
||||||
* Dr. Andrew S. Tanenbaum
|
|
||||||
* Wiskundig Seminarium
|
|
||||||
* Vrije Universiteit
|
|
||||||
* Postbox 7161
|
|
||||||
* 1007 MC Amsterdam
|
|
||||||
* The Netherlands
|
|
||||||
*
|
|
||||||
* Author: Hans van Staveren
|
|
||||||
*/
|
|
||||||
|
|
||||||
FILE *codefile;
|
|
||||||
|
|
||||||
out_init(filename) char *filename; {
|
|
||||||
|
|
||||||
#ifndef NDEBUG
|
|
||||||
static char stderrbuff[512];
|
|
||||||
|
|
||||||
if (Debug) {
|
|
||||||
codefile = stderr;
|
|
||||||
if (!isatty(2))
|
|
||||||
setbuf(stderr,stderrbuff);
|
|
||||||
} else {
|
|
||||||
#endif
|
|
||||||
if (filename == (char *) 0)
|
|
||||||
codefile = stdout;
|
|
||||||
else
|
|
||||||
if ((codefile=freopen(filename,"w",stdout))==NULL)
|
|
||||||
error("Can't create %s",filename);
|
|
||||||
#ifndef NDEBUG
|
|
||||||
}
|
|
||||||
#endif
|
|
||||||
}
|
|
||||||
|
|
||||||
out_finish() {
|
|
||||||
|
|
||||||
#ifndef NDEBUG
|
|
||||||
if (Debug)
|
|
||||||
fflush(stderr);
|
|
||||||
else
|
|
||||||
#endif
|
|
||||||
fclose(codefile);
|
|
||||||
}
|
|
||||||
|
|
||||||
tstoutput() {
|
|
||||||
|
|
||||||
if (ferror(codefile))
|
|
||||||
error("Write error on output");
|
|
||||||
}
|
|
||||||
|
|
||||||
gencode(code) register char *code; {
|
|
||||||
register c;
|
|
||||||
int tokno,fldno,insno,regno,subno;
|
|
||||||
register token_p tp;
|
|
||||||
|
|
||||||
swtxt();
|
|
||||||
while ((c= *code++)!=0) switch(c) {
|
|
||||||
default:
|
|
||||||
fputc(c,codefile);
|
|
||||||
break;
|
|
||||||
case PR_TOK:
|
|
||||||
tokno = *code++;
|
|
||||||
tp = &fakestack[stackheight-tokno];
|
|
||||||
if (tp->t_token==-1)
|
|
||||||
fprintf(codefile,"%s",codestrings[machregs[tp->t_att[0].ar].r_repr]);
|
|
||||||
else
|
|
||||||
prtoken(tp);
|
|
||||||
break;
|
|
||||||
case PR_TOKFLD:
|
|
||||||
tokno = *code++;
|
|
||||||
fldno = *code++;
|
|
||||||
tp = &fakestack[stackheight-tokno];
|
|
||||||
assert(tp->t_token != -1);
|
|
||||||
switch(tokens[tp->t_token].t_type[fldno-1]) {
|
|
||||||
default:
|
|
||||||
assert(FALSE);
|
|
||||||
case EV_INT:
|
|
||||||
fprintf(codefile,WRD_FMT,tp->t_att[fldno-1].aw);
|
|
||||||
break;
|
|
||||||
case EV_STR:
|
|
||||||
fprintf(codefile,"%s",tp->t_att[fldno-1].as);
|
|
||||||
break;
|
|
||||||
case EV_REG:
|
|
||||||
assert(tp->t_att[fldno-1].ar>0 && tp->t_att[fldno-1].ar<NREGS);
|
|
||||||
fprintf(codefile,"%s",codestrings[machregs[tp->t_att[fldno-1].ar].r_repr]);
|
|
||||||
break;
|
|
||||||
}
|
|
||||||
break;
|
|
||||||
case PR_EMINT:
|
|
||||||
insno = *code++;
|
|
||||||
fprintf(codefile,WRD_FMT,dollar[insno-1].e_v.e_con);
|
|
||||||
break;
|
|
||||||
case PR_EMSTR:
|
|
||||||
insno = *code++;
|
|
||||||
fprintf(codefile,"%s",dollar[insno-1].e_v.e_str);
|
|
||||||
break;
|
|
||||||
case PR_ALLREG:
|
|
||||||
regno = *code++;
|
|
||||||
subno = (*code++)&0377;
|
|
||||||
assert(regno>=1 && regno<=nallreg);
|
|
||||||
regno = allreg[regno-1];
|
|
||||||
#if MAXMEMBERS!=0
|
|
||||||
if (subno!=255) {
|
|
||||||
assert(subno>=1 && subno<=MAXMEMBERS);
|
|
||||||
regno = machregs[regno].r_members[subno-1];
|
|
||||||
assert(regno!=0);
|
|
||||||
}
|
|
||||||
#endif
|
|
||||||
fprintf(codefile,"%s",codestrings[machregs[regno].r_repr]);
|
|
||||||
break;
|
|
||||||
#if MAXMEMBERS!=0
|
|
||||||
case PR_SUBREG:
|
|
||||||
tokno = *code++;
|
|
||||||
subno = *code++;
|
|
||||||
tp = &fakestack[stackheight-tokno];
|
|
||||||
assert(tp->t_token == -1);
|
|
||||||
fprintf(codefile,"%s",codestrings[machregs[machregs[tp->t_att[0].ar].r_members[subno-1]].r_repr]);
|
|
||||||
break;
|
|
||||||
#endif
|
|
||||||
}
|
|
||||||
}
|
|
||||||
|
|
||||||
genexpr(nodeno) {
|
|
||||||
result_t result;
|
|
||||||
|
|
||||||
result= compute(&enodes[nodeno]);
|
|
||||||
switch(result.e_typ) {
|
|
||||||
default: assert(FALSE);
|
|
||||||
case EV_INT:
|
|
||||||
fprintf(codefile,WRD_FMT,result.e_v.e_con);
|
|
||||||
break;
|
|
||||||
case EV_REG:
|
|
||||||
fprintf(codefile,"%s", codestrings[machregs[result.e_v.e_reg].r_repr]);
|
|
||||||
break;
|
|
||||||
case EV_STR:
|
|
||||||
fprintf(codefile,"%s",result.e_v.e_str);
|
|
||||||
break;
|
|
||||||
}
|
|
||||||
}
|
|
||||||
|
|
||||||
gennl() {
|
|
||||||
fputc('\n',codefile);
|
|
||||||
}
|
|
||||||
|
|
||||||
prtoken(tp) token_p tp; {
|
|
||||||
register c;
|
|
||||||
register char *code;
|
|
||||||
register tkdef_p tdp;
|
|
||||||
|
|
||||||
tdp = &tokens[tp->t_token];
|
|
||||||
assert(tdp->t_format != -1);
|
|
||||||
code = codestrings[tdp->t_format];
|
|
||||||
while ((c = *code++) != 0) {
|
|
||||||
if (c>=' ' && c<='~')
|
|
||||||
fputc(c,codefile);
|
|
||||||
else {
|
|
||||||
assert(c>0 && c<=TOKENSIZE);
|
|
||||||
switch(tdp->t_type[c-1]) {
|
|
||||||
default:
|
|
||||||
assert(FALSE);
|
|
||||||
case EV_INT:
|
|
||||||
fprintf(codefile,WRD_FMT,tp->t_att[c-1].aw);
|
|
||||||
break;
|
|
||||||
case EV_STR:
|
|
||||||
fprintf(codefile,"%s",tp->t_att[c-1].as);
|
|
||||||
break;
|
|
||||||
case EV_REG:
|
|
||||||
fprintf(codefile,"%s",codestrings[machregs[tp->t_att[c-1].ar].r_repr]);
|
|
||||||
break;
|
|
||||||
}
|
|
||||||
}
|
|
||||||
}
|
|
||||||
}
|
|
||||||
@@ -1,52 +0,0 @@
|
|||||||
#ifndef NORCSID
|
|
||||||
static char rcsid[] = "$Header$";
|
|
||||||
#endif
|
|
||||||
|
|
||||||
#include "param.h"
|
|
||||||
#include "tables.h"
|
|
||||||
#include "types.h"
|
|
||||||
#include "glosym.h"
|
|
||||||
|
|
||||||
/*
|
|
||||||
* (c) copyright 1983 by the Vrije Universiteit, Amsterdam, The Netherlands.
|
|
||||||
*
|
|
||||||
* This product is part of the Amsterdam Compiler Kit.
|
|
||||||
*
|
|
||||||
* Permission to use, sell, duplicate or disclose this software must be
|
|
||||||
* obtained in writing. Requests for such permissions may be sent to
|
|
||||||
*
|
|
||||||
* Dr. Andrew S. Tanenbaum
|
|
||||||
* Wiskundig Seminarium
|
|
||||||
* Vrije Universiteit
|
|
||||||
* Postbox 7161
|
|
||||||
* 1007 MC Amsterdam
|
|
||||||
* The Netherlands
|
|
||||||
*
|
|
||||||
* Author: Hans van Staveren
|
|
||||||
*/
|
|
||||||
|
|
||||||
extern string myalloc();
|
|
||||||
|
|
||||||
glosym_p glolist= (glosym_p) 0;
|
|
||||||
|
|
||||||
enterglo(name,romp) string name; word *romp; {
|
|
||||||
register glosym_p gp;
|
|
||||||
register i;
|
|
||||||
|
|
||||||
gp = (glosym_p) myalloc(sizeof *gp);
|
|
||||||
gp->gl_next = glolist;
|
|
||||||
gp->gl_name = (string) myalloc(strlen(name)+1);
|
|
||||||
strcpy(gp->gl_name,name);
|
|
||||||
for (i=0;i<=MAXROM;i++)
|
|
||||||
gp->gl_rom[i] = romp[i];
|
|
||||||
glolist = gp;
|
|
||||||
}
|
|
||||||
|
|
||||||
glosym_p lookglo(name) string name; {
|
|
||||||
register glosym_p gp;
|
|
||||||
|
|
||||||
for (gp=glolist;gp != (glosym_p) 0; gp=gp->gl_next)
|
|
||||||
if (strcmp(gp->gl_name,name)==0)
|
|
||||||
return(gp);
|
|
||||||
return((glosym_p) 0);
|
|
||||||
}
|
|
||||||
@@ -1,9 +0,0 @@
|
|||||||
/* $Header$ */
|
|
||||||
|
|
||||||
typedef struct glosym {
|
|
||||||
struct glosym *gl_next;
|
|
||||||
string gl_name;
|
|
||||||
word gl_rom[MAXROM+1];
|
|
||||||
} glosym_t,*glosym_p;
|
|
||||||
|
|
||||||
glosym_p lookglo();
|
|
||||||
@@ -1,84 +0,0 @@
|
|||||||
#ifndef NORCSID
|
|
||||||
static char rcsid[] = "$Header$";
|
|
||||||
#endif
|
|
||||||
|
|
||||||
#include "param.h"
|
|
||||||
|
|
||||||
/*
|
|
||||||
* (c) copyright 1983 by the Vrije Universiteit, Amsterdam, The Netherlands.
|
|
||||||
*
|
|
||||||
* This product is part of the Amsterdam Compiler Kit.
|
|
||||||
*
|
|
||||||
* Permission to use, sell, duplicate or disclose this software must be
|
|
||||||
* obtained in writing. Requests for such permissions may be sent to
|
|
||||||
*
|
|
||||||
* Dr. Andrew S. Tanenbaum
|
|
||||||
* Wiskundig Seminarium
|
|
||||||
* Vrije Universiteit
|
|
||||||
* Postbox 7161
|
|
||||||
* 1007 MC Amsterdam
|
|
||||||
* The Netherlands
|
|
||||||
*
|
|
||||||
* Author: Hans van Staveren
|
|
||||||
*/
|
|
||||||
|
|
||||||
char *progname;
|
|
||||||
extern char startupcode[];
|
|
||||||
int maxply=1;
|
|
||||||
#ifndef NDEBUG
|
|
||||||
int Debug=0;
|
|
||||||
#endif
|
|
||||||
|
|
||||||
extern int endofprog;
|
|
||||||
|
|
||||||
main(argc,argv) char **argv; {
|
|
||||||
register unsigned n;
|
|
||||||
extern unsigned cc1,cc2,cc3,cc4;
|
|
||||||
unsigned ggd();
|
|
||||||
|
|
||||||
progname = argv[0];
|
|
||||||
while (--argc && **++argv == '-') {
|
|
||||||
switch(argv[0][1]) {
|
|
||||||
#ifndef NDEBUG
|
|
||||||
case 'd':
|
|
||||||
Debug=1; break;
|
|
||||||
#endif
|
|
||||||
case 'p':
|
|
||||||
maxply = atoi(argv[0]+2);
|
|
||||||
break;
|
|
||||||
case 'w': /* weight percentage for size */
|
|
||||||
n=atoi(argv[0]+2);
|
|
||||||
cc1 *= n;
|
|
||||||
cc2 *= 50;
|
|
||||||
cc3 *= (100-n);
|
|
||||||
cc4 *= 50;
|
|
||||||
n=ggd(cc1,cc2);
|
|
||||||
cc1 /= n;
|
|
||||||
cc2 /= n;
|
|
||||||
n=ggd(cc3,cc4);
|
|
||||||
cc3 /= n;
|
|
||||||
cc4 /= n;
|
|
||||||
break;
|
|
||||||
default:
|
|
||||||
error("Unknown flag %c",argv[0][1]);
|
|
||||||
}
|
|
||||||
}
|
|
||||||
if (argc < 1 || argc > 2)
|
|
||||||
error("Usage: %s EMfile [ asfile ]",progname);
|
|
||||||
in_init(argv[0]);
|
|
||||||
out_init(argv[1]);
|
|
||||||
codegen(startupcode,maxply,TRUE,MAXINT,0);
|
|
||||||
in_finish();
|
|
||||||
if (!endofprog)
|
|
||||||
error("Bombed out of codegen");
|
|
||||||
out_finish();
|
|
||||||
}
|
|
||||||
|
|
||||||
unsigned ggd(a,b) register unsigned a,b; {
|
|
||||||
register unsigned c;
|
|
||||||
|
|
||||||
do {
|
|
||||||
c = a%b; a=b; b=c;
|
|
||||||
} while (c!=0);
|
|
||||||
return(a);
|
|
||||||
}
|
|
||||||
@@ -1,110 +0,0 @@
|
|||||||
#ifndef NORCSID
|
|
||||||
static char rcsid[] = "$Header$";
|
|
||||||
#endif
|
|
||||||
|
|
||||||
#include "assert.h"
|
|
||||||
#include "param.h"
|
|
||||||
#include "tables.h"
|
|
||||||
#include "types.h"
|
|
||||||
#include <cg_pattern.h>
|
|
||||||
#include "data.h"
|
|
||||||
#include "result.h"
|
|
||||||
#include "extern.h"
|
|
||||||
|
|
||||||
/*
|
|
||||||
* (c) copyright 1983 by the Vrije Universiteit, Amsterdam, The Netherlands.
|
|
||||||
*
|
|
||||||
* This product is part of the Amsterdam Compiler Kit.
|
|
||||||
*
|
|
||||||
* Permission to use, sell, duplicate or disclose this software must be
|
|
||||||
* obtained in writing. Requests for such permissions may be sent to
|
|
||||||
*
|
|
||||||
* Dr. Andrew S. Tanenbaum
|
|
||||||
* Wiskundig Seminarium
|
|
||||||
* Vrije Universiteit
|
|
||||||
* Postbox 7161
|
|
||||||
* 1007 MC Amsterdam
|
|
||||||
* The Netherlands
|
|
||||||
*
|
|
||||||
* Author: Hans van Staveren
|
|
||||||
*/
|
|
||||||
|
|
||||||
unsigned costcalc();
|
|
||||||
|
|
||||||
move(tp1,tp2,ply,toplevel,maxcost) token_p tp1,tp2; unsigned maxcost; {
|
|
||||||
register move_p mp;
|
|
||||||
register unsigned t;
|
|
||||||
register struct reginfo *rp;
|
|
||||||
tkdef_p tdp;
|
|
||||||
int i;
|
|
||||||
unsigned codegen();
|
|
||||||
|
|
||||||
if (eqtoken(tp1,tp2))
|
|
||||||
return(0);
|
|
||||||
if (tp2->t_token == -1) {
|
|
||||||
if (tp1->t_token == -1) {
|
|
||||||
if (eqtoken(&machregs[tp1->t_att[0].ar].r_contents,
|
|
||||||
&machregs[tp2->t_att[0].ar].r_contents) &&
|
|
||||||
machregs[tp1->t_att[0].ar].r_contents.t_token!=0)
|
|
||||||
return(0);
|
|
||||||
if (tp1->t_att[0].ar!=1) { /* COCO reg; tmp kludge */
|
|
||||||
erasereg(tp2->t_att[0].ar);
|
|
||||||
machregs[tp2->t_att[0].ar].r_contents =
|
|
||||||
machregs[tp1->t_att[0].ar].r_contents ;
|
|
||||||
} else
|
|
||||||
machregs[tp1->t_att[0].ar].r_contents =
|
|
||||||
machregs[tp2->t_att[0].ar].r_contents ;
|
|
||||||
} else {
|
|
||||||
if (eqtoken(&machregs[tp2->t_att[0].ar].r_contents,tp1))
|
|
||||||
return(0);
|
|
||||||
machregs[tp2->t_att[0].ar].r_contents = *tp1;
|
|
||||||
}
|
|
||||||
for (rp=machregs;rp<machregs+NREGS;rp++) {
|
|
||||||
if (rp->r_contents.t_token == 0)
|
|
||||||
continue;
|
|
||||||
assert(rp->r_contents.t_token > 0);
|
|
||||||
tdp = &tokens[rp->r_contents.t_token];
|
|
||||||
for (i=0;i<TOKENSIZE;i++)
|
|
||||||
if (tdp->t_type[i] == EV_REG &&
|
|
||||||
clash(rp->r_contents.t_att[i].ar,tp2->t_att[0].ar)) {
|
|
||||||
erasereg(rp-machregs);
|
|
||||||
break;
|
|
||||||
}
|
|
||||||
}
|
|
||||||
} else if (tp1->t_token == -1) {
|
|
||||||
if (eqtoken(tp2,&machregs[tp1->t_att[0].ar].r_contents))
|
|
||||||
return(0);
|
|
||||||
machregs[tp1->t_att[0].ar].r_contents = *tp2;
|
|
||||||
}
|
|
||||||
/*
|
|
||||||
* If we arrive here the move must really be executed
|
|
||||||
*/
|
|
||||||
for (mp=moves;mp<moves+NMOVES;mp++) {
|
|
||||||
if (!match(tp1,&machsets[mp->m_set1],mp->m_expr1))
|
|
||||||
continue;
|
|
||||||
if (match(tp2,&machsets[mp->m_set2],mp->m_expr2))
|
|
||||||
break;
|
|
||||||
/*
|
|
||||||
* Correct move rule is found
|
|
||||||
*/
|
|
||||||
}
|
|
||||||
assert(mp<moves+NMOVES);
|
|
||||||
/*
|
|
||||||
* To get correct interpretation of things like %[1]
|
|
||||||
* in move code we stack tp2 and tp1. This little trick
|
|
||||||
* saves a lot of testing in other places.
|
|
||||||
*/
|
|
||||||
|
|
||||||
if (mp->m_cindex!=0) {
|
|
||||||
fakestack[stackheight] = *tp2;
|
|
||||||
fakestack[stackheight+1] = *tp1;
|
|
||||||
stackheight += 2;
|
|
||||||
t = codegen(&coderules[mp->m_cindex],ply,toplevel,maxcost,0);
|
|
||||||
if (t <= maxcost)
|
|
||||||
t += costcalc(mp->m_cost);
|
|
||||||
stackheight -= 2;
|
|
||||||
} else {
|
|
||||||
t = 0;
|
|
||||||
}
|
|
||||||
return(t);
|
|
||||||
}
|
|
||||||
@@ -1,131 +0,0 @@
|
|||||||
#ifndef NORCSID
|
|
||||||
static char rcsid[] = "$Header$";
|
|
||||||
#endif
|
|
||||||
|
|
||||||
#include <em_spec.h>
|
|
||||||
#include <em_flag.h>
|
|
||||||
#include "assert.h"
|
|
||||||
#include "param.h"
|
|
||||||
#include "tables.h"
|
|
||||||
#include "types.h"
|
|
||||||
#include <cg_pattern.h>
|
|
||||||
#include "data.h"
|
|
||||||
#include "result.h"
|
|
||||||
#include "extern.h"
|
|
||||||
|
|
||||||
/*
|
|
||||||
* (c) copyright 1983 by the Vrije Universiteit, Amsterdam, The Netherlands.
|
|
||||||
*
|
|
||||||
* This product is part of the Amsterdam Compiler Kit.
|
|
||||||
*
|
|
||||||
* Permission to use, sell, duplicate or disclose this software must be
|
|
||||||
* obtained in writing. Requests for such permissions may be sent to
|
|
||||||
*
|
|
||||||
* Dr. Andrew S. Tanenbaum
|
|
||||||
* Wiskundig Seminarium
|
|
||||||
* Vrije Universiteit
|
|
||||||
* Postbox 7161
|
|
||||||
* 1007 MC Amsterdam
|
|
||||||
* The Netherlands
|
|
||||||
*
|
|
||||||
* Author: Hans van Staveren
|
|
||||||
*/
|
|
||||||
|
|
||||||
#ifndef NDEBUG
|
|
||||||
#include <stdio.h>
|
|
||||||
extern char em_mnem[][4];
|
|
||||||
#endif
|
|
||||||
|
|
||||||
byte *trypat(bp,len) register byte *bp; {
|
|
||||||
register patlen,i;
|
|
||||||
result_t result;
|
|
||||||
|
|
||||||
getint(patlen,bp);
|
|
||||||
if (len == 3) {
|
|
||||||
if (patlen < 3)
|
|
||||||
return(0);
|
|
||||||
} else {
|
|
||||||
if (patlen != len)
|
|
||||||
return(0);
|
|
||||||
}
|
|
||||||
for(i=0;i<patlen;i++)
|
|
||||||
if (emp[i].em_instr != (*bp++&BMASK))
|
|
||||||
return(0);
|
|
||||||
for (i=0;i<patlen;i++)
|
|
||||||
if (emp[i].em_optyp==OPNO)
|
|
||||||
dollar[i].e_typ=EV_UNDEF;
|
|
||||||
else if ((dollar[i].e_typ=argtyp(emp[i].em_instr))==EV_INT)
|
|
||||||
dollar[i].e_v.e_con=emp[i].em_u.em_ioper;
|
|
||||||
else
|
|
||||||
dollar[i].e_v.e_str=emp[i].em_soper;
|
|
||||||
getint(i,bp);
|
|
||||||
if (i!=0) {
|
|
||||||
result = compute(&enodes[i]);
|
|
||||||
if (result.e_typ != EV_INT || result.e_v.e_con == 0)
|
|
||||||
return(0);
|
|
||||||
}
|
|
||||||
#ifndef NDEBUG
|
|
||||||
if (Debug) {
|
|
||||||
fprintf(stderr,"Matched:");
|
|
||||||
for (i=0;i<patlen;i++)
|
|
||||||
fprintf(stderr," %3.3s",em_mnem[emp[i].em_instr-sp_fmnem]);
|
|
||||||
fprintf(stderr,"\n");
|
|
||||||
}
|
|
||||||
#endif
|
|
||||||
saveemp = emp;
|
|
||||||
emp += patlen;
|
|
||||||
return(bp);
|
|
||||||
}
|
|
||||||
|
|
||||||
extern char em_flag[];
|
|
||||||
|
|
||||||
argtyp(mn) {
|
|
||||||
|
|
||||||
switch(em_flag[mn-sp_fmnem]&EM_PAR) {
|
|
||||||
case PAR_W:
|
|
||||||
case PAR_S:
|
|
||||||
case PAR_Z:
|
|
||||||
case PAR_O:
|
|
||||||
case PAR_N:
|
|
||||||
case PAR_L:
|
|
||||||
case PAR_F:
|
|
||||||
case PAR_R:
|
|
||||||
case PAR_C:
|
|
||||||
return(EV_INT);
|
|
||||||
default:
|
|
||||||
return(EV_STR);
|
|
||||||
}
|
|
||||||
}
|
|
||||||
|
|
||||||
byte *nextem(toplevel) {
|
|
||||||
register i;
|
|
||||||
short hash[3];
|
|
||||||
register byte *bp;
|
|
||||||
byte *cp;
|
|
||||||
int index;
|
|
||||||
register struct emline *ep;
|
|
||||||
|
|
||||||
if (toplevel) {
|
|
||||||
if (nemlines && emp>emlines) {
|
|
||||||
nemlines -= emp-emlines;
|
|
||||||
for (i=0,ep=emlines;i<nemlines;i++)
|
|
||||||
*ep++ = *emp++;
|
|
||||||
emp=emlines;
|
|
||||||
}
|
|
||||||
fillemlines();
|
|
||||||
}
|
|
||||||
hash[0] = emp[0].em_instr;
|
|
||||||
hash[1] = (hash[0]<<4) ^ emp[1].em_instr;
|
|
||||||
hash[2] = (hash[1]<<4) ^ emp[2].em_instr;
|
|
||||||
for (i=2;i>=0;i--) {
|
|
||||||
index = pathash[hash[i]&BMASK];
|
|
||||||
while (index != 0) {
|
|
||||||
bp = &pattern[index];
|
|
||||||
if ( bp[PO_HASH] == (hash[i]>>8))
|
|
||||||
if ((cp=trypat(&bp[PO_MATCH],i+1)) != 0)
|
|
||||||
return(cp);
|
|
||||||
index = (bp[PO_NEXT]&BMASK) | (bp[PO_NEXT+1]<<8);
|
|
||||||
}
|
|
||||||
}
|
|
||||||
return(0);
|
|
||||||
}
|
|
||||||
@@ -1,19 +0,0 @@
|
|||||||
/* $Header$ */
|
|
||||||
|
|
||||||
#define BMASK 0377
|
|
||||||
#define BSHIFT 8
|
|
||||||
|
|
||||||
#define TRUE 1
|
|
||||||
#define FALSE 0
|
|
||||||
|
|
||||||
#define MAXINT 32767
|
|
||||||
#define INFINITY (MAXINT+100)
|
|
||||||
|
|
||||||
#define MAXROM 3
|
|
||||||
|
|
||||||
/*
|
|
||||||
* Tunable constants
|
|
||||||
*/
|
|
||||||
|
|
||||||
#define MAXEMLINES 20
|
|
||||||
#define MAXFSTACK 20
|
|
||||||
Some files were not shown because too many files have changed in this diff Show More
Reference in New Issue
Block a user